summaryrefslogtreecommitdiff
path: root/lib
diff options
context:
space:
mode:
Diffstat (limited to 'lib')
-rw-r--r--lib/jason_types.ex2
-rw-r--r--lib/mix/pleroma.ex20
-rw-r--r--lib/mix/tasks/pleroma/app.ex49
-rw-r--r--lib/mix/tasks/pleroma/benchmark.ex41
-rw-r--r--lib/mix/tasks/pleroma/config.ex158
-rw-r--r--lib/mix/tasks/pleroma/database.ex8
-rw-r--r--lib/mix/tasks/pleroma/digest.ex7
-rw-r--r--lib/mix/tasks/pleroma/docs.ex2
-rw-r--r--lib/mix/tasks/pleroma/ecto/ecto.ex2
-rw-r--r--lib/mix/tasks/pleroma/ecto/migrate.ex2
-rw-r--r--lib/mix/tasks/pleroma/ecto/rollback.ex2
-rw-r--r--lib/mix/tasks/pleroma/email.ex24
-rw-r--r--lib/mix/tasks/pleroma/emoji.ex95
-rw-r--r--lib/mix/tasks/pleroma/instance.ex17
-rw-r--r--lib/mix/tasks/pleroma/notification_settings.ex83
-rw-r--r--lib/mix/tasks/pleroma/refresh_counter_cache.ex46
-rw-r--r--lib/mix/tasks/pleroma/relay.ex4
-rw-r--r--lib/mix/tasks/pleroma/robotstxt.ex3
-rw-r--r--lib/mix/tasks/pleroma/uploads.ex2
-rw-r--r--lib/mix/tasks/pleroma/user.ex61
-rw-r--r--lib/pleroma/activity.ex116
-rw-r--r--lib/pleroma/activity/ir/topics.ex4
-rw-r--r--lib/pleroma/activity/queries.ex45
-rw-r--r--lib/pleroma/activity/search.ex15
-rw-r--r--lib/pleroma/activity_expiration.ex4
-rw-r--r--lib/pleroma/application.ex157
-rw-r--r--lib/pleroma/bbs/authenticator.ex6
-rw-r--r--lib/pleroma/bbs/handler.ex11
-rw-r--r--lib/pleroma/bookmark.ex2
-rw-r--r--lib/pleroma/captcha/captcha.ex138
-rw-r--r--lib/pleroma/captcha/captcha_service.ex2
-rw-r--r--lib/pleroma/captcha/kocaptcha.ex7
-rw-r--r--lib/pleroma/captcha/native.ex34
-rw-r--r--lib/pleroma/clippy.ex3
-rw-r--r--lib/pleroma/config.ex14
-rw-r--r--lib/pleroma/config/config_db.ex414
-rw-r--r--lib/pleroma/config/deprecation_warnings.ex2
-rw-r--r--lib/pleroma/config/holder.ex35
-rw-r--r--lib/pleroma/config/loader.ex53
-rw-r--r--lib/pleroma/config/transfer_task.ex222
-rw-r--r--lib/pleroma/constants.ex12
-rw-r--r--lib/pleroma/conversation.ex10
-rw-r--r--lib/pleroma/conversation/participation.ex75
-rw-r--r--lib/pleroma/conversation/participation_recipient_ship.ex2
-rw-r--r--lib/pleroma/counter_cache.ex41
-rw-r--r--lib/pleroma/daemons/activity_expiration_daemon.ex66
-rw-r--r--lib/pleroma/daemons/digest_email_daemon.ex42
-rw-r--r--lib/pleroma/daemons/scheduled_activity_daemon.ex62
-rw-r--r--lib/pleroma/delivery.ex2
-rw-r--r--lib/pleroma/docs/generator.ex128
-rw-r--r--lib/pleroma/docs/json.ex19
-rw-r--r--lib/pleroma/earmark_renderer.ex256
-rw-r--r--lib/pleroma/ecto_enums.ex19
-rw-r--r--lib/pleroma/emails/admin_email.ex18
-rw-r--r--lib/pleroma/emails/mailer.ex2
-rw-r--r--lib/pleroma/emails/new_users_digest_email.ex32
-rw-r--r--lib/pleroma/emails/user_email.ex4
-rw-r--r--lib/pleroma/emoji-data.txt769
-rw-r--r--lib/pleroma/emoji.ex33
-rw-r--r--lib/pleroma/emoji/formatter.ex16
-rw-r--r--lib/pleroma/emoji/loader.ex2
-rw-r--r--lib/pleroma/emoji/pack.ex507
-rw-r--r--lib/pleroma/filter.ex11
-rw-r--r--lib/pleroma/following_relationship.ex256
-rw-r--r--lib/pleroma/formatter.ex36
-rw-r--r--lib/pleroma/gopher/server.ex2
-rw-r--r--lib/pleroma/gun/api.ex45
-rw-r--r--lib/pleroma/gun/conn.ex198
-rw-r--r--lib/pleroma/gun/gun.ex31
-rw-r--r--lib/pleroma/healthcheck.ex4
-rw-r--r--lib/pleroma/helpers/uri_helper.ex2
-rw-r--r--lib/pleroma/html.ex245
-rw-r--r--lib/pleroma/http/adapter_helper.ex41
-rw-r--r--lib/pleroma/http/adapter_helper/gun.ex77
-rw-r--r--lib/pleroma/http/adapter_helper/hackney.ex43
-rw-r--r--lib/pleroma/http/connection.ex137
-rw-r--r--lib/pleroma/http/http.ex137
-rw-r--r--lib/pleroma/http/request.ex23
-rw-r--r--lib/pleroma/http/request_builder.ex123
-rw-r--r--lib/pleroma/instances.ex2
-rw-r--r--lib/pleroma/instances/instance.ex2
-rw-r--r--lib/pleroma/job_queue_monitor.ex2
-rw-r--r--lib/pleroma/keys.ex2
-rw-r--r--lib/pleroma/list.ex2
-rw-r--r--lib/pleroma/marker.ex47
-rw-r--r--lib/pleroma/mfa.ex155
-rw-r--r--lib/pleroma/mfa/backup_codes.ex31
-rw-r--r--lib/pleroma/mfa/changeset.ex64
-rw-r--r--lib/pleroma/mfa/settings.ex24
-rw-r--r--lib/pleroma/mfa/token.ex106
-rw-r--r--lib/pleroma/mfa/totp.ex86
-rw-r--r--lib/pleroma/mime.ex4
-rw-r--r--lib/pleroma/moderation_log.ex88
-rw-r--r--lib/pleroma/notification.ex335
-rw-r--r--lib/pleroma/object.ex118
-rw-r--r--lib/pleroma/object/containment.ex31
-rw-r--r--lib/pleroma/object/fetcher.ex49
-rw-r--r--lib/pleroma/object_tombstone.ex2
-rw-r--r--lib/pleroma/otp_version.ex28
-rw-r--r--lib/pleroma/pagination.ex106
-rw-r--r--lib/pleroma/password_reset_token.ex2
-rw-r--r--lib/pleroma/plugs/admin_secret_authentication_plug.ex24
-rw-r--r--lib/pleroma/plugs/authentication_plug.ex41
-rw-r--r--lib/pleroma/plugs/basic_auth_decoder_plug.ex2
-rw-r--r--lib/pleroma/plugs/cache.ex2
-rw-r--r--lib/pleroma/plugs/digest.ex2
-rw-r--r--lib/pleroma/plugs/ensure_authenticated_plug.ex26
-rw-r--r--lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex8
-rw-r--r--lib/pleroma/plugs/ensure_user_key_plug.ex2
-rw-r--r--lib/pleroma/plugs/expect_authenticated_check_plug.ex20
-rw-r--r--lib/pleroma/plugs/expect_public_or_authenticated_check_plug.ex21
-rw-r--r--lib/pleroma/plugs/federating_plug.ex23
-rw-r--r--lib/pleroma/plugs/http_security_plug.ex51
-rw-r--r--lib/pleroma/plugs/http_signature.ex50
-rw-r--r--lib/pleroma/plugs/idempotency_plug.ex2
-rw-r--r--lib/pleroma/plugs/instance_static.ex9
-rw-r--r--lib/pleroma/plugs/legacy_authentication_plug.ex5
-rw-r--r--lib/pleroma/plugs/mapped_signature_to_identity_plug.ex13
-rw-r--r--lib/pleroma/plugs/oauth_plug.ex4
-rw-r--r--lib/pleroma/plugs/oauth_scopes_plug.ex43
-rw-r--r--lib/pleroma/plugs/plug_helper.ex40
-rw-r--r--lib/pleroma/plugs/rate_limiter.ex131
-rw-r--r--lib/pleroma/plugs/rate_limiter/limiter_supervisor.ex50
-rw-r--r--lib/pleroma/plugs/rate_limiter/rate_limiter.ex267
-rw-r--r--lib/pleroma/plugs/rate_limiter/supervisor.ex16
-rw-r--r--lib/pleroma/plugs/remote_ip.ex5
-rw-r--r--lib/pleroma/plugs/session_authentication_plug.ex2
-rw-r--r--lib/pleroma/plugs/set_format_plug.ex2
-rw-r--r--lib/pleroma/plugs/set_locale_plug.ex2
-rw-r--r--lib/pleroma/plugs/set_user_session_id_plug.ex2
-rw-r--r--lib/pleroma/plugs/static_fe_plug.ex29
-rw-r--r--lib/pleroma/plugs/trailing_format_plug.ex5
-rw-r--r--lib/pleroma/plugs/uploaded_media.ex10
-rw-r--r--lib/pleroma/plugs/user_enabled_plug.ex10
-rw-r--r--lib/pleroma/plugs/user_fetcher_plug.ex2
-rw-r--r--lib/pleroma/plugs/user_is_admin_plug.ex30
-rw-r--r--lib/pleroma/pool/connections.ex283
-rw-r--r--lib/pleroma/pool/pool.ex22
-rw-r--r--lib/pleroma/pool/request.ex65
-rw-r--r--lib/pleroma/pool/supervisor.ex42
-rw-r--r--lib/pleroma/registration.ex2
-rw-r--r--lib/pleroma/release_tasks.ex2
-rw-r--r--lib/pleroma/repo.ex37
-rw-r--r--lib/pleroma/repo_streamer.ex2
-rw-r--r--lib/pleroma/report_note.ex48
-rw-r--r--lib/pleroma/reverse_proxy/client.ex28
-rw-r--r--lib/pleroma/reverse_proxy/client/hackney.ex24
-rw-r--r--lib/pleroma/reverse_proxy/client/tesla.ex90
-rw-r--r--lib/pleroma/reverse_proxy/reverse_proxy.ex42
-rw-r--r--lib/pleroma/scheduled_activity.ex87
-rw-r--r--lib/pleroma/signature.ex20
-rw-r--r--lib/pleroma/stats.ex77
-rw-r--r--lib/pleroma/tests/auth_test_controller.ex93
-rw-r--r--lib/pleroma/thread_mute.ex46
-rw-r--r--lib/pleroma/upload.ex5
-rw-r--r--lib/pleroma/upload/filter.ex2
-rw-r--r--lib/pleroma/upload/filter/anonymize_filename.ex2
-rw-r--r--lib/pleroma/upload/filter/dedupe.ex2
-rw-r--r--lib/pleroma/upload/filter/mogrifun.ex2
-rw-r--r--lib/pleroma/upload/filter/mogrify.ex2
-rw-r--r--lib/pleroma/uploaders/local.ex15
-rw-r--r--lib/pleroma/uploaders/mdii.ex37
-rw-r--r--lib/pleroma/uploaders/s3.ex16
-rw-r--r--lib/pleroma/uploaders/uploader.ex5
-rw-r--r--lib/pleroma/user.ex1485
-rw-r--r--lib/pleroma/user/info.ex482
-rw-r--r--lib/pleroma/user/notification_setting.ex40
-rw-r--r--lib/pleroma/user/query.ex75
-rw-r--r--lib/pleroma/user/search.ex43
-rw-r--r--lib/pleroma/user/welcome_message.ex6
-rw-r--r--lib/pleroma/user_invite_token.ex2
-rw-r--r--lib/pleroma/user_relationship.ex217
-rw-r--r--lib/pleroma/utils.ex12
-rw-r--r--lib/pleroma/web/activity_pub/activity_pub.ex628
-rw-r--r--lib/pleroma/web/activity_pub/activity_pub_controller.ex140
-rw-r--r--lib/pleroma/web/activity_pub/builder.ex115
-rw-r--r--lib/pleroma/web/activity_pub/internal_fetch_actor.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex5
-rw-r--r--lib/pleroma/web/activity_pub/mrf/drop_policy.ex4
-rw-r--r--lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/keyword_policy.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex (renamed from lib/pleroma/web/activity_pub/mrf/mediaproxy_warming_policy.ex)18
-rw-r--r--lib/pleroma/web/activity_pub/mrf/mention_policy.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/no_op_policy.ex (renamed from lib/pleroma/web/activity_pub/mrf/noop_policy.ex)2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/normalize_markup.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/object_age_policy.ex106
-rw-r--r--lib/pleroma/web/activity_pub/mrf/reject_non_public.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/simple_policy.ex19
-rw-r--r--lib/pleroma/web/activity_pub/mrf/subchain_policy.ex4
-rw-r--r--lib/pleroma/web/activity_pub/mrf/tag_policy.ex2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex (renamed from lib/pleroma/web/activity_pub/mrf/user_allowlist_policy.ex)2
-rw-r--r--lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex4
-rw-r--r--lib/pleroma/web/activity_pub/object_validator.ex83
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/common_validations.ex80
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/create_validator.ex30
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/delete_validator.ex100
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex81
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/like_validator.ex99
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/note_validator.ex64
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/types/date_time.ex34
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/types/object_id.ex23
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/types/recipients.ex34
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/types/uri.ex20
-rw-r--r--lib/pleroma/web/activity_pub/object_validators/undo_validator.ex62
-rw-r--r--lib/pleroma/web/activity_pub/pipeline.ex59
-rw-r--r--lib/pleroma/web/activity_pub/publisher.ex72
-rw-r--r--lib/pleroma/web/activity_pub/relay.ex37
-rw-r--r--lib/pleroma/web/activity_pub/side_effects.ex133
-rw-r--r--lib/pleroma/web/activity_pub/transmogrifier.ex436
-rw-r--r--lib/pleroma/web/activity_pub/utils.ex360
-rw-r--r--lib/pleroma/web/activity_pub/views/object_view.ex2
-rw-r--r--lib/pleroma/web/activity_pub/views/user_view.ex48
-rw-r--r--lib/pleroma/web/activity_pub/visibility.ex22
-rw-r--r--lib/pleroma/web/admin_api/admin_api_controller.ex677
-rw-r--r--lib/pleroma/web/admin_api/config.ex182
-rw-r--r--lib/pleroma/web/admin_api/report.ex7
-rw-r--r--lib/pleroma/web/admin_api/search.ex9
-rw-r--r--lib/pleroma/web/admin_api/views/account_view.ex63
-rw-r--r--lib/pleroma/web/admin_api/views/config_view.ex22
-rw-r--r--lib/pleroma/web/admin_api/views/moderation_log_view.ex2
-rw-r--r--lib/pleroma/web/admin_api/views/report_view.ex38
-rw-r--r--lib/pleroma/web/admin_api/views/status_view.ex25
-rw-r--r--lib/pleroma/web/api_spec.ex57
-rw-r--r--lib/pleroma/web/api_spec/cast_and_validate.ex139
-rw-r--r--lib/pleroma/web/api_spec/helpers.ex71
-rw-r--r--lib/pleroma/web/api_spec/operations/account_operation.ex730
-rw-r--r--lib/pleroma/web/api_spec/operations/app_operation.ex148
-rw-r--r--lib/pleroma/web/api_spec/operations/conversation_operation.ex61
-rw-r--r--lib/pleroma/web/api_spec/operations/custom_emoji_operation.ex88
-rw-r--r--lib/pleroma/web/api_spec/operations/domain_block_operation.ex83
-rw-r--r--lib/pleroma/web/api_spec/operations/filter_operation.ex229
-rw-r--r--lib/pleroma/web/api_spec/operations/follow_request_operation.ex65
-rw-r--r--lib/pleroma/web/api_spec/operations/instance_operation.ex169
-rw-r--r--lib/pleroma/web/api_spec/operations/list_operation.ex188
-rw-r--r--lib/pleroma/web/api_spec/operations/marker_operation.ex142
-rw-r--r--lib/pleroma/web/api_spec/operations/media_operation.ex132
-rw-r--r--lib/pleroma/web/api_spec/operations/notification_operation.ex211
-rw-r--r--lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex187
-rw-r--r--lib/pleroma/web/api_spec/operations/poll_operation.ex76
-rw-r--r--lib/pleroma/web/api_spec/operations/report_operation.ex81
-rw-r--r--lib/pleroma/web/api_spec/operations/scheduled_activity_operation.ex96
-rw-r--r--lib/pleroma/web/api_spec/operations/search_operation.ex208
-rw-r--r--lib/pleroma/web/api_spec/operations/status_operation.ex517
-rw-r--r--lib/pleroma/web/api_spec/operations/subscription_operation.ex226
-rw-r--r--lib/pleroma/web/api_spec/operations/timeline_operation.ex191
-rw-r--r--lib/pleroma/web/api_spec/render_error.ex234
-rw-r--r--lib/pleroma/web/api_spec/schemas/account.ex167
-rw-r--r--lib/pleroma/web/api_spec/schemas/account_field.ex26
-rw-r--r--lib/pleroma/web/api_spec/schemas/account_relationship.ex44
-rw-r--r--lib/pleroma/web/api_spec/schemas/actor_type.ex13
-rw-r--r--lib/pleroma/web/api_spec/schemas/api_error.ex19
-rw-r--r--lib/pleroma/web/api_spec/schemas/attachment.ex68
-rw-r--r--lib/pleroma/web/api_spec/schemas/boolean_like.ex36
-rw-r--r--lib/pleroma/web/api_spec/schemas/conversation.ex41
-rw-r--r--lib/pleroma/web/api_spec/schemas/emoji.ex29
-rw-r--r--lib/pleroma/web/api_spec/schemas/flake_id.ex14
-rw-r--r--lib/pleroma/web/api_spec/schemas/list.ex23
-rw-r--r--lib/pleroma/web/api_spec/schemas/poll.ex82
-rw-r--r--lib/pleroma/web/api_spec/schemas/push_subscription.ex66
-rw-r--r--lib/pleroma/web/api_spec/schemas/scheduled_status.ex54
-rw-r--r--lib/pleroma/web/api_spec/schemas/status.ex325
-rw-r--r--lib/pleroma/web/api_spec/schemas/tag.ex27
-rw-r--r--lib/pleroma/web/api_spec/schemas/visibility_scope.ex14
-rw-r--r--lib/pleroma/web/auth/authenticator.ex2
-rw-r--r--lib/pleroma/web/auth/ldap_authenticator.ex2
-rw-r--r--lib/pleroma/web/auth/pleroma_authenticator.ex9
-rw-r--r--lib/pleroma/web/auth/totp_authenticator.ex45
-rw-r--r--lib/pleroma/web/channels/user_socket.ex2
-rw-r--r--lib/pleroma/web/chat_channel.ex5
-rw-r--r--lib/pleroma/web/common_api/activity_draft.ex34
-rw-r--r--lib/pleroma/web/common_api/common_api.ex272
-rw-r--r--lib/pleroma/web/common_api/utils.ex92
-rw-r--r--lib/pleroma/web/controller_helper.ex47
-rw-r--r--lib/pleroma/web/endpoint.ex20
-rw-r--r--lib/pleroma/web/fallback_redirect_controller.ex4
-rw-r--r--lib/pleroma/web/federator/federator.ex39
-rw-r--r--lib/pleroma/web/federator/publisher.ex4
-rw-r--r--lib/pleroma/web/feed/feed_view.ex72
-rw-r--r--lib/pleroma/web/feed/tag_controller.ex41
-rw-r--r--lib/pleroma/web/feed/user_controller.ex (renamed from lib/pleroma/web/feed/feed_controller.ex)48
-rw-r--r--lib/pleroma/web/gettext.ex2
-rw-r--r--lib/pleroma/web/masto_fe_controller.ex39
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/account_controller.ex282
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/app_controller.ex19
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/auth_controller.ex8
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex9
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex12
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex15
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex6
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/filter_controller.ex59
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex7
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/instance_controller.ex12
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/list_controller.ex32
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/marker_controller.ex14
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex22
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/media_controller.ex51
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/notification_controller.ex43
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/poll_controller.ex10
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/report_controller.ex7
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex16
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/search_controller.ex50
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/status_controller.ex143
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex46
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex72
-rw-r--r--lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex122
-rw-r--r--lib/pleroma/web/mastodon_api/mastodon_api.ex43
-rw-r--r--lib/pleroma/web/mastodon_api/views/account_view.ex288
-rw-r--r--lib/pleroma/web/mastodon_api/views/app_view.ex25
-rw-r--r--lib/pleroma/web/mastodon_api/views/conversation_view.ex13
-rw-r--r--lib/pleroma/web/mastodon_api/views/custom_emoji_view.ex2
-rw-r--r--lib/pleroma/web/mastodon_api/views/filter_view.ex8
-rw-r--r--lib/pleroma/web/mastodon_api/views/instance_view.ex60
-rw-r--r--lib/pleroma/web/mastodon_api/views/list_view.ex2
-rw-r--r--lib/pleroma/web/mastodon_api/views/marker_view.ex18
-rw-r--r--lib/pleroma/web/mastodon_api/views/notification_view.ex123
-rw-r--r--lib/pleroma/web/mastodon_api/views/poll_view.ex12
-rw-r--r--lib/pleroma/web/mastodon_api/views/report_view.ex2
-rw-r--r--lib/pleroma/web/mastodon_api/views/scheduled_activity_view.ex2
-rw-r--r--lib/pleroma/web/mastodon_api/views/status_view.ex184
-rw-r--r--lib/pleroma/web/mastodon_api/views/subscription_view.ex (renamed from lib/pleroma/web/mastodon_api/views/push_subscription_view.ex)6
-rw-r--r--lib/pleroma/web/mastodon_api/websocket_handler.ex138
-rw-r--r--lib/pleroma/web/media_proxy/media_proxy.ex2
-rw-r--r--lib/pleroma/web/media_proxy/media_proxy_controller.ex3
-rw-r--r--lib/pleroma/web/metadata.ex9
-rw-r--r--lib/pleroma/web/metadata/feed.ex4
-rw-r--r--lib/pleroma/web/metadata/opengraph.ex4
-rw-r--r--lib/pleroma/web/metadata/player_view.ex2
-rw-r--r--lib/pleroma/web/metadata/provider.ex2
-rw-r--r--lib/pleroma/web/metadata/rel_me.ex8
-rw-r--r--lib/pleroma/web/metadata/restrict_indexing.ex25
-rw-r--r--lib/pleroma/web/metadata/twitter_card.ex4
-rw-r--r--lib/pleroma/web/metadata/utils.ex15
-rw-r--r--lib/pleroma/web/mongooseim/mongoose_im_controller.ex14
-rw-r--r--lib/pleroma/web/nodeinfo/nodeinfo_controller.ex64
-rw-r--r--lib/pleroma/web/oauth.ex2
-rw-r--r--lib/pleroma/web/oauth/app.ex84
-rw-r--r--lib/pleroma/web/oauth/authorization.ex2
-rw-r--r--lib/pleroma/web/oauth/fallback_controller.ex2
-rw-r--r--lib/pleroma/web/oauth/mfa_controller.ex97
-rw-r--r--lib/pleroma/web/oauth/mfa_view.ex (renamed from lib/pleroma/scheduler.ex)5
-rw-r--r--lib/pleroma/web/oauth/oauth_controller.ex179
-rw-r--r--lib/pleroma/web/oauth/oauth_view.ex2
-rw-r--r--lib/pleroma/web/oauth/scopes.ex21
-rw-r--r--lib/pleroma/web/oauth/token.ex2
-rw-r--r--lib/pleroma/web/oauth/token/clean_worker.ex18
-rw-r--r--lib/pleroma/web/oauth/token/query.ex2
-rw-r--r--lib/pleroma/web/oauth/token/response.ex11
-rw-r--r--lib/pleroma/web/oauth/token/strategy/refresh_token.ex2
-rw-r--r--lib/pleroma/web/oauth/token/strategy/revoke.ex2
-rw-r--r--lib/pleroma/web/oauth/token/utils.ex2
-rw-r--r--lib/pleroma/web/ostatus/ostatus_controller.ex63
-rw-r--r--lib/pleroma/web/pleroma_api/controllers/account_controller.ex83
-rw-r--r--lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex699
-rw-r--r--lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex8
-rw-r--r--lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex149
-rw-r--r--lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex10
-rw-r--r--lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex133
-rw-r--r--lib/pleroma/web/push/impl.ex101
-rw-r--r--lib/pleroma/web/push/push.ex2
-rw-r--r--lib/pleroma/web/push/subscription.ex20
-rw-r--r--lib/pleroma/web/rel_me.ex33
-rw-r--r--lib/pleroma/web/rich_media/helpers.ex7
-rw-r--r--lib/pleroma/web/rich_media/parser.ex26
-rw-r--r--lib/pleroma/web/rich_media/parsers/meta_tags_parser.ex4
-rw-r--r--lib/pleroma/web/rich_media/parsers/oembed_parser.ex2
-rw-r--r--lib/pleroma/web/rich_media/parsers/ogp.ex2
-rw-r--r--lib/pleroma/web/rich_media/parsers/twitter_card.ex2
-rw-r--r--lib/pleroma/web/router.ex414
-rw-r--r--lib/pleroma/web/static_fe/static_fe_controller.ex176
-rw-r--r--lib/pleroma/web/static_fe/static_fe_view.ex38
-rw-r--r--lib/pleroma/web/streamer/ping.ex37
-rw-r--r--lib/pleroma/web/streamer/state.ex82
-rw-r--r--lib/pleroma/web/streamer/streamer.ex293
-rw-r--r--lib/pleroma/web/streamer/streamer_socket.ex35
-rw-r--r--lib/pleroma/web/streamer/supervisor.ex37
-rw-r--r--lib/pleroma/web/streamer/worker.ex224
-rw-r--r--lib/pleroma/web/templates/email/new_users_digest.html.eex158
-rw-r--r--lib/pleroma/web/templates/feed/feed/_activity.atom.eex (renamed from lib/pleroma/web/templates/feed/feed/_activity.xml.eex)14
-rw-r--r--lib/pleroma/web/templates/feed/feed/_activity.rss.eex49
-rw-r--r--lib/pleroma/web/templates/feed/feed/_author.atom.eex (renamed from lib/pleroma/web/templates/feed/feed/_author.xml.eex)0
-rw-r--r--lib/pleroma/web/templates/feed/feed/_author.rss.eex17
-rw-r--r--lib/pleroma/web/templates/feed/feed/_tag_activity.atom.eex51
-rw-r--r--lib/pleroma/web/templates/feed/feed/_tag_activity.xml.eex14
-rw-r--r--lib/pleroma/web/templates/feed/feed/_tag_author.atom.eex18
-rw-r--r--lib/pleroma/web/templates/feed/feed/tag.atom.eex22
-rw-r--r--lib/pleroma/web/templates/feed/feed/tag.rss.eex15
-rw-r--r--lib/pleroma/web/templates/feed/feed/user.atom.eex (renamed from lib/pleroma/web/templates/feed/feed/feed.xml.eex)10
-rw-r--r--lib/pleroma/web/templates/feed/feed/user.rss.eex20
-rw-r--r--lib/pleroma/web/templates/layout/email_styled.html.eex193
-rw-r--r--lib/pleroma/web/templates/layout/static_fe.html.eex15
-rw-r--r--lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex24
-rw-r--r--lib/pleroma/web/templates/o_auth/mfa/totp.html.eex24
-rw-r--r--lib/pleroma/web/templates/static_fe/static_fe/_attachment.html.eex8
-rw-r--r--lib/pleroma/web/templates/static_fe/static_fe/_notice.html.eex41
-rw-r--r--lib/pleroma/web/templates/static_fe/static_fe/_user_card.html.eex11
-rw-r--r--lib/pleroma/web/templates/static_fe/static_fe/conversation.html.eex11
-rw-r--r--lib/pleroma/web/templates/static_fe/static_fe/error.html.eex7
-rw-r--r--lib/pleroma/web/templates/static_fe/static_fe/profile.html.eex31
-rw-r--r--lib/pleroma/web/templates/twitter_api/remote_follow/follow.html.eex11
-rw-r--r--lib/pleroma/web/templates/twitter_api/remote_follow/follow_login.html.eex14
-rw-r--r--lib/pleroma/web/templates/twitter_api/remote_follow/follow_mfa.html.eex13
-rw-r--r--lib/pleroma/web/templates/twitter_api/remote_follow/followed.html.eex (renamed from lib/pleroma/web/templates/twitter_api/util/followed.html.eex)0
-rw-r--r--lib/pleroma/web/templates/twitter_api/util/follow.html.eex11
-rw-r--r--lib/pleroma/web/templates/twitter_api/util/follow_login.html.eex14
-rw-r--r--lib/pleroma/web/translation_helpers.ex2
-rw-r--r--lib/pleroma/web/twitter_api/controllers/password_controller.ex2
-rw-r--r--lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex159
-rw-r--r--lib/pleroma/web/twitter_api/controllers/util_controller.ex126
-rw-r--r--lib/pleroma/web/twitter_api/twitter_api.ex153
-rw-r--r--lib/pleroma/web/twitter_api/twitter_api_controller.ex37
-rw-r--r--lib/pleroma/web/twitter_api/views/password_view.ex2
-rw-r--r--lib/pleroma/web/twitter_api/views/remote_follow_view.ex10
-rw-r--r--lib/pleroma/web/twitter_api/views/token_view.ex2
-rw-r--r--lib/pleroma/web/twitter_api/views/util_view.ex2
-rw-r--r--lib/pleroma/web/uploader_controller.ex2
-rw-r--r--lib/pleroma/web/views/email_view.ex4
-rw-r--r--lib/pleroma/web/views/error_helpers.ex2
-rw-r--r--lib/pleroma/web/views/error_view.ex2
-rw-r--r--lib/pleroma/web/views/layout_view.ex2
-rw-r--r--lib/pleroma/web/views/masto_fe_view.ex10
-rw-r--r--lib/pleroma/web/views/streamer_view.ex4
-rw-r--r--lib/pleroma/web/web.ex132
-rw-r--r--lib/pleroma/web/web_finger/web_finger.ex74
-rw-r--r--lib/pleroma/web/web_finger/web_finger_controller.ex2
-rw-r--r--lib/pleroma/web/xml/xml.ex2
-rw-r--r--lib/pleroma/workers/activity_expiration_worker.ex18
-rw-r--r--lib/pleroma/workers/attachments_cleanup_worker.ex95
-rw-r--r--lib/pleroma/workers/background_worker.ex22
-rw-r--r--lib/pleroma/workers/cron/clear_oauth_token_worker.ex21
-rw-r--r--lib/pleroma/workers/cron/digest_emails_worker.ex59
-rw-r--r--lib/pleroma/workers/cron/new_users_digest_worker.ex61
-rw-r--r--lib/pleroma/workers/cron/purge_expired_activities_worker.ex46
-rw-r--r--lib/pleroma/workers/cron/stats_worker.ex16
-rw-r--r--lib/pleroma/workers/digest_emails_worker.ex16
-rw-r--r--lib/pleroma/workers/mailer_worker.ex2
-rw-r--r--lib/pleroma/workers/publisher_worker.ex2
-rw-r--r--lib/pleroma/workers/receiver_worker.ex2
-rw-r--r--lib/pleroma/workers/remote_fetcher_worker.ex20
-rw-r--r--lib/pleroma/workers/scheduled_activity_worker.ex40
-rw-r--r--lib/pleroma/workers/transmogrifier_worker.ex2
-rw-r--r--lib/pleroma/workers/web_pusher_worker.ex4
-rw-r--r--lib/pleroma/workers/worker_helper.ex2
-rw-r--r--lib/transports.ex2
-rw-r--r--lib/xml_builder.ex2
448 files changed, 22199 insertions, 6298 deletions
diff --git a/lib/jason_types.ex b/lib/jason_types.ex
index c558aef57..f1fdc96f4 100644
--- a/lib/jason_types.ex
+++ b/lib/jason_types.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
Postgrex.Types.define(
diff --git a/lib/mix/pleroma.ex b/lib/mix/pleroma.ex
index faeb30e1d..3ad6edbfb 100644
--- a/lib/mix/pleroma.ex
+++ b/lib/mix/pleroma.ex
@@ -1,12 +1,30 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Pleroma do
@doc "Common functions to be reused in mix tasks"
def start_pleroma do
Application.put_env(:phoenix, :serve_endpoints, false, persistent: true)
+
+ if Pleroma.Config.get(:env) != :test do
+ Application.put_env(:logger, :console, level: :debug)
+ end
+
{:ok, _} = Application.ensure_all_started(:pleroma)
+
+ if Pleroma.Config.get(:env) not in [:test, :benchmark] do
+ pleroma_rebooted?()
+ end
+ end
+
+ defp pleroma_rebooted? do
+ if Restarter.Pleroma.rebooted?() do
+ :ok
+ else
+ Process.sleep(10)
+ pleroma_rebooted?()
+ end
end
def load_pleroma do
diff --git a/lib/mix/tasks/pleroma/app.ex b/lib/mix/tasks/pleroma/app.ex
new file mode 100644
index 000000000..463e2449f
--- /dev/null
+++ b/lib/mix/tasks/pleroma/app.ex
@@ -0,0 +1,49 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Mix.Tasks.Pleroma.App do
+ @moduledoc File.read!("docs/administration/CLI_tasks/oauth_app.md")
+ use Mix.Task
+
+ import Mix.Pleroma
+
+ @shortdoc "Creates trusted OAuth App"
+
+ def run(["create" | options]) do
+ start_pleroma()
+
+ {opts, _} =
+ OptionParser.parse!(options,
+ strict: [name: :string, redirect_uri: :string, scopes: :string],
+ aliases: [n: :name, r: :redirect_uri, s: :scopes]
+ )
+
+ scopes =
+ if opts[:scopes] do
+ String.split(opts[:scopes], ",")
+ else
+ ["read", "write", "follow", "push"]
+ end
+
+ params = %{
+ client_name: opts[:name],
+ redirect_uris: opts[:redirect_uri],
+ trusted: true,
+ scopes: scopes
+ }
+
+ with {:ok, app} <- Pleroma.Web.OAuth.App.create(params) do
+ shell_info("#{app.client_name} successfully created:")
+ shell_info("App client_id: " <> app.client_id)
+ shell_info("App client_secret: " <> app.client_secret)
+ else
+ {:error, changeset} ->
+ shell_error("Creating failed:")
+
+ Enum.each(Pleroma.Web.OAuth.App.errors(changeset), fn {key, error} ->
+ shell_error("#{key}: #{error}")
+ end)
+ end
+ end
+end
diff --git a/lib/mix/tasks/pleroma/benchmark.ex b/lib/mix/tasks/pleroma/benchmark.ex
index 84dccf7f3..dd2b9c8f2 100644
--- a/lib/mix/tasks/pleroma/benchmark.ex
+++ b/lib/mix/tasks/pleroma/benchmark.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.Benchmark do
@@ -74,4 +74,43 @@ defmodule Mix.Tasks.Pleroma.Benchmark do
inputs: inputs
)
end
+
+ def run(["adapters"]) do
+ start_pleroma()
+
+ :ok =
+ Pleroma.Gun.Conn.open(
+ "https://httpbin.org/stream-bytes/1500",
+ :gun_connections
+ )
+
+ Process.sleep(1_500)
+
+ Benchee.run(
+ %{
+ "Without conn and without pool" => fn ->
+ {:ok, %Tesla.Env{}} =
+ Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [],
+ adapter: [pool: :no_pool, receive_conn: false]
+ )
+ end,
+ "Without conn and with pool" => fn ->
+ {:ok, %Tesla.Env{}} =
+ Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [],
+ adapter: [receive_conn: false]
+ )
+ end,
+ "With reused conn and without pool" => fn ->
+ {:ok, %Tesla.Env{}} =
+ Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500", [],
+ adapter: [pool: :no_pool]
+ )
+ end,
+ "With reused conn and with pool" => fn ->
+ {:ok, %Tesla.Env{}} = Pleroma.HTTP.get("https://httpbin.org/stream-bytes/1500")
+ end
+ },
+ parallel: 10
+ )
+ end
end
diff --git a/lib/mix/tasks/pleroma/config.ex b/lib/mix/tasks/pleroma/config.ex
index 11e4fde43..5c9ef6904 100644
--- a/lib/mix/tasks/pleroma/config.ex
+++ b/lib/mix/tasks/pleroma/config.ex
@@ -1,72 +1,150 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.Config do
use Mix.Task
+
import Mix.Pleroma
+
+ alias Pleroma.ConfigDB
alias Pleroma.Repo
- alias Pleroma.Web.AdminAPI.Config
+
@shortdoc "Manages the location of the config"
@moduledoc File.read!("docs/administration/CLI_tasks/config.md")
+
def run(["migrate_to_db"]) do
start_pleroma()
+ migrate_to_db()
+ end
+
+ def run(["migrate_from_db" | options]) do
+ start_pleroma()
- if Pleroma.Config.get([:instance, :dynamic_configuration]) do
- Application.get_all_env(:pleroma)
- |> Enum.reject(fn {k, _v} -> k in [Pleroma.Repo, :env] end)
- |> Enum.each(fn {k, v} ->
- key = to_string(k) |> String.replace("Elixir.", "")
+ {opts, _} =
+ OptionParser.parse!(options,
+ strict: [env: :string, delete: :boolean],
+ aliases: [d: :delete]
+ )
+
+ migrate_from_db(opts)
+ end
- key =
- if String.starts_with?(key, "Pleroma.") do
- key
+ @spec migrate_to_db(Path.t() | nil) :: any()
+ def migrate_to_db(file_path \\ nil) do
+ if Pleroma.Config.get([:configurable_from_database]) do
+ config_file =
+ if file_path do
+ file_path
+ else
+ if Pleroma.Config.get(:release) do
+ Pleroma.Config.get(:config_path)
else
- ":" <> key
+ "config/#{Pleroma.Config.get(:env)}.secret.exs"
end
+ end
- {:ok, _} = Config.update_or_create(%{group: "pleroma", key: key, value: v})
- Mix.shell().info("#{key} is migrated.")
- end)
-
- Mix.shell().info("Settings migrated.")
+ do_migrate_to_db(config_file)
else
- Mix.shell().info(
- "Migration is not allowed by config. You can change this behavior in instance settings."
- )
+ migration_error()
end
end
- def run(["migrate_from_db", env, delete?]) do
- start_pleroma()
+ defp do_migrate_to_db(config_file) do
+ if File.exists?(config_file) do
+ Ecto.Adapters.SQL.query!(Repo, "TRUNCATE config;")
+ Ecto.Adapters.SQL.query!(Repo, "ALTER SEQUENCE config_id_seq RESTART;")
- delete? = if delete? == "true", do: true, else: false
+ custom_config =
+ config_file
+ |> read_file()
+ |> elem(0)
- if Pleroma.Config.get([:instance, :dynamic_configuration]) do
- config_path = "config/#{env}.exported_from_db.secret.exs"
+ custom_config
+ |> Keyword.keys()
+ |> Enum.each(&create(&1, custom_config))
+ else
+ shell_info("To migrate settings, you must define custom settings in #{config_file}.")
+ end
+ end
- {:ok, file} = File.open(config_path, [:write])
- IO.write(file, "use Mix.Config\r\n")
+ defp create(group, settings) do
+ group
+ |> Pleroma.Config.Loader.filter_group(settings)
+ |> Enum.each(fn {key, value} ->
+ key = inspect(key)
+ {:ok, _} = ConfigDB.update_or_create(%{group: inspect(group), key: key, value: value})
- Repo.all(Config)
- |> Enum.each(fn config ->
- IO.write(
- file,
- "config :#{config.group}, #{config.key}, #{inspect(Config.from_binary(config.value))}\r\n\r\n"
- )
+ shell_info("Settings for key #{key} migrated.")
+ end)
+
+ shell_info("Settings for group :#{group} migrated.")
+ end
- if delete? do
- {:ok, _} = Repo.delete(config)
- Mix.shell().info("#{config.key} deleted from DB.")
+ defp migrate_from_db(opts) do
+ if Pleroma.Config.get([:configurable_from_database]) do
+ env = opts[:env] || "prod"
+
+ config_path =
+ if Pleroma.Config.get(:release) do
+ :config_path
+ |> Pleroma.Config.get()
+ |> Path.dirname()
+ else
+ "config"
end
- end)
+ |> Path.join("#{env}.exported_from_db.secret.exs")
+
+ file = File.open!(config_path, [:write, :utf8])
+
+ IO.write(file, config_header())
- File.close(file)
+ ConfigDB
+ |> Repo.all()
+ |> Enum.each(&write_and_delete(&1, file, opts[:delete]))
+
+ :ok = File.close(file)
System.cmd("mix", ["format", config_path])
else
- Mix.shell().info(
- "Migration is not allowed by config. You can change this behavior in instance settings."
- )
+ migration_error()
end
end
+
+ defp migration_error do
+ shell_error(
+ "Migration is not allowed in config. You can change this behavior by setting `configurable_from_database` to true."
+ )
+ end
+
+ if Code.ensure_loaded?(Config.Reader) do
+ defp config_header, do: "import Config\r\n\r\n"
+ defp read_file(config_file), do: Config.Reader.read_imports!(config_file)
+ else
+ defp config_header, do: "use Mix.Config\r\n\r\n"
+ defp read_file(config_file), do: Mix.Config.eval!(config_file)
+ end
+
+ defp write_and_delete(config, file, delete?) do
+ config
+ |> write(file)
+ |> delete(delete?)
+ end
+
+ defp write(config, file) do
+ value =
+ config.value
+ |> ConfigDB.from_binary()
+ |> inspect(limit: :infinity)
+
+ IO.write(file, "config #{config.group}, #{config.key}, #{value}\r\n\r\n")
+
+ config
+ end
+
+ defp delete(config, true) do
+ {:ok, _} = Repo.delete(config)
+ shell_info("#{config.key} deleted from DB.")
+ end
+
+ defp delete(_config, _), do: :ok
end
diff --git a/lib/mix/tasks/pleroma/database.ex b/lib/mix/tasks/pleroma/database.ex
index 8a827ca80..778de162f 100644
--- a/lib/mix/tasks/pleroma/database.ex
+++ b/lib/mix/tasks/pleroma/database.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.Database do
@@ -52,9 +52,9 @@ defmodule Mix.Tasks.Pleroma.Database do
def run(["update_users_following_followers_counts"]) do
start_pleroma()
- users = Repo.all(User)
- Enum.each(users, &User.remove_duplicated_following/1)
- Enum.each(users, &User.update_follower_count/1)
+ User
+ |> Repo.all()
+ |> Enum.each(&User.update_follower_count/1)
end
def run(["prune_objects" | args]) do
diff --git a/lib/mix/tasks/pleroma/digest.ex b/lib/mix/tasks/pleroma/digest.ex
index 7d09e70c5..3595f912d 100644
--- a/lib/mix/tasks/pleroma/digest.ex
+++ b/lib/mix/tasks/pleroma/digest.ex
@@ -1,5 +1,6 @@
defmodule Mix.Tasks.Pleroma.Digest do
use Mix.Task
+ import Mix.Pleroma
@shortdoc "Manages digest emails"
@moduledoc File.read!("docs/administration/CLI_tasks/digest.md")
@@ -22,12 +23,10 @@ defmodule Mix.Tasks.Pleroma.Digest do
with %Swoosh.Email{} = email <- Pleroma.Emails.UserEmail.digest_email(patched_user) do
{:ok, _} = Pleroma.Emails.Mailer.deliver(email)
- Mix.shell().info("Digest email have been sent to #{nickname} (#{user.email})")
+ shell_info("Digest email have been sent to #{nickname} (#{user.email})")
else
_ ->
- Mix.shell().info(
- "Cound't find any mentions for #{nickname} since #{last_digest_emailed_at}"
- )
+ shell_info("Cound't find any mentions for #{nickname} since #{last_digest_emailed_at}")
end
end
end
diff --git a/lib/mix/tasks/pleroma/docs.ex b/lib/mix/tasks/pleroma/docs.ex
index 0d2663648..6088fc71d 100644
--- a/lib/mix/tasks/pleroma/docs.ex
+++ b/lib/mix/tasks/pleroma/docs.ex
@@ -28,7 +28,7 @@ defmodule Mix.Tasks.Pleroma.Docs do
defp do_run(implementation) do
start_pleroma()
- with {descriptions, _paths} <- Mix.Config.eval!("config/description.exs"),
+ with descriptions <- Pleroma.Config.Loader.read("config/description.exs"),
{:ok, file_path} <-
Pleroma.Docs.Generator.process(
implementation,
diff --git a/lib/mix/tasks/pleroma/ecto/ecto.ex b/lib/mix/tasks/pleroma/ecto/ecto.ex
index 36808b93f..3363cd45f 100644
--- a/lib/mix/tasks/pleroma/ecto/ecto.ex
+++ b/lib/mix/tasks/pleroma/ecto/ecto.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-onl
defmodule Mix.Tasks.Pleroma.Ecto do
diff --git a/lib/mix/tasks/pleroma/ecto/migrate.ex b/lib/mix/tasks/pleroma/ecto/migrate.ex
index d87b6957d..bc8ed29fb 100644
--- a/lib/mix/tasks/pleroma/ecto/migrate.ex
+++ b/lib/mix/tasks/pleroma/ecto/migrate.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-onl
defmodule Mix.Tasks.Pleroma.Ecto.Migrate do
diff --git a/lib/mix/tasks/pleroma/ecto/rollback.ex b/lib/mix/tasks/pleroma/ecto/rollback.ex
index a1af73fa1..f43bd0b98 100644
--- a/lib/mix/tasks/pleroma/ecto/rollback.ex
+++ b/lib/mix/tasks/pleroma/ecto/rollback.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-onl
defmodule Mix.Tasks.Pleroma.Ecto.Rollback do
diff --git a/lib/mix/tasks/pleroma/email.ex b/lib/mix/tasks/pleroma/email.ex
new file mode 100644
index 000000000..d3fac6ec8
--- /dev/null
+++ b/lib/mix/tasks/pleroma/email.ex
@@ -0,0 +1,24 @@
+defmodule Mix.Tasks.Pleroma.Email do
+ use Mix.Task
+ import Mix.Pleroma
+
+ @shortdoc "Simple Email test"
+ @moduledoc File.read!("docs/administration/CLI_tasks/email.md")
+
+ def run(["test" | args]) do
+ Mix.Pleroma.start_pleroma()
+
+ {options, [], []} =
+ OptionParser.parse(
+ args,
+ strict: [
+ to: :string
+ ]
+ )
+
+ email = Pleroma.Emails.AdminEmail.test_email(options[:to])
+ {:ok, _} = Pleroma.Emails.Mailer.deliver(email)
+
+ shell_info("Test email has been sent to #{inspect(email.to)} from #{inspect(email.from)}")
+ end
+end
diff --git a/lib/mix/tasks/pleroma/emoji.ex b/lib/mix/tasks/pleroma/emoji.ex
index 35669af27..cdffa88b2 100644
--- a/lib/mix/tasks/pleroma/emoji.ex
+++ b/lib/mix/tasks/pleroma/emoji.ex
@@ -1,20 +1,21 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.Emoji do
use Mix.Task
+ import Mix.Pleroma
@shortdoc "Manages emoji packs"
@moduledoc File.read!("docs/administration/CLI_tasks/emoji.md")
def run(["ls-packs" | args]) do
- Application.ensure_all_started(:hackney)
+ start_pleroma()
{options, [], []} = parse_global_opts(args)
- manifest =
- fetch_manifest(if options[:manifest], do: options[:manifest], else: default_manifest())
+ url_or_path = options[:manifest] || default_manifest()
+ manifest = fetch_manifest(url_or_path)
Enum.each(manifest, fn {name, info} ->
to_print = [
@@ -35,13 +36,13 @@ defmodule Mix.Tasks.Pleroma.Emoji do
end
def run(["get-packs" | args]) do
- Application.ensure_all_started(:hackney)
+ start_pleroma()
{options, pack_names, []} = parse_global_opts(args)
- manifest_url = if options[:manifest], do: options[:manifest], else: default_manifest()
+ url_or_path = options[:manifest] || default_manifest()
- manifest = fetch_manifest(manifest_url)
+ manifest = fetch_manifest(url_or_path)
for pack_name <- pack_names do
if Map.has_key?(manifest, pack_name) do
@@ -74,7 +75,10 @@ defmodule Mix.Tasks.Pleroma.Emoji do
end
# The url specified in files should be in the same directory
- files_url = Path.join(Path.dirname(manifest_url), pack["files"])
+ files_url =
+ url_or_path
+ |> Path.dirname()
+ |> Path.join(pack["files"])
IO.puts(
IO.ANSI.format([
@@ -132,38 +136,51 @@ defmodule Mix.Tasks.Pleroma.Emoji do
end
end
- def run(["gen-pack", src]) do
- Application.ensure_all_started(:hackney)
+ def run(["gen-pack" | args]) do
+ start_pleroma()
+
+ {opts, [src], []} =
+ OptionParser.parse(
+ args,
+ strict: [
+ name: :string,
+ license: :string,
+ homepage: :string,
+ description: :string,
+ files: :string,
+ extensions: :string
+ ]
+ )
proposed_name = Path.basename(src) |> Path.rootname()
- name = String.trim(IO.gets("Pack name [#{proposed_name}]: "))
- # If there's no name, use the default one
- name = if String.length(name) > 0, do: name, else: proposed_name
-
- license = String.trim(IO.gets("License: "))
- homepage = String.trim(IO.gets("Homepage: "))
- description = String.trim(IO.gets("Description: "))
+ name = get_option(opts, :name, "Pack name:", proposed_name)
+ license = get_option(opts, :license, "License:")
+ homepage = get_option(opts, :homepage, "Homepage:")
+ description = get_option(opts, :description, "Description:")
- proposed_files_name = "#{name}.json"
- files_name = String.trim(IO.gets("Save file list to [#{proposed_files_name}]: "))
- files_name = if String.length(files_name) > 0, do: files_name, else: proposed_files_name
+ proposed_files_name = "#{name}_files.json"
+ files_name = get_option(opts, :files, "Save file list to:", proposed_files_name)
default_exts = [".png", ".gif"]
- default_exts_str = Enum.join(default_exts, " ")
- exts =
- String.trim(
- IO.gets("Emoji file extensions (separated with spaces) [#{default_exts_str}]: ")
+ custom_exts =
+ get_option(
+ opts,
+ :extensions,
+ "Emoji file extensions (separated with spaces):",
+ Enum.join(default_exts, " ")
)
+ |> String.split(" ", trim: true)
exts =
- if String.length(exts) > 0 do
- String.split(exts, " ")
- |> Enum.filter(fn e -> e |> String.trim() |> String.length() > 0 end)
- else
+ if MapSet.equal?(MapSet.new(default_exts), MapSet.new(custom_exts)) do
default_exts
+ else
+ custom_exts
end
+ IO.puts("Using #{Enum.join(exts, " ")} extensions")
+
IO.puts("Downloading the pack and generating SHA256")
binary_archive = Tesla.get!(client(), src).body
@@ -184,11 +201,7 @@ defmodule Mix.Tasks.Pleroma.Emoji do
tmp_pack_dir = Path.join(System.tmp_dir!(), "emoji-pack-#{name}")
- {:ok, _} =
- :zip.unzip(
- binary_archive,
- cwd: tmp_pack_dir
- )
+ {:ok, _} = :zip.unzip(binary_archive, cwd: String.to_charlist(tmp_pack_dir))
emoji_map = Pleroma.Emoji.Loader.make_shortcode_to_file_map(tmp_pack_dir, exts)
@@ -197,14 +210,16 @@ defmodule Mix.Tasks.Pleroma.Emoji do
IO.puts("""
#{files_name} has been created and contains the list of all found emojis in the pack.
- Please review the files in the remove those not needed.
+ Please review the files in the pack and remove those not needed.
""")
- if File.exists?("index.json") do
- existing_data = File.read!("index.json") |> Jason.decode!()
+ pack_file = "#{name}.json"
+
+ if File.exists?(pack_file) do
+ existing_data = File.read!(pack_file) |> Jason.decode!()
File.write!(
- "index.json",
+ pack_file,
Jason.encode!(
Map.merge(
existing_data,
@@ -214,11 +229,11 @@ defmodule Mix.Tasks.Pleroma.Emoji do
)
)
- IO.puts("index.json file has been update with the #{name} pack")
+ IO.puts("#{pack_file} has been updated with the #{name} pack")
else
- File.write!("index.json", Jason.encode!(pack_json, pretty: true))
+ File.write!(pack_file, Jason.encode!(pack_json, pretty: true))
- IO.puts("index.json has been created with the #{name} pack")
+ IO.puts("#{pack_file} has been created with the #{name} pack")
end
end
diff --git a/lib/mix/tasks/pleroma/instance.ex b/lib/mix/tasks/pleroma/instance.ex
index 9af6cda30..bc842a59f 100644
--- a/lib/mix/tasks/pleroma/instance.ex
+++ b/lib/mix/tasks/pleroma/instance.ex
@@ -1,11 +1,13 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.Instance do
use Mix.Task
import Mix.Pleroma
+ alias Pleroma.Config
+
@shortdoc "Manages Pleroma instance"
@moduledoc File.read!("docs/administration/CLI_tasks/instance.md")
@@ -63,7 +65,8 @@ defmodule Mix.Tasks.Pleroma.Instance do
get_option(
options,
:instance_name,
- "What is the name of your instance? (e.g. Pleroma/Soykaf)"
+ "What is the name of your instance? (e.g. The Corndog Emporium)",
+ domain
)
email = get_option(options, :admin_email, "What is your admin email address?")
@@ -153,6 +156,8 @@ defmodule Mix.Tasks.Pleroma.Instance do
Pleroma.Config.get([:instance, :static_dir])
)
+ Config.put([:instance, :static_dir], static_dir)
+
secret = :crypto.strong_rand_bytes(64) |> Base.encode64() |> binary_part(0, 64)
jwt_secret = :crypto.strong_rand_bytes(64) |> Base.encode64() |> binary_part(0, 64)
signing_salt = :crypto.strong_rand_bytes(8) |> Base.encode64() |> binary_part(0, 8)
@@ -202,8 +207,14 @@ defmodule Mix.Tasks.Pleroma.Instance do
write_robots_txt(indexable, template_dir)
shell_info(
- "\n All files successfully written! Refer to the installation instructions for your platform for next steps"
+ "\n All files successfully written! Refer to the installation instructions for your platform for next steps."
)
+
+ if db_configurable? do
+ shell_info(
+ " Please transfer your config to the database after running database migrations. Refer to \"Transfering the config to/from the database\" section of the docs for more information."
+ )
+ end
else
shell_error(
"The task would have overwritten the following files:\n" <>
diff --git a/lib/mix/tasks/pleroma/notification_settings.ex b/lib/mix/tasks/pleroma/notification_settings.ex
new file mode 100644
index 000000000..7d65f0587
--- /dev/null
+++ b/lib/mix/tasks/pleroma/notification_settings.ex
@@ -0,0 +1,83 @@
+defmodule Mix.Tasks.Pleroma.NotificationSettings do
+ @shortdoc "Enable&Disable privacy option for push notifications"
+ @moduledoc """
+ Example:
+
+ > mix pleroma.notification_settings --privacy-option=false --nickname-users="parallel588" # set false only for parallel588 user
+ > mix pleroma.notification_settings --privacy-option=true # set true for all users
+
+ """
+
+ use Mix.Task
+ import Mix.Pleroma
+ import Ecto.Query
+
+ def run(args) do
+ start_pleroma()
+
+ {options, _, _} =
+ OptionParser.parse(
+ args,
+ strict: [
+ privacy_option: :boolean,
+ email_users: :string,
+ nickname_users: :string
+ ]
+ )
+
+ privacy_option = Keyword.get(options, :privacy_option)
+
+ if not is_nil(privacy_option) do
+ privacy_option
+ |> build_query(options)
+ |> Pleroma.Repo.update_all([])
+ end
+
+ shell_info("Done")
+ end
+
+ defp build_query(privacy_option, options) do
+ query =
+ from(u in Pleroma.User,
+ update: [
+ set: [
+ notification_settings:
+ fragment(
+ "jsonb_set(notification_settings, '{privacy_option}', ?)",
+ ^privacy_option
+ )
+ ]
+ ]
+ )
+
+ user_emails =
+ options
+ |> Keyword.get(:email_users, "")
+ |> String.split(",")
+ |> Enum.map(&String.trim(&1))
+ |> Enum.reject(&(&1 == ""))
+
+ query =
+ if length(user_emails) > 0 do
+ where(query, [u], u.email in ^user_emails)
+ else
+ query
+ end
+
+ user_nicknames =
+ options
+ |> Keyword.get(:nickname_users, "")
+ |> String.split(",")
+ |> Enum.map(&String.trim(&1))
+ |> Enum.reject(&(&1 == ""))
+
+ query =
+ if length(user_nicknames) > 0 do
+ where(query, [u], u.nickname in ^user_nicknames)
+ else
+ query
+ end
+
+ query
+ end
+end
diff --git a/lib/mix/tasks/pleroma/refresh_counter_cache.ex b/lib/mix/tasks/pleroma/refresh_counter_cache.ex
new file mode 100644
index 000000000..15b4dbfa6
--- /dev/null
+++ b/lib/mix/tasks/pleroma/refresh_counter_cache.ex
@@ -0,0 +1,46 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Mix.Tasks.Pleroma.RefreshCounterCache do
+ @shortdoc "Refreshes counter cache"
+
+ use Mix.Task
+
+ alias Pleroma.Activity
+ alias Pleroma.CounterCache
+ alias Pleroma.Repo
+
+ require Logger
+ import Ecto.Query
+
+ def run([]) do
+ Mix.Pleroma.start_pleroma()
+
+ ["public", "unlisted", "private", "direct"]
+ |> Enum.each(fn visibility ->
+ count = status_visibility_count_query(visibility)
+ name = "status_visibility_#{visibility}"
+ CounterCache.set(name, count)
+ Mix.Pleroma.shell_info("Set #{name} to #{count}")
+ end)
+
+ Mix.Pleroma.shell_info("Done")
+ end
+
+ defp status_visibility_count_query(visibility) do
+ Activity
+ |> where(
+ [a],
+ fragment(
+ "activity_visibility(?, ?, ?) = ?",
+ a.actor,
+ a.recipients,
+ a.data,
+ ^visibility
+ )
+ )
+ |> where([a], fragment("(? ->> 'type'::text) = 'Create'", a.data))
+ |> Repo.aggregate(:count, :id, timeout: :timer.minutes(30))
+ end
+end
diff --git a/lib/mix/tasks/pleroma/relay.ex b/lib/mix/tasks/pleroma/relay.ex
index 7ef5f9678..c3312507e 100644
--- a/lib/mix/tasks/pleroma/relay.ex
+++ b/lib/mix/tasks/pleroma/relay.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.Relay do
@@ -35,7 +35,7 @@ defmodule Mix.Tasks.Pleroma.Relay do
def run(["list"]) do
start_pleroma()
- with {:ok, list} <- Relay.list() do
+ with {:ok, list} <- Relay.list(true) do
list |> Enum.each(&shell_info(&1))
else
{:error, e} -> shell_error("Error while fetching relay subscription list: #{inspect(e)}")
diff --git a/lib/mix/tasks/pleroma/robotstxt.ex b/lib/mix/tasks/pleroma/robotstxt.ex
index 2128e1cd6..24f08180e 100644
--- a/lib/mix/tasks/pleroma/robotstxt.ex
+++ b/lib/mix/tasks/pleroma/robotstxt.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.RobotsTxt do
@@ -18,6 +18,7 @@ defmodule Mix.Tasks.Pleroma.RobotsTxt do
"""
def run(["disallow_all"]) do
+ Mix.Pleroma.start_pleroma()
static_dir = Pleroma.Config.get([:instance, :static_dir], "instance/static/")
if !File.exists?(static_dir) do
diff --git a/lib/mix/tasks/pleroma/uploads.ex b/lib/mix/tasks/pleroma/uploads.ex
index 3e6fc7ee0..c47b7531e 100644
--- a/lib/mix/tasks/pleroma/uploads.ex
+++ b/lib/mix/tasks/pleroma/uploads.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.Uploads do
diff --git a/lib/mix/tasks/pleroma/user.ex b/lib/mix/tasks/pleroma/user.ex
index 134b5bccc..da140ac86 100644
--- a/lib/mix/tasks/pleroma/user.ex
+++ b/lib/mix/tasks/pleroma/user.ex
@@ -1,13 +1,15 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Mix.Tasks.Pleroma.User do
use Mix.Task
import Mix.Pleroma
+ alias Ecto.Changeset
alias Pleroma.User
alias Pleroma.UserInviteToken
- alias Pleroma.Web.OAuth
+ alias Pleroma.Web.ActivityPub.Builder
+ alias Pleroma.Web.ActivityPub.Pipeline
@shortdoc "Manages Pleroma users"
@moduledoc File.read!("docs/administration/CLI_tasks/user.md")
@@ -96,12 +98,12 @@ defmodule Mix.Tasks.Pleroma.User do
def run(["rm", nickname]) do
start_pleroma()
- with %User{local: true} = user <- User.get_cached_by_nickname(nickname) do
- User.perform(:delete, user)
+ with %User{local: true} = user <- User.get_cached_by_nickname(nickname),
+ {:ok, delete_data, _} <- Builder.delete(user, user.ap_id),
+ {:ok, _delete, _} <- Pipeline.common_pipeline(delete_data, local: true) do
shell_info("User #{nickname} deleted.")
else
- _ ->
- shell_error("No local user #{nickname}")
+ _ -> shell_error("No local user #{nickname}")
end
end
@@ -109,10 +111,10 @@ defmodule Mix.Tasks.Pleroma.User do
start_pleroma()
with %User{} = user <- User.get_cached_by_nickname(nickname) do
- {:ok, user} = User.deactivate(user, !user.info.deactivated)
+ {:ok, user} = User.deactivate(user, !user.deactivated)
shell_info(
- "Activation status of #{nickname}: #{if(user.info.deactivated, do: "de", else: "")}activated"
+ "Activation status of #{nickname}: #{if(user.deactivated, do: "de", else: "")}activated"
)
else
_ ->
@@ -162,7 +164,7 @@ defmodule Mix.Tasks.Pleroma.User do
user = User.get_cached_by_id(user.id)
- if Enum.empty?(user.following) do
+ if Enum.empty?(User.get_friends(user)) do
shell_info("Successfully unsubscribed all followers from #{user.nickname}")
end
else
@@ -340,7 +342,7 @@ defmodule Mix.Tasks.Pleroma.User do
with %User{} = user <- User.get_cached_by_nickname(nickname) do
{:ok, user} = User.toggle_confirmation(user)
- message = if user.info.confirmation_pending, do: "needs", else: "doesn't need"
+ message = if user.confirmation_pending, do: "needs", else: "doesn't need"
shell_info("#{nickname} #{message} confirmation.")
else
@@ -353,8 +355,7 @@ defmodule Mix.Tasks.Pleroma.User do
start_pleroma()
with %User{local: true} = user <- User.get_cached_by_nickname(nickname) do
- OAuth.Token.delete_user_tokens(user)
- OAuth.Authorization.delete_user_authorizations(user)
+ User.global_sign_out(user)
shell_info("#{nickname} signed out from all apps.")
else
@@ -363,24 +364,48 @@ defmodule Mix.Tasks.Pleroma.User do
end
end
+ def run(["list"]) do
+ start_pleroma()
+
+ Pleroma.User.Query.build(%{local: true})
+ |> Pleroma.RepoStreamer.chunk_stream(500)
+ |> Stream.each(fn users ->
+ users
+ |> Enum.each(fn user ->
+ shell_info(
+ "#{user.nickname} moderator: #{user.is_moderator}, admin: #{user.is_admin}, locked: #{
+ user.locked
+ }, deactivated: #{user.deactivated}"
+ )
+ end)
+ end)
+ |> Stream.run()
+ end
+
defp set_moderator(user, value) do
- {:ok, user} = User.update_info(user, &User.Info.admin_api_update(&1, %{is_moderator: value}))
+ {:ok, user} =
+ user
+ |> Changeset.change(%{is_moderator: value})
+ |> User.update_and_set_cache()
- shell_info("Moderator status of #{user.nickname}: #{user.info.is_moderator}")
+ shell_info("Moderator status of #{user.nickname}: #{user.is_moderator}")
user
end
defp set_admin(user, value) do
- {:ok, user} = User.update_info(user, &User.Info.admin_api_update(&1, %{is_admin: value}))
+ {:ok, user} = User.admin_api_update(user, %{is_admin: value})
- shell_info("Admin status of #{user.nickname}: #{user.info.is_admin}")
+ shell_info("Admin status of #{user.nickname}: #{user.is_admin}")
user
end
defp set_locked(user, value) do
- {:ok, user} = User.update_info(user, &User.Info.user_upgrade(&1, %{locked: value}))
+ {:ok, user} =
+ user
+ |> Changeset.change(%{locked: value})
+ |> User.update_and_set_cache()
- shell_info("Locked status of #{user.nickname}: #{user.info.locked}")
+ shell_info("Locked status of #{user.nickname}: #{user.locked}")
user
end
end
diff --git a/lib/pleroma/activity.ex b/lib/pleroma/activity.ex
index c1065611b..6213d0eb7 100644
--- a/lib/pleroma/activity.ex
+++ b/lib/pleroma/activity.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Activity do
@@ -12,6 +12,7 @@ defmodule Pleroma.Activity do
alias Pleroma.Notification
alias Pleroma.Object
alias Pleroma.Repo
+ alias Pleroma.ReportNote
alias Pleroma.ThreadMute
alias Pleroma.User
@@ -26,23 +27,27 @@ defmodule Pleroma.Activity do
# https://github.com/tootsuite/mastodon/blob/master/app/models/notification.rb#L19
@mastodon_notification_types %{
"Create" => "mention",
- "Follow" => "follow",
+ "Follow" => ["follow", "follow_request"],
"Announce" => "reblog",
- "Like" => "favourite"
+ "Like" => "favourite",
+ "Move" => "move",
+ "EmojiReact" => "pleroma:emoji_reaction"
}
- @mastodon_to_ap_notification_types for {k, v} <- @mastodon_notification_types,
- into: %{},
- do: {v, k}
-
schema "activities" do
field(:data, :map)
field(:local, :boolean, default: true)
field(:actor, :string)
field(:recipients, {:array, :string}, default: [])
field(:thread_muted?, :boolean, virtual: true)
+
+ # This is a fake relation,
+ # do not use outside of with_preloaded_user_actor/with_joined_user_actor
+ has_one(:user_actor, User, on_delete: :nothing, foreign_key: :id)
# This is a fake relation, do not use outside of with_preloaded_bookmark/get_bookmark
has_one(:bookmark, Bookmark)
+ # This is a fake relation, do not use outside of with_preloaded_report_notes
+ has_many(:report_notes, ReportNote)
has_many(:notifications, Notification, on_delete: :delete_all)
# Attention: this is a fake relation, don't try to preload it blindly and expect it to work!
@@ -86,6 +91,30 @@ defmodule Pleroma.Activity do
|> preload([activity, object: object], object: object)
end
+ # Note: applies to fake activities (ActivityPub.Utils.get_notified_from_object/1 etc.)
+ def user_actor(%Activity{actor: nil}), do: nil
+
+ def user_actor(%Activity{} = activity) do
+ with %User{} <- activity.user_actor do
+ activity.user_actor
+ else
+ _ -> User.get_cached_by_ap_id(activity.actor)
+ end
+ end
+
+ def with_joined_user_actor(query, join_type \\ :inner) do
+ join(query, join_type, [activity], u in User,
+ on: u.ap_id == activity.actor,
+ as: :user_actor
+ )
+ end
+
+ def with_preloaded_user_actor(query, join_type \\ :inner) do
+ query
+ |> with_joined_user_actor(join_type)
+ |> preload([activity, user_actor: user_actor], user_actor: user_actor)
+ end
+
def with_preloaded_bookmark(query, %User{} = user) do
from([a] in query,
left_join: b in Bookmark,
@@ -96,6 +125,16 @@ defmodule Pleroma.Activity do
def with_preloaded_bookmark(query, _), do: query
+ def with_preloaded_report_notes(query) do
+ from([a] in query,
+ left_join: r in ReportNote,
+ on: a.id == r.activity_id,
+ preload: [report_notes: r]
+ )
+ end
+
+ def with_preloaded_report_notes(query, _), do: query
+
def with_set_thread_muted_field(query, %User{} = user) do
from([a] in query,
left_join: tm in ThreadMute,
@@ -223,9 +262,10 @@ defmodule Pleroma.Activity do
def normalize(ap_id) when is_binary(ap_id), do: get_by_ap_id_with_object(ap_id)
def normalize(_), do: nil
- def delete_by_ap_id(id) when is_binary(id) do
+ def delete_all_by_object_ap_id(id) when is_binary(id) do
id
|> Queries.by_object_id()
+ |> Queries.exclude_type("Delete")
|> select([u], u)
|> Repo.delete_all()
|> elem(1)
@@ -237,7 +277,7 @@ defmodule Pleroma.Activity do
|> purge_web_resp_cache()
end
- def delete_by_ap_id(_), do: nil
+ def delete_all_by_object_ap_id(_), do: nil
defp purge_web_resp_cache(%Activity{} = activity) do
%{path: path} = URI.parse(activity.data["id"])
@@ -247,15 +287,43 @@ defmodule Pleroma.Activity do
defp purge_web_resp_cache(nil), do: nil
- for {ap_type, type} <- @mastodon_notification_types do
+ def follow_accepted?(
+ %Activity{data: %{"type" => "Follow", "object" => followed_ap_id}} = activity
+ ) do
+ with %User{} = follower <- Activity.user_actor(activity),
+ %User{} = followed <- User.get_cached_by_ap_id(followed_ap_id) do
+ Pleroma.FollowingRelationship.following?(follower, followed)
+ else
+ _ -> false
+ end
+ end
+
+ def follow_accepted?(_), do: false
+
+ @spec mastodon_notification_type(Activity.t()) :: String.t() | nil
+
+ for {ap_type, type} <- @mastodon_notification_types, not is_list(type) do
def mastodon_notification_type(%Activity{data: %{"type" => unquote(ap_type)}}),
do: unquote(type)
end
+ def mastodon_notification_type(%Activity{data: %{"type" => "Follow"}} = activity) do
+ if follow_accepted?(activity) do
+ "follow"
+ else
+ "follow_request"
+ end
+ end
+
def mastodon_notification_type(%Activity{}), do: nil
+ @spec from_mastodon_notification_type(String.t()) :: String.t() | nil
+ @doc "Converts Mastodon notification type to AR activity type"
def from_mastodon_notification_type(type) do
- Map.get(@mastodon_to_ap_notification_types, type)
+ with {k, _v} <-
+ Enum.find(@mastodon_notification_types, fn {_k, v} -> type in List.wrap(v) end) do
+ k
+ end
end
def all_by_actor_and_id(actor, status_ids \\ [])
@@ -275,15 +343,33 @@ defmodule Pleroma.Activity do
|> where([a], fragment("? ->> 'state' = 'pending'", a.data))
end
+ def following_requests_for_actor(%Pleroma.User{ap_id: ap_id}) do
+ Queries.by_type("Follow")
+ |> where([a], fragment("?->>'state' = 'pending'", a.data))
+ |> where([a], a.actor == ^ap_id)
+ |> Repo.all()
+ end
+
def restrict_deactivated_users(query) do
deactivated_users =
- from(u in User.Query.build(deactivated: true), select: u.ap_id)
+ from(u in User.Query.build(%{deactivated: true}), select: u.ap_id)
|> Repo.all()
- from(activity in query,
- where: activity.actor not in ^deactivated_users
- )
+ Activity.Queries.exclude_authors(query, deactivated_users)
end
defdelegate search(user, query, options \\ []), to: Pleroma.Activity.Search
+
+ def direct_conversation_id(activity, for_user) do
+ alias Pleroma.Conversation.Participation
+
+ with %{data: %{"context" => context}} when is_binary(context) <- activity,
+ %Pleroma.Conversation{} = conversation <- Pleroma.Conversation.get_for_ap_id(context),
+ %Participation{id: participation_id} <-
+ Participation.for_user_and_conversation(for_user, conversation) do
+ participation_id
+ else
+ _ -> nil
+ end
+ end
end
diff --git a/lib/pleroma/activity/ir/topics.ex b/lib/pleroma/activity/ir/topics.ex
index 010897abc..9e65bedad 100644
--- a/lib/pleroma/activity/ir/topics.ex
+++ b/lib/pleroma/activity/ir/topics.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Activity.Ir.Topics do
@@ -39,7 +39,7 @@ defmodule Pleroma.Activity.Ir.Topics do
end
end
- defp item_creation_tags(tags, %{data: %{"type" => "Create"}} = object, activity) do
+ defp item_creation_tags(tags, object, %{data: %{"type" => "Create"}} = activity) do
tags ++ hashtags_to_topics(object) ++ attachment_topics(object, activity)
end
diff --git a/lib/pleroma/activity/queries.ex b/lib/pleroma/activity/queries.ex
index 949f010a8..a34c20343 100644
--- a/lib/pleroma/activity/queries.ex
+++ b/lib/pleroma/activity/queries.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Activity.Queries do
@@ -7,11 +7,12 @@ defmodule Pleroma.Activity.Queries do
Contains queries for Activity.
"""
- import Ecto.Query, only: [from: 2]
+ import Ecto.Query, only: [from: 2, where: 3]
@type query :: Ecto.Queryable.t() | Activity.t()
alias Pleroma.Activity
+ alias Pleroma.User
@spec by_ap_id(query, String.t()) :: query
def by_ap_id(query \\ Activity, ap_id) do
@@ -29,6 +30,18 @@ defmodule Pleroma.Activity.Queries do
)
end
+ @spec by_author(query, User.t()) :: query
+ def by_author(query \\ Activity, %User{ap_id: ap_id}) do
+ from(a in query, where: a.actor == ^ap_id)
+ end
+
+ def find_by_object_ap_id(activities, object_ap_id) do
+ Enum.find(
+ activities,
+ &(object_ap_id in [is_map(&1.data["object"]) && &1.data["object"]["id"], &1.data["object"]])
+ )
+ end
+
@spec by_object_id(query, String.t() | [String.t()]) :: query
def by_object_id(query \\ Activity, object_id)
@@ -57,6 +70,22 @@ defmodule Pleroma.Activity.Queries do
)
end
+ @spec by_object_in_reply_to_id(query, String.t(), keyword()) :: query
+ def by_object_in_reply_to_id(query, in_reply_to_id, opts \\ []) do
+ query =
+ if opts[:skip_preloading] do
+ Activity.with_joined_object(query)
+ else
+ Activity.with_preloaded_object(query)
+ end
+
+ where(
+ query,
+ [activity, object: o],
+ fragment("(?)->>'inReplyTo' = ?", o.data, ^to_string(in_reply_to_id))
+ )
+ end
+
@spec by_type(query, String.t()) :: query
def by_type(query \\ Activity, activity_type) do
from(
@@ -64,4 +93,16 @@ defmodule Pleroma.Activity.Queries do
where: fragment("(?)->>'type' = ?", activity.data, ^activity_type)
)
end
+
+ @spec exclude_type(query, String.t()) :: query
+ def exclude_type(query \\ Activity, activity_type) do
+ from(
+ activity in query,
+ where: fragment("(?)->>'type' != ?", activity.data, ^activity_type)
+ )
+ end
+
+ def exclude_authors(query \\ Activity, actors) do
+ from(activity in query, where: activity.actor not in ^actors)
+ end
end
diff --git a/lib/pleroma/activity/search.ex b/lib/pleroma/activity/search.ex
index f847ac238..ceb365bb3 100644
--- a/lib/pleroma/activity/search.ex
+++ b/lib/pleroma/activity/search.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Activity.Search do
@@ -26,18 +26,23 @@ defmodule Pleroma.Activity.Search do
|> query_with(index_type, search_query)
|> maybe_restrict_local(user)
|> maybe_restrict_author(author)
+ |> maybe_restrict_blocked(user)
|> Pagination.fetch_paginated(%{"offset" => offset, "limit" => limit}, :offset)
|> maybe_fetch(user, search_query)
end
def maybe_restrict_author(query, %User{} = author) do
- from([a, o] in query,
- where: a.actor == ^author.ap_id
- )
+ Activity.Queries.by_author(query, author)
end
def maybe_restrict_author(query, _), do: query
+ def maybe_restrict_blocked(query, %User{} = user) do
+ Activity.Queries.exclude_authors(query, User.blocked_users_ap_ids(user))
+ end
+
+ def maybe_restrict_blocked(query, _), do: query
+
defp restrict_public(q) do
from([a, o] in q,
where: fragment("?->>'type' = 'Create'", a.data),
@@ -86,7 +91,7 @@ defmodule Pleroma.Activity.Search do
{:ok, object} <- Fetcher.fetch_object_from_id(search_query),
%Activity{} = activity <- Activity.get_create_by_object_ap_id(object.data["id"]),
true <- Visibility.visible_for_user?(activity, user) do
- activities ++ [activity]
+ [activity | activities]
else
_ -> activities
end
diff --git a/lib/pleroma/activity_expiration.ex b/lib/pleroma/activity_expiration.ex
index 7ea5c48ca..db9c88d84 100644
--- a/lib/pleroma/activity_expiration.ex
+++ b/lib/pleroma/activity_expiration.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.ActivityExpiration do
@@ -62,6 +62,6 @@ defmodule Pleroma.ActivityExpiration do
def expires_late_enough?(scheduled_at) do
now = NaiveDateTime.utc_now()
diff = NaiveDateTime.diff(scheduled_at, now, :millisecond)
- diff >= @min_activity_lifetime
+ diff > @min_activity_lifetime
end
end
diff --git a/lib/pleroma/application.ex b/lib/pleroma/application.ex
index d681eecc8..9d3d92b38 100644
--- a/lib/pleroma/application.ex
+++ b/lib/pleroma/application.ex
@@ -1,11 +1,16 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Application do
- import Cachex.Spec
use Application
+ import Cachex.Spec
+
+ alias Pleroma.Config
+
+ require Logger
+
@name Mix.Project.config()[:name]
@version Mix.Project.config()[:version]
@repository Mix.Project.config()[:source_url]
@@ -17,36 +22,67 @@ defmodule Pleroma.Application do
def repository, do: @repository
def user_agent do
- info = "#{Pleroma.Web.base_url()} <#{Pleroma.Config.get([:instance, :email], "")}>"
- named_version() <> "; " <> info
+ case Config.get([:http, :user_agent], :default) do
+ :default ->
+ info = "#{Pleroma.Web.base_url()} <#{Config.get([:instance, :email], "")}>"
+ named_version() <> "; " <> info
+
+ custom ->
+ custom
+ end
end
# See http://elixir-lang.org/docs/stable/elixir/Application.html
# for more information on OTP Applications
def start(_type, _args) do
- Pleroma.Config.DeprecationWarnings.warn()
+ Pleroma.Config.Holder.save_default()
+ Pleroma.HTML.compile_scrubbers()
+ Config.DeprecationWarnings.warn()
+ Pleroma.Plugs.HTTPSecurityPlug.warn_if_disabled()
+ Pleroma.Repo.check_migrations_applied!()
setup_instrumenters()
+ load_custom_modules()
+
+ adapter = Application.get_env(:tesla, :adapter)
+
+ if adapter == Tesla.Adapter.Gun do
+ if version = Pleroma.OTPVersion.version() do
+ [major, minor] =
+ version
+ |> String.split(".")
+ |> Enum.map(&String.to_integer/1)
+ |> Enum.take(2)
+
+ if (major == 22 and minor < 2) or major < 22 do
+ raise "
+ !!!OTP VERSION WARNING!!!
+ You are using gun adapter with OTP version #{version}, which doesn't support correct handling of unordered certificates chains. Please update your Erlang/OTP to at least 22.2.
+ "
+ end
+ else
+ raise "
+ !!!OTP VERSION WARNING!!!
+ To support correct handling of unordered certificates chains - OTP version must be > 22.2.
+ "
+ end
+ end
# Define workers and child supervisors to be supervised
children =
[
Pleroma.Repo,
- Pleroma.Scheduler,
- Pleroma.Config.TransferTask,
+ Config.TransferTask,
Pleroma.Emoji,
- Pleroma.Captcha,
- Pleroma.Daemons.ScheduledActivityDaemon,
- Pleroma.Daemons.ActivityExpirationDaemon
+ Pleroma.Plugs.RateLimiter.Supervisor
] ++
cachex_children() ++
- hackney_pool_children() ++
+ http_children(adapter, @env) ++
[
Pleroma.Stats,
Pleroma.JobQueueMonitor,
- {Oban, Pleroma.Config.get(Oban)}
+ {Oban, Config.get(Oban)}
] ++
task_children(@env) ++
- oauth_cleanup_child(oauth_cleanup_enabled?()) ++
streamer_child(@env) ++
chat_child(@env, chat_enabled?()) ++
[
@@ -60,6 +96,28 @@ defmodule Pleroma.Application do
Supervisor.start_link(children, opts)
end
+ def load_custom_modules do
+ dir = Config.get([:modules, :runtime_dir])
+
+ if dir && File.exists?(dir) do
+ dir
+ |> Pleroma.Utils.compile_dir()
+ |> case do
+ {:error, _errors, _warnings} ->
+ raise "Invalid custom modules"
+
+ {:ok, modules, _warnings} ->
+ if @env != :test do
+ Enum.each(modules, fn mod ->
+ Logger.info("Custom module loaded: #{inspect(mod)}")
+ end)
+ end
+
+ :ok
+ end
+ end
+ end
+
defp setup_instrumenters do
require Prometheus.Registry
@@ -80,20 +138,6 @@ defmodule Pleroma.Application do
Pleroma.Web.Endpoint.Instrumenter.setup()
end
- def enabled_hackney_pools do
- [:media] ++
- if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do
- [:federation]
- else
- []
- end ++
- if Pleroma.Config.get([Pleroma.Upload, :proxy_remote]) do
- [:upload]
- else
- []
- end
- end
-
defp cachex_children do
[
build_cachex("used_captcha", ttl_interval: seconds_valid_interval()),
@@ -115,7 +159,7 @@ defmodule Pleroma.Application do
do: expiration(default: :timer.seconds(6 * 60 * 60), interval: :timer.seconds(60))
defp seconds_valid_interval,
- do: :timer.seconds(Pleroma.Config.get!([Pleroma.Captcha, :seconds_valid]))
+ do: :timer.seconds(Config.get!([Pleroma.Captcha, :seconds_valid]))
defp build_cachex(type, opts),
do: %{
@@ -124,37 +168,27 @@ defmodule Pleroma.Application do
type: :worker
}
- defp chat_enabled?, do: Pleroma.Config.get([:chat, :enabled])
+ defp chat_enabled?, do: Config.get([:chat, :enabled])
- defp oauth_cleanup_enabled?,
- do: Pleroma.Config.get([:oauth2, :clean_expired_tokens], false)
-
- defp streamer_child(:test), do: []
+ defp streamer_child(env) when env in [:test, :benchmark], do: []
defp streamer_child(_) do
- [Pleroma.Web.Streamer.supervisor()]
+ [
+ {Registry,
+ [
+ name: Pleroma.Web.Streamer.registry(),
+ keys: :duplicate,
+ partitions: System.schedulers_online()
+ ]}
+ ]
end
- defp oauth_cleanup_child(true),
- do: [Pleroma.Web.OAuth.Token.CleanWorker]
-
- defp oauth_cleanup_child(_), do: []
-
- defp chat_child(:test, _), do: []
-
defp chat_child(_env, true) do
[Pleroma.Web.ChatChannel.ChatChannelState]
end
defp chat_child(_, _), do: []
- defp hackney_pool_children do
- for pool <- enabled_hackney_pools() do
- options = Pleroma.Config.get([:hackney_pools, pool])
- :hackney_pool.child_spec(pool, options)
- end
- end
-
defp task_children(:test) do
[
%{
@@ -179,4 +213,31 @@ defmodule Pleroma.Application do
}
]
end
+
+ # start hackney and gun pools in tests
+ defp http_children(_, :test) do
+ hackney_options = Config.get([:hackney_pools, :federation])
+ hackney_pool = :hackney_pool.child_spec(:federation, hackney_options)
+ [hackney_pool, Pleroma.Pool.Supervisor]
+ end
+
+ defp http_children(Tesla.Adapter.Hackney, _) do
+ pools = [:federation, :media]
+
+ pools =
+ if Config.get([Pleroma.Upload, :proxy_remote]) do
+ [:upload | pools]
+ else
+ pools
+ end
+
+ for pool <- pools do
+ options = Config.get([:hackney_pools, pool])
+ :hackney_pool.child_spec(pool, options)
+ end
+ end
+
+ defp http_children(Tesla.Adapter.Gun, _), do: [Pleroma.Pool.Supervisor]
+
+ defp http_children(_, _), do: []
end
diff --git a/lib/pleroma/bbs/authenticator.ex b/lib/pleroma/bbs/authenticator.ex
index 79f133ea6..815de7002 100644
--- a/lib/pleroma/bbs/authenticator.ex
+++ b/lib/pleroma/bbs/authenticator.ex
@@ -1,10 +1,10 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.BBS.Authenticator do
use Sshd.PasswordAuthenticator
- alias Comeonin.Pbkdf2
+ alias Pleroma.Plugs.AuthenticationPlug
alias Pleroma.User
def authenticate(username, password) do
@@ -12,7 +12,7 @@ defmodule Pleroma.BBS.Authenticator do
password = to_string(password)
with %User{} = user <- User.get_by_nickname(username) do
- Pbkdf2.checkpw(password, user.password_hash)
+ AuthenticationPlug.checkpw(password, user.password_hash)
else
_e -> false
end
diff --git a/lib/pleroma/bbs/handler.ex b/lib/pleroma/bbs/handler.ex
index fa838a4e4..12d64c2fe 100644
--- a/lib/pleroma/bbs/handler.ex
+++ b/lib/pleroma/bbs/handler.ex
@@ -1,10 +1,11 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.BBS.Handler do
use Sshd.ShellHandler
alias Pleroma.Activity
+ alias Pleroma.HTML
alias Pleroma.Web.ActivityPub.ActivityPub
alias Pleroma.Web.CommonAPI
@@ -44,7 +45,7 @@ defmodule Pleroma.BBS.Handler do
def puts_activity(activity) do
status = Pleroma.Web.MastodonAPI.StatusView.render("show.json", %{activity: activity})
IO.puts("-- #{status.id} by #{status.account.display_name} (#{status.account.acct})")
- IO.puts(HtmlSanitizeEx.strip_tags(status.content))
+ IO.puts(HTML.strip_tags(status.content))
IO.puts("")
end
@@ -65,7 +66,7 @@ defmodule Pleroma.BBS.Handler do
with %Activity{} <- Activity.get_by_id(activity_id),
{:ok, _activity} <-
- CommonAPI.post(user, %{"status" => rest, "in_reply_to_status_id" => activity_id}) do
+ CommonAPI.post(user, %{status: rest, in_reply_to_status_id: activity_id}) do
IO.puts("Replied!")
else
_e -> IO.puts("Could not reply...")
@@ -77,7 +78,7 @@ defmodule Pleroma.BBS.Handler do
def handle_command(%{user: user} = state, "p " <> text) do
text = String.trim(text)
- with {:ok, _activity} <- CommonAPI.post(user, %{"status" => text}) do
+ with {:ok, _activity} <- CommonAPI.post(user, %{status: text}) do
IO.puts("Posted!")
else
_e -> IO.puts("Could not post...")
@@ -97,7 +98,7 @@ defmodule Pleroma.BBS.Handler do
|> Map.put("user", user)
activities =
- [user.ap_id | user.following]
+ [user.ap_id | Pleroma.User.following(user)]
|> ActivityPub.fetch_activities(params)
Enum.each(activities, fn activity ->
diff --git a/lib/pleroma/bookmark.ex b/lib/pleroma/bookmark.ex
index 221a94f34..e6ddbce1b 100644
--- a/lib/pleroma/bookmark.ex
+++ b/lib/pleroma/bookmark.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Bookmark do
diff --git a/lib/pleroma/captcha/captcha.ex b/lib/pleroma/captcha/captcha.ex
index c2765a5b8..6ab754b6f 100644
--- a/lib/pleroma/captcha/captcha.ex
+++ b/lib/pleroma/captcha/captcha.ex
@@ -1,56 +1,25 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Captcha do
- import Pleroma.Web.Gettext
-
alias Calendar.DateTime
alias Plug.Crypto.KeyGenerator
alias Plug.Crypto.MessageEncryptor
- use GenServer
-
- @doc false
- def start_link(_) do
- GenServer.start_link(__MODULE__, [], name: __MODULE__)
- end
-
- @doc false
- def init(_) do
- {:ok, nil}
- end
-
@doc """
Ask the configured captcha service for a new captcha
"""
def new do
- GenServer.call(__MODULE__, :new)
- end
-
- @doc """
- Ask the configured captcha service to validate the captcha
- """
- def validate(token, captcha, answer_data) do
- GenServer.call(__MODULE__, {:validate, token, captcha, answer_data})
- end
-
- @doc false
- def handle_call(:new, _from, state) do
- enabled = Pleroma.Config.get([__MODULE__, :enabled])
-
- if !enabled do
- {:reply, %{type: :none}, state}
+ if not enabled?() do
+ %{type: :none}
else
new_captcha = method().new()
- secret_key_base = Pleroma.Config.get!([Pleroma.Web.Endpoint, :secret_key_base])
-
# This make salt a little different for two keys
- token = new_captcha[:token]
- secret = KeyGenerator.generate(secret_key_base, token <> "_encrypt")
- sign_secret = KeyGenerator.generate(secret_key_base, token <> "_sign")
- # Basicallty copy what Phoenix.Token does here, add the time to
+ {secret, sign_secret} = secret_pair(new_captcha[:token])
+
+ # Basically copy what Phoenix.Token does here, add the time to
# the actual data and make it a binary to then encrypt it
encrypted_captcha_answer =
%{
@@ -60,54 +29,73 @@ defmodule Pleroma.Captcha do
|> :erlang.term_to_binary()
|> MessageEncryptor.encrypt(secret, sign_secret)
- {
- :reply,
- # Repalce the answer with the encrypted answer
- %{new_captcha | answer_data: encrypted_captcha_answer},
- state
- }
+ # Replace the answer with the encrypted answer
+ %{new_captcha | answer_data: encrypted_captcha_answer}
end
end
- @doc false
- def handle_call({:validate, token, captcha, answer_data}, _from, state) do
+ @doc """
+ Ask the configured captcha service to validate the captcha
+ """
+ def validate(token, captcha, answer_data) do
+ with {:ok, %{at: at, answer_data: answer_md5}} <- validate_answer_data(token, answer_data),
+ :ok <- validate_expiration(at),
+ :ok <- validate_usage(token),
+ :ok <- method().validate(token, captcha, answer_md5),
+ {:ok, _} <- mark_captcha_as_used(token) do
+ :ok
+ end
+ end
+
+ def enabled?, do: Pleroma.Config.get([__MODULE__, :enabled], false)
+
+ defp seconds_valid, do: Pleroma.Config.get!([__MODULE__, :seconds_valid])
+
+ defp secret_pair(token) do
secret_key_base = Pleroma.Config.get!([Pleroma.Web.Endpoint, :secret_key_base])
secret = KeyGenerator.generate(secret_key_base, token <> "_encrypt")
sign_secret = KeyGenerator.generate(secret_key_base, token <> "_sign")
+ {secret, sign_secret}
+ end
+
+ defp validate_answer_data(token, answer_data) do
+ {secret, sign_secret} = secret_pair(token)
+
+ with false <- is_nil(answer_data),
+ {:ok, data} <- MessageEncryptor.decrypt(answer_data, secret, sign_secret),
+ %{at: at, answer_data: answer_md5} <- :erlang.binary_to_term(data) do
+ {:ok, %{at: at, answer_data: answer_md5}}
+ else
+ _ -> {:error, :invalid_answer_data}
+ end
+ end
+
+ defp validate_expiration(created_at) do
# If the time found is less than (current_time-seconds_valid) then the time has already passed
# Later we check that the time found is more than the presumed invalidatation time, that means
# that the data is still valid and the captcha can be checked
- seconds_valid = Pleroma.Config.get!([Pleroma.Captcha, :seconds_valid])
- valid_if_after = DateTime.subtract!(DateTime.now_utc(), seconds_valid)
-
- result =
- with {:ok, data} <- MessageEncryptor.decrypt(answer_data, secret, sign_secret),
- %{at: at, answer_data: answer_md5} <- :erlang.binary_to_term(data) do
- try do
- if DateTime.before?(at, valid_if_after),
- do: throw({:error, dgettext("errors", "CAPTCHA expired")})
-
- if not is_nil(Cachex.get!(:used_captcha_cache, token)),
- do: throw({:error, dgettext("errors", "CAPTCHA already used")})
-
- res = method().validate(token, captcha, answer_md5)
- # Throw if an error occurs
- if res != :ok, do: throw(res)
-
- # Mark this captcha as used
- {:ok, _} =
- Cachex.put(:used_captcha_cache, token, true, ttl: :timer.seconds(seconds_valid))
-
- :ok
- catch
- :throw, e -> e
- end
- else
- _ -> {:error, dgettext("errors", "Invalid answer data")}
- end
-
- {:reply, result, state}
+
+ valid_if_after = DateTime.subtract!(DateTime.now_utc(), seconds_valid())
+
+ if DateTime.before?(created_at, valid_if_after) do
+ {:error, :expired}
+ else
+ :ok
+ end
+ end
+
+ defp validate_usage(token) do
+ if is_nil(Cachex.get!(:used_captcha_cache, token)) do
+ :ok
+ else
+ {:error, :already_used}
+ end
+ end
+
+ defp mark_captcha_as_used(token) do
+ ttl = seconds_valid() |> :timer.seconds()
+ Cachex.put(:used_captcha_cache, token, true, ttl: ttl)
end
defp method, do: Pleroma.Config.get!([__MODULE__, :method])
diff --git a/lib/pleroma/captcha/captcha_service.ex b/lib/pleroma/captcha/captcha_service.ex
index 8d27c04f1..959038cef 100644
--- a/lib/pleroma/captcha/captcha_service.ex
+++ b/lib/pleroma/captcha/captcha_service.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Captcha.Service do
diff --git a/lib/pleroma/captcha/kocaptcha.ex b/lib/pleroma/captcha/kocaptcha.ex
index 4e1a07c59..6bc2fa158 100644
--- a/lib/pleroma/captcha/kocaptcha.ex
+++ b/lib/pleroma/captcha/kocaptcha.ex
@@ -1,9 +1,8 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Captcha.Kocaptcha do
- import Pleroma.Web.Gettext
alias Pleroma.Captcha.Service
@behaviour Service
@@ -13,7 +12,7 @@ defmodule Pleroma.Captcha.Kocaptcha do
case Tesla.get(endpoint <> "/new") do
{:error, _} ->
- %{error: dgettext("errors", "Kocaptcha service unavailable")}
+ %{error: :kocaptcha_service_unavailable}
{:ok, res} ->
json_resp = Jason.decode!(res.body)
@@ -33,6 +32,6 @@ defmodule Pleroma.Captcha.Kocaptcha do
if not is_nil(captcha) and
:crypto.hash(:md5, captcha) |> Base.encode16() == String.upcase(answer_data),
do: :ok,
- else: {:error, dgettext("errors", "Invalid CAPTCHA")}
+ else: {:error, :invalid}
end
end
diff --git a/lib/pleroma/captcha/native.ex b/lib/pleroma/captcha/native.ex
new file mode 100644
index 000000000..a90631d61
--- /dev/null
+++ b/lib/pleroma/captcha/native.ex
@@ -0,0 +1,34 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Captcha.Native do
+ alias Pleroma.Captcha.Service
+ @behaviour Service
+
+ @impl Service
+ def new do
+ case Captcha.get() do
+ :error ->
+ %{error: :captcha_error}
+
+ {:ok, answer_data, img_binary} ->
+ %{
+ type: :native,
+ token: token(),
+ url: "data:image/png;base64," <> Base.encode64(img_binary),
+ answer_data: answer_data
+ }
+ end
+ end
+
+ @impl Service
+ def validate(_token, captcha, captcha) when not is_nil(captcha), do: :ok
+ def validate(_token, _captcha, _answer), do: {:error, :invalid}
+
+ defp token do
+ 10
+ |> :crypto.strong_rand_bytes()
+ |> Base.url_encode64(padding: false)
+ end
+end
diff --git a/lib/pleroma/clippy.ex b/lib/pleroma/clippy.ex
index bd20952a6..ae96e6ad1 100644
--- a/lib/pleroma/clippy.ex
+++ b/lib/pleroma/clippy.ex
@@ -1,9 +1,10 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Clippy do
@moduledoc false
+
# No software is complete until they have a Clippy implementation.
# A ballmer peak _may_ be required to change this module.
diff --git a/lib/pleroma/config.ex b/lib/pleroma/config.ex
index fcc039710..cc80deff5 100644
--- a/lib/pleroma/config.ex
+++ b/lib/pleroma/config.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Config do
@@ -65,4 +65,16 @@ defmodule Pleroma.Config do
def oauth_consumer_strategies, do: get([:auth, :oauth_consumer_strategies], [])
def oauth_consumer_enabled?, do: oauth_consumer_strategies() != []
+
+ def enforce_oauth_admin_scope_usage?, do: !!get([:auth, :enforce_oauth_admin_scope_usage])
+
+ def oauth_admin_scopes(scopes) when is_list(scopes) do
+ Enum.flat_map(
+ scopes,
+ fn scope ->
+ ["admin:#{scope}"] ++
+ if enforce_oauth_admin_scope_usage?(), do: [], else: [scope]
+ end
+ )
+ end
end
diff --git a/lib/pleroma/config/config_db.ex b/lib/pleroma/config/config_db.ex
new file mode 100644
index 000000000..2b43d4c36
--- /dev/null
+++ b/lib/pleroma/config/config_db.ex
@@ -0,0 +1,414 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.ConfigDB do
+ use Ecto.Schema
+
+ import Ecto.Changeset
+ import Ecto.Query
+ import Pleroma.Web.Gettext
+
+ alias __MODULE__
+ alias Pleroma.Repo
+
+ @type t :: %__MODULE__{}
+
+ @full_key_update [
+ {:pleroma, :ecto_repos},
+ {:quack, :meta},
+ {:mime, :types},
+ {:cors_plug, [:max_age, :methods, :expose, :headers]},
+ {:auto_linker, :opts},
+ {:swarm, :node_blacklist},
+ {:logger, :backends}
+ ]
+
+ @full_subkey_update [
+ {:pleroma, :assets, :mascots},
+ {:pleroma, :emoji, :groups},
+ {:pleroma, :workers, :retries},
+ {:pleroma, :mrf_subchain, :match_actor},
+ {:pleroma, :mrf_keyword, :replace}
+ ]
+
+ @regex ~r/^~r(?'delimiter'[\/|"'([{<]{1})(?'pattern'.+)[\/|"')\]}>]{1}(?'modifier'[uismxfU]*)/u
+
+ @delimiters ["/", "|", "\"", "'", {"(", ")"}, {"[", "]"}, {"{", "}"}, {"<", ">"}]
+
+ schema "config" do
+ field(:key, :string)
+ field(:group, :string)
+ field(:value, :binary)
+ field(:db, {:array, :string}, virtual: true, default: [])
+
+ timestamps()
+ end
+
+ @spec get_all_as_keyword() :: keyword()
+ def get_all_as_keyword do
+ ConfigDB
+ |> select([c], {c.group, c.key, c.value})
+ |> Repo.all()
+ |> Enum.reduce([], fn {group, key, value}, acc ->
+ group = ConfigDB.from_string(group)
+ key = ConfigDB.from_string(key)
+ value = from_binary(value)
+
+ Keyword.update(acc, group, [{key, value}], &Keyword.merge(&1, [{key, value}]))
+ end)
+ end
+
+ @spec get_by_params(map()) :: ConfigDB.t() | nil
+ def get_by_params(params), do: Repo.get_by(ConfigDB, params)
+
+ @spec changeset(ConfigDB.t(), map()) :: Changeset.t()
+ def changeset(config, params \\ %{}) do
+ params = Map.put(params, :value, transform(params[:value]))
+
+ config
+ |> cast(params, [:key, :group, :value])
+ |> validate_required([:key, :group, :value])
+ |> unique_constraint(:key, name: :config_group_key_index)
+ end
+
+ @spec create(map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()}
+ def create(params) do
+ %ConfigDB{}
+ |> changeset(params)
+ |> Repo.insert()
+ end
+
+ @spec update(ConfigDB.t(), map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()}
+ def update(%ConfigDB{} = config, %{value: value}) do
+ config
+ |> changeset(%{value: value})
+ |> Repo.update()
+ end
+
+ @spec get_db_keys(ConfigDB.t()) :: [String.t()]
+ def get_db_keys(%ConfigDB{} = config) do
+ config.value
+ |> ConfigDB.from_binary()
+ |> get_db_keys(config.key)
+ end
+
+ @spec get_db_keys(keyword(), any()) :: [String.t()]
+ def get_db_keys(value, key) do
+ if Keyword.keyword?(value) do
+ value |> Keyword.keys() |> Enum.map(&convert(&1))
+ else
+ [convert(key)]
+ end
+ end
+
+ @spec merge_group(atom(), atom(), keyword(), keyword()) :: keyword()
+ def merge_group(group, key, old_value, new_value) do
+ new_keys = to_map_set(new_value)
+
+ intersect_keys =
+ old_value |> to_map_set() |> MapSet.intersection(new_keys) |> MapSet.to_list()
+
+ merged_value = ConfigDB.merge(old_value, new_value)
+
+ @full_subkey_update
+ |> Enum.map(fn
+ {g, k, subkey} when g == group and k == key ->
+ if subkey in intersect_keys, do: subkey, else: []
+
+ _ ->
+ []
+ end)
+ |> List.flatten()
+ |> Enum.reduce(merged_value, fn subkey, acc ->
+ Keyword.put(acc, subkey, new_value[subkey])
+ end)
+ end
+
+ defp to_map_set(keyword) do
+ keyword
+ |> Keyword.keys()
+ |> MapSet.new()
+ end
+
+ @spec sub_key_full_update?(atom(), atom(), [Keyword.key()]) :: boolean()
+ def sub_key_full_update?(group, key, subkeys) do
+ Enum.any?(@full_subkey_update, fn {g, k, subkey} ->
+ g == group and k == key and subkey in subkeys
+ end)
+ end
+
+ @spec merge(keyword(), keyword()) :: keyword()
+ def merge(config1, config2) when is_list(config1) and is_list(config2) do
+ Keyword.merge(config1, config2, fn _, app1, app2 ->
+ if Keyword.keyword?(app1) and Keyword.keyword?(app2) do
+ Keyword.merge(app1, app2, &deep_merge/3)
+ else
+ app2
+ end
+ end)
+ end
+
+ defp deep_merge(_key, value1, value2) do
+ if Keyword.keyword?(value1) and Keyword.keyword?(value2) do
+ Keyword.merge(value1, value2, &deep_merge/3)
+ else
+ value2
+ end
+ end
+
+ @spec update_or_create(map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()}
+ def update_or_create(params) do
+ search_opts = Map.take(params, [:group, :key])
+
+ with %ConfigDB{} = config <- ConfigDB.get_by_params(search_opts),
+ {:partial_update, true, config} <-
+ {:partial_update, can_be_partially_updated?(config), config},
+ old_value <- from_binary(config.value),
+ transformed_value <- do_transform(params[:value]),
+ {:can_be_merged, true, config} <- {:can_be_merged, is_list(transformed_value), config},
+ new_value <-
+ merge_group(
+ ConfigDB.from_string(config.group),
+ ConfigDB.from_string(config.key),
+ old_value,
+ transformed_value
+ ) do
+ ConfigDB.update(config, %{value: new_value})
+ else
+ {reason, false, config} when reason in [:partial_update, :can_be_merged] ->
+ ConfigDB.update(config, params)
+
+ nil ->
+ ConfigDB.create(params)
+ end
+ end
+
+ defp can_be_partially_updated?(%ConfigDB{} = config), do: not only_full_update?(config)
+
+ defp only_full_update?(%ConfigDB{} = config) do
+ config_group = ConfigDB.from_string(config.group)
+ config_key = ConfigDB.from_string(config.key)
+
+ Enum.any?(@full_key_update, fn
+ {group, key} when is_list(key) ->
+ config_group == group and config_key in key
+
+ {group, key} ->
+ config_group == group and config_key == key
+ end)
+ end
+
+ @spec delete(map()) :: {:ok, ConfigDB.t()} | {:error, Changeset.t()}
+ def delete(params) do
+ search_opts = Map.delete(params, :subkeys)
+
+ with %ConfigDB{} = config <- ConfigDB.get_by_params(search_opts),
+ {config, sub_keys} when is_list(sub_keys) <- {config, params[:subkeys]},
+ old_value <- from_binary(config.value),
+ keys <- Enum.map(sub_keys, &do_transform_string(&1)),
+ {:partial_remove, config, new_value} when new_value != [] <-
+ {:partial_remove, config, Keyword.drop(old_value, keys)} do
+ ConfigDB.update(config, %{value: new_value})
+ else
+ {:partial_remove, config, []} ->
+ Repo.delete(config)
+
+ {config, nil} ->
+ Repo.delete(config)
+
+ nil ->
+ err =
+ dgettext("errors", "Config with params %{params} not found", params: inspect(params))
+
+ {:error, err}
+ end
+ end
+
+ @spec from_binary(binary()) :: term()
+ def from_binary(binary), do: :erlang.binary_to_term(binary)
+
+ @spec from_binary_with_convert(binary()) :: any()
+ def from_binary_with_convert(binary) do
+ binary
+ |> from_binary()
+ |> do_convert()
+ end
+
+ @spec from_string(String.t()) :: atom() | no_return()
+ def from_string(string), do: do_transform_string(string)
+
+ @spec convert(any()) :: any()
+ def convert(entity), do: do_convert(entity)
+
+ defp do_convert(entity) when is_list(entity) do
+ for v <- entity, into: [], do: do_convert(v)
+ end
+
+ defp do_convert(%Regex{} = entity), do: inspect(entity)
+
+ defp do_convert(entity) when is_map(entity) do
+ for {k, v} <- entity, into: %{}, do: {do_convert(k), do_convert(v)}
+ end
+
+ defp do_convert({:proxy_url, {type, :localhost, port}}) do
+ %{"tuple" => [":proxy_url", %{"tuple" => [do_convert(type), "localhost", port]}]}
+ end
+
+ defp do_convert({:proxy_url, {type, host, port}}) when is_tuple(host) do
+ ip =
+ host
+ |> :inet_parse.ntoa()
+ |> to_string()
+
+ %{
+ "tuple" => [
+ ":proxy_url",
+ %{"tuple" => [do_convert(type), ip, port]}
+ ]
+ }
+ end
+
+ defp do_convert({:proxy_url, {type, host, port}}) do
+ %{
+ "tuple" => [
+ ":proxy_url",
+ %{"tuple" => [do_convert(type), to_string(host), port]}
+ ]
+ }
+ end
+
+ defp do_convert({:partial_chain, entity}), do: %{"tuple" => [":partial_chain", inspect(entity)]}
+
+ defp do_convert(entity) when is_tuple(entity) do
+ value =
+ entity
+ |> Tuple.to_list()
+ |> do_convert()
+
+ %{"tuple" => value}
+ end
+
+ defp do_convert(entity) when is_boolean(entity) or is_number(entity) or is_nil(entity) do
+ entity
+ end
+
+ defp do_convert(entity)
+ when is_atom(entity) and entity in [:"tlsv1.1", :"tlsv1.2", :"tlsv1.3"] do
+ ":#{entity}"
+ end
+
+ defp do_convert(entity) when is_atom(entity), do: inspect(entity)
+
+ defp do_convert(entity) when is_binary(entity), do: entity
+
+ @spec transform(any()) :: binary() | no_return()
+ def transform(entity) when is_binary(entity) or is_map(entity) or is_list(entity) do
+ entity
+ |> do_transform()
+ |> to_binary()
+ end
+
+ def transform(entity), do: to_binary(entity)
+
+ @spec transform_with_out_binary(any()) :: any()
+ def transform_with_out_binary(entity), do: do_transform(entity)
+
+ @spec to_binary(any()) :: binary()
+ def to_binary(entity), do: :erlang.term_to_binary(entity)
+
+ defp do_transform(%Regex{} = entity), do: entity
+
+ defp do_transform(%{"tuple" => [":proxy_url", %{"tuple" => [type, host, port]}]}) do
+ {:proxy_url, {do_transform_string(type), parse_host(host), port}}
+ end
+
+ defp do_transform(%{"tuple" => [":partial_chain", entity]}) do
+ {partial_chain, []} =
+ entity
+ |> String.replace(~r/[^\w|^{:,[|^,|^[|^\]^}|^\/|^\.|^"]^\s/, "")
+ |> Code.eval_string()
+
+ {:partial_chain, partial_chain}
+ end
+
+ defp do_transform(%{"tuple" => entity}) do
+ Enum.reduce(entity, {}, fn val, acc -> Tuple.append(acc, do_transform(val)) end)
+ end
+
+ defp do_transform(entity) when is_map(entity) do
+ for {k, v} <- entity, into: %{}, do: {do_transform(k), do_transform(v)}
+ end
+
+ defp do_transform(entity) when is_list(entity) do
+ for v <- entity, into: [], do: do_transform(v)
+ end
+
+ defp do_transform(entity) when is_binary(entity) do
+ entity
+ |> String.trim()
+ |> do_transform_string()
+ end
+
+ defp do_transform(entity), do: entity
+
+ defp parse_host("localhost"), do: :localhost
+
+ defp parse_host(host) do
+ charlist = to_charlist(host)
+
+ case :inet.parse_address(charlist) do
+ {:error, :einval} ->
+ charlist
+
+ {:ok, ip} ->
+ ip
+ end
+ end
+
+ defp find_valid_delimiter([], _string, _) do
+ raise(ArgumentError, message: "valid delimiter for Regex expression not found")
+ end
+
+ defp find_valid_delimiter([{leading, closing} = delimiter | others], pattern, regex_delimiter)
+ when is_tuple(delimiter) do
+ if String.contains?(pattern, closing) do
+ find_valid_delimiter(others, pattern, regex_delimiter)
+ else
+ {:ok, {leading, closing}}
+ end
+ end
+
+ defp find_valid_delimiter([delimiter | others], pattern, regex_delimiter) do
+ if String.contains?(pattern, delimiter) do
+ find_valid_delimiter(others, pattern, regex_delimiter)
+ else
+ {:ok, {delimiter, delimiter}}
+ end
+ end
+
+ defp do_transform_string("~r" <> _pattern = regex) do
+ with %{"modifier" => modifier, "pattern" => pattern, "delimiter" => regex_delimiter} <-
+ Regex.named_captures(@regex, regex),
+ {:ok, {leading, closing}} <- find_valid_delimiter(@delimiters, pattern, regex_delimiter),
+ {result, _} <- Code.eval_string("~r#{leading}#{pattern}#{closing}#{modifier}") do
+ result
+ end
+ end
+
+ defp do_transform_string(":" <> atom), do: String.to_atom(atom)
+
+ defp do_transform_string(value) do
+ if is_module_name?(value) do
+ String.to_existing_atom("Elixir." <> value)
+ else
+ value
+ end
+ end
+
+ @spec is_module_name?(String.t()) :: boolean()
+ def is_module_name?(string) do
+ Regex.match?(~r/^(Pleroma|Phoenix|Tesla|Quack|Ueberauth|Swoosh)\./, string) or
+ string in ["Oban", "Ueberauth", "ExSyslogger"]
+ end
+end
diff --git a/lib/pleroma/config/deprecation_warnings.ex b/lib/pleroma/config/deprecation_warnings.ex
index 240fb1c37..c39a8984b 100644
--- a/lib/pleroma/config/deprecation_warnings.ex
+++ b/lib/pleroma/config/deprecation_warnings.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Config.DeprecationWarnings do
diff --git a/lib/pleroma/config/holder.ex b/lib/pleroma/config/holder.ex
new file mode 100644
index 000000000..f037d5d48
--- /dev/null
+++ b/lib/pleroma/config/holder.ex
@@ -0,0 +1,35 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Config.Holder do
+ @config Pleroma.Config.Loader.default_config()
+
+ @spec save_default() :: :ok
+ def save_default do
+ default_config =
+ if System.get_env("RELEASE_NAME") do
+ release_config =
+ [:code.root_dir(), "releases", System.get_env("RELEASE_VSN"), "releases.exs"]
+ |> Path.join()
+ |> Pleroma.Config.Loader.read()
+
+ Pleroma.Config.Loader.merge(@config, release_config)
+ else
+ @config
+ end
+
+ Pleroma.Config.put(:default_config, default_config)
+ end
+
+ @spec default_config() :: keyword()
+ def default_config, do: get_default()
+
+ @spec default_config(atom()) :: keyword()
+ def default_config(group), do: Keyword.get(get_default(), group)
+
+ @spec default_config(atom(), atom()) :: keyword()
+ def default_config(group, key), do: get_in(get_default(), [group, key])
+
+ defp get_default, do: Pleroma.Config.get(:default_config)
+end
diff --git a/lib/pleroma/config/loader.ex b/lib/pleroma/config/loader.ex
new file mode 100644
index 000000000..0f3ecf1ed
--- /dev/null
+++ b/lib/pleroma/config/loader.ex
@@ -0,0 +1,53 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Config.Loader do
+ @reject_keys [
+ Pleroma.Repo,
+ Pleroma.Web.Endpoint,
+ :env,
+ :configurable_from_database,
+ :database,
+ :swarm
+ ]
+
+ if Code.ensure_loaded?(Config.Reader) do
+ @reader Config.Reader
+
+ def read(path), do: @reader.read!(path)
+ else
+ # support for Elixir less than 1.9
+ @reader Mix.Config
+ def read(path) do
+ path
+ |> @reader.eval!()
+ |> elem(0)
+ end
+ end
+
+ @spec read(Path.t()) :: keyword()
+
+ @spec merge(keyword(), keyword()) :: keyword()
+ def merge(c1, c2), do: @reader.merge(c1, c2)
+
+ @spec default_config() :: keyword()
+ def default_config do
+ "config/config.exs"
+ |> read()
+ |> filter()
+ end
+
+ defp filter(configs) do
+ configs
+ |> Keyword.keys()
+ |> Enum.reduce([], &Keyword.put(&2, &1, filter_group(&1, configs)))
+ end
+
+ @spec filter_group(atom(), keyword()) :: keyword()
+ def filter_group(group, configs) do
+ Enum.reject(configs[group], fn {key, _v} ->
+ key in @reject_keys or (group == :phoenix and key == :serve_endpoints) or group == :postgrex
+ end)
+ end
+end
diff --git a/lib/pleroma/config/transfer_task.ex b/lib/pleroma/config/transfer_task.ex
index 3214c9951..c02b70e96 100644
--- a/lib/pleroma/config/transfer_task.ex
+++ b/lib/pleroma/config/transfer_task.ex
@@ -1,59 +1,209 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Config.TransferTask do
use Task
- alias Pleroma.Web.AdminAPI.Config
+
+ alias Pleroma.Config
+ alias Pleroma.ConfigDB
+ alias Pleroma.Repo
+
+ require Logger
+
+ @type env() :: :test | :benchmark | :dev | :prod
+
+ @reboot_time_keys [
+ {:pleroma, :hackney_pools},
+ {:pleroma, :chat},
+ {:pleroma, Oban},
+ {:pleroma, :rate_limit},
+ {:pleroma, :markup},
+ {:pleroma, :streamer},
+ {:pleroma, :pools},
+ {:pleroma, :connections_pool}
+ ]
+
+ @reboot_time_subkeys [
+ {:pleroma, Pleroma.Captcha, [:seconds_valid]},
+ {:pleroma, Pleroma.Upload, [:proxy_remote]},
+ {:pleroma, :instance, [:upload_limit]},
+ {:pleroma, :email_notifications, [:digest]},
+ {:pleroma, :oauth2, [:clean_expired_tokens]},
+ {:pleroma, Pleroma.ActivityExpiration, [:enabled]},
+ {:pleroma, Pleroma.ScheduledActivity, [:enabled]},
+ {:pleroma, :gopher, [:enabled]}
+ ]
def start_link(_) do
load_and_update_env()
- if Pleroma.Config.get(:env) == :test, do: Ecto.Adapters.SQL.Sandbox.checkin(Pleroma.Repo)
+ if Config.get(:env) == :test, do: Ecto.Adapters.SQL.Sandbox.checkin(Repo)
:ignore
end
- def load_and_update_env do
- if Pleroma.Config.get([:instance, :dynamic_configuration]) and
- Ecto.Adapters.SQL.table_exists?(Pleroma.Repo, "config") do
- for_restart =
- Pleroma.Repo.all(Config)
- |> Enum.map(&update_env(&1))
-
+ @spec load_and_update_env([ConfigDB.t()], boolean()) :: :ok
+ def load_and_update_env(deleted_settings \\ [], restart_pleroma? \\ true) do
+ with {_, true} <- {:configurable, Config.get(:configurable_from_database)} do
# We need to restart applications for loaded settings take effect
- for_restart
- |> Enum.reject(&(&1 in [:pleroma, :ok]))
- |> Enum.each(fn app ->
- Application.stop(app)
- :ok = Application.start(app)
- end)
- end
- end
- defp update_env(setting) do
- try do
- key =
- if String.starts_with?(setting.key, "Pleroma.") do
- "Elixir." <> setting.key
+ {logger, other} =
+ (Repo.all(ConfigDB) ++ deleted_settings)
+ |> Enum.map(&transform_and_merge/1)
+ |> Enum.split_with(fn {group, _, _, _} -> group in [:logger, :quack] end)
+
+ logger
+ |> Enum.sort()
+ |> Enum.each(&configure/1)
+
+ started_applications = Application.started_applications()
+
+ # TODO: some problem with prometheus after restart!
+ reject = [nil, :prometheus, :postgrex]
+
+ reject =
+ if restart_pleroma? do
+ reject
else
- String.trim_leading(setting.key, ":")
+ [:pleroma | reject]
end
- group = String.to_existing_atom(setting.group)
+ other
+ |> Enum.map(&update/1)
+ |> Enum.uniq()
+ |> Enum.reject(&(&1 in reject))
+ |> maybe_set_pleroma_last()
+ |> Enum.each(&restart(started_applications, &1, Config.get(:env)))
+
+ :ok
+ else
+ {:configurable, false} -> Restarter.Pleroma.rebooted()
+ end
+ end
+
+ defp maybe_set_pleroma_last(apps) do
+ # to be ensured that pleroma will be restarted last
+ if :pleroma in apps do
+ apps
+ |> List.delete(:pleroma)
+ |> List.insert_at(-1, :pleroma)
+ else
+ Restarter.Pleroma.rebooted()
+ apps
+ end
+ end
+
+ defp transform_and_merge(%{group: group, key: key, value: value} = setting) do
+ group = ConfigDB.from_string(group)
+ key = ConfigDB.from_string(key)
+ value = ConfigDB.from_binary(value)
+
+ default = Config.Holder.default_config(group, key)
+
+ merged =
+ cond do
+ Ecto.get_meta(setting, :state) == :deleted -> default
+ can_be_merged?(default, value) -> ConfigDB.merge_group(group, key, default, value)
+ true -> value
+ end
+
+ {group, key, value, merged}
+ end
+
+ # change logger configuration in runtime, without restart
+ defp configure({:quack, key, _, merged}) do
+ Logger.configure_backend(Quack.Logger, [{key, merged}])
+ :ok = update_env(:quack, key, merged)
+ end
+
+ defp configure({_, :backends, _, merged}) do
+ # removing current backends
+ Enum.each(Application.get_env(:logger, :backends), &Logger.remove_backend/1)
- Application.put_env(
- group,
- String.to_existing_atom(key),
- Config.from_binary(setting.value)
- )
+ Enum.each(merged, &Logger.add_backend/1)
- group
+ :ok = update_env(:logger, :backends, merged)
+ end
+
+ defp configure({_, key, _, merged}) when key in [:console, :ex_syslogger] do
+ merged =
+ if key == :console do
+ put_in(merged[:format], merged[:format] <> "\n")
+ else
+ merged
+ end
+
+ backend =
+ if key == :ex_syslogger,
+ do: {ExSyslogger, :ex_syslogger},
+ else: key
+
+ Logger.configure_backend(backend, merged)
+ :ok = update_env(:logger, key, merged)
+ end
+
+ defp configure({_, key, _, merged}) do
+ Logger.configure([{key, merged}])
+ :ok = update_env(:logger, key, merged)
+ end
+
+ defp update({group, key, value, merged}) do
+ try do
+ :ok = update_env(group, key, merged)
+
+ if group != :pleroma or pleroma_need_restart?(group, key, value), do: group
rescue
- e ->
- require Logger
+ error ->
+ error_msg =
+ "updating env causes error, group: #{inspect(group)}, key: #{inspect(key)}, value: #{
+ inspect(value)
+ } error: #{inspect(error)}"
+
+ Logger.warn(error_msg)
- Logger.warn(
- "updating env causes error, key: #{inspect(setting.key)}, error: #{inspect(e)}"
- )
+ nil
end
end
+
+ defp update_env(group, key, nil), do: Application.delete_env(group, key)
+ defp update_env(group, key, value), do: Application.put_env(group, key, value)
+
+ @spec pleroma_need_restart?(atom(), atom(), any()) :: boolean()
+ def pleroma_need_restart?(group, key, value) do
+ group_and_key_need_reboot?(group, key) or group_and_subkey_need_reboot?(group, key, value)
+ end
+
+ defp group_and_key_need_reboot?(group, key) do
+ Enum.any?(@reboot_time_keys, fn {g, k} -> g == group and k == key end)
+ end
+
+ defp group_and_subkey_need_reboot?(group, key, value) do
+ Keyword.keyword?(value) and
+ Enum.any?(@reboot_time_subkeys, fn {g, k, subkeys} ->
+ g == group and k == key and
+ Enum.any?(Keyword.keys(value), &(&1 in subkeys))
+ end)
+ end
+
+ defp restart(_, :pleroma, env), do: Restarter.Pleroma.restart_after_boot(env)
+
+ defp restart(started_applications, app, _) do
+ with {^app, _, _} <- List.keyfind(started_applications, app, 0),
+ :ok <- Application.stop(app) do
+ :ok = Application.start(app)
+ else
+ nil ->
+ Logger.warn("#{app} is not started.")
+
+ error ->
+ error
+ |> inspect()
+ |> Logger.warn()
+ end
+ end
+
+ defp can_be_merged?(val1, val2) when is_list(val1) and is_list(val2) do
+ Keyword.keyword?(val1) and Keyword.keyword?(val2)
+ end
+
+ defp can_be_merged?(_val1, _val2), do: false
end
diff --git a/lib/pleroma/constants.ex b/lib/pleroma/constants.ex
index 0bf20cdd0..06174f624 100644
--- a/lib/pleroma/constants.ex
+++ b/lib/pleroma/constants.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Constants do
@@ -9,13 +9,21 @@ defmodule Pleroma.Constants do
const(object_internal_fields,
do: [
+ "reactions",
+ "reaction_count",
"likes",
"like_count",
"announcements",
"announcement_count",
"emoji",
"context_id",
- "deleted_activity_id"
+ "deleted_activity_id",
+ "pleroma_internal"
]
)
+
+ const(static_only_files,
+ do:
+ ~w(index.html robots.txt static static-fe finmoji emoji packs sounds images instance sw.js sw-pleroma.js favicon.png schemas doc)
+ )
end
diff --git a/lib/pleroma/conversation.ex b/lib/pleroma/conversation.ex
index 098016af2..37d455cfc 100644
--- a/lib/pleroma/conversation.ex
+++ b/lib/pleroma/conversation.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Conversation do
@@ -67,7 +67,13 @@ defmodule Pleroma.Conversation do
participations =
Enum.map(users, fn user ->
- User.increment_unread_conversation_count(conversation, user)
+ invisible_conversation = Enum.any?(users, &User.blocks?(user, &1))
+
+ unless invisible_conversation do
+ User.increment_unread_conversation_count(conversation, user)
+ end
+
+ opts = Keyword.put(opts, :invisible_conversation, invisible_conversation)
{:ok, participation} =
Participation.create_for_user_and_conversation(user, conversation, opts)
diff --git a/lib/pleroma/conversation/participation.ex b/lib/pleroma/conversation/participation.ex
index 41918fa78..51bb1bda9 100644
--- a/lib/pleroma/conversation/participation.ex
+++ b/lib/pleroma/conversation/participation.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Conversation.Participation do
@@ -32,11 +32,20 @@ defmodule Pleroma.Conversation.Participation do
def create_for_user_and_conversation(user, conversation, opts \\ []) do
read = !!opts[:read]
+ invisible_conversation = !!opts[:invisible_conversation]
+
+ update_on_conflict =
+ if(invisible_conversation, do: [], else: [read: read])
+ |> Keyword.put(:updated_at, NaiveDateTime.utc_now())
%__MODULE__{}
- |> creation_cng(%{user_id: user.id, conversation_id: conversation.id, read: read})
+ |> creation_cng(%{
+ user_id: user.id,
+ conversation_id: conversation.id,
+ read: invisible_conversation || read
+ })
|> Repo.insert(
- on_conflict: [set: [read: read, updated_at: NaiveDateTime.utc_now()]],
+ on_conflict: [set: update_on_conflict],
returning: true,
conflict_target: [:user_id, :conversation_id]
)
@@ -55,11 +64,13 @@ defmodule Pleroma.Conversation.Participation do
end
def mark_as_read(participation) do
- participation
- |> read_cng(%{read: true})
- |> Repo.update()
+ __MODULE__
+ |> where(id: ^participation.id)
+ |> update(set: [read: true])
+ |> select([p], p)
+ |> Repo.update_all([])
|> case do
- {:ok, participation} ->
+ {1, [participation]} ->
participation = Repo.preload(participation, :user)
User.set_unread_conversation_count(participation.user)
{:ok, participation}
@@ -69,7 +80,26 @@ defmodule Pleroma.Conversation.Participation do
end
end
- def mark_all_as_read(user) do
+ def mark_all_as_read(%User{local: true} = user, %User{} = target_user) do
+ target_conversation_ids =
+ __MODULE__
+ |> where([p], p.user_id == ^target_user.id)
+ |> select([p], p.conversation_id)
+ |> Repo.all()
+
+ __MODULE__
+ |> where([p], p.user_id == ^user.id)
+ |> where([p], p.conversation_id in ^target_conversation_ids)
+ |> update([p], set: [read: true])
+ |> Repo.update_all([])
+
+ {:ok, user} = User.set_unread_conversation_count(user)
+ {:ok, user, []}
+ end
+
+ def mark_all_as_read(%User{} = user, %User{}), do: {:ok, user, []}
+
+ def mark_all_as_read(%User{} = user) do
{_, participations} =
__MODULE__
|> where([p], p.user_id == ^user.id)
@@ -78,8 +108,8 @@ defmodule Pleroma.Conversation.Participation do
|> select([p], p)
|> Repo.update_all([])
- User.set_unread_conversation_count(user)
- {:ok, participations}
+ {:ok, user} = User.set_unread_conversation_count(user)
+ {:ok, user, participations}
end
def mark_as_unread(participation) do
@@ -94,9 +124,32 @@ defmodule Pleroma.Conversation.Participation do
order_by: [desc: p.updated_at],
preload: [conversation: [:users]]
)
+ |> restrict_recipients(user, params)
|> Pleroma.Pagination.fetch_paginated(params)
end
+ def restrict_recipients(query, user, %{recipients: user_ids}) do
+ user_binary_ids =
+ [user.id | user_ids]
+ |> Enum.uniq()
+ |> User.binary_id()
+
+ conversation_subquery =
+ __MODULE__
+ |> group_by([p], p.conversation_id)
+ |> having(
+ [p],
+ count(p.user_id) == ^length(user_binary_ids) and
+ fragment("array_agg(?) @> ?", p.user_id, ^user_binary_ids)
+ )
+ |> select([p], %{id: p.conversation_id})
+
+ query
+ |> join(:inner, [p], c in subquery(conversation_subquery), on: p.conversation_id == c.id)
+ end
+
+ def restrict_recipients(query, _, _), do: query
+
def for_user_and_conversation(user, conversation) do
from(p in __MODULE__,
where: p.user_id == ^user.id,
@@ -119,7 +172,7 @@ defmodule Pleroma.Conversation.Participation do
| last_activity_id: activity_id
}
end)
- |> Enum.filter(& &1.last_activity_id)
+ |> Enum.reject(&is_nil(&1.last_activity_id))
end
def get(_, _ \\ [])
diff --git a/lib/pleroma/conversation/participation_recipient_ship.ex b/lib/pleroma/conversation/participation_recipient_ship.ex
index e3d158cbc..de40bacac 100644
--- a/lib/pleroma/conversation/participation_recipient_ship.ex
+++ b/lib/pleroma/conversation/participation_recipient_ship.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Conversation.Participation.RecipientShip do
diff --git a/lib/pleroma/counter_cache.ex b/lib/pleroma/counter_cache.ex
new file mode 100644
index 000000000..4d348a413
--- /dev/null
+++ b/lib/pleroma/counter_cache.ex
@@ -0,0 +1,41 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.CounterCache do
+ alias Pleroma.CounterCache
+ alias Pleroma.Repo
+ use Ecto.Schema
+ import Ecto.Changeset
+ import Ecto.Query
+
+ schema "counter_cache" do
+ field(:name, :string)
+ field(:count, :integer)
+ end
+
+ def changeset(struct, params) do
+ struct
+ |> cast(params, [:name, :count])
+ |> validate_required([:name])
+ |> unique_constraint(:name)
+ end
+
+ def get_as_map(names) when is_list(names) do
+ CounterCache
+ |> where([cc], cc.name in ^names)
+ |> Repo.all()
+ |> Enum.group_by(& &1.name, & &1.count)
+ |> Map.new(fn {k, v} -> {k, hd(v)} end)
+ end
+
+ def set(name, count) do
+ %CounterCache{}
+ |> changeset(%{"name" => name, "count" => count})
+ |> Repo.insert(
+ on_conflict: [set: [count: count]],
+ returning: true,
+ conflict_target: :name
+ )
+ end
+end
diff --git a/lib/pleroma/daemons/activity_expiration_daemon.ex b/lib/pleroma/daemons/activity_expiration_daemon.ex
deleted file mode 100644
index cab7628c4..000000000
--- a/lib/pleroma/daemons/activity_expiration_daemon.ex
+++ /dev/null
@@ -1,66 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Daemons.ActivityExpirationDaemon do
- alias Pleroma.Activity
- alias Pleroma.ActivityExpiration
- alias Pleroma.Config
- alias Pleroma.Repo
- alias Pleroma.User
- alias Pleroma.Web.CommonAPI
-
- require Logger
- use GenServer
- import Ecto.Query
-
- @schedule_interval :timer.minutes(1)
-
- def start_link(_) do
- GenServer.start_link(__MODULE__, nil)
- end
-
- @impl true
- def init(_) do
- if Config.get([ActivityExpiration, :enabled]) do
- schedule_next()
- {:ok, nil}
- else
- :ignore
- end
- end
-
- def perform(:execute, expiration_id) do
- try do
- expiration =
- ActivityExpiration
- |> where([e], e.id == ^expiration_id)
- |> Repo.one!()
-
- activity = Activity.get_by_id_with_object(expiration.activity_id)
- user = User.get_by_ap_id(activity.object.data["actor"])
- CommonAPI.delete(activity.id, user)
- rescue
- error ->
- Logger.error("#{__MODULE__} Couldn't delete expired activity: #{inspect(error)}")
- end
- end
-
- @impl true
- def handle_info(:perform, state) do
- ActivityExpiration.due_expirations(@schedule_interval)
- |> Enum.each(fn expiration ->
- Pleroma.Workers.ActivityExpirationWorker.enqueue(
- "activity_expiration",
- %{"activity_expiration_id" => expiration.id}
- )
- end)
-
- schedule_next()
- {:noreply, state}
- end
-
- defp schedule_next do
- Process.send_after(self(), :perform, @schedule_interval)
- end
-end
diff --git a/lib/pleroma/daemons/digest_email_daemon.ex b/lib/pleroma/daemons/digest_email_daemon.ex
deleted file mode 100644
index 462ad2c55..000000000
--- a/lib/pleroma/daemons/digest_email_daemon.ex
+++ /dev/null
@@ -1,42 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Daemons.DigestEmailDaemon do
- alias Pleroma.Repo
- alias Pleroma.Workers.DigestEmailsWorker
-
- import Ecto.Query
-
- def perform do
- config = Pleroma.Config.get([:email_notifications, :digest])
- negative_interval = -Map.fetch!(config, :interval)
- inactivity_threshold = Map.fetch!(config, :inactivity_threshold)
- inactive_users_query = Pleroma.User.list_inactive_users_query(inactivity_threshold)
-
- now = NaiveDateTime.truncate(NaiveDateTime.utc_now(), :second)
-
- from(u in inactive_users_query,
- where: fragment(~s(? #> '{"email_notifications","digest"}' @> 'true'), u.info),
- where: u.last_digest_emailed_at < datetime_add(^now, ^negative_interval, "day"),
- select: u
- )
- |> Repo.all()
- |> Enum.each(fn user ->
- DigestEmailsWorker.enqueue("digest_email", %{"user_id" => user.id})
- end)
- end
-
- @doc """
- Send digest email to the given user.
- Updates `last_digest_emailed_at` field for the user and returns the updated user.
- """
- @spec perform(Pleroma.User.t()) :: Pleroma.User.t()
- def perform(user) do
- with %Swoosh.Email{} = email <- Pleroma.Emails.UserEmail.digest_email(user) do
- Pleroma.Emails.Mailer.deliver_async(email)
- end
-
- Pleroma.User.touch_last_digest_emailed_at(user)
- end
-end
diff --git a/lib/pleroma/daemons/scheduled_activity_daemon.ex b/lib/pleroma/daemons/scheduled_activity_daemon.ex
deleted file mode 100644
index aee5f723a..000000000
--- a/lib/pleroma/daemons/scheduled_activity_daemon.ex
+++ /dev/null
@@ -1,62 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Daemons.ScheduledActivityDaemon do
- @moduledoc """
- Sends scheduled activities to the job queue.
- """
-
- alias Pleroma.Config
- alias Pleroma.ScheduledActivity
- alias Pleroma.User
- alias Pleroma.Web.CommonAPI
-
- use GenServer
- require Logger
-
- @schedule_interval :timer.minutes(1)
-
- def start_link(_) do
- GenServer.start_link(__MODULE__, nil)
- end
-
- def init(_) do
- if Config.get([ScheduledActivity, :enabled]) do
- schedule_next()
- {:ok, nil}
- else
- :ignore
- end
- end
-
- def perform(:execute, scheduled_activity_id) do
- try do
- {:ok, scheduled_activity} = ScheduledActivity.delete(scheduled_activity_id)
- %User{} = user = User.get_cached_by_id(scheduled_activity.user_id)
- {:ok, _result} = CommonAPI.post(user, scheduled_activity.params)
- rescue
- error ->
- Logger.error(
- "#{__MODULE__} Couldn't create a status from the scheduled activity: #{inspect(error)}"
- )
- end
- end
-
- def handle_info(:perform, state) do
- ScheduledActivity.due_activities(@schedule_interval)
- |> Enum.each(fn scheduled_activity ->
- Pleroma.Workers.ScheduledActivityWorker.enqueue(
- "execute",
- %{"activity_id" => scheduled_activity.id}
- )
- end)
-
- schedule_next()
- {:noreply, state}
- end
-
- defp schedule_next do
- Process.send_after(self(), :perform, @schedule_interval)
- end
-end
diff --git a/lib/pleroma/delivery.ex b/lib/pleroma/delivery.ex
index 1d586a252..0ded2855c 100644
--- a/lib/pleroma/delivery.ex
+++ b/lib/pleroma/delivery.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Delivery do
diff --git a/lib/pleroma/docs/generator.ex b/lib/pleroma/docs/generator.ex
index aa578eee2..e0fc8cd02 100644
--- a/lib/pleroma/docs/generator.ex
+++ b/lib/pleroma/docs/generator.ex
@@ -6,68 +6,116 @@ defmodule Pleroma.Docs.Generator do
implementation.process(descriptions)
end
- @spec uploaders_list() :: [module()]
- def uploaders_list do
- {:ok, modules} = :application.get_key(:pleroma, :modules)
+ @spec list_modules_in_dir(String.t(), String.t()) :: [module()]
+ def list_modules_in_dir(dir, start) do
+ with {:ok, files} <- File.ls(dir) do
+ files
+ |> Enum.filter(&String.ends_with?(&1, ".ex"))
+ |> Enum.map(fn filename ->
+ module = filename |> String.trim_trailing(".ex") |> Macro.camelize()
+ String.to_atom(start <> module)
+ end)
+ end
+ end
+
+ @doc """
+ Converts:
+ - atoms to strings with leading `:`
+ - module names to strings, without leading `Elixir.`
+ - add humanized labels to `keys` if label is not defined, e.g. `:instance` -> `Instance`
+ """
+ @spec convert_to_strings([map()]) :: [map()]
+ def convert_to_strings(descriptions) do
+ Enum.map(descriptions, &format_entity(&1))
+ end
- Enum.filter(modules, fn module ->
- name_as_list = Module.split(module)
+ defp format_entity(entity) do
+ entity
+ |> format_key()
+ |> Map.put(:group, atom_to_string(entity[:group]))
+ |> format_children()
+ end
- List.starts_with?(name_as_list, ["Pleroma", "Uploaders"]) and
- List.last(name_as_list) != "Uploader"
- end)
+ defp format_key(%{key: key} = entity) do
+ entity
+ |> Map.put(:key, atom_to_string(key))
+ |> Map.put(:label, entity[:label] || humanize(key))
end
- @spec filters_list() :: [module()]
- def filters_list do
- {:ok, modules} = :application.get_key(:pleroma, :modules)
+ defp format_key(%{group: group} = entity) do
+ Map.put(entity, :label, entity[:label] || humanize(group))
+ end
- Enum.filter(modules, fn module ->
- name_as_list = Module.split(module)
+ defp format_key(entity), do: entity
- List.starts_with?(name_as_list, ["Pleroma", "Upload", "Filter"])
- end)
+ defp format_children(%{children: children} = entity) do
+ Map.put(entity, :children, Enum.map(children, &format_child(&1)))
end
- @spec mrf_list() :: [module()]
- def mrf_list do
- {:ok, modules} = :application.get_key(:pleroma, :modules)
+ defp format_children(entity), do: entity
+
+ defp format_child(%{suggestions: suggestions} = entity) do
+ entity
+ |> Map.put(:suggestions, format_suggestions(suggestions))
+ |> format_key()
+ |> format_group()
+ |> format_children()
+ end
- Enum.filter(modules, fn module ->
- name_as_list = Module.split(module)
+ defp format_child(entity) do
+ entity
+ |> format_key()
+ |> format_group()
+ |> format_children()
+ end
- List.starts_with?(name_as_list, ["Pleroma", "Web", "ActivityPub", "MRF"]) and
- length(name_as_list) > 4
- end)
+ defp format_group(%{group: group} = entity) do
+ Map.put(entity, :group, format_suggestion(group))
end
- @spec richmedia_parsers() :: [module()]
- def richmedia_parsers do
- {:ok, modules} = :application.get_key(:pleroma, :modules)
+ defp format_group(entity), do: entity
+
+ defp atom_to_string(entity) when is_binary(entity), do: entity
- Enum.filter(modules, fn module ->
- name_as_list = Module.split(module)
+ defp atom_to_string(entity) when is_atom(entity), do: inspect(entity)
- List.starts_with?(name_as_list, ["Pleroma", "Web", "RichMedia", "Parsers"]) and
- length(name_as_list) == 5
- end)
+ defp humanize(entity) do
+ string = inspect(entity)
+
+ if String.starts_with?(string, ":"),
+ do: Phoenix.Naming.humanize(entity),
+ else: string
end
+
+ defp format_suggestions([]), do: []
+
+ defp format_suggestions([suggestion | tail]) do
+ [format_suggestion(suggestion) | format_suggestions(tail)]
+ end
+
+ defp format_suggestion(entity) when is_atom(entity) do
+ atom_to_string(entity)
+ end
+
+ defp format_suggestion([head | tail] = entity) when is_list(entity) do
+ [format_suggestion(head) | format_suggestions(tail)]
+ end
+
+ defp format_suggestion(entity) when is_tuple(entity) do
+ format_suggestions(Tuple.to_list(entity)) |> List.to_tuple()
+ end
+
+ defp format_suggestion(entity), do: entity
end
defimpl Jason.Encoder, for: Tuple do
- def encode(tuple, opts) do
- Jason.Encode.list(Tuple.to_list(tuple), opts)
- end
+ def encode(tuple, opts), do: Jason.Encode.list(Tuple.to_list(tuple), opts)
end
defimpl Jason.Encoder, for: [Regex, Function] do
- def encode(term, opts) do
- Jason.Encode.string(inspect(term), opts)
- end
+ def encode(term, opts), do: Jason.Encode.string(inspect(term), opts)
end
defimpl String.Chars, for: Regex do
- def to_string(term) do
- inspect(term)
- end
+ def to_string(term), do: inspect(term)
end
diff --git a/lib/pleroma/docs/json.ex b/lib/pleroma/docs/json.ex
index 18ba01d58..d1cf1f487 100644
--- a/lib/pleroma/docs/json.ex
+++ b/lib/pleroma/docs/json.ex
@@ -3,18 +3,21 @@ defmodule Pleroma.Docs.JSON do
@spec process(keyword()) :: {:ok, String.t()}
def process(descriptions) do
- config_path = "docs/generate_config.json"
-
- with {:ok, file} <- File.open(config_path, [:write]),
- json <- generate_json(descriptions),
+ with path <- "docs/generated_config.json",
+ {:ok, file} <- File.open(path, [:write, :utf8]),
+ formatted_descriptions <-
+ Pleroma.Docs.Generator.convert_to_strings(descriptions),
+ json <- Jason.encode!(formatted_descriptions),
:ok <- IO.write(file, json),
:ok <- File.close(file) do
- {:ok, config_path}
+ {:ok, path}
end
end
- @spec generate_json([keyword()]) :: String.t()
- def generate_json(descriptions) do
- Jason.encode!(descriptions)
+ def compile do
+ with config <- Pleroma.Config.Loader.read("config/description.exs") do
+ config[:pleroma][:config_description]
+ |> Pleroma.Docs.Generator.convert_to_strings()
+ end
end
end
diff --git a/lib/pleroma/earmark_renderer.ex b/lib/pleroma/earmark_renderer.ex
new file mode 100644
index 000000000..6211a3b4a
--- /dev/null
+++ b/lib/pleroma/earmark_renderer.ex
@@ -0,0 +1,256 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+#
+# This file is derived from Earmark, under the following copyright:
+# Copyright © 2014 Dave Thomas, The Pragmatic Programmers
+# SPDX-License-Identifier: Apache-2.0
+# Upstream: https://github.com/pragdave/earmark/blob/master/lib/earmark/html_renderer.ex
+defmodule Pleroma.EarmarkRenderer do
+ @moduledoc false
+
+ alias Earmark.Block
+ alias Earmark.Context
+ alias Earmark.HtmlRenderer
+ alias Earmark.Options
+
+ import Earmark.Inline, only: [convert: 3]
+ import Earmark.Helpers.HtmlHelpers
+ import Earmark.Message, only: [add_messages_from: 2, get_messages: 1, set_messages: 2]
+ import Earmark.Context, only: [append: 2, set_value: 2]
+ import Earmark.Options, only: [get_mapper: 1]
+
+ @doc false
+ def render(blocks, %Context{options: %Options{}} = context) do
+ messages = get_messages(context)
+
+ {contexts, html} =
+ get_mapper(context.options).(
+ blocks,
+ &render_block(&1, put_in(context.options.messages, []))
+ )
+ |> Enum.unzip()
+
+ all_messages =
+ contexts
+ |> Enum.reduce(messages, fn ctx, messages1 -> messages1 ++ get_messages(ctx) end)
+
+ {put_in(context.options.messages, all_messages), html |> IO.iodata_to_binary()}
+ end
+
+ #############
+ # Paragraph #
+ #############
+ defp render_block(%Block.Para{lnb: lnb, lines: lines, attrs: attrs}, context) do
+ lines = convert(lines, lnb, context)
+ add_attrs(lines, "<p>#{lines.value}</p>", attrs, [], lnb)
+ end
+
+ ########
+ # Html #
+ ########
+ defp render_block(%Block.Html{html: html}, context) do
+ {context, html}
+ end
+
+ defp render_block(%Block.HtmlComment{lines: lines}, context) do
+ {context, lines}
+ end
+
+ defp render_block(%Block.HtmlOneline{html: html}, context) do
+ {context, html}
+ end
+
+ #########
+ # Ruler #
+ #########
+ defp render_block(%Block.Ruler{lnb: lnb, attrs: attrs}, context) do
+ add_attrs(context, "<hr />", attrs, [], lnb)
+ end
+
+ ###########
+ # Heading #
+ ###########
+ defp render_block(
+ %Block.Heading{lnb: lnb, level: level, content: content, attrs: attrs},
+ context
+ ) do
+ converted = convert(content, lnb, context)
+ html = "<h#{level}>#{converted.value}</h#{level}>"
+ add_attrs(converted, html, attrs, [], lnb)
+ end
+
+ ##############
+ # Blockquote #
+ ##############
+
+ defp render_block(%Block.BlockQuote{lnb: lnb, blocks: blocks, attrs: attrs}, context) do
+ {context1, body} = render(blocks, context)
+ html = "<blockquote>#{body}</blockquote>"
+ add_attrs(context1, html, attrs, [], lnb)
+ end
+
+ #########
+ # Table #
+ #########
+
+ defp render_block(
+ %Block.Table{lnb: lnb, header: header, rows: rows, alignments: aligns, attrs: attrs},
+ context
+ ) do
+ {context1, html} = add_attrs(context, "<table>", attrs, [], lnb)
+ context2 = set_value(context1, html)
+
+ context3 =
+ if header do
+ append(add_trs(append(context2, "<thead>"), [header], "th", aligns, lnb), "</thead>")
+ else
+ # Maybe an error, needed append(context, html)
+ context2
+ end
+
+ context4 = append(add_trs(append(context3, "<tbody>"), rows, "td", aligns, lnb), "</tbody>")
+
+ {context4, [context4.value, "</table>"]}
+ end
+
+ ########
+ # Code #
+ ########
+
+ defp render_block(
+ %Block.Code{lnb: lnb, language: language, attrs: attrs} = block,
+ %Context{options: options} = context
+ ) do
+ class =
+ if language, do: ~s{ class="#{code_classes(language, options.code_class_prefix)}"}, else: ""
+
+ tag = ~s[<pre><code#{class}>]
+ lines = options.render_code.(block)
+ html = ~s[#{tag}#{lines}</code></pre>]
+ add_attrs(context, html, attrs, [], lnb)
+ end
+
+ #########
+ # Lists #
+ #########
+
+ defp render_block(
+ %Block.List{lnb: lnb, type: type, blocks: items, attrs: attrs, start: start},
+ context
+ ) do
+ {context1, content} = render(items, context)
+ html = "<#{type}#{start}>#{content}</#{type}>"
+ add_attrs(context1, html, attrs, [], lnb)
+ end
+
+ # format a single paragraph list item, and remove the para tags
+ defp render_block(
+ %Block.ListItem{lnb: lnb, blocks: blocks, spaced: false, attrs: attrs},
+ context
+ )
+ when length(blocks) == 1 do
+ {context1, content} = render(blocks, context)
+ content = Regex.replace(~r{</?p>}, content, "")
+ html = "<li>#{content}</li>"
+ add_attrs(context1, html, attrs, [], lnb)
+ end
+
+ # format a spaced list item
+ defp render_block(%Block.ListItem{lnb: lnb, blocks: blocks, attrs: attrs}, context) do
+ {context1, content} = render(blocks, context)
+ html = "<li>#{content}</li>"
+ add_attrs(context1, html, attrs, [], lnb)
+ end
+
+ ##################
+ # Footnote Block #
+ ##################
+
+ defp render_block(%Block.FnList{blocks: footnotes}, context) do
+ items =
+ Enum.map(footnotes, fn note ->
+ blocks = append_footnote_link(note)
+ %Block.ListItem{attrs: "#fn:#{note.number}", type: :ol, blocks: blocks}
+ end)
+
+ {context1, html} = render_block(%Block.List{type: :ol, blocks: items}, context)
+ {context1, Enum.join([~s[<div class="footnotes">], "<hr />", html, "</div>"])}
+ end
+
+ #######################################
+ # Isolated IALs are rendered as paras #
+ #######################################
+
+ defp render_block(%Block.Ial{verbatim: verbatim}, context) do
+ {context, "<p>{:#{verbatim}}</p>"}
+ end
+
+ ####################
+ # IDDef is ignored #
+ ####################
+
+ defp render_block(%Block.IdDef{}, context), do: {context, ""}
+
+ #####################################
+ # And here are the inline renderers #
+ #####################################
+
+ defdelegate br, to: HtmlRenderer
+ defdelegate codespan(text), to: HtmlRenderer
+ defdelegate em(text), to: HtmlRenderer
+ defdelegate strong(text), to: HtmlRenderer
+ defdelegate strikethrough(text), to: HtmlRenderer
+
+ defdelegate link(url, text), to: HtmlRenderer
+ defdelegate link(url, text, title), to: HtmlRenderer
+
+ defdelegate image(path, alt, title), to: HtmlRenderer
+
+ defdelegate footnote_link(ref, backref, number), to: HtmlRenderer
+
+ # Table rows
+ defp add_trs(context, rows, tag, aligns, lnb) do
+ numbered_rows =
+ rows
+ |> Enum.zip(Stream.iterate(lnb, &(&1 + 1)))
+
+ numbered_rows
+ |> Enum.reduce(context, fn {row, lnb}, ctx ->
+ append(add_tds(append(ctx, "<tr>"), row, tag, aligns, lnb), "</tr>")
+ end)
+ end
+
+ defp add_tds(context, row, tag, aligns, lnb) do
+ Enum.reduce(1..length(row), context, add_td_fn(row, tag, aligns, lnb))
+ end
+
+ defp add_td_fn(row, tag, aligns, lnb) do
+ fn n, ctx ->
+ style =
+ case Enum.at(aligns, n - 1, :default) do
+ :default -> ""
+ align -> " style=\"text-align: #{align}\""
+ end
+
+ col = Enum.at(row, n - 1)
+ converted = convert(col, lnb, set_messages(ctx, []))
+ append(add_messages_from(ctx, converted), "<#{tag}#{style}>#{converted.value}</#{tag}>")
+ end
+ end
+
+ ###############################
+ # Append Footnote Return Link #
+ ###############################
+
+ defdelegate append_footnote_link(note), to: HtmlRenderer
+ defdelegate append_footnote_link(note, fnlink), to: HtmlRenderer
+
+ defdelegate render_code(lines), to: HtmlRenderer
+
+ defp code_classes(language, prefix) do
+ ["" | String.split(prefix || "")]
+ |> Enum.map(fn pfx -> "#{pfx}#{language}" end)
+ |> Enum.join(" ")
+ end
+end
diff --git a/lib/pleroma/ecto_enums.ex b/lib/pleroma/ecto_enums.ex
new file mode 100644
index 000000000..6fc47620c
--- /dev/null
+++ b/lib/pleroma/ecto_enums.ex
@@ -0,0 +1,19 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+import EctoEnum
+
+defenum(Pleroma.UserRelationship.Type,
+ block: 1,
+ mute: 2,
+ reblog_mute: 3,
+ notification_mute: 4,
+ inverse_subscription: 5
+)
+
+defenum(Pleroma.FollowingRelationship.State,
+ follow_pending: 1,
+ follow_accept: 2,
+ follow_reject: 3
+)
diff --git a/lib/pleroma/emails/admin_email.ex b/lib/pleroma/emails/admin_email.ex
index b15e4041b..55f61024e 100644
--- a/lib/pleroma/emails/admin_email.ex
+++ b/lib/pleroma/emails/admin_email.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Emails.AdminEmail do
@@ -7,6 +7,7 @@ defmodule Pleroma.Emails.AdminEmail do
import Swoosh.Email
+ alias Pleroma.Config
alias Pleroma.Web.Router.Helpers
defp instance_config, do: Pleroma.Config.get(:instance)
@@ -17,7 +18,20 @@ defmodule Pleroma.Emails.AdminEmail do
end
defp user_url(user) do
- Helpers.feed_url(Pleroma.Web.Endpoint, :feed_redirect, user.id)
+ Helpers.user_feed_url(Pleroma.Web.Endpoint, :feed_redirect, user.id)
+ end
+
+ def test_email(mail_to \\ nil) do
+ html_body = """
+ <h3>Instance Test Email</h3>
+ <p>A test email was requested. Hello. :)</p>
+ """
+
+ new()
+ |> to(mail_to || Config.get([:instance, :email]))
+ |> from({instance_name(), instance_notify_email()})
+ |> subject("Instance Test Email")
+ |> html_body(html_body)
end
def report(to, reporter, account, statuses, comment) do
diff --git a/lib/pleroma/emails/mailer.ex b/lib/pleroma/emails/mailer.ex
index eb96f2e8b..8b1bdef75 100644
--- a/lib/pleroma/emails/mailer.ex
+++ b/lib/pleroma/emails/mailer.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Emails.Mailer do
diff --git a/lib/pleroma/emails/new_users_digest_email.ex b/lib/pleroma/emails/new_users_digest_email.ex
new file mode 100644
index 000000000..7d16b807f
--- /dev/null
+++ b/lib/pleroma/emails/new_users_digest_email.ex
@@ -0,0 +1,32 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Emails.NewUsersDigestEmail do
+ use Phoenix.Swoosh, view: Pleroma.Web.EmailView, layout: {Pleroma.Web.LayoutView, :email_styled}
+
+ defp instance_notify_email do
+ Pleroma.Config.get([:instance, :notify_email]) || Pleroma.Config.get([:instance, :email])
+ end
+
+ def new_users(to, users_and_statuses) do
+ instance_name = Pleroma.Config.get([:instance, :name])
+ styling = Pleroma.Config.get([Pleroma.Emails.UserEmail, :styling])
+
+ logo_url =
+ Pleroma.Web.Endpoint.url() <>
+ Pleroma.Config.get([:frontend_configurations, :pleroma_fe, :logo])
+
+ new()
+ |> to({to.name, to.email})
+ |> from({instance_name, instance_notify_email()})
+ |> subject("#{instance_name} New Users")
+ |> render_body("new_users_digest.html", %{
+ title: "New Users",
+ users_and_statuses: users_and_statuses,
+ instance: instance_name,
+ styling: styling,
+ logo_url: logo_url
+ })
+ end
+end
diff --git a/lib/pleroma/emails/user_email.ex b/lib/pleroma/emails/user_email.ex
index 40b67ff56..dfadc10b3 100644
--- a/lib/pleroma/emails/user_email.ex
+++ b/lib/pleroma/emails/user_email.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Emails.UserEmail do
@@ -72,7 +72,7 @@ defmodule Pleroma.Emails.UserEmail do
Endpoint,
:confirm_email,
user.id,
- to_string(user.info.confirmation_token)
+ to_string(user.confirmation_token)
)
html_body = """
diff --git a/lib/pleroma/emoji-data.txt b/lib/pleroma/emoji-data.txt
new file mode 100644
index 000000000..2fb5c3ff6
--- /dev/null
+++ b/lib/pleroma/emoji-data.txt
@@ -0,0 +1,769 @@
+# emoji-data.txt
+# Date: 2019-01-15, 12:10:05 GMT
+# © 2019 Unicode®, Inc.
+# Unicode and the Unicode Logo are registered trademarks of Unicode, Inc. in the U.S. and other countries.
+# For terms of use, see http://www.unicode.org/terms_of_use.html
+#
+# Emoji Data for UTS #51
+# Version: 12.0
+#
+# For documentation and usage, see http://www.unicode.org/reports/tr51
+#
+# Format:
+# <codepoint(s)> ; <property> # <comments>
+# Note: there is no guarantee as to the structure of whitespace or comments
+#
+# Characters and sequences are listed in code point order. Users should be shown a more natural order.
+# See the CLDR collation order for Emoji.
+
+
+# ================================================
+
+# All omitted code points have Emoji=No
+# @missing: 0000..10FFFF ; Emoji ; No
+
+0023 ; Emoji # 1.1 [1] (#️) number sign
+002A ; Emoji # 1.1 [1] (*️) asterisk
+0030..0039 ; Emoji # 1.1 [10] (0️..9️) digit zero..digit nine
+00A9 ; Emoji # 1.1 [1] (©️) copyright
+00AE ; Emoji # 1.1 [1] (®️) registered
+203C ; Emoji # 1.1 [1] (‼️) double exclamation mark
+2049 ; Emoji # 3.0 [1] (⁉️) exclamation question mark
+2122 ; Emoji # 1.1 [1] (™️) trade mark
+2139 ; Emoji # 3.0 [1] (ℹ️) information
+2194..2199 ; Emoji # 1.1 [6] (↔️..↙️) left-right arrow..down-left arrow
+21A9..21AA ; Emoji # 1.1 [2] (↩️..↪️) right arrow curving left..left arrow curving right
+231A..231B ; Emoji # 1.1 [2] (⌚..⌛) watch..hourglass done
+2328 ; Emoji # 1.1 [1] (⌨️) keyboard
+23CF ; Emoji # 4.0 [1] (⏏️) eject button
+23E9..23F3 ; Emoji # 6.0 [11] (⏩..⏳) fast-forward button..hourglass not done
+23F8..23FA ; Emoji # 7.0 [3] (⏸️..⏺️) pause button..record button
+24C2 ; Emoji # 1.1 [1] (Ⓜ️) circled M
+25AA..25AB ; Emoji # 1.1 [2] (▪️..▫️) black small square..white small square
+25B6 ; Emoji # 1.1 [1] (▶️) play button
+25C0 ; Emoji # 1.1 [1] (◀️) reverse button
+25FB..25FE ; Emoji # 3.2 [4] (◻️..◾) white medium square..black medium-small square
+2600..2604 ; Emoji # 1.1 [5] (☀️..☄️) sun..comet
+260E ; Emoji # 1.1 [1] (☎️) telephone
+2611 ; Emoji # 1.1 [1] (☑️) check box with check
+2614..2615 ; Emoji # 4.0 [2] (☔..☕) umbrella with rain drops..hot beverage
+2618 ; Emoji # 4.1 [1] (☘️) shamrock
+261D ; Emoji # 1.1 [1] (☝️) index pointing up
+2620 ; Emoji # 1.1 [1] (☠️) skull and crossbones
+2622..2623 ; Emoji # 1.1 [2] (☢️..☣️) radioactive..biohazard
+2626 ; Emoji # 1.1 [1] (☦️) orthodox cross
+262A ; Emoji # 1.1 [1] (☪️) star and crescent
+262E..262F ; Emoji # 1.1 [2] (☮️..☯️) peace symbol..yin yang
+2638..263A ; Emoji # 1.1 [3] (☸️..☺️) wheel of dharma..smiling face
+2640 ; Emoji # 1.1 [1] (♀️) female sign
+2642 ; Emoji # 1.1 [1] (♂️) male sign
+2648..2653 ; Emoji # 1.1 [12] (♈..♓) Aries..Pisces
+265F..2660 ; Emoji # 1.1 [2] (♟️..♠️) chess pawn..spade suit
+2663 ; Emoji # 1.1 [1] (♣️) club suit
+2665..2666 ; Emoji # 1.1 [2] (♥️..♦️) heart suit..diamond suit
+2668 ; Emoji # 1.1 [1] (♨️) hot springs
+267B ; Emoji # 3.2 [1] (♻️) recycling symbol
+267E..267F ; Emoji # 4.1 [2] (♾️..♿) infinity..wheelchair symbol
+2692..2697 ; Emoji # 4.1 [6] (⚒️..⚗️) hammer and pick..alembic
+2699 ; Emoji # 4.1 [1] (⚙️) gear
+269B..269C ; Emoji # 4.1 [2] (⚛️..⚜️) atom symbol..fleur-de-lis
+26A0..26A1 ; Emoji # 4.0 [2] (⚠️..⚡) warning..high voltage
+26AA..26AB ; Emoji # 4.1 [2] (⚪..⚫) white circle..black circle
+26B0..26B1 ; Emoji # 4.1 [2] (⚰️..⚱️) coffin..funeral urn
+26BD..26BE ; Emoji # 5.2 [2] (⚽..⚾) soccer ball..baseball
+26C4..26C5 ; Emoji # 5.2 [2] (⛄..⛅) snowman without snow..sun behind cloud
+26C8 ; Emoji # 5.2 [1] (⛈️) cloud with lightning and rain
+26CE ; Emoji # 6.0 [1] (⛎) Ophiuchus
+26CF ; Emoji # 5.2 [1] (⛏️) pick
+26D1 ; Emoji # 5.2 [1] (⛑️) rescue worker’s helmet
+26D3..26D4 ; Emoji # 5.2 [2] (⛓️..⛔) chains..no entry
+26E9..26EA ; Emoji # 5.2 [2] (⛩️..⛪) shinto shrine..church
+26F0..26F5 ; Emoji # 5.2 [6] (⛰️..⛵) mountain..sailboat
+26F7..26FA ; Emoji # 5.2 [4] (⛷️..⛺) skier..tent
+26FD ; Emoji # 5.2 [1] (⛽) fuel pump
+2702 ; Emoji # 1.1 [1] (✂️) scissors
+2705 ; Emoji # 6.0 [1] (✅) check mark button
+2708..2709 ; Emoji # 1.1 [2] (✈️..✉️) airplane..envelope
+270A..270B ; Emoji # 6.0 [2] (✊..✋) raised fist..raised hand
+270C..270D ; Emoji # 1.1 [2] (✌️..✍️) victory hand..writing hand
+270F ; Emoji # 1.1 [1] (✏️) pencil
+2712 ; Emoji # 1.1 [1] (✒️) black nib
+2714 ; Emoji # 1.1 [1] (✔️) check mark
+2716 ; Emoji # 1.1 [1] (✖️) multiplication sign
+271D ; Emoji # 1.1 [1] (✝️) latin cross
+2721 ; Emoji # 1.1 [1] (✡️) star of David
+2728 ; Emoji # 6.0 [1] (✨) sparkles
+2733..2734 ; Emoji # 1.1 [2] (✳️..✴️) eight-spoked asterisk..eight-pointed star
+2744 ; Emoji # 1.1 [1] (❄️) snowflake
+2747 ; Emoji # 1.1 [1] (❇️) sparkle
+274C ; Emoji # 6.0 [1] (❌) cross mark
+274E ; Emoji # 6.0 [1] (❎) cross mark button
+2753..2755 ; Emoji # 6.0 [3] (❓..❕) question mark..white exclamation mark
+2757 ; Emoji # 5.2 [1] (❗) exclamation mark
+2763..2764 ; Emoji # 1.1 [2] (❣️..❤️) heart exclamation..red heart
+2795..2797 ; Emoji # 6.0 [3] (➕..➗) plus sign..division sign
+27A1 ; Emoji # 1.1 [1] (➡️) right arrow
+27B0 ; Emoji # 6.0 [1] (➰) curly loop
+27BF ; Emoji # 6.0 [1] (➿) double curly loop
+2934..2935 ; Emoji # 3.2 [2] (⤴️..⤵️) right arrow curving up..right arrow curving down
+2B05..2B07 ; Emoji # 4.0 [3] (⬅️..⬇️) left arrow..down arrow
+2B1B..2B1C ; Emoji # 5.1 [2] (⬛..⬜) black large square..white large square
+2B50 ; Emoji # 5.1 [1] (⭐) star
+2B55 ; Emoji # 5.2 [1] (⭕) hollow red circle
+3030 ; Emoji # 1.1 [1] (〰️) wavy dash
+303D ; Emoji # 3.2 [1] (〽️) part alternation mark
+3297 ; Emoji # 1.1 [1] (㊗️) Japanese “congratulations” button
+3299 ; Emoji # 1.1 [1] (㊙️) Japanese “secret” button
+1F004 ; Emoji # 5.1 [1] (🀄) mahjong red dragon
+1F0CF ; Emoji # 6.0 [1] (🃏) joker
+1F170..1F171 ; Emoji # 6.0 [2] (🅰️..🅱️) A button (blood type)..B button (blood type)
+1F17E ; Emoji # 6.0 [1] (🅾️) O button (blood type)
+1F17F ; Emoji # 5.2 [1] (🅿️) P button
+1F18E ; Emoji # 6.0 [1] (🆎) AB button (blood type)
+1F191..1F19A ; Emoji # 6.0 [10] (🆑..🆚) CL button..VS button
+1F1E6..1F1FF ; Emoji # 6.0 [26] (🇦..🇿) regional indicator symbol letter a..regional indicator symbol letter z
+1F201..1F202 ; Emoji # 6.0 [2] (🈁..🈂️) Japanese “here” button..Japanese “service charge” button
+1F21A ; Emoji # 5.2 [1] (🈚) Japanese “free of charge” button
+1F22F ; Emoji # 5.2 [1] (🈯) Japanese “reserved” button
+1F232..1F23A ; Emoji # 6.0 [9] (🈲..🈺) Japanese “prohibited” button..Japanese “open for business” button
+1F250..1F251 ; Emoji # 6.0 [2] (🉐..🉑) Japanese “bargain” button..Japanese “acceptable” button
+1F300..1F320 ; Emoji # 6.0 [33] (🌀..🌠) cyclone..shooting star
+1F321 ; Emoji # 7.0 [1] (🌡️) thermometer
+1F324..1F32C ; Emoji # 7.0 [9] (🌤️..🌬️) sun behind small cloud..wind face
+1F32D..1F32F ; Emoji # 8.0 [3] (🌭..🌯) hot dog..burrito
+1F330..1F335 ; Emoji # 6.0 [6] (🌰..🌵) chestnut..cactus
+1F336 ; Emoji # 7.0 [1] (🌶️) hot pepper
+1F337..1F37C ; Emoji # 6.0 [70] (🌷..🍼) tulip..baby bottle
+1F37D ; Emoji # 7.0 [1] (🍽️) fork and knife with plate
+1F37E..1F37F ; Emoji # 8.0 [2] (🍾..🍿) bottle with popping cork..popcorn
+1F380..1F393 ; Emoji # 6.0 [20] (🎀..🎓) ribbon..graduation cap
+1F396..1F397 ; Emoji # 7.0 [2] (🎖️..🎗️) military medal..reminder ribbon
+1F399..1F39B ; Emoji # 7.0 [3] (🎙️..🎛️) studio microphone..control knobs
+1F39E..1F39F ; Emoji # 7.0 [2] (🎞️..🎟️) film frames..admission tickets
+1F3A0..1F3C4 ; Emoji # 6.0 [37] (🎠..🏄) carousel horse..person surfing
+1F3C5 ; Emoji # 7.0 [1] (🏅) sports medal
+1F3C6..1F3CA ; Emoji # 6.0 [5] (🏆..🏊) trophy..person swimming
+1F3CB..1F3CE ; Emoji # 7.0 [4] (🏋️..🏎️) person lifting weights..racing car
+1F3CF..1F3D3 ; Emoji # 8.0 [5] (🏏..🏓) cricket game..ping pong
+1F3D4..1F3DF ; Emoji # 7.0 [12] (🏔️..🏟️) snow-capped mountain..stadium
+1F3E0..1F3F0 ; Emoji # 6.0 [17] (🏠..🏰) house..castle
+1F3F3..1F3F5 ; Emoji # 7.0 [3] (🏳️..🏵️) white flag..rosette
+1F3F7 ; Emoji # 7.0 [1] (🏷️) label
+1F3F8..1F3FF ; Emoji # 8.0 [8] (🏸..🏿) badminton..dark skin tone
+1F400..1F43E ; Emoji # 6.0 [63] (🐀..🐾) rat..paw prints
+1F43F ; Emoji # 7.0 [1] (🐿️) chipmunk
+1F440 ; Emoji # 6.0 [1] (👀) eyes
+1F441 ; Emoji # 7.0 [1] (👁️) eye
+1F442..1F4F7 ; Emoji # 6.0[182] (👂..📷) ear..camera
+1F4F8 ; Emoji # 7.0 [1] (📸) camera with flash
+1F4F9..1F4FC ; Emoji # 6.0 [4] (📹..📼) video camera..videocassette
+1F4FD ; Emoji # 7.0 [1] (📽️) film projector
+1F4FF ; Emoji # 8.0 [1] (📿) prayer beads
+1F500..1F53D ; Emoji # 6.0 [62] (🔀..🔽) shuffle tracks button..downwards button
+1F549..1F54A ; Emoji # 7.0 [2] (🕉️..🕊️) om..dove
+1F54B..1F54E ; Emoji # 8.0 [4] (🕋..🕎) kaaba..menorah
+1F550..1F567 ; Emoji # 6.0 [24] (🕐..🕧) one o’clock..twelve-thirty
+1F56F..1F570 ; Emoji # 7.0 [2] (🕯️..🕰️) candle..mantelpiece clock
+1F573..1F579 ; Emoji # 7.0 [7] (🕳️..🕹️) hole..joystick
+1F57A ; Emoji # 9.0 [1] (🕺) man dancing
+1F587 ; Emoji # 7.0 [1] (🖇️) linked paperclips
+1F58A..1F58D ; Emoji # 7.0 [4] (🖊️..🖍️) pen..crayon
+1F590 ; Emoji # 7.0 [1] (🖐️) hand with fingers splayed
+1F595..1F596 ; Emoji # 7.0 [2] (🖕..🖖) middle finger..vulcan salute
+1F5A4 ; Emoji # 9.0 [1] (🖤) black heart
+1F5A5 ; Emoji # 7.0 [1] (🖥️) desktop computer
+1F5A8 ; Emoji # 7.0 [1] (🖨️) printer
+1F5B1..1F5B2 ; Emoji # 7.0 [2] (🖱️..🖲️) computer mouse..trackball
+1F5BC ; Emoji # 7.0 [1] (🖼️) framed picture
+1F5C2..1F5C4 ; Emoji # 7.0 [3] (🗂️..🗄️) card index dividers..file cabinet
+1F5D1..1F5D3 ; Emoji # 7.0 [3] (🗑️..🗓️) wastebasket..spiral calendar
+1F5DC..1F5DE ; Emoji # 7.0 [3] (🗜️..🗞️) clamp..rolled-up newspaper
+1F5E1 ; Emoji # 7.0 [1] (🗡️) dagger
+1F5E3 ; Emoji # 7.0 [1] (🗣️) speaking head
+1F5E8 ; Emoji # 7.0 [1] (🗨️) left speech bubble
+1F5EF ; Emoji # 7.0 [1] (🗯️) right anger bubble
+1F5F3 ; Emoji # 7.0 [1] (🗳️) ballot box with ballot
+1F5FA ; Emoji # 7.0 [1] (🗺️) world map
+1F5FB..1F5FF ; Emoji # 6.0 [5] (🗻..🗿) mount fuji..moai
+1F600 ; Emoji # 6.1 [1] (😀) grinning face
+1F601..1F610 ; Emoji # 6.0 [16] (😁..😐) beaming face with smiling eyes..neutral face
+1F611 ; Emoji # 6.1 [1] (😑) expressionless face
+1F612..1F614 ; Emoji # 6.0 [3] (😒..😔) unamused face..pensive face
+1F615 ; Emoji # 6.1 [1] (😕) confused face
+1F616 ; Emoji # 6.0 [1] (😖) confounded face
+1F617 ; Emoji # 6.1 [1] (😗) kissing face
+1F618 ; Emoji # 6.0 [1] (😘) face blowing a kiss
+1F619 ; Emoji # 6.1 [1] (😙) kissing face with smiling eyes
+1F61A ; Emoji # 6.0 [1] (😚) kissing face with closed eyes
+1F61B ; Emoji # 6.1 [1] (😛) face with tongue
+1F61C..1F61E ; Emoji # 6.0 [3] (😜..😞) winking face with tongue..disappointed face
+1F61F ; Emoji # 6.1 [1] (😟) worried face
+1F620..1F625 ; Emoji # 6.0 [6] (😠..😥) angry face..sad but relieved face
+1F626..1F627 ; Emoji # 6.1 [2] (😦..😧) frowning face with open mouth..anguished face
+1F628..1F62B ; Emoji # 6.0 [4] (😨..😫) fearful face..tired face
+1F62C ; Emoji # 6.1 [1] (😬) grimacing face
+1F62D ; Emoji # 6.0 [1] (😭) loudly crying face
+1F62E..1F62F ; Emoji # 6.1 [2] (😮..😯) face with open mouth..hushed face
+1F630..1F633 ; Emoji # 6.0 [4] (😰..😳) anxious face with sweat..flushed face
+1F634 ; Emoji # 6.1 [1] (😴) sleeping face
+1F635..1F640 ; Emoji # 6.0 [12] (😵..🙀) dizzy face..weary cat
+1F641..1F642 ; Emoji # 7.0 [2] (🙁..🙂) slightly frowning face..slightly smiling face
+1F643..1F644 ; Emoji # 8.0 [2] (🙃..🙄) upside-down face..face with rolling eyes
+1F645..1F64F ; Emoji # 6.0 [11] (🙅..🙏) person gesturing NO..folded hands
+1F680..1F6C5 ; Emoji # 6.0 [70] (🚀..🛅) rocket..left luggage
+1F6CB..1F6CF ; Emoji # 7.0 [5] (🛋️..🛏️) couch and lamp..bed
+1F6D0 ; Emoji # 8.0 [1] (🛐) place of worship
+1F6D1..1F6D2 ; Emoji # 9.0 [2] (🛑..🛒) stop sign..shopping cart
+1F6D5 ; Emoji # 12.0 [1] (🛕) hindu temple
+1F6E0..1F6E5 ; Emoji # 7.0 [6] (🛠️..🛥️) hammer and wrench..motor boat
+1F6E9 ; Emoji # 7.0 [1] (🛩️) small airplane
+1F6EB..1F6EC ; Emoji # 7.0 [2] (🛫..🛬) airplane departure..airplane arrival
+1F6F0 ; Emoji # 7.0 [1] (🛰️) satellite
+1F6F3 ; Emoji # 7.0 [1] (🛳️) passenger ship
+1F6F4..1F6F6 ; Emoji # 9.0 [3] (🛴..🛶) kick scooter..canoe
+1F6F7..1F6F8 ; Emoji # 10.0 [2] (🛷..🛸) sled..flying saucer
+1F6F9 ; Emoji # 11.0 [1] (🛹) skateboard
+1F6FA ; Emoji # 12.0 [1] (🛺) auto rickshaw
+1F7E0..1F7EB ; Emoji # 12.0 [12] (🟠..🟫) orange circle..brown square
+1F90D..1F90F ; Emoji # 12.0 [3] (🤍..🤏) white heart..pinching hand
+1F910..1F918 ; Emoji # 8.0 [9] (🤐..🤘) zipper-mouth face..sign of the horns
+1F919..1F91E ; Emoji # 9.0 [6] (🤙..🤞) call me hand..crossed fingers
+1F91F ; Emoji # 10.0 [1] (🤟) love-you gesture
+1F920..1F927 ; Emoji # 9.0 [8] (🤠..🤧) cowboy hat face..sneezing face
+1F928..1F92F ; Emoji # 10.0 [8] (🤨..🤯) face with raised eyebrow..exploding head
+1F930 ; Emoji # 9.0 [1] (🤰) pregnant woman
+1F931..1F932 ; Emoji # 10.0 [2] (🤱..🤲) breast-feeding..palms up together
+1F933..1F93A ; Emoji # 9.0 [8] (🤳..🤺) selfie..person fencing
+1F93C..1F93E ; Emoji # 9.0 [3] (🤼..🤾) people wrestling..person playing handball
+1F93F ; Emoji # 12.0 [1] (🤿) diving mask
+1F940..1F945 ; Emoji # 9.0 [6] (🥀..🥅) wilted flower..goal net
+1F947..1F94B ; Emoji # 9.0 [5] (🥇..🥋) 1st place medal..martial arts uniform
+1F94C ; Emoji # 10.0 [1] (🥌) curling stone
+1F94D..1F94F ; Emoji # 11.0 [3] (🥍..🥏) lacrosse..flying disc
+1F950..1F95E ; Emoji # 9.0 [15] (🥐..🥞) croissant..pancakes
+1F95F..1F96B ; Emoji # 10.0 [13] (🥟..🥫) dumpling..canned food
+1F96C..1F970 ; Emoji # 11.0 [5] (🥬..🥰) leafy green..smiling face with hearts
+1F971 ; Emoji # 12.0 [1] (🥱) yawning face
+1F973..1F976 ; Emoji # 11.0 [4] (🥳..🥶) partying face..cold face
+1F97A ; Emoji # 11.0 [1] (🥺) pleading face
+1F97B ; Emoji # 12.0 [1] (🥻) sari
+1F97C..1F97F ; Emoji # 11.0 [4] (🥼..🥿) lab coat..flat shoe
+1F980..1F984 ; Emoji # 8.0 [5] (🦀..🦄) crab..unicorn
+1F985..1F991 ; Emoji # 9.0 [13] (🦅..🦑) eagle..squid
+1F992..1F997 ; Emoji # 10.0 [6] (🦒..🦗) giraffe..cricket
+1F998..1F9A2 ; Emoji # 11.0 [11] (🦘..🦢) kangaroo..swan
+1F9A5..1F9AA ; Emoji # 12.0 [6] (🦥..🦪) sloth..oyster
+1F9AE..1F9AF ; Emoji # 12.0 [2] (🦮..🦯) guide dog..probing cane
+1F9B0..1F9B9 ; Emoji # 11.0 [10] (🦰..🦹) red hair..supervillain
+1F9BA..1F9BF ; Emoji # 12.0 [6] (🦺..🦿) safety vest..mechanical leg
+1F9C0 ; Emoji # 8.0 [1] (🧀) cheese wedge
+1F9C1..1F9C2 ; Emoji # 11.0 [2] (🧁..🧂) cupcake..salt
+1F9C3..1F9CA ; Emoji # 12.0 [8] (🧃..🧊) beverage box..ice cube
+1F9CD..1F9CF ; Emoji # 12.0 [3] (🧍..🧏) person standing..deaf person
+1F9D0..1F9E6 ; Emoji # 10.0 [23] (🧐..🧦) face with monocle..socks
+1F9E7..1F9FF ; Emoji # 11.0 [25] (🧧..🧿) red envelope..nazar amulet
+1FA70..1FA73 ; Emoji # 12.0 [4] (🩰..🩳) ballet shoes..shorts
+1FA78..1FA7A ; Emoji # 12.0 [3] (🩸..🩺) drop of blood..stethoscope
+1FA80..1FA82 ; Emoji # 12.0 [3] (🪀..🪂) yo-yo..parachute
+1FA90..1FA95 ; Emoji # 12.0 [6] (🪐..🪕) ringed planet..banjo
+
+# Total elements: 1311
+
+# ================================================
+
+# All omitted code points have Emoji_Presentation=No
+# @missing: 0000..10FFFF ; Emoji_Presentation ; No
+
+231A..231B ; Emoji_Presentation # 1.1 [2] (⌚..⌛) watch..hourglass done
+23E9..23EC ; Emoji_Presentation # 6.0 [4] (⏩..⏬) fast-forward button..fast down button
+23F0 ; Emoji_Presentation # 6.0 [1] (⏰) alarm clock
+23F3 ; Emoji_Presentation # 6.0 [1] (⏳) hourglass not done
+25FD..25FE ; Emoji_Presentation # 3.2 [2] (◽..◾) white medium-small square..black medium-small square
+2614..2615 ; Emoji_Presentation # 4.0 [2] (☔..☕) umbrella with rain drops..hot beverage
+2648..2653 ; Emoji_Presentation # 1.1 [12] (♈..♓) Aries..Pisces
+267F ; Emoji_Presentation # 4.1 [1] (♿) wheelchair symbol
+2693 ; Emoji_Presentation # 4.1 [1] (⚓) anchor
+26A1 ; Emoji_Presentation # 4.0 [1] (⚡) high voltage
+26AA..26AB ; Emoji_Presentation # 4.1 [2] (⚪..⚫) white circle..black circle
+26BD..26BE ; Emoji_Presentation # 5.2 [2] (⚽..⚾) soccer ball..baseball
+26C4..26C5 ; Emoji_Presentation # 5.2 [2] (⛄..⛅) snowman without snow..sun behind cloud
+26CE ; Emoji_Presentation # 6.0 [1] (⛎) Ophiuchus
+26D4 ; Emoji_Presentation # 5.2 [1] (⛔) no entry
+26EA ; Emoji_Presentation # 5.2 [1] (⛪) church
+26F2..26F3 ; Emoji_Presentation # 5.2 [2] (⛲..⛳) fountain..flag in hole
+26F5 ; Emoji_Presentation # 5.2 [1] (⛵) sailboat
+26FA ; Emoji_Presentation # 5.2 [1] (⛺) tent
+26FD ; Emoji_Presentation # 5.2 [1] (⛽) fuel pump
+2705 ; Emoji_Presentation # 6.0 [1] (✅) check mark button
+270A..270B ; Emoji_Presentation # 6.0 [2] (✊..✋) raised fist..raised hand
+2728 ; Emoji_Presentation # 6.0 [1] (✨) sparkles
+274C ; Emoji_Presentation # 6.0 [1] (❌) cross mark
+274E ; Emoji_Presentation # 6.0 [1] (❎) cross mark button
+2753..2755 ; Emoji_Presentation # 6.0 [3] (❓..❕) question mark..white exclamation mark
+2757 ; Emoji_Presentation # 5.2 [1] (❗) exclamation mark
+2795..2797 ; Emoji_Presentation # 6.0 [3] (➕..➗) plus sign..division sign
+27B0 ; Emoji_Presentation # 6.0 [1] (➰) curly loop
+27BF ; Emoji_Presentation # 6.0 [1] (➿) double curly loop
+2B1B..2B1C ; Emoji_Presentation # 5.1 [2] (⬛..⬜) black large square..white large square
+2B50 ; Emoji_Presentation # 5.1 [1] (⭐) star
+2B55 ; Emoji_Presentation # 5.2 [1] (⭕) hollow red circle
+1F004 ; Emoji_Presentation # 5.1 [1] (🀄) mahjong red dragon
+1F0CF ; Emoji_Presentation # 6.0 [1] (🃏) joker
+1F18E ; Emoji_Presentation # 6.0 [1] (🆎) AB button (blood type)
+1F191..1F19A ; Emoji_Presentation # 6.0 [10] (🆑..🆚) CL button..VS button
+1F1E6..1F1FF ; Emoji_Presentation # 6.0 [26] (🇦..🇿) regional indicator symbol letter a..regional indicator symbol letter z
+1F201 ; Emoji_Presentation # 6.0 [1] (🈁) Japanese “here” button
+1F21A ; Emoji_Presentation # 5.2 [1] (🈚) Japanese “free of charge” button
+1F22F ; Emoji_Presentation # 5.2 [1] (🈯) Japanese “reserved” button
+1F232..1F236 ; Emoji_Presentation # 6.0 [5] (🈲..🈶) Japanese “prohibited” button..Japanese “not free of charge” button
+1F238..1F23A ; Emoji_Presentation # 6.0 [3] (🈸..🈺) Japanese “application” button..Japanese “open for business” button
+1F250..1F251 ; Emoji_Presentation # 6.0 [2] (🉐..🉑) Japanese “bargain” button..Japanese “acceptable” button
+1F300..1F320 ; Emoji_Presentation # 6.0 [33] (🌀..🌠) cyclone..shooting star
+1F32D..1F32F ; Emoji_Presentation # 8.0 [3] (🌭..🌯) hot dog..burrito
+1F330..1F335 ; Emoji_Presentation # 6.0 [6] (🌰..🌵) chestnut..cactus
+1F337..1F37C ; Emoji_Presentation # 6.0 [70] (🌷..🍼) tulip..baby bottle
+1F37E..1F37F ; Emoji_Presentation # 8.0 [2] (🍾..🍿) bottle with popping cork..popcorn
+1F380..1F393 ; Emoji_Presentation # 6.0 [20] (🎀..🎓) ribbon..graduation cap
+1F3A0..1F3C4 ; Emoji_Presentation # 6.0 [37] (🎠..🏄) carousel horse..person surfing
+1F3C5 ; Emoji_Presentation # 7.0 [1] (🏅) sports medal
+1F3C6..1F3CA ; Emoji_Presentation # 6.0 [5] (🏆..🏊) trophy..person swimming
+1F3CF..1F3D3 ; Emoji_Presentation # 8.0 [5] (🏏..🏓) cricket game..ping pong
+1F3E0..1F3F0 ; Emoji_Presentation # 6.0 [17] (🏠..🏰) house..castle
+1F3F4 ; Emoji_Presentation # 7.0 [1] (🏴) black flag
+1F3F8..1F3FF ; Emoji_Presentation # 8.0 [8] (🏸..🏿) badminton..dark skin tone
+1F400..1F43E ; Emoji_Presentation # 6.0 [63] (🐀..🐾) rat..paw prints
+1F440 ; Emoji_Presentation # 6.0 [1] (👀) eyes
+1F442..1F4F7 ; Emoji_Presentation # 6.0[182] (👂..📷) ear..camera
+1F4F8 ; Emoji_Presentation # 7.0 [1] (📸) camera with flash
+1F4F9..1F4FC ; Emoji_Presentation # 6.0 [4] (📹..📼) video camera..videocassette
+1F4FF ; Emoji_Presentation # 8.0 [1] (📿) prayer beads
+1F500..1F53D ; Emoji_Presentation # 6.0 [62] (🔀..🔽) shuffle tracks button..downwards button
+1F54B..1F54E ; Emoji_Presentation # 8.0 [4] (🕋..🕎) kaaba..menorah
+1F550..1F567 ; Emoji_Presentation # 6.0 [24] (🕐..🕧) one o’clock..twelve-thirty
+1F57A ; Emoji_Presentation # 9.0 [1] (🕺) man dancing
+1F595..1F596 ; Emoji_Presentation # 7.0 [2] (🖕..🖖) middle finger..vulcan salute
+1F5A4 ; Emoji_Presentation # 9.0 [1] (🖤) black heart
+1F5FB..1F5FF ; Emoji_Presentation # 6.0 [5] (🗻..🗿) mount fuji..moai
+1F600 ; Emoji_Presentation # 6.1 [1] (😀) grinning face
+1F601..1F610 ; Emoji_Presentation # 6.0 [16] (😁..😐) beaming face with smiling eyes..neutral face
+1F611 ; Emoji_Presentation # 6.1 [1] (😑) expressionless face
+1F612..1F614 ; Emoji_Presentation # 6.0 [3] (😒..😔) unamused face..pensive face
+1F615 ; Emoji_Presentation # 6.1 [1] (😕) confused face
+1F616 ; Emoji_Presentation # 6.0 [1] (😖) confounded face
+1F617 ; Emoji_Presentation # 6.1 [1] (😗) kissing face
+1F618 ; Emoji_Presentation # 6.0 [1] (😘) face blowing a kiss
+1F619 ; Emoji_Presentation # 6.1 [1] (😙) kissing face with smiling eyes
+1F61A ; Emoji_Presentation # 6.0 [1] (😚) kissing face with closed eyes
+1F61B ; Emoji_Presentation # 6.1 [1] (😛) face with tongue
+1F61C..1F61E ; Emoji_Presentation # 6.0 [3] (😜..😞) winking face with tongue..disappointed face
+1F61F ; Emoji_Presentation # 6.1 [1] (😟) worried face
+1F620..1F625 ; Emoji_Presentation # 6.0 [6] (😠..😥) angry face..sad but relieved face
+1F626..1F627 ; Emoji_Presentation # 6.1 [2] (😦..😧) frowning face with open mouth..anguished face
+1F628..1F62B ; Emoji_Presentation # 6.0 [4] (😨..😫) fearful face..tired face
+1F62C ; Emoji_Presentation # 6.1 [1] (😬) grimacing face
+1F62D ; Emoji_Presentation # 6.0 [1] (😭) loudly crying face
+1F62E..1F62F ; Emoji_Presentation # 6.1 [2] (😮..😯) face with open mouth..hushed face
+1F630..1F633 ; Emoji_Presentation # 6.0 [4] (😰..😳) anxious face with sweat..flushed face
+1F634 ; Emoji_Presentation # 6.1 [1] (😴) sleeping face
+1F635..1F640 ; Emoji_Presentation # 6.0 [12] (😵..🙀) dizzy face..weary cat
+1F641..1F642 ; Emoji_Presentation # 7.0 [2] (🙁..🙂) slightly frowning face..slightly smiling face
+1F643..1F644 ; Emoji_Presentation # 8.0 [2] (🙃..🙄) upside-down face..face with rolling eyes
+1F645..1F64F ; Emoji_Presentation # 6.0 [11] (🙅..🙏) person gesturing NO..folded hands
+1F680..1F6C5 ; Emoji_Presentation # 6.0 [70] (🚀..🛅) rocket..left luggage
+1F6CC ; Emoji_Presentation # 7.0 [1] (🛌) person in bed
+1F6D0 ; Emoji_Presentation # 8.0 [1] (🛐) place of worship
+1F6D1..1F6D2 ; Emoji_Presentation # 9.0 [2] (🛑..🛒) stop sign..shopping cart
+1F6D5 ; Emoji_Presentation # 12.0 [1] (🛕) hindu temple
+1F6EB..1F6EC ; Emoji_Presentation # 7.0 [2] (🛫..🛬) airplane departure..airplane arrival
+1F6F4..1F6F6 ; Emoji_Presentation # 9.0 [3] (🛴..🛶) kick scooter..canoe
+1F6F7..1F6F8 ; Emoji_Presentation # 10.0 [2] (🛷..🛸) sled..flying saucer
+1F6F9 ; Emoji_Presentation # 11.0 [1] (🛹) skateboard
+1F6FA ; Emoji_Presentation # 12.0 [1] (🛺) auto rickshaw
+1F7E0..1F7EB ; Emoji_Presentation # 12.0 [12] (🟠..🟫) orange circle..brown square
+1F90D..1F90F ; Emoji_Presentation # 12.0 [3] (🤍..🤏) white heart..pinching hand
+1F910..1F918 ; Emoji_Presentation # 8.0 [9] (🤐..🤘) zipper-mouth face..sign of the horns
+1F919..1F91E ; Emoji_Presentation # 9.0 [6] (🤙..🤞) call me hand..crossed fingers
+1F91F ; Emoji_Presentation # 10.0 [1] (🤟) love-you gesture
+1F920..1F927 ; Emoji_Presentation # 9.0 [8] (🤠..🤧) cowboy hat face..sneezing face
+1F928..1F92F ; Emoji_Presentation # 10.0 [8] (🤨..🤯) face with raised eyebrow..exploding head
+1F930 ; Emoji_Presentation # 9.0 [1] (🤰) pregnant woman
+1F931..1F932 ; Emoji_Presentation # 10.0 [2] (🤱..🤲) breast-feeding..palms up together
+1F933..1F93A ; Emoji_Presentation # 9.0 [8] (🤳..🤺) selfie..person fencing
+1F93C..1F93E ; Emoji_Presentation # 9.0 [3] (🤼..🤾) people wrestling..person playing handball
+1F93F ; Emoji_Presentation # 12.0 [1] (🤿) diving mask
+1F940..1F945 ; Emoji_Presentation # 9.0 [6] (🥀..🥅) wilted flower..goal net
+1F947..1F94B ; Emoji_Presentation # 9.0 [5] (🥇..🥋) 1st place medal..martial arts uniform
+1F94C ; Emoji_Presentation # 10.0 [1] (🥌) curling stone
+1F94D..1F94F ; Emoji_Presentation # 11.0 [3] (🥍..🥏) lacrosse..flying disc
+1F950..1F95E ; Emoji_Presentation # 9.0 [15] (🥐..🥞) croissant..pancakes
+1F95F..1F96B ; Emoji_Presentation # 10.0 [13] (🥟..🥫) dumpling..canned food
+1F96C..1F970 ; Emoji_Presentation # 11.0 [5] (🥬..🥰) leafy green..smiling face with hearts
+1F971 ; Emoji_Presentation # 12.0 [1] (🥱) yawning face
+1F973..1F976 ; Emoji_Presentation # 11.0 [4] (🥳..🥶) partying face..cold face
+1F97A ; Emoji_Presentation # 11.0 [1] (🥺) pleading face
+1F97B ; Emoji_Presentation # 12.0 [1] (🥻) sari
+1F97C..1F97F ; Emoji_Presentation # 11.0 [4] (🥼..🥿) lab coat..flat shoe
+1F980..1F984 ; Emoji_Presentation # 8.0 [5] (🦀..🦄) crab..unicorn
+1F985..1F991 ; Emoji_Presentation # 9.0 [13] (🦅..🦑) eagle..squid
+1F992..1F997 ; Emoji_Presentation # 10.0 [6] (🦒..🦗) giraffe..cricket
+1F998..1F9A2 ; Emoji_Presentation # 11.0 [11] (🦘..🦢) kangaroo..swan
+1F9A5..1F9AA ; Emoji_Presentation # 12.0 [6] (🦥..🦪) sloth..oyster
+1F9AE..1F9AF ; Emoji_Presentation # 12.0 [2] (🦮..🦯) guide dog..probing cane
+1F9B0..1F9B9 ; Emoji_Presentation # 11.0 [10] (🦰..🦹) red hair..supervillain
+1F9BA..1F9BF ; Emoji_Presentation # 12.0 [6] (🦺..🦿) safety vest..mechanical leg
+1F9C0 ; Emoji_Presentation # 8.0 [1] (🧀) cheese wedge
+1F9C1..1F9C2 ; Emoji_Presentation # 11.0 [2] (🧁..🧂) cupcake..salt
+1F9C3..1F9CA ; Emoji_Presentation # 12.0 [8] (🧃..🧊) beverage box..ice cube
+1F9CD..1F9CF ; Emoji_Presentation # 12.0 [3] (🧍..🧏) person standing..deaf person
+1F9D0..1F9E6 ; Emoji_Presentation # 10.0 [23] (🧐..🧦) face with monocle..socks
+1F9E7..1F9FF ; Emoji_Presentation # 11.0 [25] (🧧..🧿) red envelope..nazar amulet
+1FA70..1FA73 ; Emoji_Presentation # 12.0 [4] (🩰..🩳) ballet shoes..shorts
+1FA78..1FA7A ; Emoji_Presentation # 12.0 [3] (🩸..🩺) drop of blood..stethoscope
+1FA80..1FA82 ; Emoji_Presentation # 12.0 [3] (🪀..🪂) yo-yo..parachute
+1FA90..1FA95 ; Emoji_Presentation # 12.0 [6] (🪐..🪕) ringed planet..banjo
+
+# Total elements: 1093
+
+# ================================================
+
+# All omitted code points have Emoji_Modifier=No
+# @missing: 0000..10FFFF ; Emoji_Modifier ; No
+
+1F3FB..1F3FF ; Emoji_Modifier # 8.0 [5] (🏻..🏿) light skin tone..dark skin tone
+
+# Total elements: 5
+
+# ================================================
+
+# All omitted code points have Emoji_Modifier_Base=No
+# @missing: 0000..10FFFF ; Emoji_Modifier_Base ; No
+
+261D ; Emoji_Modifier_Base # 1.1 [1] (☝️) index pointing up
+26F9 ; Emoji_Modifier_Base # 5.2 [1] (⛹️) person bouncing ball
+270A..270B ; Emoji_Modifier_Base # 6.0 [2] (✊..✋) raised fist..raised hand
+270C..270D ; Emoji_Modifier_Base # 1.1 [2] (✌️..✍️) victory hand..writing hand
+1F385 ; Emoji_Modifier_Base # 6.0 [1] (🎅) Santa Claus
+1F3C2..1F3C4 ; Emoji_Modifier_Base # 6.0 [3] (🏂..🏄) snowboarder..person surfing
+1F3C7 ; Emoji_Modifier_Base # 6.0 [1] (🏇) horse racing
+1F3CA ; Emoji_Modifier_Base # 6.0 [1] (🏊) person swimming
+1F3CB..1F3CC ; Emoji_Modifier_Base # 7.0 [2] (🏋️..🏌️) person lifting weights..person golfing
+1F442..1F443 ; Emoji_Modifier_Base # 6.0 [2] (👂..👃) ear..nose
+1F446..1F450 ; Emoji_Modifier_Base # 6.0 [11] (👆..👐) backhand index pointing up..open hands
+1F466..1F478 ; Emoji_Modifier_Base # 6.0 [19] (👦..👸) boy..princess
+1F47C ; Emoji_Modifier_Base # 6.0 [1] (👼) baby angel
+1F481..1F483 ; Emoji_Modifier_Base # 6.0 [3] (💁..💃) person tipping hand..woman dancing
+1F485..1F487 ; Emoji_Modifier_Base # 6.0 [3] (💅..💇) nail polish..person getting haircut
+1F48F ; Emoji_Modifier_Base # 6.0 [1] (💏) kiss
+1F491 ; Emoji_Modifier_Base # 6.0 [1] (💑) couple with heart
+1F4AA ; Emoji_Modifier_Base # 6.0 [1] (💪) flexed biceps
+1F574..1F575 ; Emoji_Modifier_Base # 7.0 [2] (🕴️..🕵️) man in suit levitating..detective
+1F57A ; Emoji_Modifier_Base # 9.0 [1] (🕺) man dancing
+1F590 ; Emoji_Modifier_Base # 7.0 [1] (🖐️) hand with fingers splayed
+1F595..1F596 ; Emoji_Modifier_Base # 7.0 [2] (🖕..🖖) middle finger..vulcan salute
+1F645..1F647 ; Emoji_Modifier_Base # 6.0 [3] (🙅..🙇) person gesturing NO..person bowing
+1F64B..1F64F ; Emoji_Modifier_Base # 6.0 [5] (🙋..🙏) person raising hand..folded hands
+1F6A3 ; Emoji_Modifier_Base # 6.0 [1] (🚣) person rowing boat
+1F6B4..1F6B6 ; Emoji_Modifier_Base # 6.0 [3] (🚴..🚶) person biking..person walking
+1F6C0 ; Emoji_Modifier_Base # 6.0 [1] (🛀) person taking bath
+1F6CC ; Emoji_Modifier_Base # 7.0 [1] (🛌) person in bed
+1F90F ; Emoji_Modifier_Base # 12.0 [1] (🤏) pinching hand
+1F918 ; Emoji_Modifier_Base # 8.0 [1] (🤘) sign of the horns
+1F919..1F91E ; Emoji_Modifier_Base # 9.0 [6] (🤙..🤞) call me hand..crossed fingers
+1F91F ; Emoji_Modifier_Base # 10.0 [1] (🤟) love-you gesture
+1F926 ; Emoji_Modifier_Base # 9.0 [1] (🤦) person facepalming
+1F930 ; Emoji_Modifier_Base # 9.0 [1] (🤰) pregnant woman
+1F931..1F932 ; Emoji_Modifier_Base # 10.0 [2] (🤱..🤲) breast-feeding..palms up together
+1F933..1F939 ; Emoji_Modifier_Base # 9.0 [7] (🤳..🤹) selfie..person juggling
+1F93C..1F93E ; Emoji_Modifier_Base # 9.0 [3] (🤼..🤾) people wrestling..person playing handball
+1F9B5..1F9B6 ; Emoji_Modifier_Base # 11.0 [2] (🦵..🦶) leg..foot
+1F9B8..1F9B9 ; Emoji_Modifier_Base # 11.0 [2] (🦸..🦹) superhero..supervillain
+1F9BB ; Emoji_Modifier_Base # 12.0 [1] (🦻) ear with hearing aid
+1F9CD..1F9CF ; Emoji_Modifier_Base # 12.0 [3] (🧍..🧏) person standing..deaf person
+1F9D1..1F9DD ; Emoji_Modifier_Base # 10.0 [13] (🧑..🧝) person..elf
+
+# Total elements: 120
+
+# ================================================
+
+# All omitted code points have Emoji_Component=No
+# @missing: 0000..10FFFF ; Emoji_Component ; No
+
+0023 ; Emoji_Component # 1.1 [1] (#️) number sign
+002A ; Emoji_Component # 1.1 [1] (*️) asterisk
+0030..0039 ; Emoji_Component # 1.1 [10] (0️..9️) digit zero..digit nine
+200D ; Emoji_Component # 1.1 [1] (‍) zero width joiner
+20E3 ; Emoji_Component # 3.0 [1] (⃣) combining enclosing keycap
+FE0F ; Emoji_Component # 3.2 [1] () VARIATION SELECTOR-16
+1F1E6..1F1FF ; Emoji_Component # 6.0 [26] (🇦..🇿) regional indicator symbol letter a..regional indicator symbol letter z
+1F3FB..1F3FF ; Emoji_Component # 8.0 [5] (🏻..🏿) light skin tone..dark skin tone
+1F9B0..1F9B3 ; Emoji_Component # 11.0 [4] (🦰..🦳) red hair..white hair
+E0020..E007F ; Emoji_Component # 3.1 [96] (󠀠..󠁿) tag space..cancel tag
+
+# Total elements: 146
+
+# ================================================
+
+# All omitted code points have Extended_Pictographic=No
+# @missing: 0000..10FFFF ; Extended_Pictographic ; No
+
+00A9 ; Extended_Pictographic# 1.1 [1] (©️) copyright
+00AE ; Extended_Pictographic# 1.1 [1] (®️) registered
+203C ; Extended_Pictographic# 1.1 [1] (‼️) double exclamation mark
+2049 ; Extended_Pictographic# 3.0 [1] (⁉️) exclamation question mark
+2122 ; Extended_Pictographic# 1.1 [1] (™️) trade mark
+2139 ; Extended_Pictographic# 3.0 [1] (ℹ️) information
+2194..2199 ; Extended_Pictographic# 1.1 [6] (↔️..↙️) left-right arrow..down-left arrow
+21A9..21AA ; Extended_Pictographic# 1.1 [2] (↩️..↪️) right arrow curving left..left arrow curving right
+231A..231B ; Extended_Pictographic# 1.1 [2] (⌚..⌛) watch..hourglass done
+2328 ; Extended_Pictographic# 1.1 [1] (⌨️) keyboard
+2388 ; Extended_Pictographic# 3.0 [1] (⎈) HELM SYMBOL
+23CF ; Extended_Pictographic# 4.0 [1] (⏏️) eject button
+23E9..23F3 ; Extended_Pictographic# 6.0 [11] (⏩..⏳) fast-forward button..hourglass not done
+23F8..23FA ; Extended_Pictographic# 7.0 [3] (⏸️..⏺️) pause button..record button
+24C2 ; Extended_Pictographic# 1.1 [1] (Ⓜ️) circled M
+25AA..25AB ; Extended_Pictographic# 1.1 [2] (▪️..▫️) black small square..white small square
+25B6 ; Extended_Pictographic# 1.1 [1] (▶️) play button
+25C0 ; Extended_Pictographic# 1.1 [1] (◀️) reverse button
+25FB..25FE ; Extended_Pictographic# 3.2 [4] (◻️..◾) white medium square..black medium-small square
+2600..2605 ; Extended_Pictographic# 1.1 [6] (☀️..★) sun..BLACK STAR
+2607..2612 ; Extended_Pictographic# 1.1 [12] (☇..☒) LIGHTNING..BALLOT BOX WITH X
+2614..2615 ; Extended_Pictographic# 4.0 [2] (☔..☕) umbrella with rain drops..hot beverage
+2616..2617 ; Extended_Pictographic# 3.2 [2] (☖..☗) WHITE SHOGI PIECE..BLACK SHOGI PIECE
+2618 ; Extended_Pictographic# 4.1 [1] (☘️) shamrock
+2619 ; Extended_Pictographic# 3.0 [1] (☙) REVERSED ROTATED FLORAL HEART BULLET
+261A..266F ; Extended_Pictographic# 1.1 [86] (☚..♯) BLACK LEFT POINTING INDEX..MUSIC SHARP SIGN
+2670..2671 ; Extended_Pictographic# 3.0 [2] (♰..♱) WEST SYRIAC CROSS..EAST SYRIAC CROSS
+2672..267D ; Extended_Pictographic# 3.2 [12] (♲..♽) UNIVERSAL RECYCLING SYMBOL..PARTIALLY-RECYCLED PAPER SYMBOL
+267E..267F ; Extended_Pictographic# 4.1 [2] (♾️..♿) infinity..wheelchair symbol
+2680..2685 ; Extended_Pictographic# 3.2 [6] (⚀..⚅) DIE FACE-1..DIE FACE-6
+2690..2691 ; Extended_Pictographic# 4.0 [2] (⚐..⚑) WHITE FLAG..BLACK FLAG
+2692..269C ; Extended_Pictographic# 4.1 [11] (⚒️..⚜️) hammer and pick..fleur-de-lis
+269D ; Extended_Pictographic# 5.1 [1] (⚝) OUTLINED WHITE STAR
+269E..269F ; Extended_Pictographic# 5.2 [2] (⚞..⚟) THREE LINES CONVERGING RIGHT..THREE LINES CONVERGING LEFT
+26A0..26A1 ; Extended_Pictographic# 4.0 [2] (⚠️..⚡) warning..high voltage
+26A2..26B1 ; Extended_Pictographic# 4.1 [16] (⚢..⚱️) DOUBLED FEMALE SIGN..funeral urn
+26B2 ; Extended_Pictographic# 5.0 [1] (⚲) NEUTER
+26B3..26BC ; Extended_Pictographic# 5.1 [10] (⚳..⚼) CERES..SESQUIQUADRATE
+26BD..26BF ; Extended_Pictographic# 5.2 [3] (⚽..⚿) soccer ball..SQUARED KEY
+26C0..26C3 ; Extended_Pictographic# 5.1 [4] (⛀..⛃) WHITE DRAUGHTS MAN..BLACK DRAUGHTS KING
+26C4..26CD ; Extended_Pictographic# 5.2 [10] (⛄..⛍) snowman without snow..DISABLED CAR
+26CE ; Extended_Pictographic# 6.0 [1] (⛎) Ophiuchus
+26CF..26E1 ; Extended_Pictographic# 5.2 [19] (⛏️..⛡) pick..RESTRICTED LEFT ENTRY-2
+26E2 ; Extended_Pictographic# 6.0 [1] (⛢) ASTRONOMICAL SYMBOL FOR URANUS
+26E3 ; Extended_Pictographic# 5.2 [1] (⛣) HEAVY CIRCLE WITH STROKE AND TWO DOTS ABOVE
+26E4..26E7 ; Extended_Pictographic# 6.0 [4] (⛤..⛧) PENTAGRAM..INVERTED PENTAGRAM
+26E8..26FF ; Extended_Pictographic# 5.2 [24] (⛨..⛿) BLACK CROSS ON SHIELD..WHITE FLAG WITH HORIZONTAL MIDDLE BLACK STRIPE
+2700 ; Extended_Pictographic# 7.0 [1] (✀) BLACK SAFETY SCISSORS
+2701..2704 ; Extended_Pictographic# 1.1 [4] (✁..✄) UPPER BLADE SCISSORS..WHITE SCISSORS
+2705 ; Extended_Pictographic# 6.0 [1] (✅) check mark button
+2708..2709 ; Extended_Pictographic# 1.1 [2] (✈️..✉️) airplane..envelope
+270A..270B ; Extended_Pictographic# 6.0 [2] (✊..✋) raised fist..raised hand
+270C..2712 ; Extended_Pictographic# 1.1 [7] (✌️..✒️) victory hand..black nib
+2714 ; Extended_Pictographic# 1.1 [1] (✔️) check mark
+2716 ; Extended_Pictographic# 1.1 [1] (✖️) multiplication sign
+271D ; Extended_Pictographic# 1.1 [1] (✝️) latin cross
+2721 ; Extended_Pictographic# 1.1 [1] (✡️) star of David
+2728 ; Extended_Pictographic# 6.0 [1] (✨) sparkles
+2733..2734 ; Extended_Pictographic# 1.1 [2] (✳️..✴️) eight-spoked asterisk..eight-pointed star
+2744 ; Extended_Pictographic# 1.1 [1] (❄️) snowflake
+2747 ; Extended_Pictographic# 1.1 [1] (❇️) sparkle
+274C ; Extended_Pictographic# 6.0 [1] (❌) cross mark
+274E ; Extended_Pictographic# 6.0 [1] (❎) cross mark button
+2753..2755 ; Extended_Pictographic# 6.0 [3] (❓..❕) question mark..white exclamation mark
+2757 ; Extended_Pictographic# 5.2 [1] (❗) exclamation mark
+2763..2767 ; Extended_Pictographic# 1.1 [5] (❣️..❧) heart exclamation..ROTATED FLORAL HEART BULLET
+2795..2797 ; Extended_Pictographic# 6.0 [3] (➕..➗) plus sign..division sign
+27A1 ; Extended_Pictographic# 1.1 [1] (➡️) right arrow
+27B0 ; Extended_Pictographic# 6.0 [1] (➰) curly loop
+27BF ; Extended_Pictographic# 6.0 [1] (➿) double curly loop
+2934..2935 ; Extended_Pictographic# 3.2 [2] (⤴️..⤵️) right arrow curving up..right arrow curving down
+2B05..2B07 ; Extended_Pictographic# 4.0 [3] (⬅️..⬇️) left arrow..down arrow
+2B1B..2B1C ; Extended_Pictographic# 5.1 [2] (⬛..⬜) black large square..white large square
+2B50 ; Extended_Pictographic# 5.1 [1] (⭐) star
+2B55 ; Extended_Pictographic# 5.2 [1] (⭕) hollow red circle
+3030 ; Extended_Pictographic# 1.1 [1] (〰️) wavy dash
+303D ; Extended_Pictographic# 3.2 [1] (〽️) part alternation mark
+3297 ; Extended_Pictographic# 1.1 [1] (㊗️) Japanese “congratulations” button
+3299 ; Extended_Pictographic# 1.1 [1] (㊙️) Japanese “secret” button
+1F000..1F02B ; Extended_Pictographic# 5.1 [44] (🀀..🀫) MAHJONG TILE EAST WIND..MAHJONG TILE BACK
+1F02C..1F02F ; Extended_Pictographic# NA [4] (🀬..🀯) <reserved-1F02C>..<reserved-1F02F>
+1F030..1F093 ; Extended_Pictographic# 5.1[100] (🀰..🂓) DOMINO TILE HORIZONTAL BACK..DOMINO TILE VERTICAL-06-06
+1F094..1F09F ; Extended_Pictographic# NA [12] (🂔..🂟) <reserved-1F094>..<reserved-1F09F>
+1F0A0..1F0AE ; Extended_Pictographic# 6.0 [15] (🂠..🂮) PLAYING CARD BACK..PLAYING CARD KING OF SPADES
+1F0AF..1F0B0 ; Extended_Pictographic# NA [2] (🂯..🂰) <reserved-1F0AF>..<reserved-1F0B0>
+1F0B1..1F0BE ; Extended_Pictographic# 6.0 [14] (🂱..🂾) PLAYING CARD ACE OF HEARTS..PLAYING CARD KING OF HEARTS
+1F0BF ; Extended_Pictographic# 7.0 [1] (🂿) PLAYING CARD RED JOKER
+1F0C0 ; Extended_Pictographic# NA [1] (🃀) <reserved-1F0C0>
+1F0C1..1F0CF ; Extended_Pictographic# 6.0 [15] (🃁..🃏) PLAYING CARD ACE OF DIAMONDS..joker
+1F0D0 ; Extended_Pictographic# NA [1] (🃐) <reserved-1F0D0>
+1F0D1..1F0DF ; Extended_Pictographic# 6.0 [15] (🃑..🃟) PLAYING CARD ACE OF CLUBS..PLAYING CARD WHITE JOKER
+1F0E0..1F0F5 ; Extended_Pictographic# 7.0 [22] (🃠..🃵) PLAYING CARD FOOL..PLAYING CARD TRUMP-21
+1F0F6..1F0FF ; Extended_Pictographic# NA [10] (🃶..🃿) <reserved-1F0F6>..<reserved-1F0FF>
+1F10D..1F10F ; Extended_Pictographic# NA [3] (🄍..🄏) <reserved-1F10D>..<reserved-1F10F>
+1F12F ; Extended_Pictographic# 11.0 [1] (🄯) COPYLEFT SYMBOL
+1F16C ; Extended_Pictographic# 12.0 [1] (🅬) RAISED MR SIGN
+1F16D..1F16F ; Extended_Pictographic# NA [3] (🅭..🅯) <reserved-1F16D>..<reserved-1F16F>
+1F170..1F171 ; Extended_Pictographic# 6.0 [2] (🅰️..🅱️) A button (blood type)..B button (blood type)
+1F17E ; Extended_Pictographic# 6.0 [1] (🅾️) O button (blood type)
+1F17F ; Extended_Pictographic# 5.2 [1] (🅿️) P button
+1F18E ; Extended_Pictographic# 6.0 [1] (🆎) AB button (blood type)
+1F191..1F19A ; Extended_Pictographic# 6.0 [10] (🆑..🆚) CL button..VS button
+1F1AD..1F1E5 ; Extended_Pictographic# NA [57] (🆭..🇥) <reserved-1F1AD>..<reserved-1F1E5>
+1F201..1F202 ; Extended_Pictographic# 6.0 [2] (🈁..🈂️) Japanese “here” button..Japanese “service charge” button
+1F203..1F20F ; Extended_Pictographic# NA [13] (🈃..🈏) <reserved-1F203>..<reserved-1F20F>
+1F21A ; Extended_Pictographic# 5.2 [1] (🈚) Japanese “free of charge” button
+1F22F ; Extended_Pictographic# 5.2 [1] (🈯) Japanese “reserved” button
+1F232..1F23A ; Extended_Pictographic# 6.0 [9] (🈲..🈺) Japanese “prohibited” button..Japanese “open for business” button
+1F23C..1F23F ; Extended_Pictographic# NA [4] (🈼..🈿) <reserved-1F23C>..<reserved-1F23F>
+1F249..1F24F ; Extended_Pictographic# NA [7] (🉉..🉏) <reserved-1F249>..<reserved-1F24F>
+1F250..1F251 ; Extended_Pictographic# 6.0 [2] (🉐..🉑) Japanese “bargain” button..Japanese “acceptable” button
+1F252..1F25F ; Extended_Pictographic# NA [14] (🉒..🉟) <reserved-1F252>..<reserved-1F25F>
+1F260..1F265 ; Extended_Pictographic# 10.0 [6] (🉠..🉥) ROUNDED SYMBOL FOR FU..ROUNDED SYMBOL FOR CAI
+1F266..1F2FF ; Extended_Pictographic# NA[154] (🉦..🋿) <reserved-1F266>..<reserved-1F2FF>
+1F300..1F320 ; Extended_Pictographic# 6.0 [33] (🌀..🌠) cyclone..shooting star
+1F321..1F32C ; Extended_Pictographic# 7.0 [12] (🌡️..🌬️) thermometer..wind face
+1F32D..1F32F ; Extended_Pictographic# 8.0 [3] (🌭..🌯) hot dog..burrito
+1F330..1F335 ; Extended_Pictographic# 6.0 [6] (🌰..🌵) chestnut..cactus
+1F336 ; Extended_Pictographic# 7.0 [1] (🌶️) hot pepper
+1F337..1F37C ; Extended_Pictographic# 6.0 [70] (🌷..🍼) tulip..baby bottle
+1F37D ; Extended_Pictographic# 7.0 [1] (🍽️) fork and knife with plate
+1F37E..1F37F ; Extended_Pictographic# 8.0 [2] (🍾..🍿) bottle with popping cork..popcorn
+1F380..1F393 ; Extended_Pictographic# 6.0 [20] (🎀..🎓) ribbon..graduation cap
+1F394..1F39F ; Extended_Pictographic# 7.0 [12] (🎔..🎟️) HEART WITH TIP ON THE LEFT..admission tickets
+1F3A0..1F3C4 ; Extended_Pictographic# 6.0 [37] (🎠..🏄) carousel horse..person surfing
+1F3C5 ; Extended_Pictographic# 7.0 [1] (🏅) sports medal
+1F3C6..1F3CA ; Extended_Pictographic# 6.0 [5] (🏆..🏊) trophy..person swimming
+1F3CB..1F3CE ; Extended_Pictographic# 7.0 [4] (🏋️..🏎️) person lifting weights..racing car
+1F3CF..1F3D3 ; Extended_Pictographic# 8.0 [5] (🏏..🏓) cricket game..ping pong
+1F3D4..1F3DF ; Extended_Pictographic# 7.0 [12] (🏔️..🏟️) snow-capped mountain..stadium
+1F3E0..1F3F0 ; Extended_Pictographic# 6.0 [17] (🏠..🏰) house..castle
+1F3F1..1F3F7 ; Extended_Pictographic# 7.0 [7] (🏱..🏷️) WHITE PENNANT..label
+1F3F8..1F3FA ; Extended_Pictographic# 8.0 [3] (🏸..🏺) badminton..amphora
+1F400..1F43E ; Extended_Pictographic# 6.0 [63] (🐀..🐾) rat..paw prints
+1F43F ; Extended_Pictographic# 7.0 [1] (🐿️) chipmunk
+1F440 ; Extended_Pictographic# 6.0 [1] (👀) eyes
+1F441 ; Extended_Pictographic# 7.0 [1] (👁️) eye
+1F442..1F4F7 ; Extended_Pictographic# 6.0[182] (👂..📷) ear..camera
+1F4F8 ; Extended_Pictographic# 7.0 [1] (📸) camera with flash
+1F4F9..1F4FC ; Extended_Pictographic# 6.0 [4] (📹..📼) video camera..videocassette
+1F4FD..1F4FE ; Extended_Pictographic# 7.0 [2] (📽️..📾) film projector..PORTABLE STEREO
+1F4FF ; Extended_Pictographic# 8.0 [1] (📿) prayer beads
+1F500..1F53D ; Extended_Pictographic# 6.0 [62] (🔀..🔽) shuffle tracks button..downwards button
+1F546..1F54A ; Extended_Pictographic# 7.0 [5] (🕆..🕊️) WHITE LATIN CROSS..dove
+1F54B..1F54F ; Extended_Pictographic# 8.0 [5] (🕋..🕏) kaaba..BOWL OF HYGIEIA
+1F550..1F567 ; Extended_Pictographic# 6.0 [24] (🕐..🕧) one o’clock..twelve-thirty
+1F568..1F579 ; Extended_Pictographic# 7.0 [18] (🕨..🕹️) RIGHT SPEAKER..joystick
+1F57A ; Extended_Pictographic# 9.0 [1] (🕺) man dancing
+1F57B..1F5A3 ; Extended_Pictographic# 7.0 [41] (🕻..🖣) LEFT HAND TELEPHONE RECEIVER..BLACK DOWN POINTING BACKHAND INDEX
+1F5A4 ; Extended_Pictographic# 9.0 [1] (🖤) black heart
+1F5A5..1F5FA ; Extended_Pictographic# 7.0 [86] (🖥️..🗺️) desktop computer..world map
+1F5FB..1F5FF ; Extended_Pictographic# 6.0 [5] (🗻..🗿) mount fuji..moai
+1F600 ; Extended_Pictographic# 6.1 [1] (😀) grinning face
+1F601..1F610 ; Extended_Pictographic# 6.0 [16] (😁..😐) beaming face with smiling eyes..neutral face
+1F611 ; Extended_Pictographic# 6.1 [1] (😑) expressionless face
+1F612..1F614 ; Extended_Pictographic# 6.0 [3] (😒..😔) unamused face..pensive face
+1F615 ; Extended_Pictographic# 6.1 [1] (😕) confused face
+1F616 ; Extended_Pictographic# 6.0 [1] (😖) confounded face
+1F617 ; Extended_Pictographic# 6.1 [1] (😗) kissing face
+1F618 ; Extended_Pictographic# 6.0 [1] (😘) face blowing a kiss
+1F619 ; Extended_Pictographic# 6.1 [1] (😙) kissing face with smiling eyes
+1F61A ; Extended_Pictographic# 6.0 [1] (😚) kissing face with closed eyes
+1F61B ; Extended_Pictographic# 6.1 [1] (😛) face with tongue
+1F61C..1F61E ; Extended_Pictographic# 6.0 [3] (😜..😞) winking face with tongue..disappointed face
+1F61F ; Extended_Pictographic# 6.1 [1] (😟) worried face
+1F620..1F625 ; Extended_Pictographic# 6.0 [6] (😠..😥) angry face..sad but relieved face
+1F626..1F627 ; Extended_Pictographic# 6.1 [2] (😦..😧) frowning face with open mouth..anguished face
+1F628..1F62B ; Extended_Pictographic# 6.0 [4] (😨..😫) fearful face..tired face
+1F62C ; Extended_Pictographic# 6.1 [1] (😬) grimacing face
+1F62D ; Extended_Pictographic# 6.0 [1] (😭) loudly crying face
+1F62E..1F62F ; Extended_Pictographic# 6.1 [2] (😮..😯) face with open mouth..hushed face
+1F630..1F633 ; Extended_Pictographic# 6.0 [4] (😰..😳) anxious face with sweat..flushed face
+1F634 ; Extended_Pictographic# 6.1 [1] (😴) sleeping face
+1F635..1F640 ; Extended_Pictographic# 6.0 [12] (😵..🙀) dizzy face..weary cat
+1F641..1F642 ; Extended_Pictographic# 7.0 [2] (🙁..🙂) slightly frowning face..slightly smiling face
+1F643..1F644 ; Extended_Pictographic# 8.0 [2] (🙃..🙄) upside-down face..face with rolling eyes
+1F645..1F64F ; Extended_Pictographic# 6.0 [11] (🙅..🙏) person gesturing NO..folded hands
+1F680..1F6C5 ; Extended_Pictographic# 6.0 [70] (🚀..🛅) rocket..left luggage
+1F6C6..1F6CF ; Extended_Pictographic# 7.0 [10] (🛆..🛏️) TRIANGLE WITH ROUNDED CORNERS..bed
+1F6D0 ; Extended_Pictographic# 8.0 [1] (🛐) place of worship
+1F6D1..1F6D2 ; Extended_Pictographic# 9.0 [2] (🛑..🛒) stop sign..shopping cart
+1F6D3..1F6D4 ; Extended_Pictographic# 10.0 [2] (🛓..🛔) STUPA..PAGODA
+1F6D5 ; Extended_Pictographic# 12.0 [1] (🛕) hindu temple
+1F6D6..1F6DF ; Extended_Pictographic# NA [10] (🛖..🛟) <reserved-1F6D6>..<reserved-1F6DF>
+1F6E0..1F6EC ; Extended_Pictographic# 7.0 [13] (🛠️..🛬) hammer and wrench..airplane arrival
+1F6ED..1F6EF ; Extended_Pictographic# NA [3] (🛭..🛯) <reserved-1F6ED>..<reserved-1F6EF>
+1F6F0..1F6F3 ; Extended_Pictographic# 7.0 [4] (🛰️..🛳️) satellite..passenger ship
+1F6F4..1F6F6 ; Extended_Pictographic# 9.0 [3] (🛴..🛶) kick scooter..canoe
+1F6F7..1F6F8 ; Extended_Pictographic# 10.0 [2] (🛷..🛸) sled..flying saucer
+1F6F9 ; Extended_Pictographic# 11.0 [1] (🛹) skateboard
+1F6FA ; Extended_Pictographic# 12.0 [1] (🛺) auto rickshaw
+1F6FB..1F6FF ; Extended_Pictographic# NA [5] (🛻..🛿) <reserved-1F6FB>..<reserved-1F6FF>
+1F774..1F77F ; Extended_Pictographic# NA [12] (🝴..🝿) <reserved-1F774>..<reserved-1F77F>
+1F7D5..1F7D8 ; Extended_Pictographic# 11.0 [4] (🟕..🟘) CIRCLED TRIANGLE..NEGATIVE CIRCLED SQUARE
+1F7D9..1F7DF ; Extended_Pictographic# NA [7] (🟙..🟟) <reserved-1F7D9>..<reserved-1F7DF>
+1F7E0..1F7EB ; Extended_Pictographic# 12.0 [12] (🟠..🟫) orange circle..brown square
+1F7EC..1F7FF ; Extended_Pictographic# NA [20] (🟬..🟿) <reserved-1F7EC>..<reserved-1F7FF>
+1F80C..1F80F ; Extended_Pictographic# NA [4] (🠌..🠏) <reserved-1F80C>..<reserved-1F80F>
+1F848..1F84F ; Extended_Pictographic# NA [8] (🡈..🡏) <reserved-1F848>..<reserved-1F84F>
+1F85A..1F85F ; Extended_Pictographic# NA [6] (🡚..🡟) <reserved-1F85A>..<reserved-1F85F>
+1F888..1F88F ; Extended_Pictographic# NA [8] (🢈..🢏) <reserved-1F888>..<reserved-1F88F>
+1F8AE..1F8FF ; Extended_Pictographic# NA [82] (🢮..🣿) <reserved-1F8AE>..<reserved-1F8FF>
+1F90C ; Extended_Pictographic# NA [1] (🤌) <reserved-1F90C>
+1F90D..1F90F ; Extended_Pictographic# 12.0 [3] (🤍..🤏) white heart..pinching hand
+1F910..1F918 ; Extended_Pictographic# 8.0 [9] (🤐..🤘) zipper-mouth face..sign of the horns
+1F919..1F91E ; Extended_Pictographic# 9.0 [6] (🤙..🤞) call me hand..crossed fingers
+1F91F ; Extended_Pictographic# 10.0 [1] (🤟) love-you gesture
+1F920..1F927 ; Extended_Pictographic# 9.0 [8] (🤠..🤧) cowboy hat face..sneezing face
+1F928..1F92F ; Extended_Pictographic# 10.0 [8] (🤨..🤯) face with raised eyebrow..exploding head
+1F930 ; Extended_Pictographic# 9.0 [1] (🤰) pregnant woman
+1F931..1F932 ; Extended_Pictographic# 10.0 [2] (🤱..🤲) breast-feeding..palms up together
+1F933..1F93A ; Extended_Pictographic# 9.0 [8] (🤳..🤺) selfie..person fencing
+1F93C..1F93E ; Extended_Pictographic# 9.0 [3] (🤼..🤾) people wrestling..person playing handball
+1F93F ; Extended_Pictographic# 12.0 [1] (🤿) diving mask
+1F940..1F945 ; Extended_Pictographic# 9.0 [6] (🥀..🥅) wilted flower..goal net
+1F947..1F94B ; Extended_Pictographic# 9.0 [5] (🥇..🥋) 1st place medal..martial arts uniform
+1F94C ; Extended_Pictographic# 10.0 [1] (🥌) curling stone
+1F94D..1F94F ; Extended_Pictographic# 11.0 [3] (🥍..🥏) lacrosse..flying disc
+1F950..1F95E ; Extended_Pictographic# 9.0 [15] (🥐..🥞) croissant..pancakes
+1F95F..1F96B ; Extended_Pictographic# 10.0 [13] (🥟..🥫) dumpling..canned food
+1F96C..1F970 ; Extended_Pictographic# 11.0 [5] (🥬..🥰) leafy green..smiling face with hearts
+1F971 ; Extended_Pictographic# 12.0 [1] (🥱) yawning face
+1F972 ; Extended_Pictographic# NA [1] (🥲) <reserved-1F972>
+1F973..1F976 ; Extended_Pictographic# 11.0 [4] (🥳..🥶) partying face..cold face
+1F977..1F979 ; Extended_Pictographic# NA [3] (🥷..🥹) <reserved-1F977>..<reserved-1F979>
+1F97A ; Extended_Pictographic# 11.0 [1] (🥺) pleading face
+1F97B ; Extended_Pictographic# 12.0 [1] (🥻) sari
+1F97C..1F97F ; Extended_Pictographic# 11.0 [4] (🥼..🥿) lab coat..flat shoe
+1F980..1F984 ; Extended_Pictographic# 8.0 [5] (🦀..🦄) crab..unicorn
+1F985..1F991 ; Extended_Pictographic# 9.0 [13] (🦅..🦑) eagle..squid
+1F992..1F997 ; Extended_Pictographic# 10.0 [6] (🦒..🦗) giraffe..cricket
+1F998..1F9A2 ; Extended_Pictographic# 11.0 [11] (🦘..🦢) kangaroo..swan
+1F9A3..1F9A4 ; Extended_Pictographic# NA [2] (🦣..🦤) <reserved-1F9A3>..<reserved-1F9A4>
+1F9A5..1F9AA ; Extended_Pictographic# 12.0 [6] (🦥..🦪) sloth..oyster
+1F9AB..1F9AD ; Extended_Pictographic# NA [3] (🦫..🦭) <reserved-1F9AB>..<reserved-1F9AD>
+1F9AE..1F9AF ; Extended_Pictographic# 12.0 [2] (🦮..🦯) guide dog..probing cane
+1F9B0..1F9B9 ; Extended_Pictographic# 11.0 [10] (🦰..🦹) red hair..supervillain
+1F9BA..1F9BF ; Extended_Pictographic# 12.0 [6] (🦺..🦿) safety vest..mechanical leg
+1F9C0 ; Extended_Pictographic# 8.0 [1] (🧀) cheese wedge
+1F9C1..1F9C2 ; Extended_Pictographic# 11.0 [2] (🧁..🧂) cupcake..salt
+1F9C3..1F9CA ; Extended_Pictographic# 12.0 [8] (🧃..🧊) beverage box..ice cube
+1F9CB..1F9CC ; Extended_Pictographic# NA [2] (🧋..🧌) <reserved-1F9CB>..<reserved-1F9CC>
+1F9CD..1F9CF ; Extended_Pictographic# 12.0 [3] (🧍..🧏) person standing..deaf person
+1F9D0..1F9E6 ; Extended_Pictographic# 10.0 [23] (🧐..🧦) face with monocle..socks
+1F9E7..1F9FF ; Extended_Pictographic# 11.0 [25] (🧧..🧿) red envelope..nazar amulet
+1FA00..1FA53 ; Extended_Pictographic# 12.0 [84] (🨀..🩓) NEUTRAL CHESS KING..BLACK CHESS KNIGHT-BISHOP
+1FA54..1FA5F ; Extended_Pictographic# NA [12] (🩔..🩟) <reserved-1FA54>..<reserved-1FA5F>
+1FA60..1FA6D ; Extended_Pictographic# 11.0 [14] (🩠..🩭) XIANGQI RED GENERAL..XIANGQI BLACK SOLDIER
+1FA6E..1FA6F ; Extended_Pictographic# NA [2] (🩮..🩯) <reserved-1FA6E>..<reserved-1FA6F>
+1FA70..1FA73 ; Extended_Pictographic# 12.0 [4] (🩰..🩳) ballet shoes..shorts
+1FA74..1FA77 ; Extended_Pictographic# NA [4] (🩴..🩷) <reserved-1FA74>..<reserved-1FA77>
+1FA78..1FA7A ; Extended_Pictographic# 12.0 [3] (🩸..🩺) drop of blood..stethoscope
+1FA7B..1FA7F ; Extended_Pictographic# NA [5] (🩻..🩿) <reserved-1FA7B>..<reserved-1FA7F>
+1FA80..1FA82 ; Extended_Pictographic# 12.0 [3] (🪀..🪂) yo-yo..parachute
+1FA83..1FA8F ; Extended_Pictographic# NA [13] (🪃..🪏) <reserved-1FA83>..<reserved-1FA8F>
+1FA90..1FA95 ; Extended_Pictographic# 12.0 [6] (🪐..🪕) ringed planet..banjo
+1FA96..1FFFD ; Extended_Pictographic# NA[1384] (🪖..🿽) <reserved-1FA96>..<reserved-1FFFD>
+
+# Total elements: 3793
+
+#EOF
diff --git a/lib/pleroma/emoji.ex b/lib/pleroma/emoji.ex
index bafad2ae9..f6016d73f 100644
--- a/lib/pleroma/emoji.ex
+++ b/lib/pleroma/emoji.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Emoji do
@@ -98,4 +98,35 @@ defmodule Pleroma.Emoji do
defp update_emojis(emojis) do
:ets.insert(@ets, emojis)
end
+
+ @external_resource "lib/pleroma/emoji-data.txt"
+
+ emojis =
+ @external_resource
+ |> File.read!()
+ |> String.split("\n")
+ |> Enum.filter(fn line -> line != "" and not String.starts_with?(line, "#") end)
+ |> Enum.map(fn line ->
+ line
+ |> String.split(";", parts: 2)
+ |> hd()
+ |> String.trim()
+ |> String.split("..")
+ |> case do
+ [number] ->
+ <<String.to_integer(number, 16)::utf8>>
+
+ [first, last] ->
+ String.to_integer(first, 16)..String.to_integer(last, 16)
+ |> Enum.map(&<<&1::utf8>>)
+ end
+ end)
+ |> List.flatten()
+ |> Enum.uniq()
+
+ for emoji <- emojis do
+ def is_unicode_emoji?(unquote(emoji)), do: true
+ end
+
+ def is_unicode_emoji?(_), do: false
end
diff --git a/lib/pleroma/emoji/formatter.ex b/lib/pleroma/emoji/formatter.ex
index 4869d073e..dc45b8a38 100644
--- a/lib/pleroma/emoji/formatter.ex
+++ b/lib/pleroma/emoji/formatter.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Emoji.Formatter do
@@ -38,22 +38,14 @@ defmodule Pleroma.Emoji.Formatter do
def demojify(text, nil), do: text
- @doc "Outputs a list of the emoji-shortcodes in a text"
- def get_emoji(text) when is_binary(text) do
- Enum.filter(Emoji.get_all(), fn {emoji, %Emoji{}} ->
- String.contains?(text, ":#{emoji}:")
- end)
- end
-
- def get_emoji(_), do: []
-
@doc "Outputs a list of the emoji-Maps in a text"
def get_emoji_map(text) when is_binary(text) do
- get_emoji(text)
+ Emoji.get_all()
+ |> Enum.filter(fn {emoji, %Emoji{}} -> String.contains?(text, ":#{emoji}:") end)
|> Enum.reduce(%{}, fn {name, %Emoji{file: file}}, acc ->
Map.put(acc, name, "#{Pleroma.Web.Endpoint.static_url()}#{file}")
end)
end
- def get_emoji_map(_), do: []
+ def get_emoji_map(_), do: %{}
end
diff --git a/lib/pleroma/emoji/loader.ex b/lib/pleroma/emoji/loader.ex
index 4f4ee51d1..3de2dc762 100644
--- a/lib/pleroma/emoji/loader.ex
+++ b/lib/pleroma/emoji/loader.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Emoji.Loader do
diff --git a/lib/pleroma/emoji/pack.ex b/lib/pleroma/emoji/pack.ex
new file mode 100644
index 000000000..242344374
--- /dev/null
+++ b/lib/pleroma/emoji/pack.ex
@@ -0,0 +1,507 @@
+defmodule Pleroma.Emoji.Pack do
+ @derive {Jason.Encoder, only: [:files, :pack]}
+ defstruct files: %{},
+ pack_file: nil,
+ path: nil,
+ pack: %{},
+ name: nil
+
+ @type t() :: %__MODULE__{
+ files: %{String.t() => Path.t()},
+ pack_file: Path.t(),
+ path: Path.t(),
+ pack: map(),
+ name: String.t()
+ }
+
+ alias Pleroma.Emoji
+
+ @spec emoji_path() :: Path.t()
+ def emoji_path do
+ static = Pleroma.Config.get!([:instance, :static_dir])
+ Path.join(static, "emoji")
+ end
+
+ @spec create(String.t()) :: :ok | {:error, File.posix()} | {:error, :empty_values}
+ def create(name) when byte_size(name) > 0 do
+ dir = Path.join(emoji_path(), name)
+
+ with :ok <- File.mkdir(dir) do
+ %__MODULE__{
+ pack_file: Path.join(dir, "pack.json")
+ }
+ |> save_pack()
+ end
+ end
+
+ def create(_), do: {:error, :empty_values}
+
+ @spec show(String.t()) :: {:ok, t()} | {:loaded, nil} | {:error, :empty_values}
+ def show(name) when byte_size(name) > 0 do
+ with {_, %__MODULE__{} = pack} <- {:loaded, load_pack(name)},
+ {_, pack} <- validate_pack(pack) do
+ {:ok, pack}
+ end
+ end
+
+ def show(_), do: {:error, :empty_values}
+
+ @spec delete(String.t()) ::
+ {:ok, [binary()]} | {:error, File.posix(), binary()} | {:error, :empty_values}
+ def delete(name) when byte_size(name) > 0 do
+ emoji_path()
+ |> Path.join(name)
+ |> File.rm_rf()
+ end
+
+ def delete(_), do: {:error, :empty_values}
+
+ @spec add_file(String.t(), String.t(), Path.t(), Plug.Upload.t() | String.t()) ::
+ {:ok, t()} | {:error, File.posix()} | {:error, :empty_values}
+ def add_file(name, shortcode, filename, file)
+ when byte_size(name) > 0 and byte_size(shortcode) > 0 and byte_size(filename) > 0 do
+ with {_, nil} <- {:exists, Emoji.get(shortcode)},
+ {_, %__MODULE__{} = pack} <- {:loaded, load_pack(name)} do
+ file_path = Path.join(pack.path, filename)
+
+ create_subdirs(file_path)
+
+ case file do
+ %Plug.Upload{path: upload_path} ->
+ # Copy the uploaded file from the temporary directory
+ File.copy!(upload_path, file_path)
+
+ url when is_binary(url) ->
+ # Download and write the file
+ file_contents = Tesla.get!(url).body
+ File.write!(file_path, file_contents)
+ end
+
+ files = Map.put(pack.files, shortcode, filename)
+
+ updated_pack = %{pack | files: files}
+
+ case save_pack(updated_pack) do
+ :ok ->
+ Emoji.reload()
+ {:ok, updated_pack}
+
+ e ->
+ e
+ end
+ end
+ end
+
+ def add_file(_, _, _, _), do: {:error, :empty_values}
+
+ defp create_subdirs(file_path) do
+ if String.contains?(file_path, "/") do
+ file_path
+ |> Path.dirname()
+ |> File.mkdir_p!()
+ end
+ end
+
+ @spec delete_file(String.t(), String.t()) ::
+ {:ok, t()} | {:error, File.posix()} | {:error, :empty_values}
+ def delete_file(name, shortcode) when byte_size(name) > 0 and byte_size(shortcode) > 0 do
+ with {_, %__MODULE__{} = pack} <- {:loaded, load_pack(name)},
+ {_, {filename, files}} when not is_nil(filename) <-
+ {:exists, Map.pop(pack.files, shortcode)},
+ emoji <- Path.join(pack.path, filename),
+ {_, true} <- {:exists, File.exists?(emoji)} do
+ emoji_dir = Path.dirname(emoji)
+
+ File.rm!(emoji)
+
+ if String.contains?(filename, "/") and File.ls!(emoji_dir) == [] do
+ File.rmdir!(emoji_dir)
+ end
+
+ updated_pack = %{pack | files: files}
+
+ case save_pack(updated_pack) do
+ :ok ->
+ Emoji.reload()
+ {:ok, updated_pack}
+
+ e ->
+ e
+ end
+ end
+ end
+
+ def delete_file(_, _), do: {:error, :empty_values}
+
+ @spec update_file(String.t(), String.t(), String.t(), String.t(), boolean()) ::
+ {:ok, t()} | {:error, File.posix()} | {:error, :empty_values}
+ def update_file(name, shortcode, new_shortcode, new_filename, force)
+ when byte_size(name) > 0 and byte_size(shortcode) > 0 and byte_size(new_shortcode) > 0 and
+ byte_size(new_filename) > 0 do
+ with {_, %__MODULE__{} = pack} <- {:loaded, load_pack(name)},
+ {_, {filename, files}} when not is_nil(filename) <-
+ {:exists, Map.pop(pack.files, shortcode)},
+ {_, true} <- {:not_used, force or is_nil(Emoji.get(new_shortcode))} do
+ old_path = Path.join(pack.path, filename)
+ old_dir = Path.dirname(old_path)
+ new_path = Path.join(pack.path, new_filename)
+
+ create_subdirs(new_path)
+
+ :ok = File.rename(old_path, new_path)
+
+ if String.contains?(filename, "/") and File.ls!(old_dir) == [] do
+ File.rmdir!(old_dir)
+ end
+
+ files = Map.put(files, new_shortcode, new_filename)
+
+ updated_pack = %{pack | files: files}
+
+ case save_pack(updated_pack) do
+ :ok ->
+ Emoji.reload()
+ {:ok, updated_pack}
+
+ e ->
+ e
+ end
+ end
+ end
+
+ def update_file(_, _, _, _, _), do: {:error, :empty_values}
+
+ @spec import_from_filesystem() :: {:ok, [String.t()]} | {:error, atom()}
+ def import_from_filesystem do
+ emoji_path = emoji_path()
+
+ with {:ok, %{access: :read_write}} <- File.stat(emoji_path),
+ {:ok, results} <- File.ls(emoji_path) do
+ names =
+ results
+ |> Enum.map(&Path.join(emoji_path, &1))
+ |> Enum.reject(fn path ->
+ File.dir?(path) and File.exists?(Path.join(path, "pack.json"))
+ end)
+ |> Enum.map(&write_pack_contents/1)
+ |> Enum.filter(& &1)
+
+ {:ok, names}
+ else
+ {:ok, %{access: _}} -> {:error, :no_read_write}
+ e -> e
+ end
+ end
+
+ defp write_pack_contents(path) do
+ pack = %__MODULE__{
+ files: files_from_path(path),
+ path: path,
+ pack_file: Path.join(path, "pack.json")
+ }
+
+ case save_pack(pack) do
+ :ok -> Path.basename(path)
+ _ -> nil
+ end
+ end
+
+ defp files_from_path(path) do
+ txt_path = Path.join(path, "emoji.txt")
+
+ if File.exists?(txt_path) do
+ # There's an emoji.txt file, it's likely from a pack installed by the pack manager.
+ # Make a pack.json file from the contents of that emoji.txt file
+
+ # FIXME: Copy-pasted from Pleroma.Emoji/load_from_file_stream/2
+
+ # Create a map of shortcodes to filenames from emoji.txt
+ File.read!(txt_path)
+ |> String.split("\n")
+ |> Enum.map(&String.trim/1)
+ |> Enum.map(fn line ->
+ case String.split(line, ~r/,\s*/) do
+ # This matches both strings with and without tags
+ # and we don't care about tags here
+ [name, file | _] ->
+ file_dir_name = Path.dirname(file)
+
+ file =
+ if String.ends_with?(path, file_dir_name) do
+ Path.basename(file)
+ else
+ file
+ end
+
+ {name, file}
+
+ _ ->
+ nil
+ end
+ end)
+ |> Enum.filter(& &1)
+ |> Enum.into(%{})
+ else
+ # If there's no emoji.txt, assume all files
+ # that are of certain extensions from the config are emojis and import them all
+ pack_extensions = Pleroma.Config.get!([:emoji, :pack_extensions])
+ Emoji.Loader.make_shortcode_to_file_map(path, pack_extensions)
+ end
+ end
+
+ @spec list_remote(String.t()) :: {:ok, map()}
+ def list_remote(url) do
+ uri =
+ url
+ |> String.trim()
+ |> URI.parse()
+
+ with {_, true} <- {:shareable, shareable_packs_available?(uri)} do
+ packs =
+ uri
+ |> URI.merge("/api/pleroma/emoji/packs")
+ |> to_string()
+ |> Tesla.get!()
+ |> Map.get(:body)
+ |> Jason.decode!()
+
+ {:ok, packs}
+ end
+ end
+
+ @spec list_local() :: {:ok, map()}
+ def list_local do
+ emoji_path = emoji_path()
+
+ # Create the directory first if it does not exist. This is probably the first request made
+ # with the API so it should be sufficient
+ with {:create_dir, :ok} <- {:create_dir, File.mkdir_p(emoji_path)},
+ {:ls, {:ok, results}} <- {:ls, File.ls(emoji_path)} do
+ packs =
+ results
+ |> Enum.map(&load_pack/1)
+ |> Enum.filter(& &1)
+ |> Enum.map(&validate_pack/1)
+ |> Map.new()
+
+ {:ok, packs}
+ end
+ end
+
+ defp validate_pack(pack) do
+ if downloadable?(pack) do
+ archive = fetch_archive(pack)
+ archive_sha = :crypto.hash(:sha256, archive) |> Base.encode16()
+
+ info =
+ pack.pack
+ |> Map.put("can-download", true)
+ |> Map.put("download-sha256", archive_sha)
+
+ {pack.name, Map.put(pack, :pack, info)}
+ else
+ info = Map.put(pack.pack, "can-download", false)
+ {pack.name, Map.put(pack, :pack, info)}
+ end
+ end
+
+ defp downloadable?(pack) do
+ # If the pack is set as shared, check if it can be downloaded
+ # That means that when asked, the pack can be packed and sent to the remote
+ # Otherwise, they'd have to download it from external-src
+ pack.pack["share-files"] &&
+ Enum.all?(pack.files, fn {_, file} ->
+ File.exists?(Path.join(pack.path, file))
+ end)
+ end
+
+ @spec get_archive(String.t()) :: {:ok, binary()}
+ def get_archive(name) do
+ with {_, %__MODULE__{} = pack} <- {:exists?, load_pack(name)},
+ {_, true} <- {:can_download?, downloadable?(pack)} do
+ {:ok, fetch_archive(pack)}
+ end
+ end
+
+ defp fetch_archive(pack) do
+ hash = :crypto.hash(:md5, File.read!(pack.pack_file))
+
+ case Cachex.get!(:emoji_packs_cache, pack.name) do
+ %{hash: ^hash, pack_data: archive} ->
+ archive
+
+ _ ->
+ create_archive_and_cache(pack, hash)
+ end
+ end
+
+ defp create_archive_and_cache(pack, hash) do
+ files = ['pack.json' | Enum.map(pack.files, fn {_, file} -> to_charlist(file) end)]
+
+ {:ok, {_, result}} =
+ :zip.zip('#{pack.name}.zip', files, [:memory, cwd: to_charlist(pack.path)])
+
+ ttl_per_file = Pleroma.Config.get!([:emoji, :shared_pack_cache_seconds_per_file])
+ overall_ttl = :timer.seconds(ttl_per_file * Enum.count(files))
+
+ Cachex.put!(
+ :emoji_packs_cache,
+ pack.name,
+ # if pack.json MD5 changes, the cache is not valid anymore
+ %{hash: hash, pack_data: result},
+ # Add a minute to cache time for every file in the pack
+ ttl: overall_ttl
+ )
+
+ result
+ end
+
+ @spec download(String.t(), String.t(), String.t()) :: :ok
+ def download(name, url, as) do
+ uri =
+ url
+ |> String.trim()
+ |> URI.parse()
+
+ with {_, true} <- {:shareable, shareable_packs_available?(uri)} do
+ remote_pack =
+ uri
+ |> URI.merge("/api/pleroma/emoji/packs/#{name}")
+ |> to_string()
+ |> Tesla.get!()
+ |> Map.get(:body)
+ |> Jason.decode!()
+
+ result =
+ case remote_pack["pack"] do
+ %{"share-files" => true, "can-download" => true, "download-sha256" => sha} ->
+ {:ok,
+ %{
+ sha: sha,
+ url: URI.merge(uri, "/api/pleroma/emoji/packs/#{name}/archive") |> to_string()
+ }}
+
+ %{"fallback-src" => src, "fallback-src-sha256" => sha} when is_binary(src) ->
+ {:ok,
+ %{
+ sha: sha,
+ url: src,
+ fallback: true
+ }}
+
+ _ ->
+ {:error,
+ "The pack was not set as shared and there is no fallback src to download from"}
+ end
+
+ with {:ok, %{sha: sha, url: url} = pinfo} <- result,
+ %{body: archive} <- Tesla.get!(url),
+ {_, true} <- {:checksum, Base.decode16!(sha) == :crypto.hash(:sha256, archive)} do
+ local_name = as || name
+
+ path = Path.join(emoji_path(), local_name)
+
+ pack = %__MODULE__{
+ name: local_name,
+ path: path,
+ files: remote_pack["files"],
+ pack_file: Path.join(path, "pack.json")
+ }
+
+ File.mkdir_p!(pack.path)
+
+ files = Enum.map(remote_pack["files"], fn {_, path} -> to_charlist(path) end)
+ # Fallback cannot contain a pack.json file
+ files = if pinfo[:fallback], do: files, else: ['pack.json' | files]
+
+ {:ok, _} = :zip.unzip(archive, cwd: to_charlist(pack.path), file_list: files)
+
+ # Fallback can't contain a pack.json file, since that would cause the fallback-src-sha256
+ # in it to depend on itself
+ if pinfo[:fallback] do
+ save_pack(pack)
+ end
+
+ :ok
+ end
+ end
+ end
+
+ defp save_pack(pack), do: File.write(pack.pack_file, Jason.encode!(pack, pretty: true))
+
+ @spec save_metadata(map(), t()) :: {:ok, t()} | {:error, File.posix()}
+ def save_metadata(metadata, %__MODULE__{} = pack) do
+ pack = Map.put(pack, :pack, metadata)
+
+ with :ok <- save_pack(pack) do
+ {:ok, pack}
+ end
+ end
+
+ @spec update_metadata(String.t(), map()) :: {:ok, t()} | {:error, File.posix()}
+ def update_metadata(name, data) do
+ pack = load_pack(name)
+
+ fb_sha_changed? =
+ not is_nil(data["fallback-src"]) and data["fallback-src"] != pack.pack["fallback-src"]
+
+ with {_, true} <- {:update?, fb_sha_changed?},
+ {:ok, %{body: zip}} <- Tesla.get(data["fallback-src"]),
+ {:ok, f_list} <- :zip.unzip(zip, [:memory]),
+ {_, true} <- {:has_all_files?, has_all_files?(pack.files, f_list)} do
+ fallback_sha = :crypto.hash(:sha256, zip) |> Base.encode16()
+
+ data
+ |> Map.put("fallback-src-sha256", fallback_sha)
+ |> save_metadata(pack)
+ else
+ {:update?, _} -> save_metadata(data, pack)
+ e -> e
+ end
+ end
+
+ # Check if all files from the pack.json are in the archive
+ defp has_all_files?(files, f_list) do
+ Enum.all?(files, fn {_, from_manifest} ->
+ List.keyfind(f_list, to_charlist(from_manifest), 0)
+ end)
+ end
+
+ @spec load_pack(String.t()) :: t() | nil
+ def load_pack(name) do
+ pack_file = Path.join([emoji_path(), name, "pack.json"])
+
+ if File.exists?(pack_file) do
+ pack_file
+ |> File.read!()
+ |> from_json()
+ |> Map.put(:pack_file, pack_file)
+ |> Map.put(:path, Path.dirname(pack_file))
+ |> Map.put(:name, name)
+ end
+ end
+
+ defp from_json(json) do
+ map = Jason.decode!(json)
+
+ struct(__MODULE__, %{files: map["files"], pack: map["pack"]})
+ end
+
+ defp shareable_packs_available?(uri) do
+ uri
+ |> URI.merge("/.well-known/nodeinfo")
+ |> to_string()
+ |> Tesla.get!()
+ |> Map.get(:body)
+ |> Jason.decode!()
+ |> Map.get("links")
+ |> List.last()
+ |> Map.get("href")
+ # Get the actual nodeinfo address and fetch it
+ |> Tesla.get!()
+ |> Map.get(:body)
+ |> Jason.decode!()
+ |> get_in(["metadata", "features"])
+ |> Enum.member?("shareable_emoji_packs")
+ end
+end
diff --git a/lib/pleroma/filter.ex b/lib/pleroma/filter.ex
index c87141582..4d61b3650 100644
--- a/lib/pleroma/filter.ex
+++ b/lib/pleroma/filter.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Filter do
@@ -89,11 +89,10 @@ defmodule Pleroma.Filter do
|> Repo.delete()
end
- def update(%Pleroma.Filter{} = filter) do
- destination = Map.from_struct(filter)
-
- Pleroma.Filter.get(filter.filter_id, %{id: filter.user_id})
- |> cast(destination, [:phrase, :context, :hide, :expires_at, :whole_word])
+ def update(%Pleroma.Filter{} = filter, params) do
+ filter
+ |> cast(params, [:phrase, :context, :hide, :expires_at, :whole_word])
+ |> validate_required([:phrase, :context])
|> Repo.update()
end
end
diff --git a/lib/pleroma/following_relationship.ex b/lib/pleroma/following_relationship.ex
new file mode 100644
index 000000000..3a3082e72
--- /dev/null
+++ b/lib/pleroma/following_relationship.ex
@@ -0,0 +1,256 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.FollowingRelationship do
+ use Ecto.Schema
+
+ import Ecto.Changeset
+ import Ecto.Query
+
+ alias Ecto.Changeset
+ alias FlakeId.Ecto.CompatType
+ alias Pleroma.FollowingRelationship.State
+ alias Pleroma.Repo
+ alias Pleroma.User
+
+ schema "following_relationships" do
+ field(:state, State, default: :follow_pending)
+
+ belongs_to(:follower, User, type: CompatType)
+ belongs_to(:following, User, type: CompatType)
+
+ timestamps()
+ end
+
+ @doc "Returns underlying integer code for state atom"
+ def state_int_code(state_atom), do: State.__enum_map__() |> Keyword.fetch!(state_atom)
+
+ def accept_state_code, do: state_int_code(:follow_accept)
+
+ def changeset(%__MODULE__{} = following_relationship, attrs) do
+ following_relationship
+ |> cast(attrs, [:state])
+ |> put_assoc(:follower, attrs.follower)
+ |> put_assoc(:following, attrs.following)
+ |> validate_required([:state, :follower, :following])
+ |> unique_constraint(:follower_id,
+ name: :following_relationships_follower_id_following_id_index
+ )
+ |> validate_not_self_relationship()
+ end
+
+ def state_to_enum(state) when state in ["pending", "accept", "reject"] do
+ String.to_existing_atom("follow_#{state}")
+ end
+
+ def state_to_enum(state) do
+ raise "State is not convertible to Pleroma.FollowingRelationship.State: #{state}"
+ end
+
+ def get(%User{} = follower, %User{} = following) do
+ __MODULE__
+ |> where(follower_id: ^follower.id, following_id: ^following.id)
+ |> Repo.one()
+ end
+
+ def update(follower, following, :follow_reject), do: unfollow(follower, following)
+
+ def update(%User{} = follower, %User{} = following, state) do
+ case get(follower, following) do
+ nil ->
+ follow(follower, following, state)
+
+ following_relationship ->
+ following_relationship
+ |> cast(%{state: state}, [:state])
+ |> validate_required([:state])
+ |> Repo.update()
+ end
+ end
+
+ def follow(%User{} = follower, %User{} = following, state \\ :follow_accept) do
+ %__MODULE__{}
+ |> changeset(%{follower: follower, following: following, state: state})
+ |> Repo.insert(on_conflict: :nothing)
+ end
+
+ def unfollow(%User{} = follower, %User{} = following) do
+ case get(follower, following) do
+ %__MODULE__{} = following_relationship -> Repo.delete(following_relationship)
+ _ -> {:ok, nil}
+ end
+ end
+
+ def follower_count(%User{} = user) do
+ %{followers: user, deactivated: false}
+ |> User.Query.build()
+ |> Repo.aggregate(:count, :id)
+ end
+
+ def followers_query(%User{} = user) do
+ __MODULE__
+ |> join(:inner, [r], u in User, on: r.follower_id == u.id)
+ |> where([r], r.following_id == ^user.id)
+ |> where([r], r.state == ^:follow_accept)
+ end
+
+ def followers_ap_ids(%User{} = user, from_ap_ids \\ nil) do
+ query =
+ user
+ |> followers_query()
+ |> select([r, u], u.ap_id)
+
+ query =
+ if from_ap_ids do
+ where(query, [r, u], u.ap_id in ^from_ap_ids)
+ else
+ query
+ end
+
+ Repo.all(query)
+ end
+
+ def following_count(%User{id: nil}), do: 0
+
+ def following_count(%User{} = user) do
+ %{friends: user, deactivated: false}
+ |> User.Query.build()
+ |> Repo.aggregate(:count, :id)
+ end
+
+ def get_follow_requests(%User{id: id}) do
+ __MODULE__
+ |> join(:inner, [r], f in assoc(r, :follower))
+ |> where([r], r.state == ^:follow_pending)
+ |> where([r], r.following_id == ^id)
+ |> select([r, f], f)
+ |> Repo.all()
+ end
+
+ def following?(%User{id: follower_id}, %User{id: followed_id}) do
+ __MODULE__
+ |> where(follower_id: ^follower_id, following_id: ^followed_id, state: ^:follow_accept)
+ |> Repo.exists?()
+ end
+
+ def following_query(%User{} = user) do
+ __MODULE__
+ |> join(:inner, [r], u in User, on: r.following_id == u.id)
+ |> where([r], r.follower_id == ^user.id)
+ |> where([r], r.state == ^:follow_accept)
+ end
+
+ def following(%User{} = user) do
+ following =
+ following_query(user)
+ |> select([r, u], u.follower_address)
+ |> Repo.all()
+
+ if not user.local or user.invisible do
+ following
+ else
+ [user.follower_address | following]
+ end
+ end
+
+ def move_following(origin, target) do
+ __MODULE__
+ |> join(:inner, [r], f in assoc(r, :follower))
+ |> where(following_id: ^origin.id)
+ |> where([r, f], f.allow_following_move == true)
+ |> limit(50)
+ |> preload([:follower])
+ |> Repo.all()
+ |> Enum.map(fn following_relationship ->
+ Repo.delete(following_relationship)
+ Pleroma.Web.CommonAPI.follow(following_relationship.follower, target)
+ end)
+ |> case do
+ [] ->
+ User.update_follower_count(origin)
+ :ok
+
+ _ ->
+ move_following(origin, target)
+ end
+ end
+
+ def all_between_user_sets(
+ source_users,
+ target_users
+ )
+ when is_list(source_users) and is_list(target_users) do
+ source_user_ids = User.binary_id(source_users)
+ target_user_ids = User.binary_id(target_users)
+
+ __MODULE__
+ |> where(
+ fragment(
+ "(follower_id = ANY(?) AND following_id = ANY(?)) OR \
+ (follower_id = ANY(?) AND following_id = ANY(?))",
+ ^source_user_ids,
+ ^target_user_ids,
+ ^target_user_ids,
+ ^source_user_ids
+ )
+ )
+ |> Repo.all()
+ end
+
+ def find(following_relationships, follower, following) do
+ Enum.find(following_relationships, fn
+ fr -> fr.follower_id == follower.id and fr.following_id == following.id
+ end)
+ end
+
+ @doc """
+ For a query with joined activity,
+ keeps rows where activity's actor is followed by user -or- is NOT domain-blocked by user.
+ """
+ def keep_following_or_not_domain_blocked(query, user) do
+ where(
+ query,
+ [_, activity],
+ fragment(
+ # "(actor's domain NOT in domain_blocks) OR (actor IS in followed AP IDs)"
+ """
+ NOT (substring(? from '.*://([^/]*)') = ANY(?)) OR
+ ? = ANY(SELECT ap_id FROM users AS u INNER JOIN following_relationships AS fr
+ ON u.id = fr.following_id WHERE fr.follower_id = ? AND fr.state = ?)
+ """,
+ activity.actor,
+ ^user.domain_blocks,
+ activity.actor,
+ ^User.binary_id(user.id),
+ ^accept_state_code()
+ )
+ )
+ end
+
+ defp validate_not_self_relationship(%Changeset{} = changeset) do
+ changeset
+ |> validate_follower_id_following_id_inequality()
+ |> validate_following_id_follower_id_inequality()
+ end
+
+ defp validate_follower_id_following_id_inequality(%Changeset{} = changeset) do
+ validate_change(changeset, :follower_id, fn _, follower_id ->
+ if follower_id == get_field(changeset, :following_id) do
+ [source_id: "can't be equal to following_id"]
+ else
+ []
+ end
+ end)
+ end
+
+ defp validate_following_id_follower_id_inequality(%Changeset{} = changeset) do
+ validate_change(changeset, :following_id, fn _, following_id ->
+ if following_id == get_field(changeset, :follower_id) do
+ [target_id: "can't be equal to follower_id"]
+ else
+ []
+ end
+ end)
+ end
+end
diff --git a/lib/pleroma/formatter.ex b/lib/pleroma/formatter.ex
index 931b9af2b..02a93a8dc 100644
--- a/lib/pleroma/formatter.ex
+++ b/lib/pleroma/formatter.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Formatter do
@@ -13,7 +13,8 @@ defmodule Pleroma.Formatter do
@auto_linker_config hashtag: true,
hashtag_handler: &Pleroma.Formatter.hashtag_handler/4,
mention: true,
- mention_handler: &Pleroma.Formatter.mention_handler/4
+ mention_handler: &Pleroma.Formatter.mention_handler/4,
+ scheme: true
def escape_mention_handler("@" <> nickname = mention, buffer, _, _) do
case User.get_cached_by_nickname(nickname) do
@@ -30,13 +31,23 @@ defmodule Pleroma.Formatter do
def mention_handler("@" <> nickname, buffer, opts, acc) do
case User.get_cached_by_nickname(nickname) do
%User{id: id} = user ->
- ap_id = get_ap_id(user)
+ user_url = user.uri || user.ap_id
nickname_text = get_nickname_text(nickname, opts)
link =
- ~s(<span class="h-card"><a data-user="#{id}" class="u-url mention" href="#{ap_id}" rel="ugc">@<span>#{
- nickname_text
- }</span></a></span>)
+ Phoenix.HTML.Tag.content_tag(
+ :span,
+ Phoenix.HTML.Tag.content_tag(
+ :a,
+ ["@", Phoenix.HTML.Tag.content_tag(:span, nickname_text)],
+ "data-user": id,
+ class: "u-url mention",
+ href: user_url,
+ rel: "ugc"
+ ),
+ class: "h-card"
+ )
+ |> Phoenix.HTML.safe_to_string()
{link, %{acc | mentions: MapSet.put(acc.mentions, {"@" <> nickname, user})}}
@@ -48,7 +59,15 @@ defmodule Pleroma.Formatter do
def hashtag_handler("#" <> tag = tag_text, _buffer, _opts, acc) do
tag = String.downcase(tag)
url = "#{Pleroma.Web.base_url()}/tag/#{tag}"
- link = ~s(<a class="hashtag" data-tag="#{tag}" href="#{url}" rel="tag ugc">#{tag_text}</a>)
+
+ link =
+ Phoenix.HTML.Tag.content_tag(:a, tag_text,
+ class: "hashtag",
+ "data-tag": tag,
+ href: url,
+ rel: "tag ugc"
+ )
+ |> Phoenix.HTML.safe_to_string()
{link, %{acc | tags: MapSet.put(acc.tags, {tag_text, tag})}}
end
@@ -127,9 +146,6 @@ defmodule Pleroma.Formatter do
end
end
- defp get_ap_id(%User{info: %{source_data: %{"url" => url}}}) when is_binary(url), do: url
- defp get_ap_id(%User{ap_id: ap_id}), do: ap_id
-
defp get_nickname_text(nickname, %{mentions_format: :full}), do: User.full_nickname(nickname)
defp get_nickname_text(nickname, _), do: User.local_nickname(nickname)
end
diff --git a/lib/pleroma/gopher/server.ex b/lib/pleroma/gopher/server.ex
index d4e4f3e55..3d56d50a9 100644
--- a/lib/pleroma/gopher/server.ex
+++ b/lib/pleroma/gopher/server.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Gopher.Server do
diff --git a/lib/pleroma/gun/api.ex b/lib/pleroma/gun/api.ex
new file mode 100644
index 000000000..f51cd7db8
--- /dev/null
+++ b/lib/pleroma/gun/api.ex
@@ -0,0 +1,45 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Gun.API do
+ @behaviour Pleroma.Gun
+
+ alias Pleroma.Gun
+
+ @gun_keys [
+ :connect_timeout,
+ :http_opts,
+ :http2_opts,
+ :protocols,
+ :retry,
+ :retry_timeout,
+ :trace,
+ :transport,
+ :tls_opts,
+ :tcp_opts,
+ :socks_opts,
+ :ws_opts
+ ]
+
+ @impl Gun
+ def open(host, port, opts \\ %{}), do: :gun.open(host, port, Map.take(opts, @gun_keys))
+
+ @impl Gun
+ defdelegate info(pid), to: :gun
+
+ @impl Gun
+ defdelegate close(pid), to: :gun
+
+ @impl Gun
+ defdelegate await_up(pid, timeout \\ 5_000), to: :gun
+
+ @impl Gun
+ defdelegate connect(pid, opts), to: :gun
+
+ @impl Gun
+ defdelegate await(pid, ref), to: :gun
+
+ @impl Gun
+ defdelegate set_owner(pid, owner), to: :gun
+end
diff --git a/lib/pleroma/gun/conn.ex b/lib/pleroma/gun/conn.ex
new file mode 100644
index 000000000..cd25a2e74
--- /dev/null
+++ b/lib/pleroma/gun/conn.ex
@@ -0,0 +1,198 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Gun.Conn do
+ @moduledoc """
+ Struct for gun connection data
+ """
+ alias Pleroma.Gun
+ alias Pleroma.Pool.Connections
+
+ require Logger
+
+ @type gun_state :: :up | :down
+ @type conn_state :: :active | :idle
+
+ @type t :: %__MODULE__{
+ conn: pid(),
+ gun_state: gun_state(),
+ conn_state: conn_state(),
+ used_by: [pid()],
+ last_reference: pos_integer(),
+ crf: float(),
+ retries: pos_integer()
+ }
+
+ defstruct conn: nil,
+ gun_state: :open,
+ conn_state: :init,
+ used_by: [],
+ last_reference: 0,
+ crf: 1,
+ retries: 0
+
+ @spec open(String.t() | URI.t(), atom(), keyword()) :: :ok | nil
+ def open(url, name, opts \\ [])
+ def open(url, name, opts) when is_binary(url), do: open(URI.parse(url), name, opts)
+
+ def open(%URI{} = uri, name, opts) do
+ pool_opts = Pleroma.Config.get([:connections_pool], [])
+
+ opts =
+ opts
+ |> Enum.into(%{})
+ |> Map.put_new(:retry, pool_opts[:retry] || 1)
+ |> Map.put_new(:retry_timeout, pool_opts[:retry_timeout] || 1000)
+ |> Map.put_new(:await_up_timeout, pool_opts[:await_up_timeout] || 5_000)
+ |> maybe_add_tls_opts(uri)
+
+ key = "#{uri.scheme}:#{uri.host}:#{uri.port}"
+
+ max_connections = pool_opts[:max_connections] || 250
+
+ conn_pid =
+ if Connections.count(name) < max_connections do
+ do_open(uri, opts)
+ else
+ close_least_used_and_do_open(name, uri, opts)
+ end
+
+ if is_pid(conn_pid) do
+ conn = %Pleroma.Gun.Conn{
+ conn: conn_pid,
+ gun_state: :up,
+ conn_state: :active,
+ last_reference: :os.system_time(:second)
+ }
+
+ :ok = Gun.set_owner(conn_pid, Process.whereis(name))
+ Connections.add_conn(name, key, conn)
+ end
+ end
+
+ defp maybe_add_tls_opts(opts, %URI{scheme: "http"}), do: opts
+
+ defp maybe_add_tls_opts(opts, %URI{scheme: "https", host: host}) do
+ tls_opts = [
+ verify: :verify_peer,
+ cacertfile: CAStore.file_path(),
+ depth: 20,
+ reuse_sessions: false,
+ verify_fun:
+ {&:ssl_verify_hostname.verify_fun/3,
+ [check_hostname: Pleroma.HTTP.Connection.format_host(host)]}
+ ]
+
+ tls_opts =
+ if Keyword.keyword?(opts[:tls_opts]) do
+ Keyword.merge(tls_opts, opts[:tls_opts])
+ else
+ tls_opts
+ end
+
+ Map.put(opts, :tls_opts, tls_opts)
+ end
+
+ defp do_open(uri, %{proxy: {proxy_host, proxy_port}} = opts) do
+ connect_opts =
+ uri
+ |> destination_opts()
+ |> add_http2_opts(uri.scheme, Map.get(opts, :tls_opts, []))
+
+ with open_opts <- Map.delete(opts, :tls_opts),
+ {:ok, conn} <- Gun.open(proxy_host, proxy_port, open_opts),
+ {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]),
+ stream <- Gun.connect(conn, connect_opts),
+ {:response, :fin, 200, _} <- Gun.await(conn, stream) do
+ conn
+ else
+ error ->
+ Logger.warn(
+ "Opening proxied connection to #{compose_uri_log(uri)} failed with error #{
+ inspect(error)
+ }"
+ )
+
+ error
+ end
+ end
+
+ defp do_open(uri, %{proxy: {proxy_type, proxy_host, proxy_port}} = opts) do
+ version =
+ proxy_type
+ |> to_string()
+ |> String.last()
+ |> case do
+ "4" -> 4
+ _ -> 5
+ end
+
+ socks_opts =
+ uri
+ |> destination_opts()
+ |> add_http2_opts(uri.scheme, Map.get(opts, :tls_opts, []))
+ |> Map.put(:version, version)
+
+ opts =
+ opts
+ |> Map.put(:protocols, [:socks])
+ |> Map.put(:socks_opts, socks_opts)
+
+ with {:ok, conn} <- Gun.open(proxy_host, proxy_port, opts),
+ {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do
+ conn
+ else
+ error ->
+ Logger.warn(
+ "Opening socks proxied connection to #{compose_uri_log(uri)} failed with error #{
+ inspect(error)
+ }"
+ )
+
+ error
+ end
+ end
+
+ defp do_open(%URI{host: host, port: port} = uri, opts) do
+ host = Pleroma.HTTP.Connection.parse_host(host)
+
+ with {:ok, conn} <- Gun.open(host, port, opts),
+ {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do
+ conn
+ else
+ error ->
+ Logger.warn(
+ "Opening connection to #{compose_uri_log(uri)} failed with error #{inspect(error)}"
+ )
+
+ error
+ end
+ end
+
+ defp destination_opts(%URI{host: host, port: port}) do
+ host = Pleroma.HTTP.Connection.parse_host(host)
+ %{host: host, port: port}
+ end
+
+ defp add_http2_opts(opts, "https", tls_opts) do
+ Map.merge(opts, %{protocols: [:http2], transport: :tls, tls_opts: tls_opts})
+ end
+
+ defp add_http2_opts(opts, _, _), do: opts
+
+ defp close_least_used_and_do_open(name, uri, opts) do
+ with [{key, conn} | _conns] <- Connections.get_unused_conns(name),
+ :ok <- Gun.close(conn.conn) do
+ Connections.remove_conn(name, key)
+
+ do_open(uri, opts)
+ else
+ [] -> {:error, :pool_overflowed}
+ end
+ end
+
+ def compose_uri_log(%URI{scheme: scheme, host: host, path: path}) do
+ "#{scheme}://#{host}#{path}"
+ end
+end
diff --git a/lib/pleroma/gun/gun.ex b/lib/pleroma/gun/gun.ex
new file mode 100644
index 000000000..4043e4880
--- /dev/null
+++ b/lib/pleroma/gun/gun.ex
@@ -0,0 +1,31 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Gun do
+ @callback open(charlist(), pos_integer(), map()) :: {:ok, pid()}
+ @callback info(pid()) :: map()
+ @callback close(pid()) :: :ok
+ @callback await_up(pid, pos_integer()) :: {:ok, atom()} | {:error, atom()}
+ @callback connect(pid(), map()) :: reference()
+ @callback await(pid(), reference()) :: {:response, :fin, 200, []}
+ @callback set_owner(pid(), pid()) :: :ok
+
+ @api Pleroma.Config.get([Pleroma.Gun], Pleroma.Gun.API)
+
+ defp api, do: @api
+
+ def open(host, port, opts), do: api().open(host, port, opts)
+
+ def info(pid), do: api().info(pid)
+
+ def close(pid), do: api().close(pid)
+
+ def await_up(pid, timeout \\ 5_000), do: api().await_up(pid, timeout)
+
+ def connect(pid, opts), do: api().connect(pid, opts)
+
+ def await(pid, ref), do: api().await(pid, ref)
+
+ def set_owner(pid, owner), do: api().set_owner(pid, owner)
+end
diff --git a/lib/pleroma/healthcheck.ex b/lib/pleroma/healthcheck.ex
index fc2129815..92ce83cb7 100644
--- a/lib/pleroma/healthcheck.ex
+++ b/lib/pleroma/healthcheck.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Healthcheck do
@@ -29,7 +29,7 @@ defmodule Pleroma.Healthcheck do
@spec system_info() :: t()
def system_info do
%Healthcheck{
- memory_used: Float.round(:erlang.memory(:total) / 1024 / 1024, 2)
+ memory_used: Float.round(:recon_alloc.memory(:allocated) / 1024 / 1024, 2)
}
|> assign_db_info()
|> assign_job_queue_stats()
diff --git a/lib/pleroma/helpers/uri_helper.ex b/lib/pleroma/helpers/uri_helper.ex
index 8a79b44c4..256252ddb 100644
--- a/lib/pleroma/helpers/uri_helper.ex
+++ b/lib/pleroma/helpers/uri_helper.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Helpers.UriHelper do
diff --git a/lib/pleroma/html.ex b/lib/pleroma/html.ex
index 937bafed5..d78c5f202 100644
--- a/lib/pleroma/html.ex
+++ b/lib/pleroma/html.ex
@@ -1,9 +1,24 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.HTML do
- alias HtmlSanitizeEx.Scrubber
+ # Scrubbers are compiled on boot so they can be configured in OTP releases
+ # @on_load :compile_scrubbers
+
+ def compile_scrubbers do
+ dir = Path.join(:code.priv_dir(:pleroma), "scrubbers")
+
+ dir
+ |> Pleroma.Utils.compile_dir()
+ |> case do
+ {:error, _errors, _warnings} ->
+ raise "Compiling scrubbers failed"
+
+ {:ok, _modules, _warnings} ->
+ :ok
+ end
+ end
defp get_scrubbers(scrubber) when is_atom(scrubber), do: [scrubber]
defp get_scrubbers(scrubbers) when is_list(scrubbers), do: scrubbers
@@ -24,9 +39,13 @@ defmodule Pleroma.HTML do
end)
end
- def filter_tags(html, scrubber), do: Scrubber.scrub(html, scrubber)
+ def filter_tags(html, scrubber) do
+ {:ok, content} = FastSanitize.Sanitizer.scrub(html, scrubber)
+ content
+ end
+
def filter_tags(html), do: filter_tags(html, nil)
- def strip_tags(html), do: Scrubber.scrub(html, Scrubber.StripTags)
+ def strip_tags(html), do: filter_tags(html, FastSanitize.Sanitizer.StripTags)
def get_cached_scrubbed_html_for_activity(
content,
@@ -46,7 +65,7 @@ defmodule Pleroma.HTML do
def get_cached_stripped_html_for_activity(content, activity, key) do
get_cached_scrubbed_html_for_activity(
content,
- HtmlSanitizeEx.Scrubber.StripTags,
+ FastSanitize.Sanitizer.StripTags,
activity,
key,
&HtmlEntities.decode/1
@@ -89,6 +108,7 @@ defmodule Pleroma.HTML do
Cachex.fetch!(:scrubber_cache, key, fn _key ->
result =
content
+ |> Floki.parse_fragment!()
|> Floki.filter_out("a.mention,a.hashtag,a[rel~=\"tag\"]")
|> Floki.attribute("a", "href")
|> Enum.at(0)
@@ -97,218 +117,3 @@ defmodule Pleroma.HTML do
end)
end
end
-
-defmodule Pleroma.HTML.Scrubber.TwitterText do
- @moduledoc """
- An HTML scrubbing policy which limits to twitter-style text. Only
- paragraphs, breaks and links are allowed through the filter.
- """
-
- @valid_schemes Pleroma.Config.get([:uri_schemes, :valid_schemes], [])
-
- require HtmlSanitizeEx.Scrubber.Meta
- alias HtmlSanitizeEx.Scrubber.Meta
-
- Meta.remove_cdata_sections_before_scrub()
- Meta.strip_comments()
-
- # links
- Meta.allow_tag_with_uri_attributes("a", ["href", "data-user", "data-tag"], @valid_schemes)
-
- Meta.allow_tag_with_this_attribute_values("a", "class", [
- "hashtag",
- "u-url",
- "mention",
- "u-url mention",
- "mention u-url"
- ])
-
- Meta.allow_tag_with_this_attribute_values("a", "rel", [
- "tag",
- "nofollow",
- "noopener",
- "noreferrer"
- ])
-
- Meta.allow_tag_with_these_attributes("a", ["name", "title"])
-
- # paragraphs and linebreaks
- Meta.allow_tag_with_these_attributes("br", [])
- Meta.allow_tag_with_these_attributes("p", [])
-
- # microformats
- Meta.allow_tag_with_this_attribute_values("span", "class", ["h-card"])
- Meta.allow_tag_with_these_attributes("span", [])
-
- # allow inline images for custom emoji
- if Pleroma.Config.get([:markup, :allow_inline_images]) do
- # restrict img tags to http/https only, because of MediaProxy.
- Meta.allow_tag_with_uri_attributes("img", ["src"], ["http", "https"])
-
- Meta.allow_tag_with_these_attributes("img", [
- "width",
- "height",
- "class",
- "title",
- "alt"
- ])
- end
-
- Meta.strip_everything_not_covered()
-end
-
-defmodule Pleroma.HTML.Scrubber.Default do
- @doc "The default HTML scrubbing policy: no "
-
- require HtmlSanitizeEx.Scrubber.Meta
- alias HtmlSanitizeEx.Scrubber.Meta
- # credo:disable-for-previous-line
- # No idea how to fix this one…
-
- @valid_schemes Pleroma.Config.get([:uri_schemes, :valid_schemes], [])
-
- Meta.remove_cdata_sections_before_scrub()
- Meta.strip_comments()
-
- Meta.allow_tag_with_uri_attributes("a", ["href", "data-user", "data-tag"], @valid_schemes)
-
- Meta.allow_tag_with_this_attribute_values("a", "class", [
- "hashtag",
- "u-url",
- "mention",
- "u-url mention",
- "mention u-url"
- ])
-
- Meta.allow_tag_with_this_attribute_values("a", "rel", [
- "tag",
- "nofollow",
- "noopener",
- "noreferrer",
- "ugc"
- ])
-
- Meta.allow_tag_with_these_attributes("a", ["name", "title"])
-
- Meta.allow_tag_with_these_attributes("abbr", ["title"])
-
- Meta.allow_tag_with_these_attributes("b", [])
- Meta.allow_tag_with_these_attributes("blockquote", [])
- Meta.allow_tag_with_these_attributes("br", [])
- Meta.allow_tag_with_these_attributes("code", [])
- Meta.allow_tag_with_these_attributes("del", [])
- Meta.allow_tag_with_these_attributes("em", [])
- Meta.allow_tag_with_these_attributes("i", [])
- Meta.allow_tag_with_these_attributes("li", [])
- Meta.allow_tag_with_these_attributes("ol", [])
- Meta.allow_tag_with_these_attributes("p", [])
- Meta.allow_tag_with_these_attributes("pre", [])
- Meta.allow_tag_with_these_attributes("strong", [])
- Meta.allow_tag_with_these_attributes("sub", [])
- Meta.allow_tag_with_these_attributes("sup", [])
- Meta.allow_tag_with_these_attributes("u", [])
- Meta.allow_tag_with_these_attributes("ul", [])
-
- Meta.allow_tag_with_this_attribute_values("span", "class", ["h-card"])
- Meta.allow_tag_with_these_attributes("span", [])
-
- @allow_inline_images Pleroma.Config.get([:markup, :allow_inline_images])
-
- if @allow_inline_images do
- # restrict img tags to http/https only, because of MediaProxy.
- Meta.allow_tag_with_uri_attributes("img", ["src"], ["http", "https"])
-
- Meta.allow_tag_with_these_attributes("img", [
- "width",
- "height",
- "class",
- "title",
- "alt"
- ])
- end
-
- if Pleroma.Config.get([:markup, :allow_tables]) do
- Meta.allow_tag_with_these_attributes("table", [])
- Meta.allow_tag_with_these_attributes("tbody", [])
- Meta.allow_tag_with_these_attributes("td", [])
- Meta.allow_tag_with_these_attributes("th", [])
- Meta.allow_tag_with_these_attributes("thead", [])
- Meta.allow_tag_with_these_attributes("tr", [])
- end
-
- if Pleroma.Config.get([:markup, :allow_headings]) do
- Meta.allow_tag_with_these_attributes("h1", [])
- Meta.allow_tag_with_these_attributes("h2", [])
- Meta.allow_tag_with_these_attributes("h3", [])
- Meta.allow_tag_with_these_attributes("h4", [])
- Meta.allow_tag_with_these_attributes("h5", [])
- end
-
- if Pleroma.Config.get([:markup, :allow_fonts]) do
- Meta.allow_tag_with_these_attributes("font", ["face"])
- end
-
- Meta.strip_everything_not_covered()
-end
-
-defmodule Pleroma.HTML.Transform.MediaProxy do
- @moduledoc "Transforms inline image URIs to use MediaProxy."
-
- alias Pleroma.Web.MediaProxy
-
- def before_scrub(html), do: html
-
- def scrub_attribute("img", {"src", "http" <> target}) do
- media_url =
- ("http" <> target)
- |> MediaProxy.url()
-
- {"src", media_url}
- end
-
- def scrub_attribute(_tag, attribute), do: attribute
-
- def scrub({"img", attributes, children}) do
- attributes =
- attributes
- |> Enum.map(fn attr -> scrub_attribute("img", attr) end)
- |> Enum.reject(&is_nil(&1))
-
- {"img", attributes, children}
- end
-
- def scrub({:comment, _children}), do: ""
-
- def scrub({tag, attributes, children}), do: {tag, attributes, children}
- def scrub({_tag, children}), do: children
- def scrub(text), do: text
-end
-
-defmodule Pleroma.HTML.Scrubber.LinksOnly do
- @moduledoc """
- An HTML scrubbing policy which limits to links only.
- """
-
- @valid_schemes Pleroma.Config.get([:uri_schemes, :valid_schemes], [])
-
- require HtmlSanitizeEx.Scrubber.Meta
- alias HtmlSanitizeEx.Scrubber.Meta
-
- Meta.remove_cdata_sections_before_scrub()
- Meta.strip_comments()
-
- # links
- Meta.allow_tag_with_uri_attributes("a", ["href"], @valid_schemes)
-
- Meta.allow_tag_with_this_attribute_values("a", "rel", [
- "tag",
- "nofollow",
- "noopener",
- "noreferrer",
- "me",
- "ugc"
- ])
-
- Meta.allow_tag_with_these_attributes("a", ["name", "title"])
- Meta.strip_everything_not_covered()
-end
diff --git a/lib/pleroma/http/adapter_helper.ex b/lib/pleroma/http/adapter_helper.ex
new file mode 100644
index 000000000..510722ff9
--- /dev/null
+++ b/lib/pleroma/http/adapter_helper.ex
@@ -0,0 +1,41 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.HTTP.AdapterHelper do
+ alias Pleroma.HTTP.Connection
+
+ @type proxy ::
+ {Connection.host(), pos_integer()}
+ | {Connection.proxy_type(), Connection.host(), pos_integer()}
+
+ @callback options(keyword(), URI.t()) :: keyword()
+ @callback after_request(keyword()) :: :ok
+
+ @spec options(keyword(), URI.t()) :: keyword()
+ def options(opts, _uri) do
+ proxy = Pleroma.Config.get([:http, :proxy_url], nil)
+ maybe_add_proxy(opts, format_proxy(proxy))
+ end
+
+ @spec maybe_get_conn(URI.t(), keyword()) :: keyword()
+ def maybe_get_conn(_uri, opts), do: opts
+
+ @spec after_request(keyword()) :: :ok
+ def after_request(_opts), do: :ok
+
+ @spec format_proxy(String.t() | tuple() | nil) :: proxy() | nil
+ def format_proxy(nil), do: nil
+
+ def format_proxy(proxy_url) do
+ case Connection.parse_proxy(proxy_url) do
+ {:ok, host, port} -> {host, port}
+ {:ok, type, host, port} -> {type, host, port}
+ _ -> nil
+ end
+ end
+
+ @spec maybe_add_proxy(keyword(), proxy() | nil) :: keyword()
+ def maybe_add_proxy(opts, nil), do: opts
+ def maybe_add_proxy(opts, proxy), do: Keyword.put_new(opts, :proxy, proxy)
+end
diff --git a/lib/pleroma/http/adapter_helper/gun.ex b/lib/pleroma/http/adapter_helper/gun.ex
new file mode 100644
index 000000000..ead7cdc6b
--- /dev/null
+++ b/lib/pleroma/http/adapter_helper/gun.ex
@@ -0,0 +1,77 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.HTTP.AdapterHelper.Gun do
+ @behaviour Pleroma.HTTP.AdapterHelper
+
+ alias Pleroma.HTTP.AdapterHelper
+ alias Pleroma.Pool.Connections
+
+ require Logger
+
+ @defaults [
+ connect_timeout: 5_000,
+ domain_lookup_timeout: 5_000,
+ tls_handshake_timeout: 5_000,
+ retry: 1,
+ retry_timeout: 1000,
+ await_up_timeout: 5_000
+ ]
+
+ @spec options(keyword(), URI.t()) :: keyword()
+ def options(incoming_opts \\ [], %URI{} = uri) do
+ proxy =
+ Pleroma.Config.get([:http, :proxy_url])
+ |> AdapterHelper.format_proxy()
+
+ config_opts = Pleroma.Config.get([:http, :adapter], [])
+
+ @defaults
+ |> Keyword.merge(config_opts)
+ |> add_scheme_opts(uri)
+ |> AdapterHelper.maybe_add_proxy(proxy)
+ |> maybe_get_conn(uri, incoming_opts)
+ end
+
+ @spec after_request(keyword()) :: :ok
+ def after_request(opts) do
+ if opts[:conn] && opts[:body_as] != :chunks do
+ Connections.checkout(opts[:conn], self(), :gun_connections)
+ end
+
+ :ok
+ end
+
+ defp add_scheme_opts(opts, %{scheme: "http"}), do: opts
+
+ defp add_scheme_opts(opts, %{scheme: "https"}) do
+ opts
+ |> Keyword.put(:certificates_verification, true)
+ |> Keyword.put(:tls_opts, log_level: :warning)
+ end
+
+ defp maybe_get_conn(adapter_opts, uri, incoming_opts) do
+ {receive_conn?, opts} =
+ adapter_opts
+ |> Keyword.merge(incoming_opts)
+ |> Keyword.pop(:receive_conn, true)
+
+ if Connections.alive?(:gun_connections) and receive_conn? do
+ checkin_conn(uri, opts)
+ else
+ opts
+ end
+ end
+
+ defp checkin_conn(uri, opts) do
+ case Connections.checkin(uri, :gun_connections) do
+ nil ->
+ Task.start(Pleroma.Gun.Conn, :open, [uri, :gun_connections, opts])
+ opts
+
+ conn when is_pid(conn) ->
+ Keyword.merge(opts, conn: conn, close_conn: false)
+ end
+ end
+end
diff --git a/lib/pleroma/http/adapter_helper/hackney.ex b/lib/pleroma/http/adapter_helper/hackney.ex
new file mode 100644
index 000000000..dcb4cac71
--- /dev/null
+++ b/lib/pleroma/http/adapter_helper/hackney.ex
@@ -0,0 +1,43 @@
+defmodule Pleroma.HTTP.AdapterHelper.Hackney do
+ @behaviour Pleroma.HTTP.AdapterHelper
+
+ @defaults [
+ connect_timeout: 10_000,
+ recv_timeout: 20_000,
+ follow_redirect: true,
+ force_redirect: true,
+ pool: :federation
+ ]
+
+ @spec options(keyword(), URI.t()) :: keyword()
+ def options(connection_opts \\ [], %URI{} = uri) do
+ proxy = Pleroma.Config.get([:http, :proxy_url])
+
+ config_opts = Pleroma.Config.get([:http, :adapter], [])
+
+ @defaults
+ |> Keyword.merge(config_opts)
+ |> Keyword.merge(connection_opts)
+ |> add_scheme_opts(uri)
+ |> Pleroma.HTTP.AdapterHelper.maybe_add_proxy(proxy)
+ end
+
+ defp add_scheme_opts(opts, %URI{scheme: "http"}), do: opts
+
+ defp add_scheme_opts(opts, %URI{scheme: "https", host: host}) do
+ ssl_opts = [
+ ssl_options: [
+ # Workaround for remote server certificate chain issues
+ partial_chain: &:hackney_connect.partial_chain/1,
+
+ # We don't support TLS v1.3 yet
+ versions: [:tlsv1, :"tlsv1.1", :"tlsv1.2"],
+ server_name_indication: to_charlist(host)
+ ]
+ ]
+
+ Keyword.merge(opts, ssl_opts)
+ end
+
+ def after_request(_), do: :ok
+end
diff --git a/lib/pleroma/http/connection.ex b/lib/pleroma/http/connection.ex
index 7e2c6f5e8..ebacf7902 100644
--- a/lib/pleroma/http/connection.ex
+++ b/lib/pleroma/http/connection.ex
@@ -1,43 +1,124 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.HTTP.Connection do
@moduledoc """
- Connection for http-requests.
+ Configure Tesla.Client with default and customized adapter options.
"""
- @hackney_options [
- connect_timeout: 10_000,
- recv_timeout: 20_000,
- follow_redirect: true,
- force_redirect: true,
- pool: :federation
- ]
- @adapter Application.get_env(:tesla, :adapter)
+ alias Pleroma.Config
+ alias Pleroma.HTTP.AdapterHelper
- @doc """
- Configure a client connection
+ require Logger
+
+ @defaults [pool: :federation]
- # Returns
+ @type ip_address :: ipv4_address() | ipv6_address()
+ @type ipv4_address :: {0..255, 0..255, 0..255, 0..255}
+ @type ipv6_address ::
+ {0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535}
+ @type proxy_type() :: :socks4 | :socks5
+ @type host() :: charlist() | ip_address()
- Tesla.Env.client
+ @doc """
+ Merge default connection & adapter options with received ones.
"""
- @spec new(Keyword.t()) :: Tesla.Env.client()
- def new(opts \\ []) do
- Tesla.client([], {@adapter, hackney_options(opts)})
+
+ @spec options(URI.t(), keyword()) :: keyword()
+ def options(%URI{} = uri, opts \\ []) do
+ @defaults
+ |> pool_timeout()
+ |> Keyword.merge(opts)
+ |> adapter_helper().options(uri)
+ end
+
+ defp pool_timeout(opts) do
+ {config_key, default} =
+ if adapter() == Tesla.Adapter.Gun do
+ {:pools, Config.get([:pools, :default, :timeout])}
+ else
+ {:hackney_pools, 10_000}
+ end
+
+ timeout = Config.get([config_key, opts[:pool], :timeout], default)
+
+ Keyword.merge(opts, timeout: timeout)
+ end
+
+ @spec after_request(keyword()) :: :ok
+ def after_request(opts), do: adapter_helper().after_request(opts)
+
+ defp adapter, do: Application.get_env(:tesla, :adapter)
+
+ defp adapter_helper do
+ case adapter() do
+ Tesla.Adapter.Gun -> AdapterHelper.Gun
+ Tesla.Adapter.Hackney -> AdapterHelper.Hackney
+ _ -> AdapterHelper
+ end
+ end
+
+ @spec parse_proxy(String.t() | tuple() | nil) ::
+ {:ok, host(), pos_integer()}
+ | {:ok, proxy_type(), host(), pos_integer()}
+ | {:error, atom()}
+ | nil
+
+ def parse_proxy(nil), do: nil
+
+ def parse_proxy(proxy) when is_binary(proxy) do
+ with [host, port] <- String.split(proxy, ":"),
+ {port, ""} <- Integer.parse(port) do
+ {:ok, parse_host(host), port}
+ else
+ {_, _} ->
+ Logger.warn("Parsing port failed #{inspect(proxy)}")
+ {:error, :invalid_proxy_port}
+
+ :error ->
+ Logger.warn("Parsing port failed #{inspect(proxy)}")
+ {:error, :invalid_proxy_port}
+
+ _ ->
+ Logger.warn("Parsing proxy failed #{inspect(proxy)}")
+ {:error, :invalid_proxy}
+ end
+ end
+
+ def parse_proxy(proxy) when is_tuple(proxy) do
+ with {type, host, port} <- proxy do
+ {:ok, type, parse_host(host), port}
+ else
+ _ ->
+ Logger.warn("Parsing proxy failed #{inspect(proxy)}")
+ {:error, :invalid_proxy}
+ end
end
- # fetch Hackney options
- #
- def hackney_options(opts) do
- options = Keyword.get(opts, :adapter, [])
- adapter_options = Pleroma.Config.get([:http, :adapter], [])
- proxy_url = Pleroma.Config.get([:http, :proxy_url], nil)
-
- @hackney_options
- |> Keyword.merge(adapter_options)
- |> Keyword.merge(options)
- |> Keyword.merge(proxy: proxy_url)
+ @spec parse_host(String.t() | atom() | charlist()) :: charlist() | ip_address()
+ def parse_host(host) when is_list(host), do: host
+ def parse_host(host) when is_atom(host), do: to_charlist(host)
+
+ def parse_host(host) when is_binary(host) do
+ host = to_charlist(host)
+
+ case :inet.parse_address(host) do
+ {:error, :einval} -> host
+ {:ok, ip} -> ip
+ end
+ end
+
+ @spec format_host(String.t()) :: charlist()
+ def format_host(host) do
+ host_charlist = to_charlist(host)
+
+ case :inet.parse_address(host_charlist) do
+ {:error, :einval} ->
+ :idna.encode(host_charlist)
+
+ {:ok, _ip} ->
+ host_charlist
+ end
end
end
diff --git a/lib/pleroma/http/http.ex b/lib/pleroma/http/http.ex
index dec24458a..583b56484 100644
--- a/lib/pleroma/http/http.ex
+++ b/lib/pleroma/http/http.ex
@@ -1,24 +1,50 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.HTTP do
@moduledoc """
-
+ Wrapper for `Tesla.request/2`.
"""
alias Pleroma.HTTP.Connection
+ alias Pleroma.HTTP.Request
alias Pleroma.HTTP.RequestBuilder, as: Builder
+ alias Tesla.Client
+ alias Tesla.Env
+
+ require Logger
@type t :: __MODULE__
@doc """
- Builds and perform http request.
+ Performs GET request.
+
+ See `Pleroma.HTTP.request/5`
+ """
+ @spec get(Request.url() | nil, Request.headers(), keyword()) ::
+ nil | {:ok, Env.t()} | {:error, any()}
+ def get(url, headers \\ [], options \\ [])
+ def get(nil, _, _), do: nil
+ def get(url, headers, options), do: request(:get, url, "", headers, options)
+
+ @doc """
+ Performs POST request.
+
+ See `Pleroma.HTTP.request/5`
+ """
+ @spec post(Request.url(), String.t(), Request.headers(), keyword()) ::
+ {:ok, Env.t()} | {:error, any()}
+ def post(url, body, headers \\ [], options \\ []),
+ do: request(:post, url, body, headers, options)
+
+ @doc """
+ Builds and performs http request.
# Arguments:
`method` - :get, :post, :put, :delete
- `url`
- `body`
+ `url` - full url
+ `body` - request body
`headers` - a keyworld list of headers, e.g. `[{"content-type", "text/plain"}]`
`options` - custom, per-request middleware or adapter options
@@ -26,61 +52,66 @@ defmodule Pleroma.HTTP do
`{:ok, %Tesla.Env{}}` or `{:error, error}`
"""
- def request(method, url, body \\ "", headers \\ [], options \\ []) do
- try do
- options =
- process_request_options(options)
- |> process_sni_options(url)
-
- params = Keyword.get(options, :params, [])
-
- %{}
- |> Builder.method(method)
- |> Builder.headers(headers)
- |> Builder.opts(options)
- |> Builder.url(url)
- |> Builder.add_param(:body, :body, body)
- |> Builder.add_param(:query, :query, params)
- |> Enum.into([])
- |> (&Tesla.request(Connection.new(options), &1)).()
- rescue
- e ->
- {:error, e}
- catch
- :exit, e ->
- {:error, e}
- end
- end
+ @spec request(atom(), Request.url(), String.t(), Request.headers(), keyword()) ::
+ {:ok, Env.t()} | {:error, any()}
+ def request(method, url, body, headers, options) when is_binary(url) do
+ uri = URI.parse(url)
+ adapter_opts = Connection.options(uri, options[:adapter] || [])
+ options = put_in(options[:adapter], adapter_opts)
+ params = options[:params] || []
+ request = build_request(method, headers, options, url, body, params)
- defp process_sni_options(options, nil), do: options
+ adapter = Application.get_env(:tesla, :adapter)
+ client = Tesla.client([Tesla.Middleware.FollowRedirects], adapter)
- defp process_sni_options(options, url) do
- uri = URI.parse(url)
- host = uri.host |> to_charlist()
+ pid = Process.whereis(adapter_opts[:pool])
- case uri.scheme do
- "https" -> options ++ [ssl: [server_name_indication: host]]
- _ -> options
- end
- end
+ pool_alive? =
+ if adapter == Tesla.Adapter.Gun && pid do
+ Process.alive?(pid)
+ else
+ false
+ end
+
+ request_opts =
+ adapter_opts
+ |> Enum.into(%{})
+ |> Map.put(:env, Pleroma.Config.get([:env]))
+ |> Map.put(:pool_alive?, pool_alive?)
+
+ response = request(client, request, request_opts)
+
+ Connection.after_request(adapter_opts)
- def process_request_options(options) do
- Keyword.merge(Pleroma.HTTP.Connection.hackney_options([]), options)
+ response
end
- @doc """
- Performs GET request.
+ @spec request(Client.t(), keyword(), map()) :: {:ok, Env.t()} | {:error, any()}
+ def request(%Client{} = client, request, %{env: :test}), do: request(client, request)
- See `Pleroma.HTTP.request/5`
- """
- def get(url, headers \\ [], options \\ []),
- do: request(:get, url, "", headers, options)
+ def request(%Client{} = client, request, %{body_as: :chunks}), do: request(client, request)
- @doc """
- Performs POST request.
+ def request(%Client{} = client, request, %{pool_alive?: false}), do: request(client, request)
- See `Pleroma.HTTP.request/5`
- """
- def post(url, body, headers \\ [], options \\ []),
- do: request(:post, url, body, headers, options)
+ def request(%Client{} = client, request, %{pool: pool, timeout: timeout}) do
+ :poolboy.transaction(
+ pool,
+ &Pleroma.Pool.Request.execute(&1, client, request, timeout),
+ timeout
+ )
+ end
+
+ @spec request(Client.t(), keyword()) :: {:ok, Env.t()} | {:error, any()}
+ def request(client, request), do: Tesla.request(client, request)
+
+ defp build_request(method, headers, options, url, body, params) do
+ Builder.new()
+ |> Builder.method(method)
+ |> Builder.headers(headers)
+ |> Builder.opts(options)
+ |> Builder.url(url)
+ |> Builder.add_param(:body, :body, body)
+ |> Builder.add_param(:query, :query, params)
+ |> Builder.convert_to_keyword()
+ end
end
diff --git a/lib/pleroma/http/request.ex b/lib/pleroma/http/request.ex
new file mode 100644
index 000000000..761bd6ccf
--- /dev/null
+++ b/lib/pleroma/http/request.ex
@@ -0,0 +1,23 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.HTTP.Request do
+ @moduledoc """
+ Request struct.
+ """
+ defstruct method: :get, url: "", query: [], headers: [], body: "", opts: []
+
+ @type method :: :head | :get | :delete | :trace | :options | :post | :put | :patch
+ @type url :: String.t()
+ @type headers :: [{String.t(), String.t()}]
+
+ @type t :: %__MODULE__{
+ method: method(),
+ url: url(),
+ query: keyword(),
+ headers: headers(),
+ body: String.t(),
+ opts: keyword()
+ }
+end
diff --git a/lib/pleroma/http/request_builder.ex b/lib/pleroma/http/request_builder.ex
index e23457999..2fc876d92 100644
--- a/lib/pleroma/http/request_builder.ex
+++ b/lib/pleroma/http/request_builder.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.HTTP.RequestBuilder do
@@ -7,136 +7,87 @@ defmodule Pleroma.HTTP.RequestBuilder do
Helper functions for building Tesla requests
"""
- @doc """
- Specify the request method when building a request
-
- ## Parameters
-
- - request (Map) - Collected request options
- - m (atom) - Request method
-
- ## Returns
+ alias Pleroma.HTTP.Request
+ alias Tesla.Multipart
- Map
+ @doc """
+ Creates new request
"""
- @spec method(map(), atom) :: map()
- def method(request, m) do
- Map.put_new(request, :method, m)
- end
+ @spec new(Request.t()) :: Request.t()
+ def new(%Request{} = request \\ %Request{}), do: request
@doc """
Specify the request method when building a request
+ """
+ @spec method(Request.t(), Request.method()) :: Request.t()
+ def method(request, m), do: %{request | method: m}
- ## Parameters
-
- - request (Map) - Collected request options
- - u (String) - Request URL
-
- ## Returns
-
- Map
+ @doc """
+ Specify the request method when building a request
"""
- @spec url(map(), String.t()) :: map()
- def url(request, u) do
- Map.put_new(request, :url, u)
- end
+ @spec url(Request.t(), Request.url()) :: Request.t()
+ def url(request, u), do: %{request | url: u}
@doc """
Add headers to the request
"""
- @spec headers(map(), list(tuple)) :: map()
- def headers(request, header_list) do
- header_list =
+ @spec headers(Request.t(), Request.headers()) :: Request.t()
+ def headers(request, headers) do
+ headers_list =
if Pleroma.Config.get([:http, :send_user_agent]) do
- header_list ++ [{"User-Agent", Pleroma.Application.user_agent()}]
+ [{"user-agent", Pleroma.Application.user_agent()} | headers]
else
- header_list
+ headers
end
- Map.put_new(request, :headers, header_list)
+ %{request | headers: headers_list}
end
@doc """
Add custom, per-request middleware or adapter options to the request
"""
- @spec opts(map(), Keyword.t()) :: map()
- def opts(request, options) do
- Map.put_new(request, :opts, options)
- end
-
- @doc """
- Add optional parameters to the request
-
- ## Parameters
-
- - request (Map) - Collected request options
- - definitions (Map) - Map of parameter name to parameter location.
- - options (KeywordList) - The provided optional parameters
-
- ## Returns
-
- Map
- """
- @spec add_optional_params(map(), %{optional(atom) => atom}, keyword()) :: map()
- def add_optional_params(request, _, []), do: request
-
- def add_optional_params(request, definitions, [{key, value} | tail]) do
- case definitions do
- %{^key => location} ->
- request
- |> add_param(location, key, value)
- |> add_optional_params(definitions, tail)
-
- _ ->
- add_optional_params(request, definitions, tail)
- end
- end
+ @spec opts(Request.t(), keyword()) :: Request.t()
+ def opts(request, options), do: %{request | opts: options}
@doc """
Add optional parameters to the request
-
- ## Parameters
-
- - request (Map) - Collected request options
- - location (atom) - Where to put the parameter
- - key (atom) - The name of the parameter
- - value (any) - The value of the parameter
-
- ## Returns
-
- Map
"""
- @spec add_param(map(), atom, atom, any()) :: map()
- def add_param(request, :query, :query, values), do: Map.put(request, :query, values)
+ @spec add_param(Request.t(), atom(), atom(), any()) :: Request.t()
+ def add_param(request, :query, :query, values), do: %{request | query: values}
- def add_param(request, :body, :body, value), do: Map.put(request, :body, value)
+ def add_param(request, :body, :body, value), do: %{request | body: value}
def add_param(request, :body, key, value) do
request
- |> Map.put_new_lazy(:body, &Tesla.Multipart.new/0)
+ |> Map.put(:body, Multipart.new())
|> Map.update!(
:body,
- &Tesla.Multipart.add_field(
+ &Multipart.add_field(
&1,
key,
Jason.encode!(value),
- headers: [{:"Content-Type", "application/json"}]
+ headers: [{"content-type", "application/json"}]
)
)
end
def add_param(request, :file, name, path) do
request
- |> Map.put_new_lazy(:body, &Tesla.Multipart.new/0)
- |> Map.update!(:body, &Tesla.Multipart.add_file(&1, path, name: name))
+ |> Map.put(:body, Multipart.new())
+ |> Map.update!(:body, &Multipart.add_file(&1, path, name: name))
end
def add_param(request, :form, name, value) do
- request
- |> Map.update(:body, %{name => value}, &Map.put(&1, name, value))
+ Map.update(request, :body, %{name => value}, &Map.put(&1, name, value))
end
def add_param(request, location, key, value) do
Map.update(request, location, [{key, value}], &(&1 ++ [{key, value}]))
end
+
+ def convert_to_keyword(request) do
+ request
+ |> Map.from_struct()
+ |> Enum.into([])
+ end
end
diff --git a/lib/pleroma/instances.ex b/lib/pleroma/instances.ex
index 1b05d573c..557e8decf 100644
--- a/lib/pleroma/instances.ex
+++ b/lib/pleroma/instances.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Instances do
diff --git a/lib/pleroma/instances/instance.ex b/lib/pleroma/instances/instance.ex
index 544c4b687..74458c09a 100644
--- a/lib/pleroma/instances/instance.ex
+++ b/lib/pleroma/instances/instance.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Instances.Instance do
diff --git a/lib/pleroma/job_queue_monitor.ex b/lib/pleroma/job_queue_monitor.ex
index 3feea8381..2ecf261f3 100644
--- a/lib/pleroma/job_queue_monitor.ex
+++ b/lib/pleroma/job_queue_monitor.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.JobQueueMonitor do
diff --git a/lib/pleroma/keys.ex b/lib/pleroma/keys.ex
index 6dd31d3bd..c9af79f00 100644
--- a/lib/pleroma/keys.ex
+++ b/lib/pleroma/keys.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Keys do
diff --git a/lib/pleroma/list.ex b/lib/pleroma/list.ex
index 08a94c62c..89aa7b5d4 100644
--- a/lib/pleroma/list.ex
+++ b/lib/pleroma/list.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.List do
diff --git a/lib/pleroma/marker.ex b/lib/pleroma/marker.ex
index 7f87c86c3..4d82860f5 100644
--- a/lib/pleroma/marker.ex
+++ b/lib/pleroma/marker.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Marker do
@@ -9,24 +9,34 @@ defmodule Pleroma.Marker do
import Ecto.Query
alias Ecto.Multi
+ alias Pleroma.Notification
alias Pleroma.Repo
alias Pleroma.User
+ alias __MODULE__
@timelines ["notifications"]
+ @type t :: %__MODULE__{}
schema "markers" do
field(:last_read_id, :string, default: "")
field(:timeline, :string, default: "")
field(:lock_version, :integer, default: 0)
+ field(:unread_count, :integer, default: 0, virtual: true)
belongs_to(:user, User, type: FlakeId.Ecto.CompatType)
timestamps()
end
+ @doc "Gets markers by user and timeline."
+ @spec get_markers(User.t(), list(String)) :: list(t())
def get_markers(user, timelines \\ []) do
- Repo.all(get_query(user, timelines))
+ user
+ |> get_query(timelines)
+ |> unread_count_query()
+ |> Repo.all()
end
+ @spec upsert(User.t(), map()) :: {:ok | :error, any()}
def upsert(%User{} = user, attrs) do
attrs
|> Map.take(@timelines)
@@ -45,6 +55,27 @@ defmodule Pleroma.Marker do
|> Repo.transaction()
end
+ @spec multi_set_last_read_id(Multi.t(), User.t(), String.t()) :: Multi.t()
+ def multi_set_last_read_id(multi, %User{} = user, "notifications") do
+ multi
+ |> Multi.run(:counters, fn _repo, _changes ->
+ {:ok, %{last_read_id: Repo.one(Notification.last_read_query(user))}}
+ end)
+ |> Multi.insert(
+ :marker,
+ fn %{counters: attrs} ->
+ %Marker{timeline: "notifications", user_id: user.id}
+ |> struct(attrs)
+ |> Ecto.Changeset.change()
+ end,
+ returning: true,
+ on_conflict: {:replace, [:last_read_id]},
+ conflict_target: [:user_id, :timeline]
+ )
+ end
+
+ def multi_set_last_read_id(multi, _, _), do: multi
+
defp get_marker(user, timeline) do
case Repo.find_resource(get_query(user, timeline)) do
{:ok, marker} -> %__MODULE__{marker | user: user}
@@ -71,4 +102,16 @@ defmodule Pleroma.Marker do
|> by_user_id(user.id)
|> by_timeline(timelines)
end
+
+ defp unread_count_query(query) do
+ from(
+ q in query,
+ left_join: n in "notifications",
+ on: n.user_id == q.user_id and n.seen == false,
+ group_by: [:id],
+ select_merge: %{
+ unread_count: fragment("count(?)", n.id)
+ }
+ )
+ end
end
diff --git a/lib/pleroma/mfa.ex b/lib/pleroma/mfa.ex
new file mode 100644
index 000000000..2b77f5426
--- /dev/null
+++ b/lib/pleroma/mfa.ex
@@ -0,0 +1,155 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.MFA do
+ @moduledoc """
+ The MFA context.
+ """
+
+ alias Pleroma.User
+
+ alias Pleroma.MFA.BackupCodes
+ alias Pleroma.MFA.Changeset
+ alias Pleroma.MFA.Settings
+ alias Pleroma.MFA.TOTP
+
+ @doc """
+ Returns MFA methods the user has enabled.
+
+ ## Examples
+
+ iex> Pleroma.MFA.supported_method(User)
+ "totp, u2f"
+ """
+ @spec supported_methods(User.t()) :: String.t()
+ def supported_methods(user) do
+ settings = fetch_settings(user)
+
+ Settings.mfa_methods()
+ |> Enum.reduce([], fn m, acc ->
+ if method_enabled?(m, settings) do
+ acc ++ [m]
+ else
+ acc
+ end
+ end)
+ |> Enum.join(",")
+ end
+
+ @doc "Checks that user enabled MFA"
+ def require?(user) do
+ fetch_settings(user).enabled
+ end
+
+ @doc """
+ Display MFA settings of user
+ """
+ def mfa_settings(user) do
+ settings = fetch_settings(user)
+
+ Settings.mfa_methods()
+ |> Enum.map(fn m -> [m, method_enabled?(m, settings)] end)
+ |> Enum.into(%{enabled: settings.enabled}, fn [a, b] -> {a, b} end)
+ end
+
+ @doc false
+ def fetch_settings(%User{} = user) do
+ user.multi_factor_authentication_settings || %Settings{}
+ end
+
+ @doc "clears backup codes"
+ def invalidate_backup_code(%User{} = user, hash_code) do
+ %{backup_codes: codes} = fetch_settings(user)
+
+ user
+ |> Changeset.cast_backup_codes(codes -- [hash_code])
+ |> User.update_and_set_cache()
+ end
+
+ @doc "generates backup codes"
+ @spec generate_backup_codes(User.t()) :: {:ok, list(binary)} | {:error, String.t()}
+ def generate_backup_codes(%User{} = user) do
+ with codes <- BackupCodes.generate(),
+ hashed_codes <- Enum.map(codes, &Pbkdf2.hash_pwd_salt/1),
+ changeset <- Changeset.cast_backup_codes(user, hashed_codes),
+ {:ok, _} <- User.update_and_set_cache(changeset) do
+ {:ok, codes}
+ else
+ {:error, msg} ->
+ %{error: msg}
+ end
+ end
+
+ @doc """
+ Generates secret key and set delivery_type to 'app' for TOTP method.
+ """
+ @spec setup_totp(User.t()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()}
+ def setup_totp(user) do
+ user
+ |> Changeset.setup_totp(%{secret: TOTP.generate_secret(), delivery_type: "app"})
+ |> User.update_and_set_cache()
+ end
+
+ @doc """
+ Confirms the TOTP method for user.
+
+ `attrs`:
+ `password` - current user password
+ `code` - TOTP token
+ """
+ @spec confirm_totp(User.t(), map()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t() | atom()}
+ def confirm_totp(%User{} = user, attrs) do
+ with settings <- user.multi_factor_authentication_settings.totp,
+ {:ok, :pass} <- TOTP.validate_token(settings.secret, attrs["code"]) do
+ user
+ |> Changeset.confirm_totp()
+ |> User.update_and_set_cache()
+ end
+ end
+
+ @doc """
+ Disables the TOTP method for user.
+
+ `attrs`:
+ `password` - current user password
+ """
+ @spec disable_totp(User.t()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()}
+ def disable_totp(%User{} = user) do
+ user
+ |> Changeset.disable_totp()
+ |> Changeset.disable()
+ |> User.update_and_set_cache()
+ end
+
+ @doc """
+ Force disables all MFA methods for user.
+ """
+ @spec disable(User.t()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()}
+ def disable(%User{} = user) do
+ user
+ |> Changeset.disable_totp()
+ |> Changeset.disable(true)
+ |> User.update_and_set_cache()
+ end
+
+ @doc """
+ Checks if the user has MFA method enabled.
+ """
+ def method_enabled?(method, settings) do
+ with {:ok, %{confirmed: true} = _} <- Map.fetch(settings, method) do
+ true
+ else
+ _ -> false
+ end
+ end
+
+ @doc """
+ Checks if the user has enabled at least one MFA method.
+ """
+ def enabled?(settings) do
+ Settings.mfa_methods()
+ |> Enum.map(fn m -> method_enabled?(m, settings) end)
+ |> Enum.any?()
+ end
+end
diff --git a/lib/pleroma/mfa/backup_codes.ex b/lib/pleroma/mfa/backup_codes.ex
new file mode 100644
index 000000000..2b5ec34f8
--- /dev/null
+++ b/lib/pleroma/mfa/backup_codes.ex
@@ -0,0 +1,31 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.MFA.BackupCodes do
+ @moduledoc """
+ This module contains functions for generating backup codes.
+ """
+ alias Pleroma.Config
+
+ @config_ns [:instance, :multi_factor_authentication, :backup_codes]
+
+ @doc """
+ Generates backup codes.
+ """
+ @spec generate(Keyword.t()) :: list(String.t())
+ def generate(opts \\ []) do
+ number_of_codes = Keyword.get(opts, :number_of_codes, default_backup_codes_number())
+ code_length = Keyword.get(opts, :length, default_backup_codes_code_length())
+
+ Enum.map(1..number_of_codes, fn _ ->
+ :crypto.strong_rand_bytes(div(code_length, 2))
+ |> Base.encode16(case: :lower)
+ end)
+ end
+
+ defp default_backup_codes_number, do: Config.get(@config_ns ++ [:number], 5)
+
+ defp default_backup_codes_code_length,
+ do: Config.get(@config_ns ++ [:length], 16)
+end
diff --git a/lib/pleroma/mfa/changeset.ex b/lib/pleroma/mfa/changeset.ex
new file mode 100644
index 000000000..9b020aa8e
--- /dev/null
+++ b/lib/pleroma/mfa/changeset.ex
@@ -0,0 +1,64 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.MFA.Changeset do
+ alias Pleroma.MFA
+ alias Pleroma.MFA.Settings
+ alias Pleroma.User
+
+ def disable(%Ecto.Changeset{} = changeset, force \\ false) do
+ settings =
+ changeset
+ |> Ecto.Changeset.apply_changes()
+ |> MFA.fetch_settings()
+
+ if force || not MFA.enabled?(settings) do
+ put_change(changeset, %Settings{settings | enabled: false})
+ else
+ changeset
+ end
+ end
+
+ def disable_totp(%User{multi_factor_authentication_settings: settings} = user) do
+ user
+ |> put_change(%Settings{settings | totp: %Settings.TOTP{}})
+ end
+
+ def confirm_totp(%User{multi_factor_authentication_settings: settings} = user) do
+ totp_settings = %Settings.TOTP{settings.totp | confirmed: true}
+
+ user
+ |> put_change(%Settings{settings | totp: totp_settings, enabled: true})
+ end
+
+ def setup_totp(%User{} = user, attrs) do
+ mfa_settings = MFA.fetch_settings(user)
+
+ totp_settings =
+ %Settings.TOTP{}
+ |> Ecto.Changeset.cast(attrs, [:secret, :delivery_type])
+
+ user
+ |> put_change(%Settings{mfa_settings | totp: Ecto.Changeset.apply_changes(totp_settings)})
+ end
+
+ def cast_backup_codes(%User{} = user, codes) do
+ user
+ |> put_change(%Settings{
+ user.multi_factor_authentication_settings
+ | backup_codes: codes
+ })
+ end
+
+ defp put_change(%User{} = user, settings) do
+ user
+ |> Ecto.Changeset.change()
+ |> put_change(settings)
+ end
+
+ defp put_change(%Ecto.Changeset{} = changeset, settings) do
+ changeset
+ |> Ecto.Changeset.put_change(:multi_factor_authentication_settings, settings)
+ end
+end
diff --git a/lib/pleroma/mfa/settings.ex b/lib/pleroma/mfa/settings.ex
new file mode 100644
index 000000000..2764b889c
--- /dev/null
+++ b/lib/pleroma/mfa/settings.ex
@@ -0,0 +1,24 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.MFA.Settings do
+ use Ecto.Schema
+
+ @primary_key false
+
+ @mfa_methods [:totp]
+ embedded_schema do
+ field(:enabled, :boolean, default: false)
+ field(:backup_codes, {:array, :string}, default: [])
+
+ embeds_one :totp, TOTP, on_replace: :delete, primary_key: false do
+ field(:secret, :string)
+ # app | sms
+ field(:delivery_type, :string, default: "app")
+ field(:confirmed, :boolean, default: false)
+ end
+ end
+
+ def mfa_methods, do: @mfa_methods
+end
diff --git a/lib/pleroma/mfa/token.ex b/lib/pleroma/mfa/token.ex
new file mode 100644
index 000000000..25ff7fb29
--- /dev/null
+++ b/lib/pleroma/mfa/token.ex
@@ -0,0 +1,106 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.MFA.Token do
+ use Ecto.Schema
+ import Ecto.Query
+ import Ecto.Changeset
+
+ alias Pleroma.Repo
+ alias Pleroma.User
+ alias Pleroma.Web.OAuth.Authorization
+ alias Pleroma.Web.OAuth.Token, as: OAuthToken
+
+ @expires 300
+
+ schema "mfa_tokens" do
+ field(:token, :string)
+ field(:valid_until, :naive_datetime_usec)
+
+ belongs_to(:user, User, type: FlakeId.Ecto.CompatType)
+ belongs_to(:authorization, Authorization)
+
+ timestamps()
+ end
+
+ def get_by_token(token) do
+ from(
+ t in __MODULE__,
+ where: t.token == ^token,
+ preload: [:user, :authorization]
+ )
+ |> Repo.find_resource()
+ end
+
+ def validate(token) do
+ with {:fetch_token, {:ok, token}} <- {:fetch_token, get_by_token(token)},
+ {:expired, false} <- {:expired, is_expired?(token)} do
+ {:ok, token}
+ else
+ {:expired, _} -> {:error, :expired_token}
+ {:fetch_token, _} -> {:error, :not_found}
+ error -> {:error, error}
+ end
+ end
+
+ def create_token(%User{} = user) do
+ %__MODULE__{}
+ |> change
+ |> assign_user(user)
+ |> put_token
+ |> put_valid_until
+ |> Repo.insert()
+ end
+
+ def create_token(user, authorization) do
+ %__MODULE__{}
+ |> change
+ |> assign_user(user)
+ |> assign_authorization(authorization)
+ |> put_token
+ |> put_valid_until
+ |> Repo.insert()
+ end
+
+ defp assign_user(changeset, user) do
+ changeset
+ |> put_assoc(:user, user)
+ |> validate_required([:user])
+ end
+
+ defp assign_authorization(changeset, authorization) do
+ changeset
+ |> put_assoc(:authorization, authorization)
+ |> validate_required([:authorization])
+ end
+
+ defp put_token(changeset) do
+ changeset
+ |> change(%{token: OAuthToken.Utils.generate_token()})
+ |> validate_required([:token])
+ |> unique_constraint(:token)
+ end
+
+ defp put_valid_until(changeset) do
+ expires_in = NaiveDateTime.add(NaiveDateTime.utc_now(), @expires)
+
+ changeset
+ |> change(%{valid_until: expires_in})
+ |> validate_required([:valid_until])
+ end
+
+ def is_expired?(%__MODULE__{valid_until: valid_until}) do
+ NaiveDateTime.diff(NaiveDateTime.utc_now(), valid_until) > 0
+ end
+
+ def is_expired?(_), do: false
+
+ def delete_expired_tokens do
+ from(
+ q in __MODULE__,
+ where: fragment("?", q.valid_until) < ^Timex.now()
+ )
+ |> Repo.delete_all()
+ end
+end
diff --git a/lib/pleroma/mfa/totp.ex b/lib/pleroma/mfa/totp.ex
new file mode 100644
index 000000000..1407afc57
--- /dev/null
+++ b/lib/pleroma/mfa/totp.ex
@@ -0,0 +1,86 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.MFA.TOTP do
+ @moduledoc """
+ This module represents functions to create secrets for
+ TOTP Application as well as validate them with a time based token.
+ """
+ alias Pleroma.Config
+
+ @config_ns [:instance, :multi_factor_authentication, :totp]
+
+ @doc """
+ https://github.com/google/google-authenticator/wiki/Key-Uri-Format
+ """
+ def provisioning_uri(secret, label, opts \\ []) do
+ query =
+ %{
+ secret: secret,
+ issuer: Keyword.get(opts, :issuer, default_issuer()),
+ digits: Keyword.get(opts, :digits, default_digits()),
+ period: Keyword.get(opts, :period, default_period())
+ }
+ |> Enum.filter(fn {_, v} -> not is_nil(v) end)
+ |> Enum.into(%{})
+ |> URI.encode_query()
+
+ %URI{scheme: "otpauth", host: "totp", path: "/" <> label, query: query}
+ |> URI.to_string()
+ end
+
+ defp default_period, do: Config.get(@config_ns ++ [:period])
+ defp default_digits, do: Config.get(@config_ns ++ [:digits])
+
+ defp default_issuer,
+ do: Config.get(@config_ns ++ [:issuer], Config.get([:instance, :name]))
+
+ @doc "Creates a random Base 32 encoded string"
+ def generate_secret do
+ Base.encode32(:crypto.strong_rand_bytes(10))
+ end
+
+ @doc "Generates a valid token based on a secret"
+ def generate_token(secret) do
+ :pot.totp(secret)
+ end
+
+ @doc """
+ Validates a given token based on a secret.
+
+ optional parameters:
+ `token_length` default `6`
+ `interval_length` default `30`
+ `window` default 0
+
+ Returns {:ok, :pass} if the token is valid and
+ {:error, :invalid_token} if it is not.
+ """
+ @spec validate_token(String.t(), String.t()) ::
+ {:ok, :pass} | {:error, :invalid_token | :invalid_secret_and_token}
+ def validate_token(secret, token)
+ when is_binary(secret) and is_binary(token) do
+ opts = [
+ token_length: default_digits(),
+ interval_length: default_period()
+ ]
+
+ validate_token(secret, token, opts)
+ end
+
+ def validate_token(_, _), do: {:error, :invalid_secret_and_token}
+
+ @doc "See `validate_token/2`"
+ @spec validate_token(String.t(), String.t(), Keyword.t()) ::
+ {:ok, :pass} | {:error, :invalid_token | :invalid_secret_and_token}
+ def validate_token(secret, token, options)
+ when is_binary(secret) and is_binary(token) do
+ case :pot.valid_totp(token, secret, options) do
+ true -> {:ok, :pass}
+ false -> {:error, :invalid_token}
+ end
+ end
+
+ def validate_token(_, _, _), do: {:error, :invalid_secret_and_token}
+end
diff --git a/lib/pleroma/mime.ex b/lib/pleroma/mime.ex
index 36771533f..6ee055f50 100644
--- a/lib/pleroma/mime.ex
+++ b/lib/pleroma/mime.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.MIME do
@@ -9,7 +9,7 @@ defmodule Pleroma.MIME do
@default "application/octet-stream"
@read_bytes 35
- @spec file_mime_type(String.t()) ::
+ @spec file_mime_type(String.t(), String.t()) ::
{:ok, content_type :: String.t(), filename :: String.t()} | {:error, any()} | :error
def file_mime_type(path, filename) do
with {:ok, content_type} <- file_mime_type(path),
diff --git a/lib/pleroma/moderation_log.ex b/lib/pleroma/moderation_log.ex
index e8884e6e8..7aacd9d80 100644
--- a/lib/pleroma/moderation_log.ex
+++ b/lib/pleroma/moderation_log.ex
@@ -128,17 +128,35 @@ defmodule Pleroma.ModerationLog do
{:ok, ModerationLog} | {:error, any}
def insert_log(%{
actor: %User{} = actor,
- action: "report_response",
+ action: "report_note",
subject: %Activity{} = subject,
text: text
}) do
%ModerationLog{
data: %{
"actor" => user_to_map(actor),
- "action" => "report_response",
+ "action" => "report_note",
"subject" => report_to_map(subject),
- "text" => text,
- "message" => ""
+ "text" => text
+ }
+ }
+ |> insert_log_entry_with_message()
+ end
+
+ @spec insert_log(%{actor: User, subject: Activity, action: String.t(), text: String.t()}) ::
+ {:ok, ModerationLog} | {:error, any}
+ def insert_log(%{
+ actor: %User{} = actor,
+ action: "report_note_delete",
+ subject: %Activity{} = subject,
+ text: text
+ }) do
+ %ModerationLog{
+ data: %{
+ "actor" => user_to_map(actor),
+ "action" => "report_note_delete",
+ "subject" => report_to_map(subject),
+ "text" => text
}
}
|> insert_log_entry_with_message()
@@ -480,12 +498,24 @@ defmodule Pleroma.ModerationLog do
def get_log_entry_message(%ModerationLog{
data: %{
"actor" => %{"nickname" => actor_nickname},
- "action" => "report_response",
+ "action" => "report_note",
+ "subject" => %{"id" => subject_id, "type" => "report"},
+ "text" => text
+ }
+ }) do
+ "@#{actor_nickname} added note '#{text}' to report ##{subject_id}"
+ end
+
+ @spec get_log_entry_message(ModerationLog) :: String.t()
+ def get_log_entry_message(%ModerationLog{
+ data: %{
+ "actor" => %{"nickname" => actor_nickname},
+ "action" => "report_note_delete",
"subject" => %{"id" => subject_id, "type" => "report"},
"text" => text
}
}) do
- "@#{actor_nickname} responded with '#{text}' to report ##{subject_id}"
+ "@#{actor_nickname} deleted note '#{text}' from report ##{subject_id}"
end
@spec get_log_entry_message(ModerationLog) :: String.t()
@@ -540,6 +570,52 @@ defmodule Pleroma.ModerationLog do
"@#{actor_nickname} deleted status ##{subject_id}"
end
+ @spec get_log_entry_message(ModerationLog) :: String.t()
+ def get_log_entry_message(%ModerationLog{
+ data: %{
+ "actor" => %{"nickname" => actor_nickname},
+ "action" => "force_password_reset",
+ "subject" => subjects
+ }
+ }) do
+ "@#{actor_nickname} forced password reset for users: #{users_to_nicknames_string(subjects)}"
+ end
+
+ @spec get_log_entry_message(ModerationLog) :: String.t()
+ def get_log_entry_message(%ModerationLog{
+ data: %{
+ "actor" => %{"nickname" => actor_nickname},
+ "action" => "confirm_email",
+ "subject" => subjects
+ }
+ }) do
+ "@#{actor_nickname} confirmed email for users: #{users_to_nicknames_string(subjects)}"
+ end
+
+ @spec get_log_entry_message(ModerationLog) :: String.t()
+ def get_log_entry_message(%ModerationLog{
+ data: %{
+ "actor" => %{"nickname" => actor_nickname},
+ "action" => "resend_confirmation_email",
+ "subject" => subjects
+ }
+ }) do
+ "@#{actor_nickname} re-sent confirmation email for users: #{
+ users_to_nicknames_string(subjects)
+ }"
+ end
+
+ @spec get_log_entry_message(ModerationLog) :: String.t()
+ def get_log_entry_message(%ModerationLog{
+ data: %{
+ "actor" => %{"nickname" => actor_nickname},
+ "action" => "updated_users",
+ "subject" => subjects
+ }
+ }) do
+ "@#{actor_nickname} updated users: #{users_to_nicknames_string(subjects)}"
+ end
+
defp nicknames_to_string(nicknames) do
nicknames
|> Enum.map(&"@#{&1}")
diff --git a/lib/pleroma/notification.ex b/lib/pleroma/notification.ex
index e5da1492b..8aa9ed2d4 100644
--- a/lib/pleroma/notification.ex
+++ b/lib/pleroma/notification.ex
@@ -1,15 +1,19 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Notification do
use Ecto.Schema
+ alias Ecto.Multi
alias Pleroma.Activity
+ alias Pleroma.FollowingRelationship
+ alias Pleroma.Marker
alias Pleroma.Notification
alias Pleroma.Object
alias Pleroma.Pagination
alias Pleroma.Repo
+ alias Pleroma.ThreadMute
alias Pleroma.User
alias Pleroma.Web.CommonAPI.Utils
alias Pleroma.Web.Push
@@ -17,10 +21,13 @@ defmodule Pleroma.Notification do
import Ecto.Query
import Ecto.Changeset
+
require Logger
@type t :: %__MODULE__{}
+ @include_muted_option :with_muted
+
schema "notifications" do
field(:seen, :boolean, default: false)
belongs_to(:user, User, type: FlakeId.Ecto.CompatType)
@@ -29,18 +36,55 @@ defmodule Pleroma.Notification do
timestamps()
end
+ @spec unread_notifications_count(User.t()) :: integer()
+ def unread_notifications_count(%User{id: user_id}) do
+ from(q in __MODULE__,
+ where: q.user_id == ^user_id and q.seen == false
+ )
+ |> Repo.aggregate(:count, :id)
+ end
+
def changeset(%Notification{} = notification, attrs) do
notification
|> cast(attrs, [:seen])
end
- def for_user_query(user, opts \\ []) do
+ @spec last_read_query(User.t()) :: Ecto.Queryable.t()
+ def last_read_query(user) do
+ from(q in Pleroma.Notification,
+ where: q.user_id == ^user.id,
+ where: q.seen == true,
+ select: type(q.id, :string),
+ limit: 1,
+ order_by: [desc: :id]
+ )
+ end
+
+ defp for_user_query_ap_id_opts(user, opts) do
+ ap_id_relationships =
+ [:block] ++
+ if opts[@include_muted_option], do: [], else: [:notification_mute]
+
+ preloaded_ap_ids = User.outgoing_relationships_ap_ids(user, ap_id_relationships)
+
+ exclude_blocked_opts = Map.merge(%{blocked_users_ap_ids: preloaded_ap_ids[:block]}, opts)
+
+ exclude_notification_muted_opts =
+ Map.merge(%{notification_muted_users_ap_ids: preloaded_ap_ids[:notification_mute]}, opts)
+
+ {exclude_blocked_opts, exclude_notification_muted_opts}
+ end
+
+ def for_user_query(user, opts \\ %{}) do
+ {exclude_blocked_opts, exclude_notification_muted_opts} =
+ for_user_query_ap_id_opts(user, opts)
+
Notification
|> where(user_id: ^user.id)
|> where(
[n, a],
fragment(
- "? not in (SELECT ap_id FROM users WHERE info->'deactivated' @> 'true')",
+ "? not in (SELECT ap_id FROM users WHERE deactivated = 'true')",
a.actor
)
)
@@ -54,28 +98,31 @@ defmodule Pleroma.Notification do
)
)
|> preload([n, a, o], activity: {a, object: o})
- |> exclude_muted(user, opts)
- |> exclude_blocked(user)
+ |> exclude_notification_muted(user, exclude_notification_muted_opts)
+ |> exclude_blocked(user, exclude_blocked_opts)
|> exclude_visibility(opts)
end
- defp exclude_blocked(query, user) do
+ # Excludes blocked users and non-followed domain-blocked users
+ defp exclude_blocked(query, user, opts) do
+ blocked_ap_ids = opts[:blocked_users_ap_ids] || User.blocked_users_ap_ids(user)
+
query
- |> where([n, a], a.actor not in ^user.info.blocks)
- |> where(
- [n, a],
- fragment("substring(? from '.*://([^/]*)')", a.actor) not in ^user.info.domain_blocks
- )
+ |> where([n, a], a.actor not in ^blocked_ap_ids)
+ |> FollowingRelationship.keep_following_or_not_domain_blocked(user)
end
- defp exclude_muted(query, _, %{with_muted: true}) do
+ defp exclude_notification_muted(query, _, %{@include_muted_option => true}) do
query
end
- defp exclude_muted(query, user, _opts) do
+ defp exclude_notification_muted(query, user, opts) do
+ notification_muted_ap_ids =
+ opts[:notification_muted_users_ap_ids] || User.notification_muted_users_ap_ids(user)
+
query
- |> where([n, a], a.actor not in ^user.info.muted_notifications)
- |> join(:left, [n, a], tm in Pleroma.ThreadMute,
+ |> where([n, a], a.actor not in ^notification_muted_ap_ids)
+ |> join(:left, [n, a], tm in ThreadMute,
on: tm.user_id == ^user.id and tm.context == fragment("?->>'context'", a.data)
)
|> where([n, a, o, tm], is_nil(tm.user_id))
@@ -87,10 +134,28 @@ defmodule Pleroma.Notification do
when is_list(visibility) do
if Enum.all?(visibility, &(&1 in @valid_visibilities)) do
query
+ |> join(:left, [n, a], mutated_activity in Pleroma.Activity,
+ on:
+ fragment("?->>'context'", a.data) ==
+ fragment("?->>'context'", mutated_activity.data) and
+ fragment("(?->>'type' = 'Like' or ?->>'type' = 'Announce')", a.data, a.data) and
+ fragment("?->>'type'", mutated_activity.data) == "Create",
+ as: :mutated_activity
+ )
|> where(
- [n, a],
+ [n, a, mutated_activity: mutated_activity],
not fragment(
- "activity_visibility(?, ?, ?) = ANY (?)",
+ """
+ CASE WHEN (?->>'type') = 'Like' or (?->>'type') = 'Announce'
+ THEN (activity_visibility(?, ?, ?) = ANY (?))
+ ELSE (activity_visibility(?, ?, ?) = ANY (?)) END
+ """,
+ a.data,
+ a.data,
+ mutated_activity.actor,
+ mutated_activity.recipients,
+ mutated_activity.data,
+ ^visibility,
a.actor,
a.recipients,
a.data,
@@ -105,17 +170,7 @@ defmodule Pleroma.Notification do
defp exclude_visibility(query, %{exclude_visibilities: visibility})
when visibility in @valid_visibilities do
- query
- |> where(
- [n, a],
- not fragment(
- "activity_visibility(?, ?, ?) = (?)",
- a.actor,
- a.recipients,
- a.data,
- ^visibility
- )
- )
+ exclude_visibility(query, [visibility])
end
defp exclude_visibility(query, %{exclude_visibilities: visibility})
@@ -151,25 +206,23 @@ defmodule Pleroma.Notification do
|> Repo.all()
end
- def set_read_up_to(%{id: user_id} = _user, id) do
+ def set_read_up_to(%{id: user_id} = user, id) do
query =
from(
n in Notification,
where: n.user_id == ^user_id,
where: n.id <= ^id,
where: n.seen == false,
- update: [
- set: [
- seen: true,
- updated_at: ^NaiveDateTime.utc_now()
- ]
- ],
# Ideally we would preload object and activities here
# but Ecto does not support preloads in update_all
select: n.id
)
- {_, notification_ids} = Repo.update_all(query, [])
+ {:ok, %{ids: {_, notification_ids}}} =
+ Multi.new()
+ |> Multi.update_all(:ids, query, set: [seen: true, updated_at: NaiveDateTime.utc_now()])
+ |> Marker.multi_set_last_read_id(user, "notifications")
+ |> Repo.transaction()
Notification
|> where([n], n.id in ^notification_ids)
@@ -186,11 +239,18 @@ defmodule Pleroma.Notification do
|> Repo.all()
end
+ @spec read_one(User.t(), String.t()) ::
+ {:ok, Notification.t()} | {:error, Ecto.Changeset.t()} | nil
def read_one(%User{} = user, notification_id) do
with {:ok, %Notification{} = notification} <- get(user, notification_id) do
- notification
- |> changeset(%{seen: true})
- |> Repo.update()
+ Multi.new()
+ |> Multi.update(:update, changeset(notification, %{seen: true}))
+ |> Marker.multi_set_last_read_id(user, "notifications")
+ |> Repo.transaction()
+ |> case do
+ {:ok, %{update: notification}} -> {:ok, notification}
+ {:error, :update, changeset, _} -> {:error, changeset}
+ end
end
end
@@ -227,6 +287,16 @@ defmodule Pleroma.Notification do
|> Repo.delete_all()
end
+ def dismiss(%Pleroma.Activity{} = activity) do
+ Notification
+ |> where([n], n.activity_id == ^activity.id)
+ |> Repo.delete_all()
+ |> case do
+ {_, notifications} -> {:ok, notifications}
+ _ -> {:error, "Cannot dismiss notification"}
+ end
+ end
+
def dismiss(%{id: user_id} = _user, id) do
notification = Repo.get(Notification, id)
@@ -242,59 +312,159 @@ defmodule Pleroma.Notification do
def create_notifications(%Activity{data: %{"to" => _, "type" => "Create"}} = activity) do
object = Object.normalize(activity)
- unless object && object.data["type"] == "Answer" do
- users = get_notified_from_activity(activity)
- notifications = Enum.map(users, fn user -> create_notification(activity, user) end)
- {:ok, notifications}
- else
+ if object && object.data["type"] == "Answer" do
{:ok, []}
+ else
+ do_create_notifications(activity)
end
end
- def create_notifications(%Activity{data: %{"to" => _, "type" => type}} = activity)
- when type in ["Like", "Announce", "Follow"] do
- users = get_notified_from_activity(activity)
- notifications = Enum.map(users, fn user -> create_notification(activity, user) end)
- {:ok, notifications}
+ def create_notifications(%Activity{data: %{"type" => type}} = activity)
+ when type in ["Follow", "Like", "Announce", "Move", "EmojiReact"] do
+ do_create_notifications(activity)
end
def create_notifications(_), do: {:ok, []}
+ defp do_create_notifications(%Activity{} = activity) do
+ {enabled_receivers, disabled_receivers} = get_notified_from_activity(activity)
+ potential_receivers = enabled_receivers ++ disabled_receivers
+
+ notifications =
+ Enum.map(potential_receivers, fn user ->
+ do_send = user in enabled_receivers
+ create_notification(activity, user, do_send)
+ end)
+
+ {:ok, notifications}
+ end
+
# TODO move to sql, too.
- def create_notification(%Activity{} = activity, %User{} = user) do
+ def create_notification(%Activity{} = activity, %User{} = user, do_send \\ true) do
unless skip?(activity, user) do
- notification = %Notification{user_id: user.id, activity: activity}
- {:ok, notification} = Repo.insert(notification)
+ {:ok, %{notification: notification}} =
+ Multi.new()
+ |> Multi.insert(:notification, %Notification{user_id: user.id, activity: activity})
+ |> Marker.multi_set_last_read_id(user, "notifications")
+ |> Repo.transaction()
- ["user", "user:notification"]
- |> Streamer.stream(notification)
+ if do_send do
+ Streamer.stream(["user", "user:notification"], notification)
+ Push.send(notification)
+ end
- Push.send(notification)
notification
end
end
+ @doc """
+ Returns a tuple with 2 elements:
+ {notification-enabled receivers, currently disabled receivers (blocking / [thread] muting)}
+
+ NOTE: might be called for FAKE Activities, see ActivityPub.Utils.get_notified_from_object/1
+ """
+ @spec get_notified_from_activity(Activity.t(), boolean()) :: {list(User.t()), list(User.t())}
def get_notified_from_activity(activity, local_only \\ true)
- def get_notified_from_activity(
- %Activity{data: %{"to" => _, "type" => type} = _data} = activity,
- local_only
- )
- when type in ["Create", "Like", "Announce", "Follow"] do
- recipients =
- []
- |> Utils.maybe_notify_to_recipients(activity)
- |> Utils.maybe_notify_mentioned_recipients(activity)
- |> Utils.maybe_notify_subscribers(activity)
- |> Enum.uniq()
+ def get_notified_from_activity(%Activity{data: %{"type" => type}} = activity, local_only)
+ when type in ["Create", "Like", "Announce", "Follow", "Move", "EmojiReact"] do
+ potential_receiver_ap_ids = get_potential_receiver_ap_ids(activity)
+
+ potential_receivers = User.get_users_from_set(potential_receiver_ap_ids, local_only)
+
+ notification_enabled_ap_ids =
+ potential_receiver_ap_ids
+ |> exclude_domain_blocker_ap_ids(activity, potential_receivers)
+ |> exclude_relationship_restricted_ap_ids(activity)
+ |> exclude_thread_muter_ap_ids(activity)
+
+ notification_enabled_users =
+ Enum.filter(potential_receivers, fn u -> u.ap_id in notification_enabled_ap_ids end)
+
+ {notification_enabled_users, potential_receivers -- notification_enabled_users}
+ end
+
+ def get_notified_from_activity(_, _local_only), do: {[], []}
+
+ # For some activities, only notify the author of the object
+ def get_potential_receiver_ap_ids(%{data: %{"type" => type, "object" => object_id}})
+ when type in ~w{Like Announce EmojiReact} do
+ case Object.get_cached_by_ap_id(object_id) do
+ %Object{data: %{"actor" => actor}} ->
+ [actor]
+
+ _ ->
+ []
+ end
+ end
+
+ def get_potential_receiver_ap_ids(activity) do
+ []
+ |> Utils.maybe_notify_to_recipients(activity)
+ |> Utils.maybe_notify_mentioned_recipients(activity)
+ |> Utils.maybe_notify_subscribers(activity)
+ |> Utils.maybe_notify_followers(activity)
+ |> Enum.uniq()
+ end
+
+ @doc "Filters out AP IDs domain-blocking and not following the activity's actor"
+ def exclude_domain_blocker_ap_ids(ap_ids, activity, preloaded_users \\ [])
+
+ def exclude_domain_blocker_ap_ids([], _activity, _preloaded_users), do: []
- User.get_users_from_set(recipients, local_only)
+ def exclude_domain_blocker_ap_ids(ap_ids, %Activity{} = activity, preloaded_users) do
+ activity_actor_domain = activity.actor && URI.parse(activity.actor).host
+
+ users =
+ ap_ids
+ |> Enum.map(fn ap_id ->
+ Enum.find(preloaded_users, &(&1.ap_id == ap_id)) ||
+ User.get_cached_by_ap_id(ap_id)
+ end)
+ |> Enum.filter(& &1)
+
+ domain_blocker_ap_ids = for u <- users, activity_actor_domain in u.domain_blocks, do: u.ap_id
+
+ domain_blocker_follower_ap_ids =
+ if Enum.any?(domain_blocker_ap_ids) do
+ activity
+ |> Activity.user_actor()
+ |> FollowingRelationship.followers_ap_ids(domain_blocker_ap_ids)
+ else
+ []
+ end
+
+ ap_ids
+ |> Kernel.--(domain_blocker_ap_ids)
+ |> Kernel.++(domain_blocker_follower_ap_ids)
end
- def get_notified_from_activity(_, _local_only), do: []
+ @doc "Filters out AP IDs of users basing on their relationships with activity actor user"
+ def exclude_relationship_restricted_ap_ids([], _activity), do: []
+
+ def exclude_relationship_restricted_ap_ids(ap_ids, %Activity{} = activity) do
+ relationship_restricted_ap_ids =
+ activity
+ |> Activity.user_actor()
+ |> User.incoming_relationships_ungrouped_ap_ids([
+ :block,
+ :notification_mute
+ ])
+
+ Enum.uniq(ap_ids) -- relationship_restricted_ap_ids
+ end
+
+ @doc "Filters out AP IDs of users who mute activity thread"
+ def exclude_thread_muter_ap_ids([], _activity), do: []
+
+ def exclude_thread_muter_ap_ids(ap_ids, %Activity{} = activity) do
+ thread_muter_ap_ids = ThreadMute.muter_ap_ids(activity.data["context"])
+
+ Enum.uniq(ap_ids) -- thread_muter_ap_ids
+ end
@spec skip?(Activity.t(), User.t()) :: boolean()
- def skip?(activity, user) do
+ def skip?(%Activity{} = activity, %User{} = user) do
[
:self,
:followers,
@@ -303,18 +473,20 @@ defmodule Pleroma.Notification do
:non_follows,
:recently_followed
]
- |> Enum.any?(&skip?(&1, activity, user))
+ |> Enum.find(&skip?(&1, activity, user))
end
+ def skip?(_, _), do: false
+
@spec skip?(atom(), Activity.t(), User.t()) :: boolean()
- def skip?(:self, activity, user) do
+ def skip?(:self, %Activity{} = activity, %User{} = user) do
activity.data["actor"] == user.ap_id
end
def skip?(
:followers,
- activity,
- %{info: %{notification_settings: %{"followers" => false}}} = user
+ %Activity{} = activity,
+ %User{notification_settings: %{followers: false}} = user
) do
actor = activity.data["actor"]
follower = User.get_cached_by_ap_id(actor)
@@ -323,15 +495,19 @@ defmodule Pleroma.Notification do
def skip?(
:non_followers,
- activity,
- %{info: %{notification_settings: %{"non_followers" => false}}} = user
+ %Activity{} = activity,
+ %User{notification_settings: %{non_followers: false}} = user
) do
actor = activity.data["actor"]
follower = User.get_cached_by_ap_id(actor)
!User.following?(follower, user)
end
- def skip?(:follows, activity, %{info: %{notification_settings: %{"follows" => false}}} = user) do
+ def skip?(
+ :follows,
+ %Activity{} = activity,
+ %User{notification_settings: %{follows: false}} = user
+ ) do
actor = activity.data["actor"]
followed = User.get_cached_by_ap_id(actor)
User.following?(user, followed)
@@ -339,15 +515,16 @@ defmodule Pleroma.Notification do
def skip?(
:non_follows,
- activity,
- %{info: %{notification_settings: %{"non_follows" => false}}} = user
+ %Activity{} = activity,
+ %User{notification_settings: %{non_follows: false}} = user
) do
actor = activity.data["actor"]
followed = User.get_cached_by_ap_id(actor)
!User.following?(user, followed)
end
- def skip?(:recently_followed, %{data: %{"type" => "Follow"}} = activity, user) do
+ # To do: consider defining recency in hours and checking FollowingRelationship with a single SQL
+ def skip?(:recently_followed, %Activity{data: %{"type" => "Follow"}} = activity, %User{} = user) do
actor = activity.data["actor"]
Notification.for_user(user)
diff --git a/lib/pleroma/object.ex b/lib/pleroma/object.ex
index d9b41d710..ab16bf2db 100644
--- a/lib/pleroma/object.ex
+++ b/lib/pleroma/object.ex
@@ -1,10 +1,13 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Object do
use Ecto.Schema
+ import Ecto.Query
+ import Ecto.Changeset
+
alias Pleroma.Activity
alias Pleroma.Object
alias Pleroma.Object.Fetcher
@@ -12,17 +15,35 @@ defmodule Pleroma.Object do
alias Pleroma.Repo
alias Pleroma.User
- import Ecto.Query
- import Ecto.Changeset
-
require Logger
+ @type t() :: %__MODULE__{}
+
+ @derive {Jason.Encoder, only: [:data]}
+
schema "objects" do
field(:data, :map)
timestamps()
end
+ def with_joined_activity(query, activity_type \\ "Create", join_type \\ :inner) do
+ object_position = Map.get(query.aliases, :object, 0)
+
+ join(query, join_type, [{object, object_position}], a in Activity,
+ on:
+ fragment(
+ "COALESCE(?->'object'->>'id', ?->>'object') = (? ->> 'id') AND (?->>'type' = ?) ",
+ a.data,
+ a.data,
+ object.data,
+ a.data,
+ ^activity_type
+ ),
+ as: :object_activity
+ )
+ end
+
def create(data) do
Object.change(%Object{}, %{data: data})
|> Repo.insert()
@@ -62,8 +83,22 @@ defmodule Pleroma.Object do
Repo.one(from(object in Object, where: fragment("(?)->>'id' = ?", object.data, ^ap_id)))
end
+ @doc """
+ Get a single attachment by it's name and href
+ """
+ @spec get_attachment_by_name_and_href(String.t(), String.t()) :: Object.t() | nil
+ def get_attachment_by_name_and_href(name, href) do
+ query =
+ from(o in Object,
+ where: fragment("(?)->>'name' = ?", o.data, ^name),
+ where: fragment("(?)->>'href' = ?", o.data, ^href)
+ )
+
+ Repo.one(query)
+ end
+
defp warn_on_no_object_preloaded(ap_id) do
- "Object.normalize() called without preloaded object (#{ap_id}). Consider preloading the object"
+ "Object.normalize() called without preloaded object (#{inspect(ap_id)}). Consider preloading the object"
|> Logger.debug()
Logger.debug("Backtrace: #{inspect(Process.info(:erlang.self(), :current_stacktrace))}")
@@ -103,25 +138,30 @@ defmodule Pleroma.Object do
def normalize(_, _, _), do: nil
- # Owned objects can only be mutated by their owner
- def authorize_mutation(%Object{data: %{"actor" => actor}}, %User{ap_id: ap_id}),
- do: actor == ap_id
+ # Owned objects can only be accessed by their owner
+ def authorize_access(%Object{data: %{"actor" => actor}}, %User{ap_id: ap_id}) do
+ if actor == ap_id do
+ :ok
+ else
+ {:error, :forbidden}
+ end
+ end
- # Legacy objects can be mutated by anybody
- def authorize_mutation(%Object{}, %User{}), do: true
+ # Legacy objects can be accessed by anybody
+ def authorize_access(%Object{}, %User{}), do: :ok
+ @spec get_cached_by_ap_id(String.t()) :: Object.t() | nil
def get_cached_by_ap_id(ap_id) do
key = "object:#{ap_id}"
- Cachex.fetch!(:object_cache, key, fn _ ->
- object = get_by_ap_id(ap_id)
-
- if object do
- {:commit, object}
- else
- {:ignore, object}
- end
- end)
+ with {:ok, nil} <- Cachex.get(:object_cache, key),
+ object when not is_nil(object) <- get_by_ap_id(ap_id),
+ {:ok, true} <- Cachex.put(:object_cache, key, object) do
+ object
+ else
+ {:ok, object} -> object
+ nil -> nil
+ end
end
def context_mapping(context) do
@@ -147,9 +187,16 @@ defmodule Pleroma.Object do
def delete(%Object{data: %{"id" => id}} = object) do
with {:ok, _obj} = swap_object_with_tombstone(object),
- deleted_activity = Activity.delete_by_ap_id(id),
+ deleted_activity = Activity.delete_all_by_object_ap_id(id),
{:ok, true} <- Cachex.del(:object_cache, "object:#{id}"),
{:ok, _} <- Cachex.del(:web_resp_cache, URI.parse(id).path) do
+ with true <- Pleroma.Config.get([:instance, :cleanup_attachments]) do
+ {:ok, _} =
+ Pleroma.Workers.AttachmentsCleanupWorker.enqueue("cleanup_attachments", %{
+ "object" => object
+ })
+ end
+
{:ok, object, deleted_activity}
end
end
@@ -219,7 +266,7 @@ defmodule Pleroma.Object do
end
end
- def increase_vote_count(ap_id, name) do
+ def increase_vote_count(ap_id, name, actor) do
with %Object{} = object <- Object.normalize(ap_id),
"Question" <- object.data["type"] do
multiple = Map.has_key?(object.data, "anyOf")
@@ -234,12 +281,15 @@ defmodule Pleroma.Object do
option
end)
+ voters = [actor | object.data["voters"] || []] |> Enum.uniq()
+
data =
if multiple do
Map.put(object.data, "anyOf", options)
else
Map.put(object.data, "oneOf", options)
end
+ |> Map.put("voters", voters)
object
|> Object.change(%{data: data})
@@ -255,4 +305,30 @@ defmodule Pleroma.Object do
|> Object.change(%{data: Map.merge(data || %{}, attrs)})
|> Repo.update()
end
+
+ def local?(%Object{data: %{"id" => id}}) do
+ String.starts_with?(id, Pleroma.Web.base_url() <> "/")
+ end
+
+ def replies(object, opts \\ []) do
+ object = Object.normalize(object)
+
+ query =
+ Object
+ |> where(
+ [o],
+ fragment("(?)->>'inReplyTo' = ?", o.data, ^object.data["id"])
+ )
+ |> order_by([o], asc: o.id)
+
+ if opts[:self_only] do
+ actor = object.data["actor"]
+ where(query, [o], fragment("(?)->>'actor' = ?", o.data, ^actor))
+ else
+ query
+ end
+ end
+
+ def self_replies(object, opts \\ []),
+ do: replies(object, Keyword.put(opts, :self_only, true))
end
diff --git a/lib/pleroma/object/containment.ex b/lib/pleroma/object/containment.ex
index 68535c09e..99608b8a5 100644
--- a/lib/pleroma/object/containment.ex
+++ b/lib/pleroma/object/containment.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Object.Containment do
@@ -32,6 +32,18 @@ defmodule Pleroma.Object.Containment do
get_actor(%{"actor" => actor})
end
+ def get_object(%{"object" => id}) when is_binary(id) do
+ id
+ end
+
+ def get_object(%{"object" => %{"id" => id}}) when is_binary(id) do
+ id
+ end
+
+ def get_object(_) do
+ nil
+ end
+
# TODO: We explicitly allow 'tag' URIs through, due to references to legacy OStatus
# objects being present in the test suite environment. Once these objects are
# removed, please also remove this.
@@ -39,15 +51,8 @@ defmodule Pleroma.Object.Containment do
defp compare_uris(_, %URI{scheme: "tag"}), do: :ok
end
- defp compare_uris(%URI{} = id_uri, %URI{} = other_uri) do
- if id_uri.host == other_uri.host do
- :ok
- else
- :error
- end
- end
-
- defp compare_uris(_, _), do: :error
+ defp compare_uris(%URI{host: host} = _id_uri, %URI{host: host} = _other_uri), do: :ok
+ defp compare_uris(_id_uri, _other_uri), do: :error
@doc """
Checks that an imported AP object's actor matches the domain it came from.
@@ -64,15 +69,17 @@ defmodule Pleroma.Object.Containment do
def contain_origin(id, %{"attributedTo" => actor} = params),
do: contain_origin(id, Map.put(params, "actor", actor))
- def contain_origin_from_id(_id, %{"id" => nil}), do: :error
+ def contain_origin(_id, _data), do: :error
- def contain_origin_from_id(id, %{"id" => other_id} = _params) do
+ def contain_origin_from_id(id, %{"id" => other_id} = _params) when is_binary(other_id) do
id_uri = URI.parse(id)
other_uri = URI.parse(other_id)
compare_uris(id_uri, other_uri)
end
+ def contain_origin_from_id(_id, _data), do: :error
+
def contain_child(%{"object" => %{"id" => id, "attributedTo" => _} = object}),
do: contain_origin(id, object)
diff --git a/lib/pleroma/object/fetcher.ex b/lib/pleroma/object/fetcher.ex
index 7758cb90b..263ded5dd 100644
--- a/lib/pleroma/object/fetcher.ex
+++ b/lib/pleroma/object/fetcher.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Object.Fetcher do
@@ -10,6 +10,7 @@ defmodule Pleroma.Object.Fetcher do
alias Pleroma.Signature
alias Pleroma.Web.ActivityPub.InternalFetchActor
alias Pleroma.Web.ActivityPub.Transmogrifier
+ alias Pleroma.Web.Federator
require Logger
require Pleroma.Constants
@@ -38,7 +39,8 @@ defmodule Pleroma.Object.Fetcher do
data <- maybe_reinject_internal_fields(data, struct),
changeset <- Object.change(struct, %{data: data}),
changeset <- touch_changeset(changeset),
- {:ok, object} <- Repo.insert_or_update(changeset) do
+ {:ok, object} <- Repo.insert_or_update(changeset),
+ {:ok, object} <- Object.set_cache(object) do
{:ok, object}
else
e ->
@@ -48,30 +50,33 @@ defmodule Pleroma.Object.Fetcher do
end
def refetch_object(%Object{data: %{"id" => id}} = object) do
- with {:local, false} <- {:local, String.starts_with?(id, Pleroma.Web.base_url() <> "/")},
+ with {:local, false} <- {:local, Object.local?(object)},
{:ok, data} <- fetch_and_contain_remote_object_from_id(id),
{:ok, object} <- reinject_object(object, data) do
{:ok, object}
else
- {:local, true} -> object
+ {:local, true} -> {:ok, object}
e -> {:error, e}
end
end
- # TODO:
- # This will create a Create activity, which we need internally at the moment.
+ # Note: will create a Create activity, which we need internally at the moment.
def fetch_object_from_id(id, options \\ []) do
- with {:fetch_object, nil} <- {:fetch_object, Object.get_cached_by_ap_id(id)},
- {:fetch, {:ok, data}} <- {:fetch, fetch_and_contain_remote_object_from_id(id)},
- {:normalize, nil} <- {:normalize, Object.normalize(data, false)},
+ with {_, nil} <- {:fetch_object, Object.get_cached_by_ap_id(id)},
+ {_, true} <- {:allowed_depth, Federator.allowed_thread_distance?(options[:depth])},
+ {_, {:ok, data}} <- {:fetch, fetch_and_contain_remote_object_from_id(id)},
+ {_, nil} <- {:normalize, Object.normalize(data, false)},
params <- prepare_activity_params(data),
- {:containment, :ok} <- {:containment, Containment.contain_origin(id, params)},
- {:transmogrifier, {:ok, activity}} <-
+ {_, :ok} <- {:containment, Containment.contain_origin(id, params)},
+ {_, {:ok, activity}} <-
{:transmogrifier, Transmogrifier.handle_incoming(params, options)},
- {:object, _data, %Object{} = object} <-
+ {_, _data, %Object{} = object} <-
{:object, data, Object.normalize(activity, false)} do
{:ok, object}
else
+ {:allowed_depth, false} ->
+ {:error, "Max thread distance exceeded."}
+
{:containment, _} ->
{:error, "Object containment failed."}
@@ -90,6 +95,9 @@ defmodule Pleroma.Object.Fetcher do
{:fetch_object, %Object{} = object} ->
{:ok, object}
+ {:fetch, {:error, error}} ->
+ {:error, error}
+
e ->
e
end
@@ -110,6 +118,12 @@ defmodule Pleroma.Object.Fetcher do
with {:ok, object} <- fetch_object_from_id(id, options) do
object
else
+ {:error, %Tesla.Mock.Error{}} ->
+ nil
+
+ {:error, "Object has been deleted"} ->
+ nil
+
e ->
Logger.error("Error while fetching #{id}: #{inspect(e)}")
nil
@@ -127,7 +141,7 @@ defmodule Pleroma.Object.Fetcher do
date: date
})
- [{:Signature, signature}]
+ [{"signature", signature}]
end
defp sign_fetch(headers, id, date) do
@@ -140,19 +154,19 @@ defmodule Pleroma.Object.Fetcher do
defp maybe_date_fetch(headers, date) do
if Pleroma.Config.get([:activitypub, :sign_object_fetches]) do
- headers ++ [{:Date, date}]
+ headers ++ [{"date", date}]
else
headers
end
end
def fetch_and_contain_remote_object_from_id(id) when is_binary(id) do
- Logger.info("Fetching object #{id} via AP")
+ Logger.debug("Fetching object #{id} via AP")
date = Pleroma.Signature.signed_date()
headers =
- [{:Accept, "application/activity+json"}]
+ [{"accept", "application/activity+json"}]
|> maybe_date_fetch(date)
|> sign_fetch(id, date)
@@ -170,6 +184,9 @@ defmodule Pleroma.Object.Fetcher do
{:scheme, _} ->
{:error, "Unsupported URI scheme"}
+ {:error, e} ->
+ {:error, e}
+
e ->
{:error, e}
end
diff --git a/lib/pleroma/object_tombstone.ex b/lib/pleroma/object_tombstone.ex
index fe947ffd3..e26f44057 100644
--- a/lib/pleroma/object_tombstone.ex
+++ b/lib/pleroma/object_tombstone.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.ObjectTombstone do
diff --git a/lib/pleroma/otp_version.ex b/lib/pleroma/otp_version.ex
new file mode 100644
index 000000000..114d0054f
--- /dev/null
+++ b/lib/pleroma/otp_version.ex
@@ -0,0 +1,28 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.OTPVersion do
+ @spec version() :: String.t() | nil
+ def version do
+ # OTP Version https://erlang.org/doc/system_principles/versions.html#otp-version
+ [
+ Path.join(:code.root_dir(), "OTP_VERSION"),
+ Path.join([:code.root_dir(), "releases", :erlang.system_info(:otp_release), "OTP_VERSION"])
+ ]
+ |> get_version_from_files()
+ end
+
+ @spec get_version_from_files([Path.t()]) :: String.t() | nil
+ def get_version_from_files([]), do: nil
+
+ def get_version_from_files([path | paths]) do
+ if File.exists?(path) do
+ path
+ |> File.read!()
+ |> String.replace(~r/\r|\n|\s/, "")
+ else
+ get_version_from_files(paths)
+ end
+ end
+end
diff --git a/lib/pleroma/pagination.ex b/lib/pleroma/pagination.ex
index 9d279fba7..d43a96cd2 100644
--- a/lib/pleroma/pagination.ex
+++ b/lib/pleroma/pagination.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Pagination do
@@ -12,61 +12,72 @@ defmodule Pleroma.Pagination do
alias Pleroma.Repo
+ @type type :: :keyset | :offset
+
@default_limit 20
+ @max_limit 40
+ @page_keys ["max_id", "min_id", "limit", "since_id", "order"]
+
+ def page_keys, do: @page_keys
- def fetch_paginated(query, params, type \\ :keyset)
+ @spec fetch_paginated(Ecto.Query.t(), map(), type(), atom() | nil) :: [Ecto.Schema.t()]
+ def fetch_paginated(query, params, type \\ :keyset, table_binding \\ nil)
- def fetch_paginated(query, %{"total" => true} = params, :keyset) do
+ def fetch_paginated(query, %{"total" => true} = params, :keyset, table_binding) do
total = Repo.aggregate(query, :count, :id)
%{
total: total,
- items: fetch_paginated(query, Map.drop(params, ["total"]), :keyset)
+ items: fetch_paginated(query, Map.drop(params, ["total"]), :keyset, table_binding)
}
end
- def fetch_paginated(query, params, :keyset) do
+ def fetch_paginated(query, params, :keyset, table_binding) do
options = cast_params(params)
query
- |> paginate(options, :keyset)
+ |> paginate(options, :keyset, table_binding)
|> Repo.all()
|> enforce_order(options)
end
- def fetch_paginated(query, %{"total" => true} = params, :offset) do
- total = Repo.aggregate(query, :count, :id)
+ def fetch_paginated(query, %{"total" => true} = params, :offset, table_binding) do
+ total =
+ query
+ |> Ecto.Query.exclude(:left_join)
+ |> Repo.aggregate(:count, :id)
%{
total: total,
- items: fetch_paginated(query, Map.drop(params, ["total"]), :offset)
+ items: fetch_paginated(query, Map.drop(params, ["total"]), :offset, table_binding)
}
end
- def fetch_paginated(query, params, :offset) do
+ def fetch_paginated(query, params, :offset, table_binding) do
options = cast_params(params)
query
- |> paginate(options, :offset)
+ |> paginate(options, :offset, table_binding)
|> Repo.all()
end
- def paginate(query, options, method \\ :keyset)
+ @spec paginate(Ecto.Query.t(), map(), type(), atom() | nil) :: [Ecto.Schema.t()]
+ def paginate(query, options, method \\ :keyset, table_binding \\ nil)
- def paginate(query, options, :keyset) do
+ def paginate(query, options, :keyset, table_binding) do
query
- |> restrict(:min_id, options)
- |> restrict(:since_id, options)
- |> restrict(:max_id, options)
- |> restrict(:order, options)
- |> restrict(:limit, options)
+ |> restrict(:min_id, options, table_binding)
+ |> restrict(:since_id, options, table_binding)
+ |> restrict(:max_id, options, table_binding)
+ |> restrict(:order, options, table_binding)
+ |> restrict(:limit, options, table_binding)
end
- def paginate(query, options, :offset) do
+ def paginate(query, options, :offset, table_binding) do
query
- |> restrict(:order, options)
- |> restrict(:offset, options)
- |> restrict(:limit, options)
+ |> restrict(:order, options, table_binding)
+ |> restrict(:offset, options, table_binding)
+ |> restrict(:limit, options, table_binding)
end
defp cast_params(params) do
@@ -75,7 +86,8 @@ defmodule Pleroma.Pagination do
since_id: :string,
max_id: :string,
offset: :integer,
- limit: :integer
+ limit: :integer,
+ skip_order: :boolean
}
params =
@@ -88,38 +100,52 @@ defmodule Pleroma.Pagination do
changeset.changes
end
- defp restrict(query, :min_id, %{min_id: min_id}) do
- where(query, [q], q.id > ^min_id)
+ defp restrict(query, :min_id, %{min_id: min_id}, table_binding) do
+ where(query, [{q, table_position(query, table_binding)}], q.id > ^min_id)
end
- defp restrict(query, :since_id, %{since_id: since_id}) do
- where(query, [q], q.id > ^since_id)
+ defp restrict(query, :since_id, %{since_id: since_id}, table_binding) do
+ where(query, [{q, table_position(query, table_binding)}], q.id > ^since_id)
end
- defp restrict(query, :max_id, %{max_id: max_id}) do
- where(query, [q], q.id < ^max_id)
+ defp restrict(query, :max_id, %{max_id: max_id}, table_binding) do
+ where(query, [{q, table_position(query, table_binding)}], q.id < ^max_id)
end
- defp restrict(query, :order, %{min_id: _}) do
- order_by(query, [u], fragment("? asc nulls last", u.id))
+ defp restrict(query, :order, %{skip_order: true}, _), do: query
+
+ defp restrict(query, :order, %{min_id: _}, table_binding) do
+ order_by(
+ query,
+ [{u, table_position(query, table_binding)}],
+ fragment("? asc nulls last", u.id)
+ )
end
- defp restrict(query, :order, _options) do
- order_by(query, [u], fragment("? desc nulls last", u.id))
+ defp restrict(query, :order, _options, table_binding) do
+ order_by(
+ query,
+ [{u, table_position(query, table_binding)}],
+ fragment("? desc nulls last", u.id)
+ )
end
- defp restrict(query, :offset, %{offset: offset}) do
+ defp restrict(query, :offset, %{offset: offset}, _table_binding) do
offset(query, ^offset)
end
- defp restrict(query, :limit, options) do
- limit = Map.get(options, :limit, @default_limit)
+ defp restrict(query, :limit, options, _table_binding) do
+ limit =
+ case Map.get(options, :limit, @default_limit) do
+ limit when limit < @max_limit -> limit
+ _ -> @max_limit
+ end
query
|> limit(^limit)
end
- defp restrict(query, _, _), do: query
+ defp restrict(query, _, _, _), do: query
defp enforce_order(result, %{min_id: _}) do
result
@@ -127,4 +153,10 @@ defmodule Pleroma.Pagination do
end
defp enforce_order(result, _), do: result
+
+ defp table_position(%Ecto.Query{} = query, binding_name) do
+ Map.get(query.aliases, binding_name, 0)
+ end
+
+ defp table_position(_, _), do: 0
end
diff --git a/lib/pleroma/password_reset_token.ex b/lib/pleroma/password_reset_token.ex
index db398b1fc..787bd4781 100644
--- a/lib/pleroma/password_reset_token.ex
+++ b/lib/pleroma/password_reset_token.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.PasswordResetToken do
diff --git a/lib/pleroma/plugs/admin_secret_authentication_plug.ex b/lib/pleroma/plugs/admin_secret_authentication_plug.ex
index 5baf8a691..b4b47a31f 100644
--- a/lib/pleroma/plugs/admin_secret_authentication_plug.ex
+++ b/lib/pleroma/plugs/admin_secret_authentication_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.AdminSecretAuthenticationPlug do
@@ -16,14 +16,28 @@ defmodule Pleroma.Plugs.AdminSecretAuthenticationPlug do
def call(%{assigns: %{user: %User{}}} = conn, _), do: conn
- def call(%{params: %{"admin_token" => admin_token}} = conn, _) do
- if secret_token() && admin_token == secret_token() do
+ def call(conn, _) do
+ if secret_token() do
+ authenticate(conn)
+ else
conn
- |> assign(:user, %User{info: %{is_admin: true}})
+ end
+ end
+
+ def authenticate(%{params: %{"admin_token" => admin_token}} = conn) do
+ if admin_token == secret_token() do
+ assign(conn, :user, %User{is_admin: true})
else
conn
end
end
- def call(conn, _), do: conn
+ def authenticate(conn) do
+ token = secret_token()
+
+ case get_req_header(conn, "x-admin-token") do
+ [^token] -> assign(conn, :user, %User{is_admin: true})
+ _ -> conn
+ end
+ end
end
diff --git a/lib/pleroma/plugs/authentication_plug.ex b/lib/pleroma/plugs/authentication_plug.ex
index 567674a0b..057ea42f1 100644
--- a/lib/pleroma/plugs/authentication_plug.ex
+++ b/lib/pleroma/plugs/authentication_plug.ex
@@ -1,11 +1,13 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.AuthenticationPlug do
- alias Comeonin.Pbkdf2
- import Plug.Conn
+ alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.User
+
+ import Plug.Conn
+
require Logger
def init(options), do: options
@@ -14,8 +16,13 @@ defmodule Pleroma.Plugs.AuthenticationPlug do
:crypt.crypt(password, password_hash) == password_hash
end
+ def checkpw(password, "$2" <> _ = password_hash) do
+ # Handle bcrypt passwords for Mastodon migration
+ Bcrypt.verify_pass(password, password_hash)
+ end
+
def checkpw(password, "$pbkdf2" <> _ = password_hash) do
- Pbkdf2.checkpw(password, password_hash)
+ Pbkdf2.verify_pass(password, password_hash)
end
def checkpw(_password, _password_hash) do
@@ -23,6 +30,25 @@ defmodule Pleroma.Plugs.AuthenticationPlug do
false
end
+ def maybe_update_password(%User{password_hash: "$2" <> _} = user, password) do
+ do_update_password(user, password)
+ end
+
+ def maybe_update_password(%User{password_hash: "$6" <> _} = user, password) do
+ do_update_password(user, password)
+ end
+
+ def maybe_update_password(user, _), do: {:ok, user}
+
+ defp do_update_password(user, password) do
+ user
+ |> User.password_update_changeset(%{
+ "password" => password,
+ "password_confirmation" => password
+ })
+ |> Pleroma.Repo.update()
+ end
+
def call(%{assigns: %{user: %User{}}} = conn, _), do: conn
def call(
@@ -34,16 +60,19 @@ defmodule Pleroma.Plugs.AuthenticationPlug do
} = conn,
_
) do
- if Pbkdf2.checkpw(password, password_hash) do
+ if checkpw(password, password_hash) do
+ {:ok, auth_user} = maybe_update_password(auth_user, password)
+
conn
|> assign(:user, auth_user)
+ |> OAuthScopesPlug.skip_plug()
else
conn
end
end
def call(%{assigns: %{auth_credentials: %{password: _}}} = conn, _) do
- Pbkdf2.dummy_checkpw()
+ Pbkdf2.no_user_verify()
conn
end
diff --git a/lib/pleroma/plugs/basic_auth_decoder_plug.ex b/lib/pleroma/plugs/basic_auth_decoder_plug.ex
index 7eeeb1e5d..af7ecb0d8 100644
--- a/lib/pleroma/plugs/basic_auth_decoder_plug.ex
+++ b/lib/pleroma/plugs/basic_auth_decoder_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.BasicAuthDecoderPlug do
diff --git a/lib/pleroma/plugs/cache.ex b/lib/pleroma/plugs/cache.ex
index 50b534e7b..f65c2a189 100644
--- a/lib/pleroma/plugs/cache.ex
+++ b/lib/pleroma/plugs/cache.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.Cache do
diff --git a/lib/pleroma/plugs/digest.ex b/lib/pleroma/plugs/digest.ex
index 0ba00845a..b521b3073 100644
--- a/lib/pleroma/plugs/digest.ex
+++ b/lib/pleroma/plugs/digest.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Plugs.DigestPlug do
diff --git a/lib/pleroma/plugs/ensure_authenticated_plug.ex b/lib/pleroma/plugs/ensure_authenticated_plug.ex
index 27cd41aec..3fe550806 100644
--- a/lib/pleroma/plugs/ensure_authenticated_plug.ex
+++ b/lib/pleroma/plugs/ensure_authenticated_plug.ex
@@ -1,23 +1,41 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.EnsureAuthenticatedPlug do
import Plug.Conn
import Pleroma.Web.TranslationHelpers
+
alias Pleroma.User
+ use Pleroma.Web, :plug
+
def init(options) do
options
end
- def call(%{assigns: %{user: %User{}}} = conn, _) do
+ @impl true
+ def perform(
+ %{
+ assigns: %{
+ auth_credentials: %{password: _},
+ user: %User{multi_factor_authentication_settings: %{enabled: true}}
+ }
+ } = conn,
+ _
+ ) do
+ conn
+ |> render_error(:forbidden, "Two-factor authentication enabled, you must use a access token.")
+ |> halt()
+ end
+
+ def perform(%{assigns: %{user: %User{}}} = conn, _) do
conn
end
- def call(conn, _) do
+ def perform(conn, _) do
conn
|> render_error(:forbidden, "Invalid credentials.")
- |> halt
+ |> halt()
end
end
diff --git a/lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex b/lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex
index a16f61435..7265bb87a 100644
--- a/lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex
+++ b/lib/pleroma/plugs/ensure_public_or_authenticated_plug.ex
@@ -1,18 +1,22 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug do
import Pleroma.Web.TranslationHelpers
import Plug.Conn
+
alias Pleroma.Config
alias Pleroma.User
+ use Pleroma.Web, :plug
+
def init(options) do
options
end
- def call(conn, _) do
+ @impl true
+ def perform(conn, _) do
public? = Config.get!([:instance, :public])
case {public?, conn} do
diff --git a/lib/pleroma/plugs/ensure_user_key_plug.ex b/lib/pleroma/plugs/ensure_user_key_plug.ex
index c88ebfb3f..9795cdbde 100644
--- a/lib/pleroma/plugs/ensure_user_key_plug.ex
+++ b/lib/pleroma/plugs/ensure_user_key_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.EnsureUserKeyPlug do
diff --git a/lib/pleroma/plugs/expect_authenticated_check_plug.ex b/lib/pleroma/plugs/expect_authenticated_check_plug.ex
new file mode 100644
index 000000000..66b8d5de5
--- /dev/null
+++ b/lib/pleroma/plugs/expect_authenticated_check_plug.ex
@@ -0,0 +1,20 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Plugs.ExpectAuthenticatedCheckPlug do
+ @moduledoc """
+ Marks `Pleroma.Plugs.EnsureAuthenticatedPlug` as expected to be executed later in plug chain.
+
+ No-op plug which affects `Pleroma.Web` operation (is checked with `PlugHelper.plug_called?/2`).
+ """
+
+ use Pleroma.Web, :plug
+
+ def init(options), do: options
+
+ @impl true
+ def perform(conn, _) do
+ conn
+ end
+end
diff --git a/lib/pleroma/plugs/expect_public_or_authenticated_check_plug.ex b/lib/pleroma/plugs/expect_public_or_authenticated_check_plug.ex
new file mode 100644
index 000000000..ba0ef76bd
--- /dev/null
+++ b/lib/pleroma/plugs/expect_public_or_authenticated_check_plug.ex
@@ -0,0 +1,21 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug do
+ @moduledoc """
+ Marks `Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug` as expected to be executed later in plug
+ chain.
+
+ No-op plug which affects `Pleroma.Web` operation (is checked with `PlugHelper.plug_called?/2`).
+ """
+
+ use Pleroma.Web, :plug
+
+ def init(options), do: options
+
+ @impl true
+ def perform(conn, _) do
+ conn
+ end
+end
diff --git a/lib/pleroma/plugs/federating_plug.ex b/lib/pleroma/plugs/federating_plug.ex
index 4dc4e9279..09038f3c6 100644
--- a/lib/pleroma/plugs/federating_plug.ex
+++ b/lib/pleroma/plugs/federating_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.FederatingPlug do
@@ -10,14 +10,23 @@ defmodule Pleroma.Web.FederatingPlug do
end
def call(conn, _opts) do
- if Pleroma.Config.get([:instance, :federating]) do
+ if federating?() do
conn
else
- conn
- |> put_status(404)
- |> Phoenix.Controller.put_view(Pleroma.Web.ErrorView)
- |> Phoenix.Controller.render("404.json")
- |> halt()
+ fail(conn)
end
end
+
+ def federating?, do: Pleroma.Config.get([:instance, :federating])
+
+ # Definition for the use in :if_func / :unless_func plug options
+ def federating?(_conn), do: federating?()
+
+ defp fail(conn) do
+ conn
+ |> put_status(404)
+ |> Phoenix.Controller.put_view(Pleroma.Web.ErrorView)
+ |> Phoenix.Controller.render("404.json")
+ |> halt()
+ end
end
diff --git a/lib/pleroma/plugs/http_security_plug.ex b/lib/pleroma/plugs/http_security_plug.ex
index a7cc22831..6462797b6 100644
--- a/lib/pleroma/plugs/http_security_plug.ex
+++ b/lib/pleroma/plugs/http_security_plug.ex
@@ -1,11 +1,13 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.HTTPSecurityPlug do
alias Pleroma.Config
import Plug.Conn
+ require Logger
+
def init(opts), do: opts
def call(conn, _options) do
@@ -73,7 +75,7 @@ defmodule Pleroma.Plugs.HTTPSecurityPlug do
"default-src 'none'",
"base-uri 'self'",
"frame-ancestors 'none'",
- "img-src 'self' data: https:",
+ "img-src 'self' data: blob: https:",
"media-src 'self' https:",
"style-src 'self' 'unsafe-inline'",
"font-src 'self'",
@@ -90,6 +92,51 @@ defmodule Pleroma.Plugs.HTTPSecurityPlug do
|> Enum.join("; ")
end
+ def warn_if_disabled do
+ unless Config.get([:http_security, :enabled]) do
+ Logger.warn("
+ .i;;;;i.
+ iYcviii;vXY:
+ .YXi .i1c.
+ .YC. . in7.
+ .vc. ...... ;1c.
+ i7, .. .;1;
+ i7, .. ... .Y1i
+ ,7v .6MMM@; .YX,
+ .7;. ..IMMMMMM1 :t7.
+ .;Y. ;$MMMMMM9. :tc.
+ vY. .. .nMMM@MMU. ;1v.
+ i7i ... .#MM@M@C. .....:71i
+ it: .... $MMM@9;.,i;;;i,;tti
+ :t7. ..... 0MMMWv.,iii:::,,;St.
+ .nC. ..... IMMMQ..,::::::,.,czX.
+ .ct: ....... .ZMMMI..,:::::::,,:76Y.
+ c2: ......,i..Y$M@t..:::::::,,..inZY
+ vov ......:ii..c$MBc..,,,,,,,,,,..iI9i
+ i9Y ......iii:..7@MA,..,,,,,,,,,....;AA:
+ iIS. ......:ii::..;@MI....,............;Ez.
+ .I9. ......:i::::...8M1..................C0z.
+ .z9; ......:i::::,.. .i:...................zWX.
+ vbv ......,i::::,,. ................. :AQY
+ c6Y. .,...,::::,,..:t0@@QY. ................ :8bi
+ :6S. ..,,...,:::,,,..EMMMMMMI. ............... .;bZ,
+ :6o, .,,,,..:::,,,..i#MMMMMM#v................. YW2.
+ .n8i ..,,,,,,,::,,,,.. tMMMMM@C:.................. .1Wn
+ 7Uc. .:::,,,,,::,,,,.. i1t;,..................... .UEi
+ 7C...::::::::::::,,,,.. .................... vSi.
+ ;1;...,,::::::,......... .................. Yz:
+ v97,......... .voC.
+ izAotX7777777777777777777777777777777777777777Y7n92:
+ .;CoIIIIIUAA666666699999ZZZZZZZZZZZZZZZZZZZZ6ov.
+
+HTTP Security is disabled. Please re-enable it to prevent users from attacking
+your instance and your users via malicious posts:
+
+ config :pleroma, :http_security, enabled: true
+ ")
+ end
+ end
+
defp maybe_send_sts_header(conn, true) do
max_age_sts = Config.get([:http_security, :sts_max_age])
max_age_ct = Config.get([:http_security, :ct_max_age])
diff --git a/lib/pleroma/plugs/http_signature.ex b/lib/pleroma/plugs/http_signature.ex
index 23d22a712..036e2a773 100644
--- a/lib/pleroma/plugs/http_signature.ex
+++ b/lib/pleroma/plugs/http_signature.ex
@@ -1,9 +1,10 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Plugs.HTTPSignaturePlug do
import Plug.Conn
+ import Phoenix.Controller, only: [get_format: 1, text: 2]
require Logger
def init(options) do
@@ -15,25 +16,27 @@ defmodule Pleroma.Web.Plugs.HTTPSignaturePlug do
end
def call(conn, _opts) do
- headers = get_req_header(conn, "signature")
- signature = Enum.at(headers, 0)
+ if get_format(conn) == "activity+json" do
+ conn
+ |> maybe_assign_valid_signature()
+ |> maybe_require_signature()
+ else
+ conn
+ end
+ end
- if signature do
+ defp maybe_assign_valid_signature(conn) do
+ if has_signature_header?(conn) do
# set (request-target) header to the appropriate value
# we also replace the digest header with the one we computed
- conn =
- conn
- |> put_req_header(
- "(request-target)",
- String.downcase("#{conn.method}") <> " #{conn.request_path}"
- )
+ request_target = String.downcase("#{conn.method}") <> " #{conn.request_path}"
conn =
- if conn.assigns[:digest] do
- conn
- |> put_req_header("digest", conn.assigns[:digest])
- else
- conn
+ conn
+ |> put_req_header("(request-target)", request_target)
+ |> case do
+ %{assigns: %{digest: digest}} = conn -> put_req_header(conn, "digest", digest)
+ conn -> conn
end
assign(conn, :valid_signature, HTTPSignatures.validate_conn(conn))
@@ -42,4 +45,21 @@ defmodule Pleroma.Web.Plugs.HTTPSignaturePlug do
conn
end
end
+
+ defp has_signature_header?(conn) do
+ conn |> get_req_header("signature") |> Enum.at(0, false)
+ end
+
+ defp maybe_require_signature(%{assigns: %{valid_signature: true}} = conn), do: conn
+
+ defp maybe_require_signature(conn) do
+ if Pleroma.Config.get([:activitypub, :authorized_fetch_mode], false) do
+ conn
+ |> put_status(:unauthorized)
+ |> text("Request not signed")
+ |> halt()
+ else
+ conn
+ end
+ end
end
diff --git a/lib/pleroma/plugs/idempotency_plug.ex b/lib/pleroma/plugs/idempotency_plug.ex
index e99c5d279..f41397075 100644
--- a/lib/pleroma/plugs/idempotency_plug.ex
+++ b/lib/pleroma/plugs/idempotency_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.IdempotencyPlug do
diff --git a/lib/pleroma/plugs/instance_static.ex b/lib/pleroma/plugs/instance_static.ex
index a64f1ea80..7516f75c3 100644
--- a/lib/pleroma/plugs/instance_static.ex
+++ b/lib/pleroma/plugs/instance_static.ex
@@ -1,8 +1,10 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.InstanceStatic do
+ require Pleroma.Constants
+
@moduledoc """
This is a shim to call `Plug.Static` but with runtime `from` configuration.
@@ -21,9 +23,6 @@ defmodule Pleroma.Plugs.InstanceStatic do
end
end
- @only ~w(index.html robots.txt static emoji packs sounds images instance favicon.png sw.js
- sw-pleroma.js)
-
def init(opts) do
opts
|> Keyword.put(:from, "__unconfigured_instance_static_plug")
@@ -31,7 +30,7 @@ defmodule Pleroma.Plugs.InstanceStatic do
|> Plug.Static.init()
end
- for only <- @only do
+ for only <- Pleroma.Constants.static_only_files() do
at = Plug.Router.Utils.split("/")
def call(%{request_path: "/" <> unquote(only) <> _} = conn, opts) do
diff --git a/lib/pleroma/plugs/legacy_authentication_plug.ex b/lib/pleroma/plugs/legacy_authentication_plug.ex
index 78b7e388f..d346e01a6 100644
--- a/lib/pleroma/plugs/legacy_authentication_plug.ex
+++ b/lib/pleroma/plugs/legacy_authentication_plug.ex
@@ -1,9 +1,11 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.LegacyAuthenticationPlug do
import Plug.Conn
+
+ alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.User
def init(options) do
@@ -27,6 +29,7 @@ defmodule Pleroma.Plugs.LegacyAuthenticationPlug do
conn
|> assign(:auth_user, user)
|> assign(:user, user)
+ |> OAuthScopesPlug.skip_plug()
else
_ ->
conn
diff --git a/lib/pleroma/plugs/mapped_signature_to_identity_plug.ex b/lib/pleroma/plugs/mapped_signature_to_identity_plug.ex
index ce8494b9d..f44d4dee5 100644
--- a/lib/pleroma/plugs/mapped_signature_to_identity_plug.ex
+++ b/lib/pleroma/plugs/mapped_signature_to_identity_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Plugs.MappedSignatureToIdentityPlug do
@@ -13,8 +13,9 @@ defmodule Pleroma.Web.Plugs.MappedSignatureToIdentityPlug do
def init(options), do: options
defp key_id_from_conn(conn) do
- with %{"keyId" => key_id} <- HTTPSignatures.signature_for_conn(conn) do
- Signature.key_id_to_actor_id(key_id)
+ with %{"keyId" => key_id} <- HTTPSignatures.signature_for_conn(conn),
+ {:ok, ap_id} <- Signature.key_id_to_actor_id(key_id) do
+ ap_id
else
_ ->
nil
@@ -42,13 +43,13 @@ defmodule Pleroma.Web.Plugs.MappedSignatureToIdentityPlug do
else
{:user_match, false} ->
Logger.debug("Failed to map identity from signature (payload actor mismatch)")
- Logger.debug("key_id=#{key_id_from_conn(conn)}, actor=#{actor}")
+ Logger.debug("key_id=#{inspect(key_id_from_conn(conn))}, actor=#{inspect(actor)}")
assign(conn, :valid_signature, false)
# remove me once testsuite uses mapped capabilities instead of what we do now
{:user, nil} ->
Logger.debug("Failed to map identity from signature (lookup failure)")
- Logger.debug("key_id=#{key_id_from_conn(conn)}, actor=#{actor}")
+ Logger.debug("key_id=#{inspect(key_id_from_conn(conn))}, actor=#{actor}")
conn
end
end
@@ -60,7 +61,7 @@ defmodule Pleroma.Web.Plugs.MappedSignatureToIdentityPlug do
else
_ ->
Logger.debug("Failed to map identity from signature (no payload actor mismatch)")
- Logger.debug("key_id=#{key_id_from_conn(conn)}")
+ Logger.debug("key_id=#{inspect(key_id_from_conn(conn))}")
assign(conn, :valid_signature, false)
end
end
diff --git a/lib/pleroma/plugs/oauth_plug.ex b/lib/pleroma/plugs/oauth_plug.ex
index 86bc4aa3a..6fa71ef47 100644
--- a/lib/pleroma/plugs/oauth_plug.ex
+++ b/lib/pleroma/plugs/oauth_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.OAuthPlug do
@@ -71,7 +71,7 @@ defmodule Pleroma.Plugs.OAuthPlug do
)
# credo:disable-for-next-line Credo.Check.Readability.MaxLineLength
- with %Token{user: %{info: %{deactivated: false} = _} = user} = token_record <- Repo.one(query) do
+ with %Token{user: user} = token_record <- Repo.one(query) do
{:ok, user, token_record}
end
end
diff --git a/lib/pleroma/plugs/oauth_scopes_plug.ex b/lib/pleroma/plugs/oauth_scopes_plug.ex
index a3278dbef..efc25b79f 100644
--- a/lib/pleroma/plugs/oauth_scopes_plug.ex
+++ b/lib/pleroma/plugs/oauth_scopes_plug.ex
@@ -1,37 +1,34 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.OAuthScopesPlug do
import Plug.Conn
import Pleroma.Web.Gettext
- alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
+ alias Pleroma.Config
- @behaviour Plug
+ use Pleroma.Web, :plug
def init(%{scopes: _} = options), do: options
- def call(%Plug.Conn{assigns: assigns} = conn, %{scopes: scopes} = options) do
+ @impl true
+ def perform(%Plug.Conn{assigns: assigns} = conn, %{scopes: scopes} = options) do
op = options[:op] || :|
token = assigns[:token]
- matched_scopes = token && filter_descendants(scopes, token.scopes)
- cond do
- is_nil(token) ->
- maybe_perform_instance_privacy_check(conn, options)
+ scopes = transform_scopes(scopes, options)
+ matched_scopes = (token && filter_descendants(scopes, token.scopes)) || []
- op == :| && Enum.any?(matched_scopes) ->
+ cond do
+ token && op == :| && Enum.any?(matched_scopes) ->
conn
- op == :& && matched_scopes == scopes ->
+ token && op == :& && matched_scopes == scopes ->
conn
options[:fallback] == :proceed_unauthenticated ->
- conn
- |> assign(:user, nil)
- |> assign(:token, nil)
- |> maybe_perform_instance_privacy_check(options)
+ drop_auth_info(conn)
true ->
missing_scopes = scopes -- matched_scopes
@@ -47,6 +44,15 @@ defmodule Pleroma.Plugs.OAuthScopesPlug do
end
end
+ @doc "Drops authentication info from connection"
+ def drop_auth_info(conn) do
+ # To simplify debugging, setting a private variable on `conn` if auth info is dropped
+ conn
+ |> put_private(:authentication_ignored, true)
+ |> assign(:user, nil)
+ |> assign(:token, nil)
+ end
+
@doc "Filters descendants of supported scopes"
def filter_descendants(scopes, supported_scopes) do
Enum.filter(
@@ -60,11 +66,12 @@ defmodule Pleroma.Plugs.OAuthScopesPlug do
)
end
- defp maybe_perform_instance_privacy_check(%Plug.Conn{} = conn, options) do
- if options[:skip_instance_privacy_check] do
- conn
+ @doc "Transforms scopes by applying supported options (e.g. :admin)"
+ def transform_scopes(scopes, options) do
+ if options[:admin] do
+ Config.oauth_admin_scopes(scopes)
else
- EnsurePublicOrAuthenticatedPlug.call(conn, [])
+ scopes
end
end
end
diff --git a/lib/pleroma/plugs/plug_helper.ex b/lib/pleroma/plugs/plug_helper.ex
new file mode 100644
index 000000000..9c67be8ef
--- /dev/null
+++ b/lib/pleroma/plugs/plug_helper.ex
@@ -0,0 +1,40 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Plugs.PlugHelper do
+ @moduledoc "Pleroma Plug helper"
+
+ @called_plugs_list_id :called_plugs
+ def called_plugs_list_id, do: @called_plugs_list_id
+
+ @skipped_plugs_list_id :skipped_plugs
+ def skipped_plugs_list_id, do: @skipped_plugs_list_id
+
+ @doc "Returns `true` if specified plug was called."
+ def plug_called?(conn, plug_module) do
+ contained_in_private_list?(conn, @called_plugs_list_id, plug_module)
+ end
+
+ @doc "Returns `true` if specified plug was explicitly marked as skipped."
+ def plug_skipped?(conn, plug_module) do
+ contained_in_private_list?(conn, @skipped_plugs_list_id, plug_module)
+ end
+
+ @doc "Returns `true` if specified plug was either called or explicitly marked as skipped."
+ def plug_called_or_skipped?(conn, plug_module) do
+ plug_called?(conn, plug_module) || plug_skipped?(conn, plug_module)
+ end
+
+ # Appends plug to known list (skipped, called). Intended to be used from within plug code only.
+ def append_to_private_list(conn, list_id, value) do
+ list = conn.private[list_id] || []
+ modified_list = Enum.uniq(list ++ [value])
+ Plug.Conn.put_private(conn, list_id, modified_list)
+ end
+
+ defp contained_in_private_list?(conn, private_variable, value) do
+ list = conn.private[private_variable] || []
+ value in list
+ end
+end
diff --git a/lib/pleroma/plugs/rate_limiter.ex b/lib/pleroma/plugs/rate_limiter.ex
deleted file mode 100644
index 31388f574..000000000
--- a/lib/pleroma/plugs/rate_limiter.ex
+++ /dev/null
@@ -1,131 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Plugs.RateLimiter do
- @moduledoc """
-
- ## Configuration
-
- A keyword list of rate limiters where a key is a limiter name and value is the limiter configuration. The basic configuration is a tuple where:
-
- * The first element: `scale` (Integer). The time scale in milliseconds.
- * The second element: `limit` (Integer). How many requests to limit in the time scale provided.
-
- It is also possible to have different limits for unauthenticated and authenticated users: the keyword value must be a list of two tuples where the first one is a config for unauthenticated users and the second one is for authenticated.
-
- To disable a limiter set its value to `nil`.
-
- ### Example
-
- config :pleroma, :rate_limit,
- one: {1000, 10},
- two: [{10_000, 10}, {10_000, 50}],
- foobar: nil
-
- Here we have three limiters:
-
- * `one` which is not over 10req/1s
- * `two` which has two limits: 10req/10s for unauthenticated users and 50req/10s for authenticated users
- * `foobar` which is disabled
-
- ## Usage
-
- AllowedSyntax:
-
- plug(Pleroma.Plugs.RateLimiter, :limiter_name)
- plug(Pleroma.Plugs.RateLimiter, {:limiter_name, options})
-
- Allowed options:
-
- * `bucket_name` overrides bucket name (e.g. to have a separate limit for a set of actions)
- * `params` appends values of specified request params (e.g. ["id"]) to bucket name
-
- Inside a controller:
-
- plug(Pleroma.Plugs.RateLimiter, :one when action == :one)
- plug(Pleroma.Plugs.RateLimiter, :two when action in [:two, :three])
-
- plug(
- Pleroma.Plugs.RateLimiter,
- {:status_id_action, bucket_name: "status_id_action:fav_unfav", params: ["id"]}
- when action in ~w(fav_status unfav_status)a
- )
-
- or inside a router pipeline:
-
- pipeline :api do
- ...
- plug(Pleroma.Plugs.RateLimiter, :one)
- ...
- end
- """
- import Pleroma.Web.TranslationHelpers
- import Plug.Conn
-
- alias Pleroma.User
-
- def init(limiter_name) when is_atom(limiter_name) do
- init({limiter_name, []})
- end
-
- def init({limiter_name, opts}) do
- case Pleroma.Config.get([:rate_limit, limiter_name]) do
- nil -> nil
- config -> {limiter_name, config, opts}
- end
- end
-
- # Do not limit if there is no limiter configuration
- def call(conn, nil), do: conn
-
- def call(conn, settings) do
- case check_rate(conn, settings) do
- {:ok, _count} ->
- conn
-
- {:error, _count} ->
- render_throttled_error(conn)
- end
- end
-
- defp bucket_name(conn, limiter_name, opts) do
- bucket_name = opts[:bucket_name] || limiter_name
-
- if params_names = opts[:params] do
- params_values = for p <- Enum.sort(params_names), do: conn.params[p]
- Enum.join([bucket_name] ++ params_values, ":")
- else
- bucket_name
- end
- end
-
- defp check_rate(
- %{assigns: %{user: %User{id: user_id}}} = conn,
- {limiter_name, [_, {scale, limit}], opts}
- ) do
- bucket_name = bucket_name(conn, limiter_name, opts)
- ExRated.check_rate("#{bucket_name}:#{user_id}", scale, limit)
- end
-
- defp check_rate(conn, {limiter_name, [{scale, limit} | _], opts}) do
- bucket_name = bucket_name(conn, limiter_name, opts)
- ExRated.check_rate("#{bucket_name}:#{ip(conn)}", scale, limit)
- end
-
- defp check_rate(conn, {limiter_name, {scale, limit}, opts}) do
- check_rate(conn, {limiter_name, [{scale, limit}, {scale, limit}], opts})
- end
-
- def ip(%{remote_ip: remote_ip}) do
- remote_ip
- |> Tuple.to_list()
- |> Enum.join(".")
- end
-
- defp render_throttled_error(conn) do
- conn
- |> render_error(:too_many_requests, "Throttled")
- |> halt()
- end
-end
diff --git a/lib/pleroma/plugs/rate_limiter/limiter_supervisor.ex b/lib/pleroma/plugs/rate_limiter/limiter_supervisor.ex
new file mode 100644
index 000000000..884268d96
--- /dev/null
+++ b/lib/pleroma/plugs/rate_limiter/limiter_supervisor.ex
@@ -0,0 +1,50 @@
+defmodule Pleroma.Plugs.RateLimiter.LimiterSupervisor do
+ use DynamicSupervisor
+
+ import Cachex.Spec
+
+ def start_link(init_arg) do
+ DynamicSupervisor.start_link(__MODULE__, init_arg, name: __MODULE__)
+ end
+
+ def add_or_return_limiter(limiter_name, expiration) do
+ result =
+ DynamicSupervisor.start_child(
+ __MODULE__,
+ %{
+ id: String.to_atom("rl_#{limiter_name}"),
+ start:
+ {Cachex, :start_link,
+ [
+ limiter_name,
+ [
+ expiration:
+ expiration(
+ default: expiration,
+ interval: check_interval(expiration),
+ lazy: true
+ )
+ ]
+ ]}
+ }
+ )
+
+ case result do
+ {:ok, _pid} = result -> result
+ {:error, {:already_started, pid}} -> {:ok, pid}
+ _ -> result
+ end
+ end
+
+ @impl true
+ def init(_init_arg) do
+ DynamicSupervisor.init(strategy: :one_for_one)
+ end
+
+ defp check_interval(exp) do
+ (exp / 2)
+ |> Kernel.trunc()
+ |> Kernel.min(5000)
+ |> Kernel.max(1)
+ end
+end
diff --git a/lib/pleroma/plugs/rate_limiter/rate_limiter.ex b/lib/pleroma/plugs/rate_limiter/rate_limiter.ex
new file mode 100644
index 000000000..c51e2c634
--- /dev/null
+++ b/lib/pleroma/plugs/rate_limiter/rate_limiter.ex
@@ -0,0 +1,267 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Plugs.RateLimiter do
+ @moduledoc """
+
+ ## Configuration
+
+ A keyword list of rate limiters where a key is a limiter name and value is the limiter configuration.
+ The basic configuration is a tuple where:
+
+ * The first element: `scale` (Integer). The time scale in milliseconds.
+ * The second element: `limit` (Integer). How many requests to limit in the time scale provided.
+
+ It is also possible to have different limits for unauthenticated and authenticated users: the keyword value must be a
+ list of two tuples where the first one is a config for unauthenticated users and the second one is for authenticated.
+
+ To disable a limiter set its value to `nil`.
+
+ ### Example
+
+ config :pleroma, :rate_limit,
+ one: {1000, 10},
+ two: [{10_000, 10}, {10_000, 50}],
+ foobar: nil
+
+ Here we have three limiters:
+
+ * `one` which is not over 10req/1s
+ * `two` which has two limits: 10req/10s for unauthenticated users and 50req/10s for authenticated users
+ * `foobar` which is disabled
+
+ ## Usage
+
+ AllowedSyntax:
+
+ plug(Pleroma.Plugs.RateLimiter, name: :limiter_name)
+ plug(Pleroma.Plugs.RateLimiter, options) # :name is a required option
+
+ Allowed options:
+
+ * `name` required, always used to fetch the limit values from the config
+ * `bucket_name` overrides name for counting purposes (e.g. to have a separate limit for a set of actions)
+ * `params` appends values of specified request params (e.g. ["id"]) to bucket name
+
+ Inside a controller:
+
+ plug(Pleroma.Plugs.RateLimiter, [name: :one] when action == :one)
+ plug(Pleroma.Plugs.RateLimiter, [name: :two] when action in [:two, :three])
+
+ plug(
+ Pleroma.Plugs.RateLimiter,
+ [name: :status_id_action, bucket_name: "status_id_action:fav_unfav", params: ["id"]]
+ when action in ~w(fav_status unfav_status)a
+ )
+
+ or inside a router pipeline:
+
+ pipeline :api do
+ ...
+ plug(Pleroma.Plugs.RateLimiter, name: :one)
+ ...
+ end
+ """
+ import Pleroma.Web.TranslationHelpers
+ import Plug.Conn
+
+ alias Pleroma.Config
+ alias Pleroma.Plugs.RateLimiter.LimiterSupervisor
+ alias Pleroma.User
+
+ require Logger
+
+ @doc false
+ def init(plug_opts) do
+ plug_opts
+ end
+
+ def call(conn, plug_opts) do
+ if disabled?(conn) do
+ handle_disabled(conn)
+ else
+ action_settings = action_settings(plug_opts)
+ handle(conn, action_settings)
+ end
+ end
+
+ defp handle_disabled(conn) do
+ Logger.warn(
+ "Rate limiter disabled due to forwarded IP not being found. Please ensure your reverse proxy is providing the X-Forwarded-For header or disable the RemoteIP plug/rate limiter."
+ )
+
+ conn
+ end
+
+ defp handle(conn, nil), do: conn
+
+ defp handle(conn, action_settings) do
+ action_settings
+ |> incorporate_conn_info(conn)
+ |> check_rate()
+ |> case do
+ {:ok, _count} ->
+ conn
+
+ {:error, _count} ->
+ render_throttled_error(conn)
+ end
+ end
+
+ def disabled?(conn) do
+ if Map.has_key?(conn.assigns, :remote_ip_found),
+ do: !conn.assigns.remote_ip_found,
+ else: false
+ end
+
+ @inspect_bucket_not_found {:error, :not_found}
+
+ def inspect_bucket(conn, bucket_name_root, plug_opts) do
+ with %{name: _} = action_settings <- action_settings(plug_opts) do
+ action_settings = incorporate_conn_info(action_settings, conn)
+ bucket_name = make_bucket_name(%{action_settings | name: bucket_name_root})
+ key_name = make_key_name(action_settings)
+ limit = get_limits(action_settings)
+
+ case Cachex.get(bucket_name, key_name) do
+ {:error, :no_cache} ->
+ @inspect_bucket_not_found
+
+ {:ok, nil} ->
+ {0, limit}
+
+ {:ok, value} ->
+ {value, limit - value}
+ end
+ else
+ _ -> @inspect_bucket_not_found
+ end
+ end
+
+ def action_settings(plug_opts) do
+ with limiter_name when is_atom(limiter_name) <- plug_opts[:name],
+ limits when not is_nil(limits) <- Config.get([:rate_limit, limiter_name]) do
+ bucket_name_root = Keyword.get(plug_opts, :bucket_name, limiter_name)
+
+ %{
+ name: bucket_name_root,
+ limits: limits,
+ opts: plug_opts
+ }
+ end
+ end
+
+ defp check_rate(action_settings) do
+ bucket_name = make_bucket_name(action_settings)
+ key_name = make_key_name(action_settings)
+ limit = get_limits(action_settings)
+
+ case Cachex.get_and_update(bucket_name, key_name, &increment_value(&1, limit)) do
+ {:commit, value} ->
+ {:ok, value}
+
+ {:ignore, value} ->
+ {:error, value}
+
+ {:error, :no_cache} ->
+ initialize_buckets!(action_settings)
+ check_rate(action_settings)
+ end
+ end
+
+ defp increment_value(nil, _limit), do: {:commit, 1}
+
+ defp increment_value(val, limit) when val >= limit, do: {:ignore, val}
+
+ defp increment_value(val, _limit), do: {:commit, val + 1}
+
+ defp incorporate_conn_info(action_settings, %{
+ assigns: %{user: %User{id: user_id}},
+ params: params
+ }) do
+ Map.merge(action_settings, %{
+ mode: :user,
+ conn_params: params,
+ conn_info: "#{user_id}"
+ })
+ end
+
+ defp incorporate_conn_info(action_settings, %{params: params} = conn) do
+ Map.merge(action_settings, %{
+ mode: :anon,
+ conn_params: params,
+ conn_info: "#{ip(conn)}"
+ })
+ end
+
+ defp ip(%{remote_ip: remote_ip}) do
+ remote_ip
+ |> Tuple.to_list()
+ |> Enum.join(".")
+ end
+
+ defp render_throttled_error(conn) do
+ conn
+ |> render_error(:too_many_requests, "Throttled")
+ |> halt()
+ end
+
+ defp make_key_name(action_settings) do
+ ""
+ |> attach_selected_params(action_settings)
+ |> attach_identity(action_settings)
+ end
+
+ defp get_scale(_, {scale, _}), do: scale
+
+ defp get_scale(:anon, [{scale, _}, {_, _}]), do: scale
+
+ defp get_scale(:user, [{_, _}, {scale, _}]), do: scale
+
+ defp get_limits(%{limits: {_scale, limit}}), do: limit
+
+ defp get_limits(%{mode: :user, limits: [_, {_, limit}]}), do: limit
+
+ defp get_limits(%{limits: [{_, limit}, _]}), do: limit
+
+ defp make_bucket_name(%{mode: :user, name: bucket_name_root}),
+ do: user_bucket_name(bucket_name_root)
+
+ defp make_bucket_name(%{mode: :anon, name: bucket_name_root}),
+ do: anon_bucket_name(bucket_name_root)
+
+ defp attach_selected_params(input, %{conn_params: conn_params, opts: plug_opts}) do
+ params_string =
+ plug_opts
+ |> Keyword.get(:params, [])
+ |> Enum.sort()
+ |> Enum.map(&Map.get(conn_params, &1, ""))
+ |> Enum.join(":")
+
+ [input, params_string]
+ |> Enum.join(":")
+ |> String.replace_leading(":", "")
+ end
+
+ defp initialize_buckets!(%{name: _name, limits: nil}), do: :ok
+
+ defp initialize_buckets!(%{name: name, limits: limits}) do
+ {:ok, _pid} =
+ LimiterSupervisor.add_or_return_limiter(anon_bucket_name(name), get_scale(:anon, limits))
+
+ {:ok, _pid} =
+ LimiterSupervisor.add_or_return_limiter(user_bucket_name(name), get_scale(:user, limits))
+
+ :ok
+ end
+
+ defp attach_identity(base, %{mode: :user, conn_info: conn_info}),
+ do: "user:#{base}:#{conn_info}"
+
+ defp attach_identity(base, %{mode: :anon, conn_info: conn_info}),
+ do: "ip:#{base}:#{conn_info}"
+
+ defp user_bucket_name(bucket_name_root), do: "user:#{bucket_name_root}" |> String.to_atom()
+ defp anon_bucket_name(bucket_name_root), do: "anon:#{bucket_name_root}" |> String.to_atom()
+end
diff --git a/lib/pleroma/plugs/rate_limiter/supervisor.ex b/lib/pleroma/plugs/rate_limiter/supervisor.ex
new file mode 100644
index 000000000..9672f7876
--- /dev/null
+++ b/lib/pleroma/plugs/rate_limiter/supervisor.ex
@@ -0,0 +1,16 @@
+defmodule Pleroma.Plugs.RateLimiter.Supervisor do
+ use Supervisor
+
+ def start_link(opts) do
+ Supervisor.start_link(__MODULE__, opts, name: __MODULE__)
+ end
+
+ def init(_args) do
+ children = [
+ Pleroma.Plugs.RateLimiter.LimiterSupervisor
+ ]
+
+ opts = [strategy: :one_for_one, name: Pleroma.Web.Streamer.Supervisor]
+ Supervisor.init(children, opts)
+ end
+end
diff --git a/lib/pleroma/plugs/remote_ip.ex b/lib/pleroma/plugs/remote_ip.ex
index fdedc27ee..2eca4f8f6 100644
--- a/lib/pleroma/plugs/remote_ip.ex
+++ b/lib/pleroma/plugs/remote_ip.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.RemoteIp do
@@ -10,10 +10,7 @@ defmodule Pleroma.Plugs.RemoteIp do
@behaviour Plug
@headers ~w[
- forwarded
x-forwarded-for
- x-client-ip
- x-real-ip
]
# https://en.wikipedia.org/wiki/Localhost
diff --git a/lib/pleroma/plugs/session_authentication_plug.ex b/lib/pleroma/plugs/session_authentication_plug.ex
index a08484b65..0f83a5e53 100644
--- a/lib/pleroma/plugs/session_authentication_plug.ex
+++ b/lib/pleroma/plugs/session_authentication_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.SessionAuthenticationPlug do
diff --git a/lib/pleroma/plugs/set_format_plug.ex b/lib/pleroma/plugs/set_format_plug.ex
index 5ca741c64..c03fcb28d 100644
--- a/lib/pleroma/plugs/set_format_plug.ex
+++ b/lib/pleroma/plugs/set_format_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.SetFormatPlug do
diff --git a/lib/pleroma/plugs/set_locale_plug.ex b/lib/pleroma/plugs/set_locale_plug.ex
index 8646cb30d..9a21d0a9d 100644
--- a/lib/pleroma/plugs/set_locale_plug.ex
+++ b/lib/pleroma/plugs/set_locale_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
# NOTE: this module is based on https://github.com/smeevil/set_locale
diff --git a/lib/pleroma/plugs/set_user_session_id_plug.ex b/lib/pleroma/plugs/set_user_session_id_plug.ex
index 9265cc116..730c4ac74 100644
--- a/lib/pleroma/plugs/set_user_session_id_plug.ex
+++ b/lib/pleroma/plugs/set_user_session_id_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.SetUserSessionIdPlug do
diff --git a/lib/pleroma/plugs/static_fe_plug.ex b/lib/pleroma/plugs/static_fe_plug.ex
new file mode 100644
index 000000000..156e6788e
--- /dev/null
+++ b/lib/pleroma/plugs/static_fe_plug.ex
@@ -0,0 +1,29 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Plugs.StaticFEPlug do
+ import Plug.Conn
+ alias Pleroma.Web.StaticFE.StaticFEController
+
+ def init(options), do: options
+
+ def call(conn, _) do
+ if enabled?() and accepts_html?(conn) do
+ conn
+ |> StaticFEController.call(:show)
+ |> halt()
+ else
+ conn
+ end
+ end
+
+ defp enabled?, do: Pleroma.Config.get([:static_fe, :enabled], false)
+
+ defp accepts_html?(conn) do
+ case get_req_header(conn, "accept") do
+ [accept | _] -> String.contains?(accept, "text/html")
+ _ -> false
+ end
+ end
+end
diff --git a/lib/pleroma/plugs/trailing_format_plug.ex b/lib/pleroma/plugs/trailing_format_plug.ex
index ce366b218..8b4d5fc9f 100644
--- a/lib/pleroma/plugs/trailing_format_plug.ex
+++ b/lib/pleroma/plugs/trailing_format_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.TrailingFormatPlug do
@@ -24,7 +24,8 @@ defmodule Pleroma.Plugs.TrailingFormatPlug do
"/api/help",
"/api/externalprofile",
"/notice",
- "/api/pleroma/emoji"
+ "/api/pleroma/emoji",
+ "/api/oauth_tokens"
]
def init(opts) do
diff --git a/lib/pleroma/plugs/uploaded_media.ex b/lib/pleroma/plugs/uploaded_media.ex
index 69c1ab942..94147e0c4 100644
--- a/lib/pleroma/plugs/uploaded_media.ex
+++ b/lib/pleroma/plugs/uploaded_media.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.UploadedMedia do
@@ -14,9 +14,14 @@ defmodule Pleroma.Plugs.UploadedMedia do
# no slashes
@path "media"
+ @default_cache_control_header "public, max-age=1209600"
+
def init(_opts) do
static_plug_opts =
- []
+ [
+ headers: %{"cache-control" => @default_cache_control_header},
+ cache_control_for_etags: @default_cache_control_header
+ ]
|> Keyword.put(:from, "__unconfigured_media_plug")
|> Keyword.put(:at, "/__unconfigured_media_plug")
|> Plug.Static.init()
@@ -36,6 +41,7 @@ defmodule Pleroma.Plugs.UploadedMedia do
conn ->
conn
end
+ |> merge_resp_headers([{"content-security-policy", "sandbox"}])
config = Pleroma.Config.get(Pleroma.Upload)
diff --git a/lib/pleroma/plugs/user_enabled_plug.ex b/lib/pleroma/plugs/user_enabled_plug.ex
index da892c28b..23e800a74 100644
--- a/lib/pleroma/plugs/user_enabled_plug.ex
+++ b/lib/pleroma/plugs/user_enabled_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.UserEnabledPlug do
@@ -10,9 +10,11 @@ defmodule Pleroma.Plugs.UserEnabledPlug do
options
end
- def call(%{assigns: %{user: %User{info: %{deactivated: true}}}} = conn, _) do
- conn
- |> assign(:user, nil)
+ def call(%{assigns: %{user: %User{} = user}} = conn, _) do
+ case User.account_status(user) do
+ :active -> conn
+ _ -> assign(conn, :user, nil)
+ end
end
def call(conn, _) do
diff --git a/lib/pleroma/plugs/user_fetcher_plug.ex b/lib/pleroma/plugs/user_fetcher_plug.ex
index 4089aa958..235c77d85 100644
--- a/lib/pleroma/plugs/user_fetcher_plug.ex
+++ b/lib/pleroma/plugs/user_fetcher_plug.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.UserFetcherPlug do
diff --git a/lib/pleroma/plugs/user_is_admin_plug.ex b/lib/pleroma/plugs/user_is_admin_plug.ex
index 4c4b3d610..2748102df 100644
--- a/lib/pleroma/plugs/user_is_admin_plug.ex
+++ b/lib/pleroma/plugs/user_is_admin_plug.ex
@@ -1,23 +1,43 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Plugs.UserIsAdminPlug do
import Pleroma.Web.TranslationHelpers
import Plug.Conn
+
alias Pleroma.User
+ alias Pleroma.Web.OAuth
def init(options) do
options
end
- def call(%{assigns: %{user: %User{info: %{is_admin: true}}}} = conn, _) do
- conn
+ def call(%{assigns: %{user: %User{is_admin: true}} = assigns} = conn, _) do
+ token = assigns[:token]
+
+ cond do
+ not Pleroma.Config.enforce_oauth_admin_scope_usage?() ->
+ conn
+
+ token && OAuth.Scopes.contains_admin_scopes?(token.scopes) ->
+ # Note: checking for _any_ admin scope presence, not necessarily fitting requested action.
+ # Thus, controller must explicitly invoke OAuthScopesPlug to verify scope requirements.
+ # Admin might opt out of admin scope for some apps to block any admin actions from them.
+ conn
+
+ true ->
+ fail(conn)
+ end
end
def call(conn, _) do
+ fail(conn)
+ end
+
+ defp fail(conn) do
conn
- |> render_error(:forbidden, "User is not admin.")
- |> halt
+ |> render_error(:forbidden, "User is not an admin or OAuth admin scope is not granted.")
+ |> halt()
end
end
diff --git a/lib/pleroma/pool/connections.ex b/lib/pleroma/pool/connections.ex
new file mode 100644
index 000000000..acafe1bea
--- /dev/null
+++ b/lib/pleroma/pool/connections.ex
@@ -0,0 +1,283 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Pool.Connections do
+ use GenServer
+
+ alias Pleroma.Config
+ alias Pleroma.Gun
+
+ require Logger
+
+ @type domain :: String.t()
+ @type conn :: Pleroma.Gun.Conn.t()
+
+ @type t :: %__MODULE__{
+ conns: %{domain() => conn()},
+ opts: keyword()
+ }
+
+ defstruct conns: %{}, opts: []
+
+ @spec start_link({atom(), keyword()}) :: {:ok, pid()}
+ def start_link({name, opts}) do
+ GenServer.start_link(__MODULE__, opts, name: name)
+ end
+
+ @impl true
+ def init(opts), do: {:ok, %__MODULE__{conns: %{}, opts: opts}}
+
+ @spec checkin(String.t() | URI.t(), atom()) :: pid() | nil
+ def checkin(url, name)
+ def checkin(url, name) when is_binary(url), do: checkin(URI.parse(url), name)
+
+ def checkin(%URI{} = uri, name) do
+ timeout = Config.get([:connections_pool, :checkin_timeout], 250)
+
+ GenServer.call(name, {:checkin, uri}, timeout)
+ end
+
+ @spec alive?(atom()) :: boolean()
+ def alive?(name) do
+ if pid = Process.whereis(name) do
+ Process.alive?(pid)
+ else
+ false
+ end
+ end
+
+ @spec get_state(atom()) :: t()
+ def get_state(name) do
+ GenServer.call(name, :state)
+ end
+
+ @spec count(atom()) :: pos_integer()
+ def count(name) do
+ GenServer.call(name, :count)
+ end
+
+ @spec get_unused_conns(atom()) :: [{domain(), conn()}]
+ def get_unused_conns(name) do
+ GenServer.call(name, :unused_conns)
+ end
+
+ @spec checkout(pid(), pid(), atom()) :: :ok
+ def checkout(conn, pid, name) do
+ GenServer.cast(name, {:checkout, conn, pid})
+ end
+
+ @spec add_conn(atom(), String.t(), Pleroma.Gun.Conn.t()) :: :ok
+ def add_conn(name, key, conn) do
+ GenServer.cast(name, {:add_conn, key, conn})
+ end
+
+ @spec remove_conn(atom(), String.t()) :: :ok
+ def remove_conn(name, key) do
+ GenServer.cast(name, {:remove_conn, key})
+ end
+
+ @impl true
+ def handle_cast({:add_conn, key, conn}, state) do
+ state = put_in(state.conns[key], conn)
+
+ Process.monitor(conn.conn)
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_cast({:checkout, conn_pid, pid}, state) do
+ state =
+ with true <- Process.alive?(conn_pid),
+ {key, conn} <- find_conn(state.conns, conn_pid),
+ used_by <- List.keydelete(conn.used_by, pid, 0) do
+ conn_state = if used_by == [], do: :idle, else: conn.conn_state
+
+ put_in(state.conns[key], %{conn | conn_state: conn_state, used_by: used_by})
+ else
+ false ->
+ Logger.debug("checkout for closed conn #{inspect(conn_pid)}")
+ state
+
+ nil ->
+ Logger.debug("checkout for alive conn #{inspect(conn_pid)}, but is not in state")
+ state
+ end
+
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_cast({:remove_conn, key}, state) do
+ state = put_in(state.conns, Map.delete(state.conns, key))
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_call({:checkin, uri}, from, state) do
+ key = "#{uri.scheme}:#{uri.host}:#{uri.port}"
+
+ case state.conns[key] do
+ %{conn: pid, gun_state: :up} = conn ->
+ time = :os.system_time(:second)
+ last_reference = time - conn.last_reference
+ crf = crf(last_reference, 100, conn.crf)
+
+ state =
+ put_in(state.conns[key], %{
+ conn
+ | last_reference: time,
+ crf: crf,
+ conn_state: :active,
+ used_by: [from | conn.used_by]
+ })
+
+ {:reply, pid, state}
+
+ %{gun_state: :down} ->
+ {:reply, nil, state}
+
+ nil ->
+ {:reply, nil, state}
+ end
+ end
+
+ @impl true
+ def handle_call(:state, _from, state), do: {:reply, state, state}
+
+ @impl true
+ def handle_call(:count, _from, state) do
+ {:reply, Enum.count(state.conns), state}
+ end
+
+ @impl true
+ def handle_call(:unused_conns, _from, state) do
+ unused_conns =
+ state.conns
+ |> Enum.filter(&filter_conns/1)
+ |> Enum.sort(&sort_conns/2)
+
+ {:reply, unused_conns, state}
+ end
+
+ defp filter_conns({_, %{conn_state: :idle, used_by: []}}), do: true
+ defp filter_conns(_), do: false
+
+ defp sort_conns({_, c1}, {_, c2}) do
+ c1.crf <= c2.crf and c1.last_reference <= c2.last_reference
+ end
+
+ @impl true
+ def handle_info({:gun_up, conn_pid, _protocol}, state) do
+ %{origin_host: host, origin_scheme: scheme, origin_port: port} = Gun.info(conn_pid)
+
+ host =
+ case :inet.ntoa(host) do
+ {:error, :einval} -> host
+ ip -> ip
+ end
+
+ key = "#{scheme}:#{host}:#{port}"
+
+ state =
+ with {key, conn} <- find_conn(state.conns, conn_pid, key),
+ {true, key} <- {Process.alive?(conn_pid), key} do
+ put_in(state.conns[key], %{
+ conn
+ | gun_state: :up,
+ conn_state: :active,
+ retries: 0
+ })
+ else
+ {false, key} ->
+ put_in(
+ state.conns,
+ Map.delete(state.conns, key)
+ )
+
+ nil ->
+ :ok = Gun.close(conn_pid)
+
+ state
+ end
+
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_info({:gun_down, conn_pid, _protocol, _reason, _killed}, state) do
+ retries = Config.get([:connections_pool, :retry], 1)
+ # we can't get info on this pid, because pid is dead
+ state =
+ with {key, conn} <- find_conn(state.conns, conn_pid),
+ {true, key} <- {Process.alive?(conn_pid), key} do
+ if conn.retries == retries do
+ :ok = Gun.close(conn.conn)
+
+ put_in(
+ state.conns,
+ Map.delete(state.conns, key)
+ )
+ else
+ put_in(state.conns[key], %{
+ conn
+ | gun_state: :down,
+ retries: conn.retries + 1
+ })
+ end
+ else
+ {false, key} ->
+ put_in(
+ state.conns,
+ Map.delete(state.conns, key)
+ )
+
+ nil ->
+ Logger.debug(":gun_down for conn which isn't found in state")
+
+ state
+ end
+
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_info({:DOWN, _ref, :process, conn_pid, reason}, state) do
+ Logger.debug("received DOWN message for #{inspect(conn_pid)} reason -> #{inspect(reason)}")
+
+ state =
+ with {key, conn} <- find_conn(state.conns, conn_pid) do
+ Enum.each(conn.used_by, fn {pid, _ref} ->
+ Process.exit(pid, reason)
+ end)
+
+ put_in(
+ state.conns,
+ Map.delete(state.conns, key)
+ )
+ else
+ nil ->
+ Logger.debug(":DOWN for conn which isn't found in state")
+
+ state
+ end
+
+ {:noreply, state}
+ end
+
+ defp find_conn(conns, conn_pid) do
+ Enum.find(conns, fn {_key, conn} ->
+ conn.conn == conn_pid
+ end)
+ end
+
+ defp find_conn(conns, conn_pid, conn_key) do
+ Enum.find(conns, fn {key, conn} ->
+ key == conn_key and conn.conn == conn_pid
+ end)
+ end
+
+ def crf(current, steps, crf) do
+ 1 + :math.pow(0.5, current / steps) * crf
+ end
+end
diff --git a/lib/pleroma/pool/pool.ex b/lib/pleroma/pool/pool.ex
new file mode 100644
index 000000000..21a6fbbc5
--- /dev/null
+++ b/lib/pleroma/pool/pool.ex
@@ -0,0 +1,22 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Pool do
+ def child_spec(opts) do
+ poolboy_opts =
+ opts
+ |> Keyword.put(:worker_module, Pleroma.Pool.Request)
+ |> Keyword.put(:name, {:local, opts[:name]})
+ |> Keyword.put(:size, opts[:size])
+ |> Keyword.put(:max_overflow, opts[:max_overflow])
+
+ %{
+ id: opts[:id] || {__MODULE__, make_ref()},
+ start: {:poolboy, :start_link, [poolboy_opts, [name: opts[:name]]]},
+ restart: :permanent,
+ shutdown: 5000,
+ type: :worker
+ }
+ end
+end
diff --git a/lib/pleroma/pool/request.ex b/lib/pleroma/pool/request.ex
new file mode 100644
index 000000000..3fb930db7
--- /dev/null
+++ b/lib/pleroma/pool/request.ex
@@ -0,0 +1,65 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Pool.Request do
+ use GenServer
+
+ require Logger
+
+ def start_link(args) do
+ GenServer.start_link(__MODULE__, args)
+ end
+
+ @impl true
+ def init(_), do: {:ok, []}
+
+ @spec execute(pid() | atom(), Tesla.Client.t(), keyword(), pos_integer()) ::
+ {:ok, Tesla.Env.t()} | {:error, any()}
+ def execute(pid, client, request, timeout) do
+ GenServer.call(pid, {:execute, client, request}, timeout)
+ end
+
+ @impl true
+ def handle_call({:execute, client, request}, _from, state) do
+ response = Pleroma.HTTP.request(client, request)
+
+ {:reply, response, state}
+ end
+
+ @impl true
+ def handle_info({:gun_data, _conn, _stream, _, _}, state) do
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_info({:gun_up, _conn, _protocol}, state) do
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_info({:gun_down, _conn, _protocol, _reason, _killed}, state) do
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_info({:gun_error, _conn, _stream, _error}, state) do
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_info({:gun_push, _conn, _stream, _new_stream, _method, _uri, _headers}, state) do
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_info({:gun_response, _conn, _stream, _, _status, _headers}, state) do
+ {:noreply, state}
+ end
+
+ @impl true
+ def handle_info(msg, state) do
+ Logger.warn("Received unexpected message #{inspect(__MODULE__)} #{inspect(msg)}")
+ {:noreply, state}
+ end
+end
diff --git a/lib/pleroma/pool/supervisor.ex b/lib/pleroma/pool/supervisor.ex
new file mode 100644
index 000000000..faf646cb2
--- /dev/null
+++ b/lib/pleroma/pool/supervisor.ex
@@ -0,0 +1,42 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Pool.Supervisor do
+ use Supervisor
+
+ alias Pleroma.Config
+ alias Pleroma.Pool
+
+ def start_link(args) do
+ Supervisor.start_link(__MODULE__, args, name: __MODULE__)
+ end
+
+ def init(_) do
+ conns_child = %{
+ id: Pool.Connections,
+ start:
+ {Pool.Connections, :start_link, [{:gun_connections, Config.get([:connections_pool])}]}
+ }
+
+ Supervisor.init([conns_child | pools()], strategy: :one_for_one)
+ end
+
+ defp pools do
+ pools = Config.get(:pools)
+
+ pools =
+ if Config.get([Pleroma.Upload, :proxy_remote]) == false do
+ Keyword.delete(pools, :upload)
+ else
+ pools
+ end
+
+ for {pool_name, pool_opts} <- pools do
+ pool_opts
+ |> Keyword.put(:id, {Pool, pool_name})
+ |> Keyword.put(:name, pool_name)
+ |> Pool.child_spec()
+ end
+ end
+end
diff --git a/lib/pleroma/registration.ex b/lib/pleroma/registration.ex
index 8544461db..9163040b4 100644
--- a/lib/pleroma/registration.ex
+++ b/lib/pleroma/registration.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Registration do
diff --git a/lib/pleroma/release_tasks.ex b/lib/pleroma/release_tasks.ex
index 8afabf463..02dd6c325 100644
--- a/lib/pleroma/release_tasks.ex
+++ b/lib/pleroma/release_tasks.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.ReleaseTasks do
diff --git a/lib/pleroma/repo.ex b/lib/pleroma/repo.ex
index f57e088bc..f62138466 100644
--- a/lib/pleroma/repo.ex
+++ b/lib/pleroma/repo.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Repo do
@@ -8,6 +8,8 @@ defmodule Pleroma.Repo do
adapter: Ecto.Adapters.Postgres,
migration_timestamps: [type: :naive_datetime_usec]
+ require Logger
+
defmodule Instrumenter do
use Prometheus.EctoInstrumenter
end
@@ -47,4 +49,37 @@ defmodule Pleroma.Repo do
_ -> {:error, :not_found}
end
end
+
+ def check_migrations_applied!() do
+ unless Pleroma.Config.get(
+ [:i_am_aware_this_may_cause_data_loss, :disable_migration_check],
+ false
+ ) do
+ Ecto.Migrator.with_repo(__MODULE__, fn repo ->
+ down_migrations =
+ Ecto.Migrator.migrations(repo)
+ |> Enum.reject(fn
+ {:up, _, _} -> true
+ {:down, _, _} -> false
+ end)
+
+ if length(down_migrations) > 0 do
+ down_migrations_text =
+ Enum.map(down_migrations, fn {:down, id, name} -> "- #{name} (#{id})\n" end)
+
+ Logger.error(
+ "The following migrations were not applied:\n#{down_migrations_text}If you want to start Pleroma anyway, set\nconfig :pleroma, :i_am_aware_this_may_cause_data_loss, disable_migration_check: true"
+ )
+
+ raise Pleroma.Repo.UnappliedMigrationsError
+ end
+ end)
+ else
+ :ok
+ end
+ end
+end
+
+defmodule Pleroma.Repo.UnappliedMigrationsError do
+ defexception message: "Unapplied Migrations detected"
end
diff --git a/lib/pleroma/repo_streamer.ex b/lib/pleroma/repo_streamer.ex
index a4b71a1bb..cb4d7bb7a 100644
--- a/lib/pleroma/repo_streamer.ex
+++ b/lib/pleroma/repo_streamer.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.RepoStreamer do
diff --git a/lib/pleroma/report_note.ex b/lib/pleroma/report_note.ex
new file mode 100644
index 000000000..a239bd361
--- /dev/null
+++ b/lib/pleroma/report_note.ex
@@ -0,0 +1,48 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.ReportNote do
+ use Ecto.Schema
+
+ import Ecto.Changeset
+ import Ecto.Query
+
+ alias Pleroma.Activity
+ alias Pleroma.Repo
+ alias Pleroma.ReportNote
+ alias Pleroma.User
+
+ @type t :: %__MODULE__{}
+
+ schema "report_notes" do
+ field(:content, :string)
+ belongs_to(:user, User, type: FlakeId.Ecto.CompatType)
+ belongs_to(:activity, Activity, type: FlakeId.Ecto.CompatType)
+
+ timestamps()
+ end
+
+ @spec create(FlakeId.Ecto.CompatType.t(), FlakeId.Ecto.CompatType.t(), String.t()) ::
+ {:ok, ReportNote.t()} | {:error, Changeset.t()}
+ def create(user_id, activity_id, content) do
+ attrs = %{
+ user_id: user_id,
+ activity_id: activity_id,
+ content: content
+ }
+
+ %ReportNote{}
+ |> cast(attrs, [:user_id, :activity_id, :content])
+ |> validate_required([:user_id, :activity_id, :content])
+ |> Repo.insert()
+ end
+
+ @spec destroy(FlakeId.Ecto.CompatType.t()) ::
+ {:ok, ReportNote.t()} | {:error, Changeset.t()}
+ def destroy(id) do
+ from(r in ReportNote, where: r.id == ^id)
+ |> Repo.one()
+ |> Repo.delete()
+ end
+end
diff --git a/lib/pleroma/reverse_proxy/client.ex b/lib/pleroma/reverse_proxy/client.ex
index 776c4794c..0d13ff174 100644
--- a/lib/pleroma/reverse_proxy/client.ex
+++ b/lib/pleroma/reverse_proxy/client.ex
@@ -1,21 +1,25 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.ReverseProxy.Client do
- @callback request(atom(), String.t(), [tuple()], String.t(), list()) ::
- {:ok, pos_integer(), [tuple()], reference() | map()}
- | {:ok, pos_integer(), [tuple()]}
+ @type status :: pos_integer()
+ @type header_name :: String.t()
+ @type header_value :: String.t()
+ @type headers :: [{header_name(), header_value()}]
+
+ @callback request(atom(), String.t(), headers(), String.t(), list()) ::
+ {:ok, status(), headers(), reference() | map()}
+ | {:ok, status(), headers()}
| {:ok, reference()}
| {:error, term()}
- @callback stream_body(reference() | pid() | map()) ::
- {:ok, binary()} | :done | {:error, String.t()}
+ @callback stream_body(map()) :: {:ok, binary(), map()} | :done | {:error, atom() | String.t()}
@callback close(reference() | pid() | map()) :: :ok
- def request(method, url, headers, "", opts \\ []) do
- client().request(method, url, headers, "", opts)
+ def request(method, url, headers, body \\ "", opts \\ []) do
+ client().request(method, url, headers, body, opts)
end
def stream_body(ref), do: client().stream_body(ref)
@@ -23,6 +27,12 @@ defmodule Pleroma.ReverseProxy.Client do
def close(ref), do: client().close(ref)
defp client do
- Pleroma.Config.get([Pleroma.ReverseProxy.Client], :hackney)
+ :tesla
+ |> Application.get_env(:adapter)
+ |> client()
end
+
+ defp client(Tesla.Adapter.Hackney), do: Pleroma.ReverseProxy.Client.Hackney
+ defp client(Tesla.Adapter.Gun), do: Pleroma.ReverseProxy.Client.Tesla
+ defp client(_), do: Pleroma.Config.get!(Pleroma.ReverseProxy.Client)
end
diff --git a/lib/pleroma/reverse_proxy/client/hackney.ex b/lib/pleroma/reverse_proxy/client/hackney.ex
new file mode 100644
index 000000000..e84118a90
--- /dev/null
+++ b/lib/pleroma/reverse_proxy/client/hackney.ex
@@ -0,0 +1,24 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.ReverseProxy.Client.Hackney do
+ @behaviour Pleroma.ReverseProxy.Client
+
+ @impl true
+ def request(method, url, headers, body, opts \\ []) do
+ :hackney.request(method, url, headers, body, opts)
+ end
+
+ @impl true
+ def stream_body(ref) do
+ case :hackney.stream_body(ref) do
+ :done -> :done
+ {:ok, data} -> {:ok, data, ref}
+ {:error, error} -> {:error, error}
+ end
+ end
+
+ @impl true
+ def close(ref), do: :hackney.close(ref)
+end
diff --git a/lib/pleroma/reverse_proxy/client/tesla.ex b/lib/pleroma/reverse_proxy/client/tesla.ex
new file mode 100644
index 000000000..e81ea8bde
--- /dev/null
+++ b/lib/pleroma/reverse_proxy/client/tesla.ex
@@ -0,0 +1,90 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.ReverseProxy.Client.Tesla do
+ @behaviour Pleroma.ReverseProxy.Client
+
+ @type headers() :: [{String.t(), String.t()}]
+ @type status() :: pos_integer()
+
+ @spec request(atom(), String.t(), headers(), String.t(), keyword()) ::
+ {:ok, status(), headers}
+ | {:ok, status(), headers, map()}
+ | {:error, atom() | String.t()}
+ | no_return()
+
+ @impl true
+ def request(method, url, headers, body, opts \\ []) do
+ check_adapter()
+
+ opts = Keyword.put(opts, :body_as, :chunks)
+
+ with {:ok, response} <-
+ Pleroma.HTTP.request(
+ method,
+ url,
+ body,
+ headers,
+ Keyword.put(opts, :adapter, opts)
+ ) do
+ if is_map(response.body) and method != :head do
+ {:ok, response.status, response.headers, response.body}
+ else
+ {:ok, response.status, response.headers}
+ end
+ else
+ {:error, error} -> {:error, error}
+ end
+ end
+
+ @impl true
+ @spec stream_body(map()) ::
+ {:ok, binary(), map()} | {:error, atom() | String.t()} | :done | no_return()
+ def stream_body(%{pid: pid, opts: opts, fin: true}) do
+ # if connection was reused, but in tesla were redirects,
+ # tesla returns new opened connection, which must be closed manually
+ if opts[:old_conn], do: Tesla.Adapter.Gun.close(pid)
+ # if there were redirects we need to checkout old conn
+ conn = opts[:old_conn] || opts[:conn]
+
+ if conn, do: :ok = Pleroma.Pool.Connections.checkout(conn, self(), :gun_connections)
+
+ :done
+ end
+
+ def stream_body(client) do
+ case read_chunk!(client) do
+ {:fin, body} ->
+ {:ok, body, Map.put(client, :fin, true)}
+
+ {:nofin, part} ->
+ {:ok, part, client}
+
+ {:error, error} ->
+ {:error, error}
+ end
+ end
+
+ defp read_chunk!(%{pid: pid, stream: stream, opts: opts}) do
+ adapter = check_adapter()
+ adapter.read_chunk(pid, stream, opts)
+ end
+
+ @impl true
+ @spec close(map) :: :ok | no_return()
+ def close(%{pid: pid}) do
+ adapter = check_adapter()
+ adapter.close(pid)
+ end
+
+ defp check_adapter do
+ adapter = Application.get_env(:tesla, :adapter)
+
+ unless adapter == Tesla.Adapter.Gun do
+ raise "#{adapter} doesn't support reading body in chunks"
+ end
+
+ adapter
+ end
+end
diff --git a/lib/pleroma/reverse_proxy/reverse_proxy.ex b/lib/pleroma/reverse_proxy/reverse_proxy.ex
index 2ed719315..4bbeb493c 100644
--- a/lib/pleroma/reverse_proxy/reverse_proxy.ex
+++ b/lib/pleroma/reverse_proxy/reverse_proxy.ex
@@ -1,13 +1,11 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.ReverseProxy do
- alias Pleroma.HTTP
-
@keep_req_headers ~w(accept user-agent accept-encoding cache-control if-modified-since) ++
~w(if-unmodified-since if-none-match if-range range)
- @resp_cache_headers ~w(etag date last-modified cache-control)
+ @resp_cache_headers ~w(etag date last-modified)
@keep_resp_headers @resp_cache_headers ++
~w(content-type content-disposition content-encoding content-range) ++
~w(accept-ranges vary)
@@ -34,9 +32,6 @@ defmodule Pleroma.ReverseProxy do
* request: `#{inspect(@keep_req_headers)}`
* response: `#{inspect(@keep_resp_headers)}`
- If no caching headers (`#{inspect(@resp_cache_headers)}`) are returned by upstream, `cache-control` will be
- set to `#{inspect(@default_cache_control_header)}`.
-
Options:
* `redirect_on_failure` (default `false`). Redirects the client to the real remote URL if there's any HTTP
@@ -61,10 +56,10 @@ defmodule Pleroma.ReverseProxy do
* `req_headers`, `resp_headers` additional headers.
- * `http`: options for [hackney](https://github.com/benoitc/hackney).
+ * `http`: options for [hackney](https://github.com/benoitc/hackney) or [gun](https://github.com/ninenines/gun).
"""
- @default_hackney_options [pool: :media]
+ @default_options [pool: :media]
@inline_content_types [
"image/gif",
@@ -97,11 +92,7 @@ defmodule Pleroma.ReverseProxy do
def call(_conn, _url, _opts \\ [])
def call(conn = %{method: method}, url, opts) when method in @methods do
- hackney_opts =
- Pleroma.HTTP.Connection.hackney_options([])
- |> Keyword.merge(@default_hackney_options)
- |> Keyword.merge(Keyword.get(opts, :http, []))
- |> HTTP.process_request_options()
+ client_opts = Keyword.merge(@default_options, Keyword.get(opts, :http, []))
req_headers = build_req_headers(conn.req_headers, opts)
@@ -113,7 +104,7 @@ defmodule Pleroma.ReverseProxy do
end
with {:ok, nil} <- Cachex.get(:failed_proxy_url_cache, url),
- {:ok, code, headers, client} <- request(method, url, req_headers, hackney_opts),
+ {:ok, code, headers, client} <- request(method, url, req_headers, client_opts),
:ok <-
header_length_constraint(
headers,
@@ -159,11 +150,11 @@ defmodule Pleroma.ReverseProxy do
|> halt()
end
- defp request(method, url, headers, hackney_opts) do
+ defp request(method, url, headers, opts) do
Logger.debug("#{__MODULE__} #{method} #{url} #{inspect(headers)}")
method = method |> String.downcase() |> String.to_existing_atom()
- case client().request(method, url, headers, "", hackney_opts) do
+ case client().request(method, url, headers, "", opts) do
{:ok, code, headers, client} when code in @valid_resp_codes ->
{:ok, code, downcase_headers(headers), client}
@@ -213,7 +204,7 @@ defmodule Pleroma.ReverseProxy do
duration,
Keyword.get(opts, :max_read_duration, @max_read_duration)
),
- {:ok, data} <- client().stream_body(client),
+ {:ok, data, client} <- client().stream_body(client),
{:ok, duration} <- increase_read_duration(duration),
sent_so_far = sent_so_far + byte_size(data),
:ok <-
@@ -297,16 +288,17 @@ defmodule Pleroma.ReverseProxy do
defp build_resp_cache_headers(headers, _opts) do
has_cache? = Enum.any?(headers, fn {k, _} -> k in @resp_cache_headers end)
- has_cache_control? = List.keymember?(headers, "cache-control", 0)
cond do
- has_cache? && has_cache_control? ->
- headers
-
has_cache? ->
- # There's caching header present but no cache-control -- we need to explicitely override it
- # to public as Plug defaults to "max-age=0, private, must-revalidate"
- List.keystore(headers, "cache-control", 0, {"cache-control", "public"})
+ # There's caching header present but no cache-control -- we need to set our own
+ # as Plug defaults to "max-age=0, private, must-revalidate"
+ List.keystore(
+ headers,
+ "cache-control",
+ 0,
+ {"cache-control", @default_cache_control_header}
+ )
true ->
List.keystore(
diff --git a/lib/pleroma/scheduled_activity.ex b/lib/pleroma/scheduled_activity.ex
index fea2cf3ff..0937cb7db 100644
--- a/lib/pleroma/scheduled_activity.ex
+++ b/lib/pleroma/scheduled_activity.ex
@@ -1,19 +1,23 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.ScheduledActivity do
use Ecto.Schema
+ alias Ecto.Multi
alias Pleroma.Config
alias Pleroma.Repo
alias Pleroma.ScheduledActivity
alias Pleroma.User
alias Pleroma.Web.CommonAPI.Utils
+ alias Pleroma.Workers.ScheduledActivityWorker
import Ecto.Query
import Ecto.Changeset
+ @type t :: %__MODULE__{}
+
@min_offset :timer.minutes(5)
schema "scheduled_activities" do
@@ -36,7 +40,7 @@ defmodule Pleroma.ScheduledActivity do
%{changes: %{params: %{"media_ids" => media_ids} = params}} = changeset
)
when is_list(media_ids) do
- media_attachments = Utils.attachments_from_ids(%{"media_ids" => media_ids})
+ media_attachments = Utils.attachments_from_ids(%{media_ids: media_ids})
params =
params
@@ -105,16 +109,32 @@ defmodule Pleroma.ScheduledActivity do
end
def new(%User{} = user, attrs) do
- %ScheduledActivity{user_id: user.id}
- |> changeset(attrs)
+ changeset(%ScheduledActivity{user_id: user.id}, attrs)
end
+ @doc """
+ Creates ScheduledActivity and add to queue to perform at scheduled_at date
+ """
+ @spec create(User.t(), map()) :: {:ok, ScheduledActivity.t()} | {:error, Ecto.Changeset.t()}
def create(%User{} = user, attrs) do
- user
- |> new(attrs)
- |> Repo.insert()
+ Multi.new()
+ |> Multi.insert(:scheduled_activity, new(user, attrs))
+ |> maybe_add_jobs(Config.get([ScheduledActivity, :enabled]))
+ |> Repo.transaction()
+ |> transaction_response
+ end
+
+ defp maybe_add_jobs(multi, true) do
+ multi
+ |> Multi.run(:scheduled_activity_job, fn _repo, %{scheduled_activity: activity} ->
+ %{activity_id: activity.id}
+ |> ScheduledActivityWorker.new(scheduled_at: activity.scheduled_at)
+ |> Oban.insert()
+ end)
end
+ defp maybe_add_jobs(multi, _), do: multi
+
def get(%User{} = user, scheduled_activity_id) do
ScheduledActivity
|> where(user_id: ^user.id)
@@ -122,25 +142,43 @@ defmodule Pleroma.ScheduledActivity do
|> Repo.one()
end
- def update(%ScheduledActivity{} = scheduled_activity, attrs) do
- scheduled_activity
- |> update_changeset(attrs)
- |> Repo.update()
+ @spec update(ScheduledActivity.t(), map()) ::
+ {:ok, ScheduledActivity.t()} | {:error, Ecto.Changeset.t()}
+ def update(%ScheduledActivity{id: id} = scheduled_activity, attrs) do
+ with {:error, %Ecto.Changeset{valid?: true} = changeset} <-
+ {:error, update_changeset(scheduled_activity, attrs)} do
+ Multi.new()
+ |> Multi.update(:scheduled_activity, changeset)
+ |> Multi.update_all(:scheduled_job, job_query(id),
+ set: [scheduled_at: get_field(changeset, :scheduled_at)]
+ )
+ |> Repo.transaction()
+ |> transaction_response
+ end
end
- def delete(%ScheduledActivity{} = scheduled_activity) do
- scheduled_activity
- |> Repo.delete()
+ @doc "Deletes a ScheduledActivity and linked jobs."
+ @spec delete(ScheduledActivity.t() | binary() | integer) ::
+ {:ok, ScheduledActivity.t()} | {:error, Ecto.Changeset.t()}
+ def delete(%ScheduledActivity{id: id} = scheduled_activity) do
+ Multi.new()
+ |> Multi.delete(:scheduled_activity, scheduled_activity, stale_error_field: :id)
+ |> Multi.delete_all(:jobs, job_query(id))
+ |> Repo.transaction()
+ |> transaction_response
end
def delete(id) when is_binary(id) or is_integer(id) do
- ScheduledActivity
- |> where(id: ^id)
- |> select([sa], sa)
- |> Repo.delete_all()
- |> case do
- {1, [scheduled_activity]} -> {:ok, scheduled_activity}
- _ -> :error
+ delete(%__MODULE__{id: id})
+ end
+
+ defp transaction_response(result) do
+ case result do
+ {:ok, %{scheduled_activity: scheduled_activity}} ->
+ {:ok, scheduled_activity}
+
+ {:error, _, changeset, _} ->
+ {:error, changeset}
end
end
@@ -158,4 +196,11 @@ defmodule Pleroma.ScheduledActivity do
|> where([sa], sa.scheduled_at < ^naive_datetime)
|> Repo.all()
end
+
+ def job_query(scheduled_activity_id) do
+ from(j in Oban.Job,
+ where: j.queue == "scheduled_activities",
+ where: fragment("args ->> 'activity_id' = ?::text", ^to_string(scheduled_activity_id))
+ )
+ end
end
diff --git a/lib/pleroma/signature.ex b/lib/pleroma/signature.ex
index 1e7c9ae86..d01728361 100644
--- a/lib/pleroma/signature.ex
+++ b/lib/pleroma/signature.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Signature do
@@ -8,6 +8,7 @@ defmodule Pleroma.Signature do
alias Pleroma.Keys
alias Pleroma.User
alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
def key_id_to_actor_id(key_id) do
uri =
@@ -21,12 +22,23 @@ defmodule Pleroma.Signature do
uri
end
- URI.to_string(uri)
+ maybe_ap_id = URI.to_string(uri)
+
+ case Types.ObjectID.cast(maybe_ap_id) do
+ {:ok, ap_id} ->
+ {:ok, ap_id}
+
+ _ ->
+ case Pleroma.Web.WebFinger.finger(maybe_ap_id) do
+ %{"ap_id" => ap_id} -> {:ok, ap_id}
+ _ -> {:error, maybe_ap_id}
+ end
+ end
end
def fetch_public_key(conn) do
with %{"keyId" => kid} <- HTTPSignatures.signature_for_conn(conn),
- actor_id <- key_id_to_actor_id(kid),
+ {:ok, actor_id} <- key_id_to_actor_id(kid),
{:ok, public_key} <- User.get_public_key_for_ap_id(actor_id) do
{:ok, public_key}
else
@@ -37,7 +49,7 @@ defmodule Pleroma.Signature do
def refetch_public_key(conn) do
with %{"keyId" => kid} <- HTTPSignatures.signature_for_conn(conn),
- actor_id <- key_id_to_actor_id(kid),
+ {:ok, actor_id} <- key_id_to_actor_id(kid),
{:ok, _user} <- ActivityPub.make_user_from_ap_id(actor_id),
{:ok, public_key} <- User.get_public_key_for_ap_id(actor_id) do
{:ok, public_key}
diff --git a/lib/pleroma/stats.ex b/lib/pleroma/stats.ex
index df80fbaa4..6b3a8a41f 100644
--- a/lib/pleroma/stats.ex
+++ b/lib/pleroma/stats.ex
@@ -1,43 +1,55 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Stats do
import Ecto.Query
+ alias Pleroma.CounterCache
alias Pleroma.Repo
alias Pleroma.User
use GenServer
- @interval 1000 * 60 * 60
-
def start_link(_) do
- GenServer.start_link(__MODULE__, initial_data(), name: __MODULE__)
+ GenServer.start_link(
+ __MODULE__,
+ nil,
+ name: __MODULE__
+ )
end
+ @doc "Performs update stats"
def force_update do
GenServer.call(__MODULE__, :force_update)
end
+ @doc "Performs collect stats"
+ def do_collect do
+ GenServer.cast(__MODULE__, :run_update)
+ end
+
+ @doc "Returns stats data"
+ @spec get_stats() :: %{domain_count: integer(), status_count: integer(), user_count: integer()}
def get_stats do
%{stats: stats} = GenServer.call(__MODULE__, :get_state)
stats
end
+ @doc "Returns list peers"
+ @spec get_peers() :: list(String.t())
def get_peers do
%{peers: peers} = GenServer.call(__MODULE__, :get_state)
peers
end
- def init(args) do
- Process.send(self(), :run_update, [])
- {:ok, args}
+ def init(_args) do
+ {:ok, calculate_stat_data()}
end
def handle_call(:force_update, _from, _state) do
- new_stats = get_stat_data()
+ new_stats = calculate_stat_data()
{:reply, new_stats, new_stats}
end
@@ -45,18 +57,13 @@ defmodule Pleroma.Stats do
{:reply, state, state}
end
- def handle_info(:run_update, _state) do
- new_stats = get_stat_data()
+ def handle_cast(:run_update, _state) do
+ new_stats = calculate_stat_data()
- Process.send_after(self(), :run_update, @interval)
{:noreply, new_stats}
end
- defp initial_data do
- %{peers: [], stats: %{}}
- end
-
- defp get_stat_data do
+ def calculate_stat_data do
peers =
from(
u in User,
@@ -68,18 +75,42 @@ defmodule Pleroma.Stats do
domain_count = Enum.count(peers)
- status_query =
- from(u in User.Query.build(%{local: true}),
- select: fragment("sum((?->>'note_count')::int)", u.info)
- )
+ status_count = Repo.aggregate(User.Query.build(%{local: true}), :sum, :note_count)
- status_count = Repo.one(status_query)
+ users_query =
+ from(u in User,
+ where: u.deactivated != true,
+ where: u.local == true,
+ where: not is_nil(u.nickname),
+ where: not u.invisible
+ )
- user_count = Repo.aggregate(User.Query.build(%{local: true, active: true}), :count, :id)
+ user_count = Repo.aggregate(users_query, :count, :id)
%{
peers: peers,
- stats: %{domain_count: domain_count, status_count: status_count, user_count: user_count}
+ stats: %{
+ domain_count: domain_count,
+ status_count: status_count || 0,
+ user_count: user_count
+ }
+ }
+ end
+
+ def get_status_visibility_count do
+ counter_cache =
+ CounterCache.get_as_map([
+ "status_visibility_public",
+ "status_visibility_private",
+ "status_visibility_unlisted",
+ "status_visibility_direct"
+ ])
+
+ %{
+ public: counter_cache["status_visibility_public"] || 0,
+ unlisted: counter_cache["status_visibility_unlisted"] || 0,
+ private: counter_cache["status_visibility_private"] || 0,
+ direct: counter_cache["status_visibility_direct"] || 0
}
end
end
diff --git a/lib/pleroma/tests/auth_test_controller.ex b/lib/pleroma/tests/auth_test_controller.ex
new file mode 100644
index 000000000..fb04411d9
--- /dev/null
+++ b/lib/pleroma/tests/auth_test_controller.ex
@@ -0,0 +1,93 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+# A test controller reachable only in :test env.
+defmodule Pleroma.Tests.AuthTestController do
+ @moduledoc false
+
+ use Pleroma.Web, :controller
+
+ alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
+ alias Pleroma.Plugs.OAuthScopesPlug
+ alias Pleroma.User
+
+ # Serves only with proper OAuth token (:api and :authenticated_api)
+ # Skipping EnsurePublicOrAuthenticatedPlug has no effect in this case
+ #
+ # Suggested use case: all :authenticated_api endpoints (makes no sense for :api endpoints)
+ plug(OAuthScopesPlug, %{scopes: ["read"]} when action == :do_oauth_check)
+
+ # Via :api, keeps :user if token has requested scopes (if :user is dropped, serves if public)
+ # Via :authenticated_api, serves if token is present and has requested scopes
+ #
+ # Suggested use case: vast majority of :api endpoints (no sense for :authenticated_api ones)
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["read"], fallback: :proceed_unauthenticated}
+ when action == :fallback_oauth_check
+ )
+
+ # Keeps :user if present, executes regardless of token / token scopes
+ # Fails with no :user for :authenticated_api / no user for :api on private instance
+ # Note: EnsurePublicOrAuthenticatedPlug is not skipped (private instance fails on no :user)
+ # Note: Basic Auth processing results in :skip_plug call for OAuthScopesPlug
+ #
+ # Suggested use: suppressing OAuth checks for other auth mechanisms (like Basic Auth)
+ # For controller-level use, see :skip_oauth_skip_publicity_check instead
+ plug(
+ :skip_plug,
+ OAuthScopesPlug when action == :skip_oauth_check
+ )
+
+ # (Shouldn't be executed since the plug is skipped)
+ plug(OAuthScopesPlug, %{scopes: ["admin"]} when action == :skip_oauth_check)
+
+ # Via :api, keeps :user if token has requested scopes, and continues with nil :user otherwise
+ # Via :authenticated_api, serves if token is present and has requested scopes
+ #
+ # Suggested use: as :fallback_oauth_check but open with nil :user for :api on private instances
+ plug(
+ :skip_plug,
+ EnsurePublicOrAuthenticatedPlug when action == :fallback_oauth_skip_publicity_check
+ )
+
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["read"], fallback: :proceed_unauthenticated}
+ when action == :fallback_oauth_skip_publicity_check
+ )
+
+ # Via :api, keeps :user if present, serves regardless of token presence / scopes / :user presence
+ # Via :authenticated_api, serves if :user is set (regardless of token presence and its scopes)
+ #
+ # Suggested use: making an :api endpoint always accessible (e.g. email confirmation endpoint)
+ plug(
+ :skip_plug,
+ [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug]
+ when action == :skip_oauth_skip_publicity_check
+ )
+
+ # Via :authenticated_api, always fails with 403 (endpoint is insecure)
+ # Via :api, drops :user if present and serves if public (private instance rejects on no user)
+ #
+ # Suggested use: none; please define OAuth rules for all :api / :authenticated_api endpoints
+ plug(:skip_plug, [] when action == :missing_oauth_check_definition)
+
+ def do_oauth_check(conn, _params), do: conn_state(conn)
+
+ def fallback_oauth_check(conn, _params), do: conn_state(conn)
+
+ def skip_oauth_check(conn, _params), do: conn_state(conn)
+
+ def fallback_oauth_skip_publicity_check(conn, _params), do: conn_state(conn)
+
+ def skip_oauth_skip_publicity_check(conn, _params), do: conn_state(conn)
+
+ def missing_oauth_check_definition(conn, _params), do: conn_state(conn)
+
+ defp conn_state(%{assigns: %{user: %User{} = user}} = conn),
+ do: json(conn, %{user_id: user.id})
+
+ defp conn_state(conn), do: json(conn, %{user_id: nil})
+end
diff --git a/lib/pleroma/thread_mute.ex b/lib/pleroma/thread_mute.ex
index 65cbbede3..be01d541d 100644
--- a/lib/pleroma/thread_mute.ex
+++ b/lib/pleroma/thread_mute.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.ThreadMute do
@@ -9,7 +9,8 @@ defmodule Pleroma.ThreadMute do
alias Pleroma.ThreadMute
alias Pleroma.User
- require Ecto.Query
+ import Ecto.Changeset
+ import Ecto.Query
schema "thread_mutes" do
belongs_to(:user, User, type: FlakeId.Ecto.CompatType)
@@ -18,19 +19,44 @@ defmodule Pleroma.ThreadMute do
def changeset(mute, params \\ %{}) do
mute
- |> Ecto.Changeset.cast(params, [:user_id, :context])
- |> Ecto.Changeset.foreign_key_constraint(:user_id)
- |> Ecto.Changeset.unique_constraint(:user_id, name: :unique_index)
+ |> cast(params, [:user_id, :context])
+ |> foreign_key_constraint(:user_id)
+ |> unique_constraint(:user_id, name: :unique_index)
end
def query(user_id, context) do
- {:ok, user_id} = FlakeId.Ecto.CompatType.dump(user_id)
+ user_binary_id = User.binary_id(user_id)
ThreadMute
- |> Ecto.Query.where(user_id: ^user_id)
- |> Ecto.Query.where(context: ^context)
+ |> where(user_id: ^user_binary_id)
+ |> where(context: ^context)
end
+ def muters_query(context) do
+ ThreadMute
+ |> join(:inner, [tm], u in assoc(tm, :user))
+ |> where([tm], tm.context == ^context)
+ |> select([tm, u], u.ap_id)
+ end
+
+ def muter_ap_ids(context, ap_ids \\ nil)
+
+ # Note: applies to fake activities (ActivityPub.Utils.get_notified_from_object/1 etc.)
+ def muter_ap_ids(context, _ap_ids) when is_nil(context), do: []
+
+ def muter_ap_ids(context, ap_ids) do
+ context
+ |> muters_query()
+ |> maybe_filter_on_ap_id(ap_ids)
+ |> Repo.all()
+ end
+
+ defp maybe_filter_on_ap_id(query, ap_ids) when is_list(ap_ids) do
+ where(query, [tm, u], u.ap_id in ^ap_ids)
+ end
+
+ defp maybe_filter_on_ap_id(query, _ap_ids), do: query
+
def add_mute(user_id, context) do
%ThreadMute{}
|> changeset(%{user_id: user_id, context: context})
@@ -42,8 +68,8 @@ defmodule Pleroma.ThreadMute do
|> Repo.delete_all()
end
- def check_muted(user_id, context) do
+ def exists?(user_id, context) do
query(user_id, context)
- |> Repo.all()
+ |> Repo.exists?()
end
end
diff --git a/lib/pleroma/upload.ex b/lib/pleroma/upload.ex
index 2e0986197..1be1a3a5b 100644
--- a/lib/pleroma/upload.ex
+++ b/lib/pleroma/upload.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Upload do
@@ -37,6 +37,7 @@ defmodule Pleroma.Upload do
Plug.Upload.t()
| (data_uri_string :: String.t())
| {:from_local, name :: String.t(), id :: String.t(), path :: String.t()}
+ | map()
@type option ::
{:type, :avatar | :banner | :background}
@@ -133,7 +134,7 @@ defmodule Pleroma.Upload do
end
end
- defp prepare_upload(%{"img" => "data:image/" <> image_data}, opts) do
+ defp prepare_upload(%{img: "data:image/" <> image_data}, opts) do
parsed = Regex.named_captures(~r/(?<filetype>jpeg|png|gif);base64,(?<data>.*)/, image_data)
data = Base.decode64!(parsed["data"], ignore: :whitespace)
hash = String.downcase(Base.encode16(:crypto.hash(:sha256, data)))
diff --git a/lib/pleroma/upload/filter.ex b/lib/pleroma/upload/filter.ex
index fa02a55de..dbdadc97f 100644
--- a/lib/pleroma/upload/filter.ex
+++ b/lib/pleroma/upload/filter.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Upload.Filter do
diff --git a/lib/pleroma/upload/filter/anonymize_filename.ex b/lib/pleroma/upload/filter/anonymize_filename.ex
index a8516811c..07ead8203 100644
--- a/lib/pleroma/upload/filter/anonymize_filename.ex
+++ b/lib/pleroma/upload/filter/anonymize_filename.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Upload.Filter.AnonymizeFilename do
diff --git a/lib/pleroma/upload/filter/dedupe.ex b/lib/pleroma/upload/filter/dedupe.ex
index 14928c355..41218a918 100644
--- a/lib/pleroma/upload/filter/dedupe.ex
+++ b/lib/pleroma/upload/filter/dedupe.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Upload.Filter.Dedupe do
diff --git a/lib/pleroma/upload/filter/mogrifun.ex b/lib/pleroma/upload/filter/mogrifun.ex
index fee49fb51..7d95577a4 100644
--- a/lib/pleroma/upload/filter/mogrifun.ex
+++ b/lib/pleroma/upload/filter/mogrifun.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Upload.Filter.Mogrifun do
diff --git a/lib/pleroma/upload/filter/mogrify.ex b/lib/pleroma/upload/filter/mogrify.ex
index 91bfdd4f5..2eb758006 100644
--- a/lib/pleroma/upload/filter/mogrify.ex
+++ b/lib/pleroma/upload/filter/mogrify.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Upload.Filter.Mogrify do
diff --git a/lib/pleroma/uploaders/local.ex b/lib/pleroma/uploaders/local.ex
index 36b3c35ec..10b3069f4 100644
--- a/lib/pleroma/uploaders/local.ex
+++ b/lib/pleroma/uploaders/local.ex
@@ -1,14 +1,16 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Uploaders.Local do
@behaviour Pleroma.Uploaders.Uploader
+ @impl true
def get_file(_) do
{:ok, {:static_dir, upload_path()}}
end
+ @impl true
def put_file(upload) do
{local_path, file} =
case Enum.reverse(Path.split(upload.path)) do
@@ -33,4 +35,15 @@ defmodule Pleroma.Uploaders.Local do
def upload_path do
Pleroma.Config.get!([__MODULE__, :uploads])
end
+
+ @impl true
+ def delete_file(path) do
+ upload_path()
+ |> Path.join(path)
+ |> File.rm()
+ |> case do
+ :ok -> :ok
+ {:error, posix_error} -> {:error, to_string(posix_error)}
+ end
+ end
end
diff --git a/lib/pleroma/uploaders/mdii.ex b/lib/pleroma/uploaders/mdii.ex
deleted file mode 100644
index c36f3d61d..000000000
--- a/lib/pleroma/uploaders/mdii.ex
+++ /dev/null
@@ -1,37 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Uploaders.MDII do
- @moduledoc "Represents uploader for https://github.com/hakaba-hitoyo/minimal-digital-image-infrastructure"
-
- alias Pleroma.Config
- alias Pleroma.HTTP
-
- @behaviour Pleroma.Uploaders.Uploader
-
- # MDII-hosted images are never passed through the MediaPlug; only local media.
- # Delegate to Pleroma.Uploaders.Local
- def get_file(file) do
- Pleroma.Uploaders.Local.get_file(file)
- end
-
- def put_file(upload) do
- cgi = Config.get([Pleroma.Uploaders.MDII, :cgi])
- files = Config.get([Pleroma.Uploaders.MDII, :files])
-
- {:ok, file_data} = File.read(upload.tempfile)
-
- extension = String.split(upload.name, ".") |> List.last()
- query = "#{cgi}?#{extension}"
-
- with {:ok, %{status: 200, body: body}} <-
- HTTP.post(query, file_data, [], adapter: [pool: :default]) do
- remote_file_name = String.split(body) |> List.first()
- public_url = "#{files}/#{remote_file_name}.#{extension}"
- {:ok, {:url, public_url}}
- else
- _ -> Pleroma.Uploaders.Local.put_file(upload)
- end
- end
-end
diff --git a/lib/pleroma/uploaders/s3.ex b/lib/pleroma/uploaders/s3.ex
index 9876b6398..a13ff23b6 100644
--- a/lib/pleroma/uploaders/s3.ex
+++ b/lib/pleroma/uploaders/s3.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Uploaders.S3 do
@@ -10,6 +10,7 @@ defmodule Pleroma.Uploaders.S3 do
# The file name is re-encoded with S3's constraints here to comply with previous
# links with less strict filenames
+ @impl true
def get_file(file) do
config = Config.get([__MODULE__])
bucket = Keyword.fetch!(config, :bucket)
@@ -35,6 +36,7 @@ defmodule Pleroma.Uploaders.S3 do
])}}
end
+ @impl true
def put_file(%Pleroma.Upload{} = upload) do
config = Config.get([__MODULE__])
bucket = Keyword.get(config, :bucket)
@@ -69,6 +71,18 @@ defmodule Pleroma.Uploaders.S3 do
end
end
+ @impl true
+ def delete_file(file) do
+ [__MODULE__, :bucket]
+ |> Config.get()
+ |> ExAws.S3.delete_object(file)
+ |> ExAws.request()
+ |> case do
+ {:ok, %{status_code: 204}} -> :ok
+ error -> {:error, inspect(error)}
+ end
+ end
+
@regex Regex.compile!("[^0-9a-zA-Z!.*/'()_-]")
def strict_encode(name) do
String.replace(name, @regex, "-")
diff --git a/lib/pleroma/uploaders/uploader.ex b/lib/pleroma/uploaders/uploader.ex
index c0b22c28a..9a94534e9 100644
--- a/lib/pleroma/uploaders/uploader.ex
+++ b/lib/pleroma/uploaders/uploader.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Uploaders.Uploader do
@@ -36,6 +36,8 @@ defmodule Pleroma.Uploaders.Uploader do
@callback put_file(Pleroma.Upload.t()) ::
:ok | {:ok, file_spec()} | {:error, String.t()} | :wait_callback
+ @callback delete_file(file :: String.t()) :: :ok | {:error, String.t()}
+
@callback http_callback(Plug.Conn.t(), Map.t()) ::
{:ok, Plug.Conn.t()}
| {:ok, Plug.Conn.t(), file_spec()}
@@ -43,7 +45,6 @@ defmodule Pleroma.Uploaders.Uploader do
@optional_callbacks http_callback: 2
@spec put_file(module(), Pleroma.Upload.t()) :: {:ok, file_spec()} | {:error, String.t()}
-
def put_file(uploader, upload) do
case uploader.put_file(upload) do
:ok -> {:ok, {:file, upload.path}}
diff --git a/lib/pleroma/user.ex b/lib/pleroma/user.ex
index 2bbfaa55b..cba391072 100644
--- a/lib/pleroma/user.ex
+++ b/lib/pleroma/user.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.User do
@@ -7,21 +7,31 @@ defmodule Pleroma.User do
import Ecto.Changeset
import Ecto.Query
+ import Ecto, only: [assoc: 2]
- alias Comeonin.Pbkdf2
alias Ecto.Multi
alias Pleroma.Activity
+ alias Pleroma.Config
alias Pleroma.Conversation.Participation
alias Pleroma.Delivery
+ alias Pleroma.Emoji
+ alias Pleroma.FollowingRelationship
+ alias Pleroma.Formatter
+ alias Pleroma.HTML
alias Pleroma.Keys
+ alias Pleroma.MFA
alias Pleroma.Notification
alias Pleroma.Object
alias Pleroma.Registration
alias Pleroma.Repo
alias Pleroma.RepoStreamer
alias Pleroma.User
+ alias Pleroma.UserRelationship
alias Pleroma.Web
alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.Builder
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+ alias Pleroma.Web.ActivityPub.Pipeline
alias Pleroma.Web.ActivityPub.Utils
alias Pleroma.Web.CommonAPI
alias Pleroma.Web.CommonAPI.Utils, as: CommonUtils
@@ -32,7 +42,7 @@ defmodule Pleroma.User do
require Logger
@type t :: %__MODULE__{}
-
+ @type account_status :: :active | :deactivated | :password_reset_pending | :confirmation_pending
@primary_key {:id, FlakeId.Ecto.CompatType, autogenerate: true}
# credo:disable-for-next-line Credo.Check.Readability.MaxLineLength
@@ -41,6 +51,32 @@ defmodule Pleroma.User do
@strict_local_nickname_regex ~r/^[a-zA-Z\d]+$/
@extended_local_nickname_regex ~r/^[a-zA-Z\d_-]+$/
+ # AP ID user relationships (blocks, mutes etc.)
+ # Format: [rel_type: [outgoing_rel: :outgoing_rel_target, incoming_rel: :incoming_rel_source]]
+ @user_relationships_config [
+ block: [
+ blocker_blocks: :blocked_users,
+ blockee_blocks: :blocker_users
+ ],
+ mute: [
+ muter_mutes: :muted_users,
+ mutee_mutes: :muter_users
+ ],
+ reblog_mute: [
+ reblog_muter_mutes: :reblog_muted_users,
+ reblog_mutee_mutes: :reblog_muter_users
+ ],
+ notification_mute: [
+ notification_muter_mutes: :notification_muted_users,
+ notification_mutee_mutes: :notification_muter_users
+ ],
+ # Note: `inverse_subscription` relationship is inverse: subscriber acts as relationship target
+ inverse_subscription: [
+ subscribee_subscriptions: :subscriber_users,
+ subscriber_subscriptions: :subscribee_users
+ ]
+ ]
+
schema "users" do
field(:bio, :string)
field(:email, :string)
@@ -50,7 +86,7 @@ defmodule Pleroma.User do
field(:password, :string, virtual: true)
field(:password_confirmation, :string, virtual: true)
field(:keys, :string)
- field(:following, {:array, :string}, default: [])
+ field(:public_key, :string)
field(:ap_id, :string)
field(:avatar, :map)
field(:local, :boolean, default: true)
@@ -61,34 +97,210 @@ defmodule Pleroma.User do
field(:tags, {:array, :string}, default: [])
field(:last_refreshed_at, :naive_datetime_usec)
field(:last_digest_emailed_at, :naive_datetime)
+ field(:banner, :map, default: %{})
+ field(:background, :map, default: %{})
+ field(:note_count, :integer, default: 0)
+ field(:follower_count, :integer, default: 0)
+ field(:following_count, :integer, default: 0)
+ field(:locked, :boolean, default: false)
+ field(:confirmation_pending, :boolean, default: false)
+ field(:password_reset_pending, :boolean, default: false)
+ field(:confirmation_token, :string, default: nil)
+ field(:default_scope, :string, default: "public")
+ field(:domain_blocks, {:array, :string}, default: [])
+ field(:deactivated, :boolean, default: false)
+ field(:no_rich_text, :boolean, default: false)
+ field(:ap_enabled, :boolean, default: false)
+ field(:is_moderator, :boolean, default: false)
+ field(:is_admin, :boolean, default: false)
+ field(:show_role, :boolean, default: true)
+ field(:settings, :map, default: nil)
+ field(:uri, Types.Uri, default: nil)
+ field(:hide_followers_count, :boolean, default: false)
+ field(:hide_follows_count, :boolean, default: false)
+ field(:hide_followers, :boolean, default: false)
+ field(:hide_follows, :boolean, default: false)
+ field(:hide_favorites, :boolean, default: true)
+ field(:unread_conversation_count, :integer, default: 0)
+ field(:pinned_activities, {:array, :string}, default: [])
+ field(:email_notifications, :map, default: %{"digest" => false})
+ field(:mascot, :map, default: nil)
+ field(:emoji, :map, default: %{})
+ field(:pleroma_settings_store, :map, default: %{})
+ field(:fields, {:array, :map}, default: [])
+ field(:raw_fields, {:array, :map}, default: [])
+ field(:discoverable, :boolean, default: false)
+ field(:invisible, :boolean, default: false)
+ field(:allow_following_move, :boolean, default: true)
+ field(:skip_thread_containment, :boolean, default: false)
+ field(:actor_type, :string, default: "Person")
+ field(:also_known_as, {:array, :string}, default: [])
+ field(:inbox, :string)
+ field(:shared_inbox, :string)
+
+ embeds_one(
+ :notification_settings,
+ Pleroma.User.NotificationSetting,
+ on_replace: :update
+ )
+
has_many(:notifications, Notification)
has_many(:registrations, Registration)
has_many(:deliveries, Delivery)
- embeds_one(:info, User.Info)
+
+ has_many(:outgoing_relationships, UserRelationship, foreign_key: :source_id)
+ has_many(:incoming_relationships, UserRelationship, foreign_key: :target_id)
+
+ for {relationship_type,
+ [
+ {outgoing_relation, outgoing_relation_target},
+ {incoming_relation, incoming_relation_source}
+ ]} <- @user_relationships_config do
+ # Definitions of `has_many` relations: :blocker_blocks, :muter_mutes, :reblog_muter_mutes,
+ # :notification_muter_mutes, :subscribee_subscriptions
+ has_many(outgoing_relation, UserRelationship,
+ foreign_key: :source_id,
+ where: [relationship_type: relationship_type]
+ )
+
+ # Definitions of `has_many` relations: :blockee_blocks, :mutee_mutes, :reblog_mutee_mutes,
+ # :notification_mutee_mutes, :subscriber_subscriptions
+ has_many(incoming_relation, UserRelationship,
+ foreign_key: :target_id,
+ where: [relationship_type: relationship_type]
+ )
+
+ # Definitions of `has_many` relations: :blocked_users, :muted_users, :reblog_muted_users,
+ # :notification_muted_users, :subscriber_users
+ has_many(outgoing_relation_target, through: [outgoing_relation, :target])
+
+ # Definitions of `has_many` relations: :blocker_users, :muter_users, :reblog_muter_users,
+ # :notification_muter_users, :subscribee_users
+ has_many(incoming_relation_source, through: [incoming_relation, :source])
+ end
+
+ # `:blocks` is deprecated (replaced with `blocked_users` relation)
+ field(:blocks, {:array, :string}, default: [])
+ # `:mutes` is deprecated (replaced with `muted_users` relation)
+ field(:mutes, {:array, :string}, default: [])
+ # `:muted_reblogs` is deprecated (replaced with `reblog_muted_users` relation)
+ field(:muted_reblogs, {:array, :string}, default: [])
+ # `:muted_notifications` is deprecated (replaced with `notification_muted_users` relation)
+ field(:muted_notifications, {:array, :string}, default: [])
+ # `:subscribers` is deprecated (replaced with `subscriber_users` relation)
+ field(:subscribers, {:array, :string}, default: [])
+
+ embeds_one(
+ :multi_factor_authentication_settings,
+ MFA.Settings,
+ on_replace: :delete
+ )
timestamps()
end
- def auth_active?(%User{info: %User.Info{confirmation_pending: true}}),
- do: !Pleroma.Config.get([:instance, :account_activation_required])
+ for {_relationship_type, [{_outgoing_relation, outgoing_relation_target}, _]} <-
+ @user_relationships_config do
+ # `def blocked_users_relation/2`, `def muted_users_relation/2`,
+ # `def reblog_muted_users_relation/2`, `def notification_muted_users/2`,
+ # `def subscriber_users/2`
+ def unquote(:"#{outgoing_relation_target}_relation")(user, restrict_deactivated? \\ false) do
+ target_users_query = assoc(user, unquote(outgoing_relation_target))
- def auth_active?(%User{}), do: true
+ if restrict_deactivated? do
+ restrict_deactivated(target_users_query)
+ else
+ target_users_query
+ end
+ end
+ # `def blocked_users/2`, `def muted_users/2`, `def reblog_muted_users/2`,
+ # `def notification_muted_users/2`, `def subscriber_users/2`
+ def unquote(outgoing_relation_target)(user, restrict_deactivated? \\ false) do
+ __MODULE__
+ |> apply(unquote(:"#{outgoing_relation_target}_relation"), [
+ user,
+ restrict_deactivated?
+ ])
+ |> Repo.all()
+ end
+
+ # `def blocked_users_ap_ids/2`, `def muted_users_ap_ids/2`, `def reblog_muted_users_ap_ids/2`,
+ # `def notification_muted_users_ap_ids/2`, `def subscriber_users_ap_ids/2`
+ def unquote(:"#{outgoing_relation_target}_ap_ids")(user, restrict_deactivated? \\ false) do
+ __MODULE__
+ |> apply(unquote(:"#{outgoing_relation_target}_relation"), [
+ user,
+ restrict_deactivated?
+ ])
+ |> select([u], u.ap_id)
+ |> Repo.all()
+ end
+ end
+
+ @doc """
+ Dumps Flake Id to SQL-compatible format (16-byte UUID).
+ E.g. "9pQtDGXuq4p3VlcJEm" -> <<0, 0, 1, 110, 179, 218, 42, 92, 213, 41, 44, 227, 95, 213, 0, 0>>
+ """
+ def binary_id(source_id) when is_binary(source_id) do
+ with {:ok, dumped_id} <- FlakeId.Ecto.CompatType.dump(source_id) do
+ dumped_id
+ else
+ _ -> source_id
+ end
+ end
+
+ def binary_id(source_ids) when is_list(source_ids) do
+ Enum.map(source_ids, &binary_id/1)
+ end
+
+ def binary_id(%User{} = user), do: binary_id(user.id)
+
+ @doc "Returns status account"
+ @spec account_status(User.t()) :: account_status()
+ def account_status(%User{deactivated: true}), do: :deactivated
+ def account_status(%User{password_reset_pending: true}), do: :password_reset_pending
+
+ def account_status(%User{confirmation_pending: true}) do
+ case Config.get([:instance, :account_activation_required]) do
+ true -> :confirmation_pending
+ _ -> :active
+ end
+ end
+
+ def account_status(%User{}), do: :active
+
+ @spec visible_for?(User.t(), User.t() | nil) :: boolean()
def visible_for?(user, for_user \\ nil)
- def visible_for?(%User{id: user_id}, %User{id: for_id}) when user_id == for_id, do: true
+ def visible_for?(%User{invisible: true}, _), do: false
+
+ def visible_for?(%User{id: user_id}, %User{id: user_id}), do: true
+
+ def visible_for?(%User{local: local} = user, nil) do
+ cfg_key =
+ if local,
+ do: :local,
+ else: :remote
+
+ if Config.get([:restrict_unauthenticated, :profiles, cfg_key]),
+ do: false,
+ else: account_status(user) == :active
+ end
def visible_for?(%User{} = user, for_user) do
- auth_active?(user) || superuser?(for_user)
+ account_status(user) == :active || superuser?(for_user)
end
def visible_for?(_, _), do: false
- def superuser?(%User{local: true, info: %User.Info{is_admin: true}}), do: true
- def superuser?(%User{local: true, info: %User.Info{is_moderator: true}}), do: true
+ @spec superuser?(User.t()) :: boolean()
+ def superuser?(%User{local: true, is_admin: true}), do: true
+ def superuser?(%User{local: true, is_moderator: true}), do: true
def superuser?(_), do: false
- def invisible?(%User{info: %User.Info{invisible: true}}), do: true
+ @spec invisible?(User.t()) :: boolean()
+ def invisible?(%User{invisible: true}), do: true
def invisible?(_), do: false
def avatar_url(user, options \\ []) do
@@ -99,76 +311,35 @@ defmodule Pleroma.User do
end
def banner_url(user, options \\ []) do
- case user.info.banner do
+ case user.banner do
%{"url" => [%{"href" => href} | _]} -> href
_ -> !options[:no_default] && "#{Web.base_url()}/images/banner.png"
end
end
- def profile_url(%User{info: %{source_data: %{"url" => url}}}), do: url
- def profile_url(%User{ap_id: ap_id}), do: ap_id
- def profile_url(_), do: nil
-
+ # Should probably be renamed or removed
def ap_id(%User{nickname: nickname}), do: "#{Web.base_url()}/users/#{nickname}"
def ap_followers(%User{follower_address: fa}) when is_binary(fa), do: fa
def ap_followers(%User{} = user), do: "#{ap_id(user)}/followers"
- @spec ap_following(User.t()) :: Sring.t()
+ @spec ap_following(User.t()) :: String.t()
def ap_following(%User{following_address: fa}) when is_binary(fa), do: fa
def ap_following(%User{} = user), do: "#{ap_id(user)}/following"
- def user_info(%User{} = user, args \\ %{}) do
- following_count =
- Map.get(args, :following_count, user.info.following_count || following_count(user))
-
- follower_count = Map.get(args, :follower_count, user.info.follower_count)
-
- %{
- note_count: user.info.note_count,
- locked: user.info.locked,
- confirmation_pending: user.info.confirmation_pending,
- default_scope: user.info.default_scope
- }
- |> Map.put(:following_count, following_count)
- |> Map.put(:follower_count, follower_count)
- end
-
- def follow_state(%User{} = user, %User{} = target) do
- case Utils.fetch_latest_follow(user, target) do
- %{data: %{"state" => state}} -> state
- # Ideally this would be nil, but then Cachex does not commit the value
- _ -> false
- end
- end
-
- def get_cached_follow_state(user, target) do
- key = "follow_state:#{user.ap_id}|#{target.ap_id}"
- Cachex.fetch!(:user_cache, key, fn _ -> {:commit, follow_state(user, target)} end)
- end
-
- @spec set_follow_state_cache(String.t(), String.t(), String.t()) :: {:ok | :error, boolean()}
- def set_follow_state_cache(user_ap_id, target_ap_id, state) do
- Cachex.put(:user_cache, "follow_state:#{user_ap_id}|#{target_ap_id}", state)
- end
-
- def set_info_cache(user, args) do
- Cachex.put(:user_cache, "user_info:#{user.id}", user_info(user, args))
- end
-
@spec restrict_deactivated(Ecto.Query.t()) :: Ecto.Query.t()
def restrict_deactivated(query) do
- from(u in query,
- where: not fragment("? \\? 'deactivated' AND ?->'deactivated' @> 'true'", u.info, u.info)
- )
+ from(u in query, where: u.deactivated != ^true)
end
- def following_count(%User{following: []}), do: 0
+ defdelegate following_count(user), to: FollowingRelationship
- def following_count(%User{} = user) do
- user
- |> get_friends_query()
- |> Repo.aggregate(:count, :id)
+ defp truncate_fields_param(params) do
+ if Map.has_key?(params, :fields) do
+ Map.put(params, :fields, Enum.map(params[:fields], &truncate_field/1))
+ else
+ params
+ end
end
defp truncate_if_exists(params, key, max_length) do
@@ -180,36 +351,71 @@ defmodule Pleroma.User do
end
end
- def remote_user_creation(params) do
+ defp fix_follower_address(%{follower_address: _, following_address: _} = params), do: params
+
+ defp fix_follower_address(%{nickname: nickname} = params),
+ do: Map.put(params, :follower_address, ap_followers(%User{nickname: nickname}))
+
+ defp fix_follower_address(params), do: params
+
+ def remote_user_changeset(struct \\ %User{local: false}, params) do
bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000)
name_limit = Pleroma.Config.get([:instance, :user_name_length], 100)
+ name =
+ case params[:name] do
+ name when is_binary(name) and byte_size(name) > 0 -> name
+ _ -> params[:nickname]
+ end
+
params =
params
- |> Map.put(:info, params[:info] || %{})
+ |> Map.put(:name, name)
+ |> Map.put_new(:last_refreshed_at, NaiveDateTime.utc_now())
|> truncate_if_exists(:name, name_limit)
|> truncate_if_exists(:bio, bio_limit)
+ |> truncate_fields_param()
+ |> fix_follower_address()
- changeset =
- %User{local: false}
- |> cast(params, [:bio, :name, :ap_id, :nickname, :avatar])
- |> validate_required([:name, :ap_id])
- |> unique_constraint(:nickname)
- |> validate_format(:nickname, @email_regex)
- |> validate_length(:bio, max: bio_limit)
- |> validate_length(:name, max: name_limit)
- |> change_info(&User.Info.remote_user_creation(&1, params[:info]))
-
- case params[:info][:source_data] do
- %{"followers" => followers, "following" => following} ->
- changeset
- |> put_change(:follower_address, followers)
- |> put_change(:following_address, following)
-
- _ ->
- followers = ap_followers(%User{nickname: get_field(changeset, :nickname)})
- put_change(changeset, :follower_address, followers)
- end
+ struct
+ |> cast(
+ params,
+ [
+ :bio,
+ :name,
+ :emoji,
+ :ap_id,
+ :inbox,
+ :shared_inbox,
+ :nickname,
+ :public_key,
+ :avatar,
+ :ap_enabled,
+ :banner,
+ :locked,
+ :last_refreshed_at,
+ :uri,
+ :follower_address,
+ :following_address,
+ :hide_followers,
+ :hide_follows,
+ :hide_followers_count,
+ :hide_follows_count,
+ :follower_count,
+ :fields,
+ :following_count,
+ :discoverable,
+ :invisible,
+ :actor_type,
+ :also_known_as
+ ]
+ )
+ |> validate_required([:name, :ap_id])
+ |> unique_constraint(:nickname)
+ |> validate_format(:nickname, @email_regex)
+ |> validate_length(:bio, max: bio_limit)
+ |> validate_length(:name, max: name_limit)
+ |> validate_fields(true)
end
def update_changeset(struct, params \\ %{}) do
@@ -217,33 +423,128 @@ defmodule Pleroma.User do
name_limit = Pleroma.Config.get([:instance, :user_name_length], 100)
struct
- |> cast(params, [:bio, :name, :avatar, :following])
+ |> cast(
+ params,
+ [
+ :bio,
+ :name,
+ :emoji,
+ :avatar,
+ :public_key,
+ :inbox,
+ :shared_inbox,
+ :locked,
+ :no_rich_text,
+ :default_scope,
+ :banner,
+ :hide_follows,
+ :hide_followers,
+ :hide_followers_count,
+ :hide_follows_count,
+ :hide_favorites,
+ :allow_following_move,
+ :background,
+ :show_role,
+ :skip_thread_containment,
+ :fields,
+ :raw_fields,
+ :pleroma_settings_store,
+ :discoverable,
+ :actor_type,
+ :also_known_as
+ ]
+ )
|> unique_constraint(:nickname)
|> validate_format(:nickname, local_nickname_regex())
|> validate_length(:bio, max: bio_limit)
|> validate_length(:name, min: 1, max: name_limit)
+ |> put_fields()
+ |> put_emoji()
+ |> put_change_if_present(:bio, &{:ok, parse_bio(&1, struct)})
+ |> put_change_if_present(:avatar, &put_upload(&1, :avatar))
+ |> put_change_if_present(:banner, &put_upload(&1, :banner))
+ |> put_change_if_present(:background, &put_upload(&1, :background))
+ |> put_change_if_present(
+ :pleroma_settings_store,
+ &{:ok, Map.merge(struct.pleroma_settings_store, &1)}
+ )
+ |> validate_fields(false)
end
- def upgrade_changeset(struct, params \\ %{}, remote? \\ false) do
- bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000)
- name_limit = Pleroma.Config.get([:instance, :user_name_length], 100)
+ defp put_fields(changeset) do
+ if raw_fields = get_change(changeset, :raw_fields) do
+ raw_fields =
+ raw_fields
+ |> Enum.filter(fn %{"name" => n} -> n != "" end)
- params = Map.put(params, :last_refreshed_at, NaiveDateTime.utc_now())
+ fields =
+ raw_fields
+ |> Enum.map(fn f -> Map.update!(f, "value", &parse_fields(&1)) end)
+ changeset
+ |> put_change(:raw_fields, raw_fields)
+ |> put_change(:fields, fields)
+ else
+ changeset
+ end
+ end
+
+ defp parse_fields(value) do
+ value
+ |> Formatter.linkify(mentions_format: :full)
+ |> elem(0)
+ end
+
+ defp put_emoji(changeset) do
+ bio = get_change(changeset, :bio)
+ name = get_change(changeset, :name)
+
+ if bio || name do
+ emoji = Map.merge(Emoji.Formatter.get_emoji_map(bio), Emoji.Formatter.get_emoji_map(name))
+ put_change(changeset, :emoji, emoji)
+ else
+ changeset
+ end
+ end
+
+ defp put_change_if_present(changeset, map_field, value_function) do
+ if value = get_change(changeset, map_field) do
+ with {:ok, new_value} <- value_function.(value) do
+ put_change(changeset, map_field, new_value)
+ else
+ _ -> changeset
+ end
+ else
+ changeset
+ end
+ end
+
+ defp put_upload(value, type) do
+ with %Plug.Upload{} <- value,
+ {:ok, object} <- ActivityPub.upload(value, type: type) do
+ {:ok, object.data}
+ end
+ end
+
+ def update_as_admin_changeset(struct, params) do
struct
- |> cast(params, [
- :bio,
- :name,
- :follower_address,
- :following_address,
- :avatar,
- :last_refreshed_at
- ])
- |> unique_constraint(:nickname)
- |> validate_format(:nickname, local_nickname_regex())
- |> validate_length(:bio, max: bio_limit)
- |> validate_length(:name, max: name_limit)
- |> change_info(&User.Info.user_upgrade(&1, params[:info], remote?))
+ |> update_changeset(params)
+ |> cast(params, [:email])
+ |> delete_change(:also_known_as)
+ |> unique_constraint(:email)
+ |> validate_format(:email, @email_regex)
+ end
+
+ @spec update_as_admin(%User{}, map) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()}
+ def update_as_admin(user, params) do
+ params = Map.put(params, "password_confirmation", params["password"])
+ changeset = update_as_admin_changeset(user, params)
+
+ if params["password"] do
+ reset_password(user, changeset, params)
+ else
+ User.update_and_set_cache(changeset)
+ end
end
def password_update_changeset(struct, params) do
@@ -251,15 +552,19 @@ defmodule Pleroma.User do
|> cast(params, [:password, :password_confirmation])
|> validate_required([:password, :password_confirmation])
|> validate_confirmation(:password)
- |> put_password_hash
- |> put_embed(:info, User.Info.set_password_reset_pending(struct.info, false))
+ |> put_password_hash()
+ |> put_change(:password_reset_pending, false)
end
@spec reset_password(User.t(), map) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()}
- def reset_password(%User{id: user_id} = user, data) do
+ def reset_password(%User{} = user, params) do
+ reset_password(user, user, params)
+ end
+
+ def reset_password(%User{id: user_id} = user, struct, params) do
multi =
Multi.new()
- |> Multi.update(:user, password_update_changeset(user, data))
+ |> Multi.update(:user, password_update_changeset(struct, params))
|> Multi.delete_all(:tokens, OAuth.Token.Query.get_by_user(user_id))
|> Multi.delete_all(:auth, OAuth.Authorization.delete_by_user_query(user))
@@ -269,19 +574,19 @@ defmodule Pleroma.User do
end
end
+ def update_password_reset_pending(user, value) do
+ user
+ |> change()
+ |> put_change(:password_reset_pending, value)
+ |> update_and_set_cache()
+ end
+
def force_password_reset_async(user) do
BackgroundWorker.enqueue("force_password_reset", %{"user_id" => user.id})
end
@spec force_password_reset(User.t()) :: {:ok, User.t()} | {:error, Ecto.Changeset.t()}
- def force_password_reset(user) do
- info_cng = User.Info.set_password_reset_pending(user.info, true)
-
- user
- |> change()
- |> put_embed(:info, info_cng)
- |> update_and_set_cache()
- end
+ def force_password_reset(user), do: update_password_reset_pending(user, true)
def register_changeset(struct, params \\ %{}, opts \\ []) do
bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000)
@@ -295,7 +600,8 @@ defmodule Pleroma.User do
end
struct
- |> cast(params, [:bio, :email, :name, :nickname, :password, :password_confirmation])
+ |> confirmation_changeset(need_confirmation: need_confirmation?)
+ |> cast(params, [:bio, :email, :name, :nickname, :password, :password_confirmation, :emoji])
|> validate_required([:name, :nickname, :password, :password_confirmation])
|> validate_confirmation(:password)
|> unique_constraint(:email)
@@ -305,7 +611,6 @@ defmodule Pleroma.User do
|> validate_format(:email, @email_regex)
|> validate_length(:bio, max: bio_limit)
|> validate_length(:name, min: 1, max: name_limit)
- |> change_info(&User.Info.confirmation_changeset(&1, need_confirmation: need_confirmation?))
|> maybe_validate_required_email(opts[:external])
|> put_password_hash
|> put_ap_id()
@@ -314,7 +619,14 @@ defmodule Pleroma.User do
end
def maybe_validate_required_email(changeset, true), do: changeset
- def maybe_validate_required_email(changeset, _), do: validate_required(changeset, [:email])
+
+ def maybe_validate_required_email(changeset, _) do
+ if Pleroma.Config.get([:instance, :account_activation_required]) do
+ validate_required(changeset, [:email])
+ else
+ changeset
+ end
+ end
defp put_ap_id(changeset) do
ap_id = ap_id(%User{nickname: get_field(changeset, :nickname)})
@@ -325,7 +637,6 @@ defmodule Pleroma.User do
followers = ap_followers(%User{nickname: get_field(changeset, :nickname)})
changeset
- |> put_change(:following, [followers])
|> put_change(:follower_address, followers)
end
@@ -356,7 +667,7 @@ defmodule Pleroma.User do
end
def try_send_confirmation_email(%User{} = user) do
- if user.info.confirmation_pending &&
+ if user.confirmation_pending &&
Pleroma.Config.get([:instance, :account_activation_required]) do
user
|> Pleroma.Emails.UserEmail.account_confirmation_email()
@@ -368,6 +679,10 @@ defmodule Pleroma.User do
end
end
+ def try_send_confirmation_email(users) do
+ Enum.each(users, &try_send_confirmation_email/1)
+ end
+
def needs_update?(%User{local: true}), do: false
def needs_update?(%User{local: false, last_refreshed_at: nil}), do: true
@@ -379,8 +694,10 @@ defmodule Pleroma.User do
def needs_update?(_), do: true
@spec maybe_direct_follow(User.t(), User.t()) :: {:ok, User.t()} | {:error, String.t()}
- def maybe_direct_follow(%User{} = follower, %User{local: true, info: %{locked: true}}) do
- {:ok, follower}
+
+ # "Locked" (self-locked) users demand explicit authorization of follow requests
+ def maybe_direct_follow(%User{} = follower, %User{local: true, locked: true} = followed) do
+ follow(follower, followed, :follow_pending)
end
def maybe_direct_follow(%User{} = follower, %User{local: true} = followed) do
@@ -398,95 +715,91 @@ defmodule Pleroma.User do
@doc "A mass follow for local users. Respects blocks in both directions but does not create activities."
@spec follow_all(User.t(), list(User.t())) :: {atom(), User.t()}
def follow_all(follower, followeds) do
- followed_addresses =
- followeds
- |> Enum.reject(fn followed -> blocks?(follower, followed) || blocks?(followed, follower) end)
- |> Enum.map(fn %{follower_address: fa} -> fa end)
-
- q =
- from(u in User,
- where: u.id == ^follower.id,
- update: [
- set: [
- following:
- fragment(
- "array(select distinct unnest (array_cat(?, ?)))",
- u.following,
- ^followed_addresses
- )
- ]
- ],
- select: u
- )
-
- {1, [follower]} = Repo.update_all(q, [])
-
- Enum.each(followeds, &update_follower_count/1)
+ followeds
+ |> Enum.reject(fn followed -> blocks?(follower, followed) || blocks?(followed, follower) end)
+ |> Enum.each(&follow(follower, &1, :follow_accept))
set_cache(follower)
end
- def follow(%User{} = follower, %User{info: info} = followed) do
+ defdelegate following(user), to: FollowingRelationship
+
+ def follow(%User{} = follower, %User{} = followed, state \\ :follow_accept) do
deny_follow_blocked = Pleroma.Config.get([:user, :deny_follow_blocked])
- ap_followers = followed.follower_address
cond do
- info.deactivated ->
- {:error, "Could not follow user: You are deactivated."}
+ followed.deactivated ->
+ {:error, "Could not follow user: #{followed.nickname} is deactivated."}
deny_follow_blocked and blocks?(followed, follower) ->
{:error, "Could not follow user: #{followed.nickname} blocked you."}
true ->
- q =
- from(u in User,
- where: u.id == ^follower.id,
- update: [push: [following: ^ap_followers]],
- select: u
- )
-
- {1, [follower]} = Repo.update_all(q, [])
-
- follower = maybe_update_following_count(follower)
+ FollowingRelationship.follow(follower, followed, state)
{:ok, _} = update_follower_count(followed)
- set_cache(follower)
+ follower
+ |> update_following_count()
+ |> set_cache()
end
end
+ def unfollow(%User{ap_id: ap_id}, %User{ap_id: ap_id}) do
+ {:error, "Not subscribed!"}
+ end
+
def unfollow(%User{} = follower, %User{} = followed) do
- ap_followers = followed.follower_address
-
- if following?(follower, followed) and follower.ap_id != followed.ap_id do
- q =
- from(u in User,
- where: u.id == ^follower.id,
- update: [pull: [following: ^ap_followers]],
- select: u
- )
+ case get_follow_state(follower, followed) do
+ state when state in [:follow_pending, :follow_accept] ->
+ FollowingRelationship.unfollow(follower, followed)
+ {:ok, followed} = update_follower_count(followed)
- {1, [follower]} = Repo.update_all(q, [])
+ {:ok, follower} =
+ follower
+ |> update_following_count()
+ |> set_cache()
- follower = maybe_update_following_count(follower)
+ {:ok, follower, Utils.fetch_latest_follow(follower, followed)}
- {:ok, followed} = update_follower_count(followed)
+ nil ->
+ {:error, "Not subscribed!"}
+ end
+ end
- set_cache(follower)
+ defdelegate following?(follower, followed), to: FollowingRelationship
- {:ok, follower, Utils.fetch_latest_follow(follower, followed)}
- else
- {:error, "Not subscribed!"}
- end
+ @doc "Returns follow state as Pleroma.FollowingRelationship.State value"
+ def get_follow_state(%User{} = follower, %User{} = following) do
+ following_relationship = FollowingRelationship.get(follower, following)
+ get_follow_state(follower, following, following_relationship)
end
- @spec following?(User.t(), User.t()) :: boolean
- def following?(%User{} = follower, %User{} = followed) do
- Enum.member?(follower.following, followed.follower_address)
+ def get_follow_state(
+ %User{} = follower,
+ %User{} = following,
+ following_relationship
+ ) do
+ case {following_relationship, following.local} do
+ {nil, false} ->
+ case Utils.fetch_latest_follow(follower, following) do
+ %Activity{data: %{"state" => state}} when state in ["pending", "accept"] ->
+ FollowingRelationship.state_to_enum(state)
+
+ _ ->
+ nil
+ end
+
+ {%{state: state}, _} ->
+ state
+
+ {nil, _} ->
+ nil
+ end
end
def locked?(%User{} = user) do
- user.info.locked || false
+ user.locked || false
end
def get_by_id(id) do
@@ -525,25 +838,52 @@ defmodule Pleroma.User do
def set_cache(%User{} = user) do
Cachex.put(:user_cache, "ap_id:#{user.ap_id}", user)
Cachex.put(:user_cache, "nickname:#{user.nickname}", user)
- Cachex.put(:user_cache, "user_info:#{user.id}", user_info(user))
+ Cachex.put(:user_cache, "friends_ap_ids:#{user.nickname}", get_user_friends_ap_ids(user))
{:ok, user}
end
+ def update_and_set_cache(struct, params) do
+ struct
+ |> update_changeset(params)
+ |> update_and_set_cache()
+ end
+
def update_and_set_cache(changeset) do
with {:ok, user} <- Repo.update(changeset, stale_error_field: :id) do
set_cache(user)
end
end
+ def get_user_friends_ap_ids(user) do
+ from(u in User.get_friends_query(user), select: u.ap_id)
+ |> Repo.all()
+ end
+
+ @spec get_cached_user_friends_ap_ids(User.t()) :: [String.t()]
+ def get_cached_user_friends_ap_ids(user) do
+ Cachex.fetch!(:user_cache, "friends_ap_ids:#{user.ap_id}", fn _ ->
+ get_user_friends_ap_ids(user)
+ end)
+ end
+
def invalidate_cache(user) do
Cachex.del(:user_cache, "ap_id:#{user.ap_id}")
Cachex.del(:user_cache, "nickname:#{user.nickname}")
- Cachex.del(:user_cache, "user_info:#{user.id}")
+ Cachex.del(:user_cache, "friends_ap_ids:#{user.ap_id}")
end
+ @spec get_cached_by_ap_id(String.t()) :: User.t() | nil
def get_cached_by_ap_id(ap_id) do
key = "ap_id:#{ap_id}"
- Cachex.fetch!(:user_cache, key, fn _ -> get_by_ap_id(ap_id) end)
+
+ with {:ok, nil} <- Cachex.get(:user_cache, key),
+ user when not is_nil(user) <- get_by_ap_id(ap_id),
+ {:ok, true} <- Cachex.put(:user_cache, key, user) do
+ user
+ else
+ {:ok, user} -> user
+ nil -> nil
+ end
end
def get_cached_by_id(id) do
@@ -593,6 +933,7 @@ defmodule Pleroma.User do
end
end
+ @spec get_by_nickname(String.t()) :: User.t() | nil
def get_by_nickname(nickname) do
Repo.get_by(User, nickname: nickname) ||
if Regex.match?(~r(@#{Pleroma.Web.Endpoint.host()})i, nickname) do
@@ -606,11 +947,6 @@ defmodule Pleroma.User do
get_by_nickname(nickname_or_email) || get_by_email(nickname_or_email)
end
- def get_cached_user_info(user) do
- key = "user_info:#{user.id}"
- Cachex.fetch!(:user_cache, key, fn -> user_info(user) end)
- end
-
def fetch_by_nickname(nickname), do: ActivityPub.make_user_from_nickname(nickname)
def get_or_fetch_by_nickname(nickname) do
@@ -620,10 +956,6 @@ defmodule Pleroma.User do
_e ->
with [_nick, _domain] <- String.split(nickname, "@"),
{:ok, user} <- fetch_by_nickname(nickname) do
- if Pleroma.Config.get([:fetch_initial_posts, :enabled]) do
- fetch_initial_posts(user)
- end
-
{:ok, user}
else
_e -> {:error, "not found " <> nickname}
@@ -631,11 +963,6 @@ defmodule Pleroma.User do
end
end
- @doc "Fetch some posts when the user has just been federated with"
- def fetch_initial_posts(user) do
- BackgroundWorker.enqueue("fetch_initial_posts", %{"user_id" => user.id})
- end
-
@spec get_followers_query(User.t(), pos_integer() | nil) :: Ecto.Query.t()
def get_followers_query(%User{} = user, nil) do
User.Query.build(%{followers: user, deactivated: false})
@@ -650,14 +977,14 @@ defmodule Pleroma.User do
@spec get_followers_query(User.t()) :: Ecto.Query.t()
def get_followers_query(user), do: get_followers_query(user, nil)
- @spec get_followers(User.t(), pos_integer()) :: {:ok, list(User.t())}
+ @spec get_followers(User.t(), pos_integer() | nil) :: {:ok, list(User.t())}
def get_followers(user, page \\ nil) do
user
|> get_followers_query(page)
|> Repo.all()
end
- @spec get_external_followers(User.t(), pos_integer()) :: {:ok, list(User.t())}
+ @spec get_external_followers(User.t(), pos_integer() | nil) :: {:ok, list(User.t())}
def get_external_followers(user, page \\ nil) do
user
|> get_followers_query(page)
@@ -692,37 +1019,26 @@ defmodule Pleroma.User do
|> Repo.all()
end
- def get_friends_ids(user, page \\ nil) do
+ def get_friends_ap_ids(user) do
user
- |> get_friends_query(page)
- |> select([u], u.id)
+ |> get_friends_query(nil)
+ |> select([u], u.ap_id)
|> Repo.all()
end
- @spec get_follow_requests(User.t()) :: {:ok, [User.t()]}
- def get_follow_requests(%User{} = user) do
+ def get_friends_ids(user, page \\ nil) do
user
- |> Activity.follow_requests_for_actor()
- |> join(:inner, [a], u in User, on: a.actor == u.ap_id)
- |> where([a, u], not fragment("? @> ?", u.following, ^[user.follower_address]))
- |> group_by([a, u], u.id)
- |> select([a, u], u)
+ |> get_friends_query(page)
+ |> select([u], u.id)
|> Repo.all()
end
+ defdelegate get_follow_requests(user), to: FollowingRelationship
+
def increase_note_count(%User{} = user) do
User
|> where(id: ^user.id)
- |> update([u],
- set: [
- info:
- fragment(
- "safe_jsonb_set(?, '{note_count}', ((?->>'note_count')::int + 1)::varchar::jsonb, true)",
- u.info,
- u.info
- )
- ]
- )
+ |> update([u], inc: [note_count: 1])
|> select([u], u)
|> Repo.update_all([])
|> case do
@@ -736,12 +1052,7 @@ defmodule Pleroma.User do
|> where(id: ^user.id)
|> update([u],
set: [
- info:
- fragment(
- "safe_jsonb_set(?, '{note_count}', (greatest(0, (?->>'note_count')::int - 1))::varchar::jsonb, true)",
- u.info,
- u.info
- )
+ note_count: fragment("greatest(0, note_count - 1)")
]
)
|> select([u], u)
@@ -752,28 +1063,18 @@ defmodule Pleroma.User do
end
end
- def update_note_count(%User{} = user) do
+ def update_note_count(%User{} = user, note_count \\ nil) do
note_count =
- from(
- a in Object,
- where: fragment("?->>'actor' = ? and ?->>'type' = 'Note'", a.data, ^user.ap_id, a.data),
- select: count(a.id)
- )
- |> Repo.one()
-
- update_info(user, &User.Info.set_note_count(&1, note_count))
- end
-
- def update_mascot(user, url) do
- info_changeset =
- User.Info.mascot_update(
- user.info,
- url
- )
+ note_count ||
+ from(
+ a in Object,
+ where: fragment("?->>'actor' = ? and ?->>'type' = 'Note'", a.data, ^user.ap_id, a.data),
+ select: count(a.id)
+ )
+ |> Repo.one()
user
- |> change()
- |> put_embed(:info, info_changeset)
+ |> cast(%{note_count: note_count}, [:note_count])
|> update_and_set_cache()
end
@@ -791,10 +1092,24 @@ defmodule Pleroma.User do
def fetch_follow_information(user) do
with {:ok, info} <- ActivityPub.fetch_follow_information_for_user(user) do
- update_info(user, &User.Info.follow_information_update(&1, info))
+ user
+ |> follow_information_changeset(info)
+ |> update_and_set_cache()
end
end
+ defp follow_information_changeset(user, params) do
+ user
+ |> cast(params, [
+ :hide_followers,
+ :hide_follows,
+ :follower_count,
+ :following_count,
+ :hide_followers_count,
+ :hide_follows_count
+ ])
+ end
+
def update_follower_count(%User{} = user) do
if user.local or !Pleroma.Config.get([:instance, :external_user_synchronization]) do
follower_count_query =
@@ -805,14 +1120,7 @@ defmodule Pleroma.User do
|> where(id: ^user.id)
|> join(:inner, [u], s in subquery(follower_count_query))
|> update([u, s],
- set: [
- info:
- fragment(
- "safe_jsonb_set(?, '{follower_count}', ?::varchar::jsonb, true)",
- u.info,
- s.count
- )
- ]
+ set: [follower_count: s.count]
)
|> select([u], u)
|> Repo.update_all([])
@@ -825,8 +1133,8 @@ defmodule Pleroma.User do
end
end
- @spec maybe_update_following_count(User.t()) :: User.t()
- def maybe_update_following_count(%User{local: false} = user) do
+ @spec update_following_count(User.t()) :: User.t()
+ def update_following_count(%User{local: false} = user) do
if Pleroma.Config.get([:instance, :external_user_synchronization]) do
maybe_fetch_follow_information(user)
else
@@ -834,7 +1142,13 @@ defmodule Pleroma.User do
end
end
- def maybe_update_following_count(user), do: user
+ def update_following_count(%User{local: true} = user) do
+ following_count = FollowingRelationship.following_count(user)
+
+ user
+ |> follow_information_changeset(%{following_count: following_count})
+ |> Repo.update!()
+ end
def set_unread_conversation_count(%User{local: true} = user) do
unread_query = Participation.unread_conversation_count_for_user(user)
@@ -842,14 +1156,7 @@ defmodule Pleroma.User do
User
|> join(:inner, [u], p in subquery(unread_query))
|> update([u, p],
- set: [
- info:
- fragment(
- "jsonb_set(?, '{unread_conversation_count}', ?::varchar::jsonb, true)",
- u.info,
- p.count
- )
- ]
+ set: [unread_conversation_count: p.count]
)
|> where([u], u.id == ^user.id)
|> select([u], u)
@@ -860,7 +1167,7 @@ defmodule Pleroma.User do
end
end
- def set_unread_conversation_count(_), do: :noop
+ def set_unread_conversation_count(user), do: {:ok, user}
def increment_unread_conversation_count(conversation, %User{local: true} = user) do
unread_query =
@@ -870,14 +1177,7 @@ defmodule Pleroma.User do
User
|> join(:inner, [u], p in subquery(unread_query))
|> update([u, p],
- set: [
- info:
- fragment(
- "jsonb_set(?, '{unread_conversation_count}', (coalesce((?->>'unread_conversation_count')::int, 0) + 1)::varchar::jsonb, true)",
- u.info,
- u.info
- )
- ]
+ inc: [unread_conversation_count: 1]
)
|> where([u], u.id == ^user.id)
|> where([u, p], p.count == 0)
@@ -889,19 +1189,7 @@ defmodule Pleroma.User do
end
end
- def increment_unread_conversation_count(_, _), do: :noop
-
- def remove_duplicated_following(%User{following: following} = user) do
- uniq_following = Enum.uniq(following)
-
- if length(following) == length(uniq_following) do
- {:ok, user}
- else
- user
- |> update_changeset(%{following: uniq_following})
- |> update_and_set_cache()
- end
- end
+ def increment_unread_conversation_count(_, user), do: {:ok, user}
@spec get_users_from_set([String.t()], boolean()) :: [User.t()]
def get_users_from_set(ap_ids, local_only \\ true) do
@@ -913,39 +1201,52 @@ defmodule Pleroma.User do
end
@spec get_recipients_from_activity(Activity.t()) :: [User.t()]
- def get_recipients_from_activity(%Activity{recipients: to}) do
+ def get_recipients_from_activity(%Activity{recipients: to, actor: actor}) do
+ to = [actor | to]
+
User.Query.build(%{recipients_from_activity: to, local: true, deactivated: false})
|> Repo.all()
end
- @spec mute(User.t(), User.t(), boolean()) :: {:ok, User.t()} | {:error, String.t()}
- def mute(muter, %User{ap_id: ap_id}, notifications? \\ true) do
- update_info(muter, &User.Info.add_to_mutes(&1, ap_id, notifications?))
+ @spec mute(User.t(), User.t(), boolean()) ::
+ {:ok, list(UserRelationship.t())} | {:error, String.t()}
+ def mute(%User{} = muter, %User{} = mutee, notifications? \\ true) do
+ add_to_mutes(muter, mutee, notifications?)
end
- def unmute(muter, %{ap_id: ap_id}) do
- update_info(muter, &User.Info.remove_from_mutes(&1, ap_id))
+ def unmute(%User{} = muter, %User{} = mutee) do
+ remove_from_mutes(muter, mutee)
end
- def subscribe(subscriber, %{ap_id: ap_id}) do
- with %User{} = subscribed <- get_cached_by_ap_id(ap_id) do
- deny_follow_blocked = Pleroma.Config.get([:user, :deny_follow_blocked])
+ def subscribe(%User{} = subscriber, %User{} = target) do
+ deny_follow_blocked = Pleroma.Config.get([:user, :deny_follow_blocked])
- if blocks?(subscribed, subscriber) and deny_follow_blocked do
- {:error, "Could not subscribe: #{subscribed.nickname} is blocking you"}
- else
- update_info(subscribed, &User.Info.add_to_subscribers(&1, subscriber.ap_id))
- end
+ if blocks?(target, subscriber) and deny_follow_blocked do
+ {:error, "Could not subscribe: #{target.nickname} is blocking you"}
+ else
+ # Note: the relationship is inverse: subscriber acts as relationship target
+ UserRelationship.create_inverse_subscription(target, subscriber)
end
end
- def unsubscribe(unsubscriber, %{ap_id: ap_id}) do
+ def subscribe(%User{} = subscriber, %{ap_id: ap_id}) do
+ with %User{} = subscribee <- get_cached_by_ap_id(ap_id) do
+ subscribe(subscriber, subscribee)
+ end
+ end
+
+ def unsubscribe(%User{} = unsubscriber, %User{} = target) do
+ # Note: the relationship is inverse: subscriber acts as relationship target
+ UserRelationship.delete_inverse_subscription(target, unsubscriber)
+ end
+
+ def unsubscribe(%User{} = unsubscriber, %{ap_id: ap_id}) do
with %User{} = user <- get_cached_by_ap_id(ap_id) do
- update_info(user, &User.Info.remove_from_subscribers(&1, unsubscriber.ap_id))
+ unsubscribe(unsubscriber, user)
end
end
- def block(blocker, %User{ap_id: ap_id} = blocked) do
+ def block(%User{} = blocker, %User{} = blocked) do
# sever any follow relationships to prevent leaks per activitypub (Pleroma issue #213)
blocker =
if following?(blocker, blocked) do
@@ -962,90 +1263,125 @@ defmodule Pleroma.User do
nil -> blocked
end
- blocker =
- if subscribed_to?(blocked, blocker) do
- {:ok, blocker} = unsubscribe(blocked, blocker)
- blocker
- else
- blocker
- end
+ unsubscribe(blocked, blocker)
if following?(blocked, blocker), do: unfollow(blocked, blocker)
{:ok, blocker} = update_follower_count(blocker)
-
- update_info(blocker, &User.Info.add_to_block(&1, ap_id))
+ {:ok, blocker, _} = Participation.mark_all_as_read(blocker, blocked)
+ add_to_block(blocker, blocked)
end
# helper to handle the block given only an actor's AP id
- def block(blocker, %{ap_id: ap_id}) do
+ def block(%User{} = blocker, %{ap_id: ap_id}) do
block(blocker, get_cached_by_ap_id(ap_id))
end
- def unblock(blocker, %{ap_id: ap_id}) do
- update_info(blocker, &User.Info.remove_from_block(&1, ap_id))
+ def unblock(%User{} = blocker, %User{} = blocked) do
+ remove_from_block(blocker, blocked)
+ end
+
+ # helper to handle the block given only an actor's AP id
+ def unblock(%User{} = blocker, %{ap_id: ap_id}) do
+ unblock(blocker, get_cached_by_ap_id(ap_id))
end
def mutes?(nil, _), do: false
- def mutes?(user, %{ap_id: ap_id}), do: Enum.member?(user.info.mutes, ap_id)
+ def mutes?(%User{} = user, %User{} = target), do: mutes_user?(user, target)
+
+ def mutes_user?(%User{} = user, %User{} = target) do
+ UserRelationship.mute_exists?(user, target)
+ end
@spec muted_notifications?(User.t() | nil, User.t() | map()) :: boolean()
def muted_notifications?(nil, _), do: false
- def muted_notifications?(user, %{ap_id: ap_id}),
- do: Enum.member?(user.info.muted_notifications, ap_id)
+ def muted_notifications?(%User{} = user, %User{} = target),
+ do: UserRelationship.notification_mute_exists?(user, target)
+
+ def blocks?(nil, _), do: false
def blocks?(%User{} = user, %User{} = target) do
- blocks_ap_id?(user, target) || blocks_domain?(user, target)
+ blocks_user?(user, target) ||
+ (blocks_domain?(user, target) and not User.following?(user, target))
end
- def blocks?(nil, _), do: false
-
- def blocks_ap_id?(%User{} = user, %User{} = target) do
- Enum.member?(user.info.blocks, target.ap_id)
+ def blocks_user?(%User{} = user, %User{} = target) do
+ UserRelationship.block_exists?(user, target)
end
- def blocks_ap_id?(_, _), do: false
+ def blocks_user?(_, _), do: false
def blocks_domain?(%User{} = user, %User{} = target) do
- domain_blocks = Pleroma.Web.ActivityPub.MRF.subdomains_regex(user.info.domain_blocks)
+ domain_blocks = Pleroma.Web.ActivityPub.MRF.subdomains_regex(user.domain_blocks)
%{host: host} = URI.parse(target.ap_id)
Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, host)
end
def blocks_domain?(_, _), do: false
- def subscribed_to?(user, %{ap_id: ap_id}) do
+ def subscribed_to?(%User{} = user, %User{} = target) do
+ # Note: the relationship is inverse: subscriber acts as relationship target
+ UserRelationship.inverse_subscription_exists?(target, user)
+ end
+
+ def subscribed_to?(%User{} = user, %{ap_id: ap_id}) do
with %User{} = target <- get_cached_by_ap_id(ap_id) do
- Enum.member?(target.info.subscribers, user.ap_id)
+ subscribed_to?(user, target)
end
end
- @spec muted_users(User.t()) :: [User.t()]
- def muted_users(user) do
- User.Query.build(%{ap_id: user.info.mutes, deactivated: false})
- |> Repo.all()
- end
+ @doc """
+ Returns map of outgoing (blocked, muted etc.) relationships' user AP IDs by relation type.
+ E.g. `outgoing_relationships_ap_ids(user, [:block])` -> `%{block: ["https://some.site/users/userapid"]}`
+ """
+ @spec outgoing_relationships_ap_ids(User.t(), list(atom())) :: %{atom() => list(String.t())}
+ def outgoing_relationships_ap_ids(_user, []), do: %{}
- @spec blocked_users(User.t()) :: [User.t()]
- def blocked_users(user) do
- User.Query.build(%{ap_id: user.info.blocks, deactivated: false})
- |> Repo.all()
+ def outgoing_relationships_ap_ids(nil, _relationship_types), do: %{}
+
+ def outgoing_relationships_ap_ids(%User{} = user, relationship_types)
+ when is_list(relationship_types) do
+ db_result =
+ user
+ |> assoc(:outgoing_relationships)
+ |> join(:inner, [user_rel], u in assoc(user_rel, :target))
+ |> where([user_rel, u], user_rel.relationship_type in ^relationship_types)
+ |> select([user_rel, u], [user_rel.relationship_type, fragment("array_agg(?)", u.ap_id)])
+ |> group_by([user_rel, u], user_rel.relationship_type)
+ |> Repo.all()
+ |> Enum.into(%{}, fn [k, v] -> {k, v} end)
+
+ Enum.into(
+ relationship_types,
+ %{},
+ fn rel_type -> {rel_type, db_result[rel_type] || []} end
+ )
end
- @spec subscribers(User.t()) :: [User.t()]
- def subscribers(user) do
- User.Query.build(%{ap_id: user.info.subscribers, deactivated: false})
+ def incoming_relationships_ungrouped_ap_ids(user, relationship_types, ap_ids \\ nil)
+
+ def incoming_relationships_ungrouped_ap_ids(_user, [], _ap_ids), do: []
+
+ def incoming_relationships_ungrouped_ap_ids(nil, _relationship_types, _ap_ids), do: []
+
+ def incoming_relationships_ungrouped_ap_ids(%User{} = user, relationship_types, ap_ids)
+ when is_list(relationship_types) do
+ user
+ |> assoc(:incoming_relationships)
+ |> join(:inner, [user_rel], u in assoc(user_rel, :source))
+ |> where([user_rel, u], user_rel.relationship_type in ^relationship_types)
+ |> maybe_filter_on_ap_id(ap_ids)
+ |> select([user_rel, u], u.ap_id)
+ |> distinct(true)
|> Repo.all()
end
- def block_domain(user, domain) do
- update_info(user, &User.Info.add_to_domain_block(&1, domain))
+ defp maybe_filter_on_ap_id(query, ap_ids) when is_list(ap_ids) do
+ where(query, [user_rel, u], u.ap_id in ^ap_ids)
end
- def unblock_domain(user, domain) do
- update_info(user, &User.Info.remove_from_domain_block(&1, domain))
- end
+ defp maybe_filter_on_ap_id(query, _ap_ids), do: query
def deactivate_async(user, status \\ true) do
BackgroundWorker.enqueue("deactivate_user", %{"user_id" => user.id, "status" => status})
@@ -1060,16 +1396,30 @@ defmodule Pleroma.User do
end
def deactivate(%User{} = user, status) do
- with {:ok, user} <- update_info(user, &User.Info.set_activation_status(&1, status)) do
- Enum.each(get_followers(user), &invalidate_cache/1)
- Enum.each(get_friends(user), &update_follower_count/1)
+ with {:ok, user} <- set_activation_status(user, status) do
+ user
+ |> get_followers()
+ |> Enum.filter(& &1.local)
+ |> Enum.each(fn follower ->
+ follower |> update_following_count() |> set_cache()
+ end)
+
+ # Only update local user counts, remote will be update during the next pull.
+ user
+ |> get_friends()
+ |> Enum.filter(& &1.local)
+ |> Enum.each(&update_follower_count/1)
{:ok, user}
end
end
- def update_notification_settings(%User{} = user, settings \\ %{}) do
- update_info(user, &User.Info.update_notification_settings(&1, settings))
+ def update_notification_settings(%User{} = user, settings) do
+ user
+ |> cast(%{notification_settings: settings}, [])
+ |> cast_embed(:notification_settings)
+ |> validate_required([:notification_settings])
+ |> update_and_set_cache()
end
def delete(users) when is_list(users) do
@@ -1084,8 +1434,6 @@ defmodule Pleroma.User do
@spec perform(atom(), User.t()) :: {:ok, User.t()}
def perform(:delete, %User{} = user) do
- {:ok, _user} = ActivityPub.delete(user)
-
# Remove all relationships
user
|> get_followers()
@@ -1102,19 +1450,15 @@ defmodule Pleroma.User do
end)
delete_user_activities(user)
- invalidate_cache(user)
- Repo.delete(user)
- end
-
- @spec perform(atom(), User.t()) :: {:ok, User.t()}
- def perform(:fetch_initial_posts, %User{} = user) do
- pages = Pleroma.Config.get!([:fetch_initial_posts, :pages])
- # Insert all the posts in reverse order, so they're in the right order on the timeline
- user.info.source_data["outbox"]
- |> Utils.fetch_ordered_collection(pages)
- |> Enum.reverse()
- |> Enum.each(&Pleroma.Web.Federator.incoming_ap_doc/1)
+ if user.local do
+ user
+ |> change(%{deactivated: true, email: nil})
+ |> update_and_set_cache()
+ else
+ invalidate_cache(user)
+ Repo.delete(user)
+ end
end
def perform(:deactivate_async, user, status), do: deactivate(user, status)
@@ -1126,7 +1470,7 @@ defmodule Pleroma.User do
blocked_identifiers,
fn blocked_identifier ->
with {:ok, %User{} = blocked} <- get_or_fetch(blocked_identifier),
- {:ok, blocker} <- block(blocker, blocked),
+ {:ok, _user_block} <- block(blocker, blocked),
{:ok, _} <- ActivityPub.block(blocker, blocked) do
blocked
else
@@ -1138,7 +1482,6 @@ defmodule Pleroma.User do
)
end
- @spec perform(atom(), User.t(), list()) :: list() | {:error, any()}
def perform(:follow_import, %User{} = follower, followed_identifiers)
when is_list(followed_identifiers) do
Enum.map(
@@ -1170,7 +1513,7 @@ defmodule Pleroma.User do
def external_users(opts \\ []) do
query =
external_users_query()
- |> select([u], struct(u, [:id, :ap_id, :info]))
+ |> select([u], struct(u, [:id, :ap_id]))
query =
if opts[:max_id],
@@ -1200,39 +1543,44 @@ defmodule Pleroma.User do
})
end
- def delete_user_activities(%User{ap_id: ap_id}) do
+ def delete_user_activities(%User{ap_id: ap_id} = user) do
ap_id
|> Activity.Queries.by_actor()
|> RepoStreamer.chunk_stream(50)
- |> Stream.each(fn activities -> Enum.each(activities, &delete_activity/1) end)
+ |> Stream.each(fn activities ->
+ Enum.each(activities, fn activity -> delete_activity(activity, user) end)
+ end)
|> Stream.run()
end
- defp delete_activity(%{data: %{"type" => "Create"}} = activity) do
- activity
- |> Object.normalize()
- |> ActivityPub.delete()
- end
-
- defp delete_activity(%{data: %{"type" => "Like"}} = activity) do
- object = Object.normalize(activity)
+ defp delete_activity(%{data: %{"type" => "Create", "object" => object}} = activity, user) do
+ with {_, %Object{}} <- {:find_object, Object.get_by_ap_id(object)},
+ {:ok, delete_data, _} <- Builder.delete(user, object) do
+ Pipeline.common_pipeline(delete_data, local: user.local)
+ else
+ {:find_object, nil} ->
+ # We have the create activity, but not the object, it was probably pruned.
+ # Insert a tombstone and try again
+ with {:ok, tombstone_data, _} <- Builder.tombstone(user.ap_id, object),
+ {:ok, _tombstone} <- Object.create(tombstone_data) do
+ delete_activity(activity, user)
+ end
- activity.actor
- |> get_cached_by_ap_id()
- |> ActivityPub.unlike(object)
+ e ->
+ Logger.error("Could not delete #{object} created by #{activity.data["ap_id"]}")
+ Logger.error("Error: #{inspect(e)}")
+ end
end
- defp delete_activity(%{data: %{"type" => "Announce"}} = activity) do
- object = Object.normalize(activity)
-
- activity.actor
- |> get_cached_by_ap_id()
- |> ActivityPub.unannounce(object)
+ defp delete_activity(%{data: %{"type" => type}} = activity, user)
+ when type in ["Like", "Announce"] do
+ {:ok, undo, _} = Builder.undo(user, activity)
+ Pipeline.common_pipeline(undo, local: user.local)
end
- defp delete_activity(_activity), do: "Doing nothing"
+ defp delete_activity(_activity, _user), do: "Doing nothing"
- def html_filter_policy(%User{info: %{no_rich_text: true}}) do
+ def html_filter_policy(%User{no_rich_text: true}) do
Pleroma.HTML.Scrubber.TwitterText
end
@@ -1246,44 +1594,58 @@ defmodule Pleroma.User do
if !is_nil(user) and !needs_update?(user) do
{:ok, user}
else
- # Whether to fetch initial posts for the user (if it's a new user & the fetching is enabled)
- should_fetch_initial = is_nil(user) and Pleroma.Config.get([:fetch_initial_posts, :enabled])
+ fetch_by_ap_id(ap_id)
+ end
+ end
- resp = fetch_by_ap_id(ap_id)
+ @doc """
+ Creates an internal service actor by URI if missing.
+ Optionally takes nickname for addressing.
+ """
+ @spec get_or_create_service_actor_by_ap_id(String.t(), String.t()) :: User.t() | nil
+ def get_or_create_service_actor_by_ap_id(uri, nickname) do
+ {_, user} =
+ case get_cached_by_ap_id(uri) do
+ nil ->
+ with {:error, %{errors: errors}} <- create_service_actor(uri, nickname) do
+ Logger.error("Cannot create service actor: #{uri}/.\n#{inspect(errors)}")
+ {:error, nil}
+ end
- if should_fetch_initial do
- with {:ok, %User{} = user} <- resp do
- fetch_initial_posts(user)
- end
+ %User{invisible: false} = user ->
+ set_invisible(user)
+
+ user ->
+ {:ok, user}
end
- resp
- end
+ user
end
- @doc "Creates an internal service actor by URI if missing. Optionally takes nickname for addressing."
- def get_or_create_service_actor_by_ap_id(uri, nickname \\ nil) do
- with %User{} = user <- get_cached_by_ap_id(uri) do
- user
- else
- _ ->
- {:ok, user} =
- %User{info: %User.Info{}}
- |> cast(%{}, [:ap_id, :nickname, :local])
- |> put_change(:ap_id, uri)
- |> put_change(:nickname, nickname)
- |> put_change(:local, true)
- |> put_change(:follower_address, uri <> "/followers")
- |> Repo.insert()
+ @spec set_invisible(User.t()) :: {:ok, User.t()}
+ defp set_invisible(user) do
+ user
+ |> change(%{invisible: true})
+ |> update_and_set_cache()
+ end
- user
- end
+ @spec create_service_actor(String.t(), String.t()) ::
+ {:ok, User.t()} | {:error, Ecto.Changeset.t()}
+ defp create_service_actor(uri, nickname) do
+ %User{
+ invisible: true,
+ local: true,
+ ap_id: uri,
+ nickname: nickname,
+ follower_address: uri <> "/followers"
+ }
+ |> change
+ |> unique_constraint(:nickname)
+ |> Repo.insert()
+ |> set_cache()
end
- # AP style
- def public_key_from_info(%{
- source_data: %{"publicKey" => %{"publicKeyPem" => public_key_pem}}
- }) do
+ def public_key(%{public_key: public_key_pem}) when is_binary(public_key_pem) do
key =
public_key_pem
|> :public_key.pem_decode()
@@ -1293,30 +1655,19 @@ defmodule Pleroma.User do
{:ok, key}
end
- def public_key_from_info(_), do: {:error, "not found key"}
+ def public_key(_), do: {:error, "key not found"}
def get_public_key_for_ap_id(ap_id) do
with {:ok, %User{} = user} <- get_or_fetch_by_ap_id(ap_id),
- {:ok, public_key} <- public_key_from_info(user.info) do
+ {:ok, public_key} <- public_key(user) do
{:ok, public_key}
else
_ -> :error
end
end
- defp blank?(""), do: nil
- defp blank?(n), do: n
-
- def insert_or_update_user(data) do
- data
- |> Map.put(:name, blank?(data[:name]) || data[:nickname])
- |> remote_user_creation()
- |> Repo.insert(on_conflict: :replace_all_except_primary_key, conflict_target: :nickname)
- |> set_cache()
- end
-
def ap_enabled?(%User{local: true}), do: true
- def ap_enabled?(%User{info: info}), do: info.ap_enabled
+ def ap_enabled?(%User{ap_enabled: ap_enabled}), do: ap_enabled
def ap_enabled?(_), do: false
@doc "Gets or fetch a user by uri or nickname."
@@ -1429,7 +1780,6 @@ defmodule Pleroma.User do
%User{
name: ap_id,
ap_id: ap_id,
- info: %User.Info{},
nickname: "erroruser@example.com",
inserted_at: NaiveDateTime.utc_now()
}
@@ -1441,8 +1791,12 @@ defmodule Pleroma.User do
|> Repo.all()
end
+ def muting_reblogs?(%User{} = user, %User{} = target) do
+ UserRelationship.reblog_mute_exists?(user, target)
+ end
+
def showing_reblogs?(%User{} = user, %User{} = target) do
- target.ap_id not in user.info.muted_reblogs
+ not muting_reblogs?(user, target)
end
@doc """
@@ -1474,7 +1828,7 @@ defmodule Pleroma.User do
left_join: a in Pleroma.Activity,
on: u.ap_id == a.actor,
where: not is_nil(u.nickname),
- where: fragment("not (?->'deactivated' @> 'true')", u.info),
+ where: u.deactivated != ^true,
where: u.id not in ^has_read_notifications,
group_by: u.id,
having:
@@ -1488,16 +1842,16 @@ defmodule Pleroma.User do
## Examples
- iex> Pleroma.User.switch_email_notifications(Pleroma.User{info: %{email_notifications: %{"digest" => false}}}, "digest", true)
- Pleroma.User{info: %{email_notifications: %{"digest" => true}}}
+ iex> Pleroma.User.switch_email_notifications(Pleroma.User{email_notifications: %{"digest" => false}}, "digest", true)
+ Pleroma.User{email_notifications: %{"digest" => true}}
- iex> Pleroma.User.switch_email_notifications(Pleroma.User{info: %{email_notifications: %{"digest" => true}}}, "digest", false)
- Pleroma.User{info: %{email_notifications: %{"digest" => false}}}
+ iex> Pleroma.User.switch_email_notifications(Pleroma.User{email_notifications: %{"digest" => true}}, "digest", false)
+ Pleroma.User{email_notifications: %{"digest" => false}}
"""
@spec switch_email_notifications(t(), String.t(), boolean()) ::
{:ok, t()} | {:error, Ecto.Changeset.t()}
def switch_email_notifications(user, type, status) do
- update_info(user, &User.Info.update_email_notifications(&1, %{type => status}))
+ User.update_email_notifications(user, %{type => status})
end
@doc """
@@ -1517,17 +1871,21 @@ defmodule Pleroma.User do
@spec toggle_confirmation(User.t()) :: {:ok, User.t()} | {:error, Changeset.t()}
def toggle_confirmation(%User{} = user) do
- need_confirmation? = !user.info.confirmation_pending
-
user
- |> update_info(&User.Info.confirmation_changeset(&1, need_confirmation: need_confirmation?))
+ |> confirmation_changeset(need_confirmation: !user.confirmation_pending)
+ |> update_and_set_cache()
+ end
+
+ @spec toggle_confirmation([User.t()]) :: [{:ok, User.t()} | {:error, Changeset.t()}]
+ def toggle_confirmation(users) do
+ Enum.map(users, &toggle_confirmation/1)
end
- def get_mascot(%{info: %{mascot: %{} = mascot}}) when not is_nil(mascot) do
+ def get_mascot(%{mascot: %{} = mascot}) when not is_nil(mascot) do
mascot
end
- def get_mascot(%{info: %{mascot: mascot}}) when is_nil(mascot) do
+ def get_mascot(%{mascot: mascot}) when is_nil(mascot) do
# use instance-default
config = Pleroma.Config.get([:assets, :mascots])
default_mascot = Pleroma.Config.get([:assets, :default_mascot])
@@ -1567,7 +1925,7 @@ defmodule Pleroma.User do
defp put_password_hash(
%Ecto.Changeset{valid?: true, changes: %{password: password}} = changeset
) do
- change(changeset, password_hash: Pbkdf2.hashpwsalt(password))
+ change(changeset, password_hash: Pbkdf2.hash_pwd_salt(password))
end
defp put_password_hash(changeset), do: changeset
@@ -1597,31 +1955,228 @@ defmodule Pleroma.User do
|> update_and_set_cache()
end
- @doc """
- Changes `user.info` and returns the user changeset.
+ # Internal function; public one is `deactivate/2`
+ defp set_activation_status(user, deactivated) do
+ user
+ |> cast(%{deactivated: deactivated}, [:deactivated])
+ |> update_and_set_cache()
+ end
- `fun` is called with the `user.info`.
- """
- def change_info(user, fun) do
- changeset = change(user)
- info = get_field(changeset, :info) || %User.Info{}
- put_embed(changeset, :info, fun.(info))
+ def update_banner(user, banner) do
+ user
+ |> cast(%{banner: banner}, [:banner])
+ |> update_and_set_cache()
end
- @doc """
- Updates `user.info` and sets cache.
+ def update_background(user, background) do
+ user
+ |> cast(%{background: background}, [:background])
+ |> update_and_set_cache()
+ end
- `fun` is called with the `user.info`.
- """
- def update_info(users, fun) when is_list(users) do
- Repo.transaction(fn ->
- for user <- users, do: update_info(user, fun)
+ def roles(%{is_moderator: is_moderator, is_admin: is_admin}) do
+ %{
+ admin: is_admin,
+ moderator: is_moderator
+ }
+ end
+
+ def validate_fields(changeset, remote? \\ false) do
+ limit_name = if remote?, do: :max_remote_account_fields, else: :max_account_fields
+ limit = Pleroma.Config.get([:instance, limit_name], 0)
+
+ changeset
+ |> validate_length(:fields, max: limit)
+ |> validate_change(:fields, fn :fields, fields ->
+ if Enum.all?(fields, &valid_field?/1) do
+ []
+ else
+ [fields: "invalid"]
+ end
end)
end
- def update_info(user, fun) do
+ defp valid_field?(%{"name" => name, "value" => value}) do
+ name_limit = Pleroma.Config.get([:instance, :account_field_name_length], 255)
+ value_limit = Pleroma.Config.get([:instance, :account_field_value_length], 255)
+
+ is_binary(name) && is_binary(value) && String.length(name) <= name_limit &&
+ String.length(value) <= value_limit
+ end
+
+ defp valid_field?(_), do: false
+
+ defp truncate_field(%{"name" => name, "value" => value}) do
+ {name, _chopped} =
+ String.split_at(name, Pleroma.Config.get([:instance, :account_field_name_length], 255))
+
+ {value, _chopped} =
+ String.split_at(value, Pleroma.Config.get([:instance, :account_field_value_length], 255))
+
+ %{"name" => name, "value" => value}
+ end
+
+ def admin_api_update(user, params) do
user
- |> change_info(fun)
+ |> cast(params, [
+ :is_moderator,
+ :is_admin,
+ :show_role
+ ])
|> update_and_set_cache()
end
+
+ @doc "Signs user out of all applications"
+ def global_sign_out(user) do
+ OAuth.Authorization.delete_user_authorizations(user)
+ OAuth.Token.delete_user_tokens(user)
+ end
+
+ def mascot_update(user, url) do
+ user
+ |> cast(%{mascot: url}, [:mascot])
+ |> validate_required([:mascot])
+ |> update_and_set_cache()
+ end
+
+ def mastodon_settings_update(user, settings) do
+ user
+ |> cast(%{settings: settings}, [:settings])
+ |> validate_required([:settings])
+ |> update_and_set_cache()
+ end
+
+ @spec confirmation_changeset(User.t(), keyword()) :: Changeset.t()
+ def confirmation_changeset(user, need_confirmation: need_confirmation?) do
+ params =
+ if need_confirmation? do
+ %{
+ confirmation_pending: true,
+ confirmation_token: :crypto.strong_rand_bytes(32) |> Base.url_encode64()
+ }
+ else
+ %{
+ confirmation_pending: false,
+ confirmation_token: nil
+ }
+ end
+
+ cast(user, params, [:confirmation_pending, :confirmation_token])
+ end
+
+ def add_pinnned_activity(user, %Pleroma.Activity{id: id}) do
+ if id not in user.pinned_activities do
+ max_pinned_statuses = Pleroma.Config.get([:instance, :max_pinned_statuses], 0)
+ params = %{pinned_activities: user.pinned_activities ++ [id]}
+
+ user
+ |> cast(params, [:pinned_activities])
+ |> validate_length(:pinned_activities,
+ max: max_pinned_statuses,
+ message: "You have already pinned the maximum number of statuses"
+ )
+ else
+ change(user)
+ end
+ |> update_and_set_cache()
+ end
+
+ def remove_pinnned_activity(user, %Pleroma.Activity{id: id}) do
+ params = %{pinned_activities: List.delete(user.pinned_activities, id)}
+
+ user
+ |> cast(params, [:pinned_activities])
+ |> update_and_set_cache()
+ end
+
+ def update_email_notifications(user, settings) do
+ email_notifications =
+ user.email_notifications
+ |> Map.merge(settings)
+ |> Map.take(["digest"])
+
+ params = %{email_notifications: email_notifications}
+ fields = [:email_notifications]
+
+ user
+ |> cast(params, fields)
+ |> validate_required(fields)
+ |> update_and_set_cache()
+ end
+
+ defp set_domain_blocks(user, domain_blocks) do
+ params = %{domain_blocks: domain_blocks}
+
+ user
+ |> cast(params, [:domain_blocks])
+ |> validate_required([:domain_blocks])
+ |> update_and_set_cache()
+ end
+
+ def block_domain(user, domain_blocked) do
+ set_domain_blocks(user, Enum.uniq([domain_blocked | user.domain_blocks]))
+ end
+
+ def unblock_domain(user, domain_blocked) do
+ set_domain_blocks(user, List.delete(user.domain_blocks, domain_blocked))
+ end
+
+ @spec add_to_block(User.t(), User.t()) ::
+ {:ok, UserRelationship.t()} | {:error, Ecto.Changeset.t()}
+ defp add_to_block(%User{} = user, %User{} = blocked) do
+ UserRelationship.create_block(user, blocked)
+ end
+
+ @spec add_to_block(User.t(), User.t()) ::
+ {:ok, UserRelationship.t()} | {:ok, nil} | {:error, Ecto.Changeset.t()}
+ defp remove_from_block(%User{} = user, %User{} = blocked) do
+ UserRelationship.delete_block(user, blocked)
+ end
+
+ defp add_to_mutes(%User{} = user, %User{} = muted_user, notifications?) do
+ with {:ok, user_mute} <- UserRelationship.create_mute(user, muted_user),
+ {:ok, user_notification_mute} <-
+ (notifications? && UserRelationship.create_notification_mute(user, muted_user)) ||
+ {:ok, nil} do
+ {:ok, Enum.filter([user_mute, user_notification_mute], & &1)}
+ end
+ end
+
+ defp remove_from_mutes(user, %User{} = muted_user) do
+ with {:ok, user_mute} <- UserRelationship.delete_mute(user, muted_user),
+ {:ok, user_notification_mute} <-
+ UserRelationship.delete_notification_mute(user, muted_user) do
+ {:ok, [user_mute, user_notification_mute]}
+ end
+ end
+
+ def set_invisible(user, invisible) do
+ params = %{invisible: invisible}
+
+ user
+ |> cast(params, [:invisible])
+ |> validate_required([:invisible])
+ |> update_and_set_cache()
+ end
+
+ def sanitize_html(%User{} = user) do
+ sanitize_html(user, nil)
+ end
+
+ # User data that mastodon isn't filtering (treated as plaintext):
+ # - field name
+ # - display name
+ def sanitize_html(%User{} = user, filter) do
+ fields =
+ Enum.map(user.fields, fn %{"name" => name, "value" => value} ->
+ %{
+ "name" => name,
+ "value" => HTML.filter_tags(value, Pleroma.HTML.Scrubber.LinksOnly)
+ }
+ end)
+
+ user
+ |> Map.put(:bio, HTML.filter_tags(user.bio, filter))
+ |> Map.put(:fields, fields)
+ end
end
diff --git a/lib/pleroma/user/info.ex b/lib/pleroma/user/info.ex
deleted file mode 100644
index 982fb61c6..000000000
--- a/lib/pleroma/user/info.ex
+++ /dev/null
@@ -1,482 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.User.Info do
- use Ecto.Schema
- import Ecto.Changeset
-
- alias Pleroma.User.Info
-
- @type t :: %__MODULE__{}
-
- embedded_schema do
- field(:banner, :map, default: %{})
- field(:background, :map, default: %{})
- field(:source_data, :map, default: %{})
- field(:note_count, :integer, default: 0)
- field(:follower_count, :integer, default: 0)
- # Should be filled in only for remote users
- field(:following_count, :integer, default: nil)
- field(:locked, :boolean, default: false)
- field(:confirmation_pending, :boolean, default: false)
- field(:password_reset_pending, :boolean, default: false)
- field(:confirmation_token, :string, default: nil)
- field(:default_scope, :string, default: "public")
- field(:blocks, {:array, :string}, default: [])
- field(:domain_blocks, {:array, :string}, default: [])
- field(:mutes, {:array, :string}, default: [])
- field(:muted_reblogs, {:array, :string}, default: [])
- field(:muted_notifications, {:array, :string}, default: [])
- field(:subscribers, {:array, :string}, default: [])
- field(:deactivated, :boolean, default: false)
- field(:no_rich_text, :boolean, default: false)
- field(:ap_enabled, :boolean, default: false)
- field(:is_moderator, :boolean, default: false)
- field(:is_admin, :boolean, default: false)
- field(:show_role, :boolean, default: true)
- field(:keys, :string, default: nil)
- field(:settings, :map, default: nil)
- field(:magic_key, :string, default: nil)
- field(:uri, :string, default: nil)
- field(:hide_followers_count, :boolean, default: false)
- field(:hide_follows_count, :boolean, default: false)
- field(:hide_followers, :boolean, default: false)
- field(:hide_follows, :boolean, default: false)
- field(:hide_favorites, :boolean, default: true)
- field(:unread_conversation_count, :integer, default: 0)
- field(:pinned_activities, {:array, :string}, default: [])
- field(:email_notifications, :map, default: %{"digest" => false})
- field(:mascot, :map, default: nil)
- field(:emoji, {:array, :map}, default: [])
- field(:pleroma_settings_store, :map, default: %{})
- field(:fields, {:array, :map}, default: nil)
- field(:raw_fields, {:array, :map}, default: [])
- field(:discoverable, :boolean, default: false)
- field(:invisible, :boolean, default: false)
-
- field(:notification_settings, :map,
- default: %{
- "followers" => true,
- "follows" => true,
- "non_follows" => true,
- "non_followers" => true
- }
- )
-
- field(:skip_thread_containment, :boolean, default: false)
-
- # Found in the wild
- # ap_id -> Where is this used?
- # bio -> Where is this used?
- # avatar -> Where is this used?
- # fqn -> Where is this used?
- # host -> Where is this used?
- # subject _> Where is this used?
- end
-
- def set_activation_status(info, deactivated) do
- params = %{deactivated: deactivated}
-
- info
- |> cast(params, [:deactivated])
- |> validate_required([:deactivated])
- end
-
- def set_password_reset_pending(info, pending) do
- params = %{password_reset_pending: pending}
-
- info
- |> cast(params, [:password_reset_pending])
- |> validate_required([:password_reset_pending])
- end
-
- def update_notification_settings(info, settings) do
- settings =
- settings
- |> Enum.map(fn {k, v} -> {k, v in [true, "true", "True", "1"]} end)
- |> Map.new()
-
- notification_settings =
- info.notification_settings
- |> Map.merge(settings)
- |> Map.take(["followers", "follows", "non_follows", "non_followers"])
-
- params = %{notification_settings: notification_settings}
-
- info
- |> cast(params, [:notification_settings])
- |> validate_required([:notification_settings])
- end
-
- @doc """
- Update email notifications in the given User.Info struct.
-
- Examples:
-
- iex> update_email_notifications(%Pleroma.User.Info{email_notifications: %{"digest" => false}}, %{"digest" => true})
- %Pleroma.User.Info{email_notifications: %{"digest" => true}}
-
- """
- @spec update_email_notifications(t(), map()) :: Ecto.Changeset.t()
- def update_email_notifications(info, settings) do
- email_notifications =
- info.email_notifications
- |> Map.merge(settings)
- |> Map.take(["digest"])
-
- params = %{email_notifications: email_notifications}
- fields = [:email_notifications]
-
- info
- |> cast(params, fields)
- |> validate_required(fields)
- end
-
- def add_to_note_count(info, number) do
- set_note_count(info, info.note_count + number)
- end
-
- def set_note_count(info, number) do
- params = %{note_count: Enum.max([0, number])}
-
- info
- |> cast(params, [:note_count])
- |> validate_required([:note_count])
- end
-
- def set_follower_count(info, number) do
- params = %{follower_count: Enum.max([0, number])}
-
- info
- |> cast(params, [:follower_count])
- |> validate_required([:follower_count])
- end
-
- def set_mutes(info, mutes) do
- params = %{mutes: mutes}
-
- info
- |> cast(params, [:mutes])
- |> validate_required([:mutes])
- end
-
- @spec set_notification_mutes(Changeset.t(), [String.t()], boolean()) :: Changeset.t()
- def set_notification_mutes(changeset, muted_notifications, notifications?) do
- if notifications? do
- put_change(changeset, :muted_notifications, muted_notifications)
- |> validate_required([:muted_notifications])
- else
- changeset
- end
- end
-
- def set_blocks(info, blocks) do
- params = %{blocks: blocks}
-
- info
- |> cast(params, [:blocks])
- |> validate_required([:blocks])
- end
-
- def set_subscribers(info, subscribers) do
- params = %{subscribers: subscribers}
-
- info
- |> cast(params, [:subscribers])
- |> validate_required([:subscribers])
- end
-
- @spec add_to_mutes(Info.t(), String.t(), boolean()) :: Changeset.t()
- def add_to_mutes(info, muted, notifications?) do
- info
- |> set_mutes(Enum.uniq([muted | info.mutes]))
- |> set_notification_mutes(
- Enum.uniq([muted | info.muted_notifications]),
- notifications?
- )
- end
-
- @spec remove_from_mutes(Info.t(), String.t()) :: Changeset.t()
- def remove_from_mutes(info, muted) do
- info
- |> set_mutes(List.delete(info.mutes, muted))
- |> set_notification_mutes(List.delete(info.muted_notifications, muted), true)
- end
-
- def add_to_block(info, blocked) do
- set_blocks(info, Enum.uniq([blocked | info.blocks]))
- end
-
- def remove_from_block(info, blocked) do
- set_blocks(info, List.delete(info.blocks, blocked))
- end
-
- def add_to_subscribers(info, subscribed) do
- set_subscribers(info, Enum.uniq([subscribed | info.subscribers]))
- end
-
- def remove_from_subscribers(info, subscribed) do
- set_subscribers(info, List.delete(info.subscribers, subscribed))
- end
-
- def set_domain_blocks(info, domain_blocks) do
- params = %{domain_blocks: domain_blocks}
-
- info
- |> cast(params, [:domain_blocks])
- |> validate_required([:domain_blocks])
- end
-
- def add_to_domain_block(info, domain_blocked) do
- set_domain_blocks(info, Enum.uniq([domain_blocked | info.domain_blocks]))
- end
-
- def remove_from_domain_block(info, domain_blocked) do
- set_domain_blocks(info, List.delete(info.domain_blocks, domain_blocked))
- end
-
- def set_keys(info, keys) do
- params = %{keys: keys}
-
- info
- |> cast(params, [:keys])
- |> validate_required([:keys])
- end
-
- def remote_user_creation(info, params) do
- params =
- if Map.has_key?(params, :fields) do
- Map.put(params, :fields, Enum.map(params[:fields], &truncate_field/1))
- else
- params
- end
-
- info
- |> cast(params, [
- :ap_enabled,
- :source_data,
- :banner,
- :locked,
- :magic_key,
- :uri,
- :hide_followers,
- :hide_follows,
- :hide_followers_count,
- :hide_follows_count,
- :follower_count,
- :fields,
- :following_count,
- :discoverable,
- :invisible
- ])
- |> validate_fields(true)
- end
-
- def user_upgrade(info, params, remote? \\ false) do
- info
- |> cast(params, [
- :ap_enabled,
- :source_data,
- :banner,
- :locked,
- :magic_key,
- :follower_count,
- :following_count,
- :hide_follows,
- :fields,
- :hide_followers,
- :discoverable,
- :hide_followers_count,
- :hide_follows_count
- ])
- |> validate_fields(remote?)
- end
-
- def profile_update(info, params) do
- info
- |> cast(params, [
- :locked,
- :no_rich_text,
- :default_scope,
- :banner,
- :hide_follows,
- :hide_followers,
- :hide_followers_count,
- :hide_follows_count,
- :hide_favorites,
- :background,
- :show_role,
- :skip_thread_containment,
- :fields,
- :raw_fields,
- :pleroma_settings_store,
- :discoverable
- ])
- |> validate_fields()
- end
-
- def validate_fields(changeset, remote? \\ false) do
- limit_name = if remote?, do: :max_remote_account_fields, else: :max_account_fields
- limit = Pleroma.Config.get([:instance, limit_name], 0)
-
- changeset
- |> validate_length(:fields, max: limit)
- |> validate_change(:fields, fn :fields, fields ->
- if Enum.all?(fields, &valid_field?/1) do
- []
- else
- [fields: "invalid"]
- end
- end)
- end
-
- defp valid_field?(%{"name" => name, "value" => value}) do
- name_limit = Pleroma.Config.get([:instance, :account_field_name_length], 255)
- value_limit = Pleroma.Config.get([:instance, :account_field_value_length], 255)
-
- is_binary(name) && is_binary(value) && String.length(name) <= name_limit &&
- String.length(value) <= value_limit
- end
-
- defp valid_field?(_), do: false
-
- defp truncate_field(%{"name" => name, "value" => value}) do
- {name, _chopped} =
- String.split_at(name, Pleroma.Config.get([:instance, :account_field_name_length], 255))
-
- {value, _chopped} =
- String.split_at(value, Pleroma.Config.get([:instance, :account_field_value_length], 255))
-
- %{"name" => name, "value" => value}
- end
-
- @spec confirmation_changeset(Info.t(), keyword()) :: Changeset.t()
- def confirmation_changeset(info, opts) do
- need_confirmation? = Keyword.get(opts, :need_confirmation)
-
- params =
- if need_confirmation? do
- %{
- confirmation_pending: true,
- confirmation_token: :crypto.strong_rand_bytes(32) |> Base.url_encode64()
- }
- else
- %{
- confirmation_pending: false,
- confirmation_token: nil
- }
- end
-
- cast(info, params, [:confirmation_pending, :confirmation_token])
- end
-
- def mastodon_settings_update(info, settings) do
- params = %{settings: settings}
-
- info
- |> cast(params, [:settings])
- |> validate_required([:settings])
- end
-
- def mascot_update(info, url) do
- params = %{mascot: url}
-
- info
- |> cast(params, [:mascot])
- |> validate_required([:mascot])
- end
-
- def set_source_data(info, source_data) do
- params = %{source_data: source_data}
-
- info
- |> cast(params, [:source_data])
- |> validate_required([:source_data])
- end
-
- def set_invisible(info, invisible) do
- params = %{invisible: invisible}
-
- info
- |> cast(params, [:invisible])
- |> validate_required([:invisible])
- end
-
- def admin_api_update(info, params) do
- info
- |> cast(params, [
- :is_moderator,
- :is_admin,
- :show_role
- ])
- end
-
- def add_pinnned_activity(info, %Pleroma.Activity{id: id}) do
- if id not in info.pinned_activities do
- max_pinned_statuses = Pleroma.Config.get([:instance, :max_pinned_statuses], 0)
- params = %{pinned_activities: info.pinned_activities ++ [id]}
-
- info
- |> cast(params, [:pinned_activities])
- |> validate_length(:pinned_activities,
- max: max_pinned_statuses,
- message: "You have already pinned the maximum number of statuses"
- )
- else
- change(info)
- end
- end
-
- def remove_pinnned_activity(info, %Pleroma.Activity{id: id}) do
- params = %{pinned_activities: List.delete(info.pinned_activities, id)}
-
- cast(info, params, [:pinned_activities])
- end
-
- def roles(%Info{is_moderator: is_moderator, is_admin: is_admin}) do
- %{
- admin: is_admin,
- moderator: is_moderator
- }
- end
-
- def add_reblog_mute(info, ap_id) do
- params = %{muted_reblogs: info.muted_reblogs ++ [ap_id]}
-
- cast(info, params, [:muted_reblogs])
- end
-
- def remove_reblog_mute(info, ap_id) do
- params = %{muted_reblogs: List.delete(info.muted_reblogs, ap_id)}
-
- cast(info, params, [:muted_reblogs])
- end
-
- # ``fields`` is an array of mastodon profile field, containing ``{"name": "…", "value": "…"}``.
- # For example: [{"name": "Pronoun", "value": "she/her"}, …]
- def fields(%{fields: nil, source_data: %{"attachment" => attachment}}) do
- limit = Pleroma.Config.get([:instance, :max_remote_account_fields], 0)
-
- attachment
- |> Enum.filter(fn %{"type" => t} -> t == "PropertyValue" end)
- |> Enum.map(fn fields -> Map.take(fields, ["name", "value"]) end)
- |> Enum.take(limit)
- end
-
- def fields(%{fields: nil}), do: []
-
- def fields(%{fields: fields}), do: fields
-
- def follow_information_update(info, params) do
- info
- |> cast(params, [
- :hide_followers,
- :hide_follows,
- :follower_count,
- :following_count,
- :hide_followers_count,
- :hide_follows_count
- ])
- end
-end
diff --git a/lib/pleroma/user/notification_setting.ex b/lib/pleroma/user/notification_setting.ex
new file mode 100644
index 000000000..4bd55e139
--- /dev/null
+++ b/lib/pleroma/user/notification_setting.ex
@@ -0,0 +1,40 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.User.NotificationSetting do
+ use Ecto.Schema
+ import Ecto.Changeset
+
+ @derive Jason.Encoder
+ @primary_key false
+
+ embedded_schema do
+ field(:followers, :boolean, default: true)
+ field(:follows, :boolean, default: true)
+ field(:non_follows, :boolean, default: true)
+ field(:non_followers, :boolean, default: true)
+ field(:privacy_option, :boolean, default: false)
+ end
+
+ def changeset(schema, params) do
+ schema
+ |> cast(prepare_attrs(params), [
+ :followers,
+ :follows,
+ :non_follows,
+ :non_followers,
+ :privacy_option
+ ])
+ end
+
+ defp prepare_attrs(params) do
+ Enum.reduce(params, %{}, fn
+ {k, v}, acc when is_binary(v) ->
+ Map.put(acc, k, String.downcase(v))
+
+ {k, v}, acc ->
+ Map.put(acc, k, v)
+ end)
+ end
+end
diff --git a/lib/pleroma/user/query.ex b/lib/pleroma/user/query.ex
index 2baf016cf..3a3b04793 100644
--- a/lib/pleroma/user/query.ex
+++ b/lib/pleroma/user/query.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.User.Query do
@@ -28,6 +28,8 @@ defmodule Pleroma.User.Query do
"""
import Ecto.Query
import Pleroma.Web.AdminAPI.Search, only: [not_empty_string: 1]
+
+ alias Pleroma.FollowingRelationship
alias Pleroma.User
@type criteria ::
@@ -43,23 +45,23 @@ defmodule Pleroma.User.Query do
is_admin: boolean(),
is_moderator: boolean(),
super_users: boolean(),
+ exclude_service_users: boolean(),
followers: User.t(),
friends: User.t(),
recipients_from_activity: [String.t()],
- nickname: [String.t()],
+ nickname: [String.t()] | String.t(),
ap_id: [String.t()],
order_by: term(),
select: term(),
limit: pos_integer()
}
- | %{}
+ | map()
@ilike_criteria [:nickname, :name, :query]
@equal_criteria [:email]
- @role_criteria [:is_admin, :is_moderator]
@contains_criteria [:ap_id, :nickname]
- @spec build(criteria()) :: Query.t()
+ @spec build(Query.t(), criteria()) :: Query.t()
def build(query \\ base_query(), criteria) do
prepare_query(query, criteria)
end
@@ -87,6 +89,10 @@ defmodule Pleroma.User.Query do
where(query, [u], ilike(field(u, ^key), ^"%#{value}%"))
end
+ defp compose_query({:exclude_service_users, _}, query) do
+ where(query, [u], not like(u.ap_id, "%/relay") and not like(u.ap_id, "%/internal/fetch"))
+ end
+
defp compose_query({key, value}, query)
when key in @equal_criteria and not_empty_string(value) do
where(query, [u], ^[{key, value}])
@@ -97,18 +103,22 @@ defmodule Pleroma.User.Query do
end
defp compose_query({:tags, tags}, query) when is_list(tags) and length(tags) > 0 do
- Enum.reduce(tags, query, &prepare_tag_criteria/2)
+ where(query, [u], fragment("? && ?", u.tags, ^tags))
+ end
+
+ defp compose_query({:is_admin, _}, query) do
+ where(query, [u], u.is_admin)
end
- defp compose_query({key, _}, query) when key in @role_criteria do
- where(query, [u], fragment("(?->? @> 'true')", u.info, ^to_string(key)))
+ defp compose_query({:is_moderator, _}, query) do
+ where(query, [u], u.is_moderator)
end
defp compose_query({:super_users, _}, query) do
where(
query,
[u],
- fragment("?->'is_admin' @> 'true' OR ?->'is_moderator' @> 'true'", u.info, u.info)
+ u.is_admin or u.is_moderator
)
end
@@ -117,7 +127,13 @@ defmodule Pleroma.User.Query do
defp compose_query({:external, _}, query), do: location_query(query, false)
defp compose_query({:active, _}, query) do
- where(query, [u], fragment("not (?->'deactivated' @> 'true')", u.info))
+ User.restrict_deactivated(query)
+ |> where([u], not is_nil(u.nickname))
+ end
+
+ defp compose_query({:legacy_active, _}, query) do
+ query
+ |> where([u], fragment("not (?->'deactivated' @> 'true')", u.info))
|> where([u], not is_nil(u.nickname))
end
@@ -126,22 +142,45 @@ defmodule Pleroma.User.Query do
end
defp compose_query({:deactivated, true}, query) do
- where(query, [u], fragment("?->'deactivated' @> 'true'", u.info))
+ where(query, [u], u.deactivated == ^true)
|> where([u], not is_nil(u.nickname))
end
- defp compose_query({:followers, %User{id: id, follower_address: follower_address}}, query) do
- where(query, [u], fragment("? <@ ?", ^[follower_address], u.following))
+ defp compose_query({:followers, %User{id: id}}, query) do
+ query
|> where([u], u.id != ^id)
+ |> join(:inner, [u], r in FollowingRelationship,
+ as: :relationships,
+ on: r.following_id == ^id and r.follower_id == u.id
+ )
+ |> where([relationships: r], r.state == ^:follow_accept)
end
- defp compose_query({:friends, %User{id: id, following: following}}, query) do
- where(query, [u], u.follower_address in ^following)
+ defp compose_query({:friends, %User{id: id}}, query) do
+ query
|> where([u], u.id != ^id)
+ |> join(:inner, [u], r in FollowingRelationship,
+ as: :relationships,
+ on: r.following_id == u.id and r.follower_id == ^id
+ )
+ |> where([relationships: r], r.state == ^:follow_accept)
end
defp compose_query({:recipients_from_activity, to}, query) do
- where(query, [u], u.ap_id in ^to or fragment("? && ?", u.following, ^to))
+ query
+ |> join(:left, [u], r in FollowingRelationship,
+ as: :relationships,
+ on: r.follower_id == u.id
+ )
+ |> join(:left, [relationships: r], f in User,
+ as: :following,
+ on: f.id == r.following_id
+ )
+ |> where(
+ [u, following: f, relationships: r],
+ u.ap_id in ^to or (f.follower_address in ^to and r.state == ^:follow_accept)
+ )
+ |> distinct(true)
end
defp compose_query({:order_by, key}, query) do
@@ -158,10 +197,6 @@ defmodule Pleroma.User.Query do
defp compose_query(_unsupported_param, query), do: query
- defp prepare_tag_criteria(tag, query) do
- or_where(query, [u], fragment("? = any(?)", ^tag, u.tags))
- end
-
defp location_query(query, local) do
where(query, [u], u.local == ^local)
|> where([u], not is_nil(u.nickname))
diff --git a/lib/pleroma/user/search.ex b/lib/pleroma/user/search.ex
index 0d697fe3d..cec59c372 100644
--- a/lib/pleroma/user/search.ex
+++ b/lib/pleroma/user/search.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.User.Search do
@@ -33,9 +33,15 @@ defmodule Pleroma.User.Search do
# Strip the beginning @ off if there is a query
query_string = String.trim_leading(query_string, "@")
- with [name, domain] <- String.split(query_string, "@"),
- formatted_domain <- String.replace(domain, ~r/[!-\-|@|[-`|{-~|\/|:|\s]+/, "") do
- name <> "@" <> to_string(:idna.encode(formatted_domain))
+ with [name, domain] <- String.split(query_string, "@") do
+ encoded_domain =
+ domain
+ |> String.replace(~r/[!-\-|@|[-`|{-~|\/|:|\s]+/, "")
+ |> String.to_charlist()
+ |> :idna.encode()
+ |> to_string()
+
+ name <> "@" <> encoded_domain
else
_ -> query_string
end
@@ -45,6 +51,7 @@ defmodule Pleroma.User.Search do
for_user
|> base_query(following)
|> filter_blocked_user(for_user)
+ |> filter_invisible_users()
|> filter_blocked_domains(for_user)
|> fts_search(query_string)
|> trigram_rank(query_string)
@@ -54,15 +61,7 @@ defmodule Pleroma.User.Search do
|> maybe_restrict_local(for_user)
end
- @nickname_regex ~r/^[a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~\-@]+$/
defp fts_search(query, query_string) do
- {nickname_weight, name_weight} =
- if String.match?(query_string, @nickname_regex) do
- {"A", "B"}
- else
- {"B", "A"}
- end
-
query_string = to_tsquery(query_string)
from(
@@ -70,12 +69,10 @@ defmodule Pleroma.User.Search do
where:
fragment(
"""
- (setweight(to_tsvector('simple', ?), ?) || setweight(to_tsvector('simple', ?), ?)) @@ to_tsquery('simple', ?)
+ (to_tsvector('simple', ?) || to_tsvector('simple', ?)) @@ to_tsquery('simple', ?)
""",
u.name,
- ^name_weight,
u.nickname,
- ^nickname_weight,
^query_string
)
)
@@ -108,14 +105,22 @@ defmodule Pleroma.User.Search do
defp base_query(_user, false), do: User
defp base_query(user, true), do: User.get_followers_query(user)
- defp filter_blocked_user(query, %User{info: %{blocks: blocks}})
- when length(blocks) > 0 do
- from(q in query, where: not (q.ap_id in ^blocks))
+ defp filter_invisible_users(query) do
+ from(q in query, where: q.invisible == false)
+ end
+
+ defp filter_blocked_user(query, %User{} = blocker) do
+ query
+ |> join(:left, [u], b in Pleroma.UserRelationship,
+ as: :blocks,
+ on: b.relationship_type == ^:block and b.source_id == ^blocker.id and u.id == b.target_id
+ )
+ |> where([blocks: b], is_nil(b.target_id))
end
defp filter_blocked_user(query, _), do: query
- defp filter_blocked_domains(query, %User{info: %{domain_blocks: domain_blocks}})
+ defp filter_blocked_domains(query, %User{domain_blocks: domain_blocks})
when length(domain_blocks) > 0 do
domains = Enum.join(domain_blocks, ",")
diff --git a/lib/pleroma/user/welcome_message.ex b/lib/pleroma/user/welcome_message.ex
index 99fba729e..f8f520285 100644
--- a/lib/pleroma/user/welcome_message.ex
+++ b/lib/pleroma/user/welcome_message.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.User.WelcomeMessage do
@@ -10,8 +10,8 @@ defmodule Pleroma.User.WelcomeMessage do
with %User{} = sender_user <- welcome_user(),
message when is_binary(message) <- welcome_message() do
CommonAPI.post(sender_user, %{
- "visibility" => "direct",
- "status" => "@#{user.nickname}\n#{message}"
+ visibility: "direct",
+ status: "@#{user.nickname}\n#{message}"
})
else
_ -> {:ok, nil}
diff --git a/lib/pleroma/user_invite_token.ex b/lib/pleroma/user_invite_token.ex
index b9e80acdd..a08ba99f1 100644
--- a/lib/pleroma/user_invite_token.ex
+++ b/lib/pleroma/user_invite_token.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.UserInviteToken do
diff --git a/lib/pleroma/user_relationship.ex b/lib/pleroma/user_relationship.ex
new file mode 100644
index 000000000..6dfdd2860
--- /dev/null
+++ b/lib/pleroma/user_relationship.ex
@@ -0,0 +1,217 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.UserRelationship do
+ use Ecto.Schema
+
+ import Ecto.Changeset
+ import Ecto.Query
+
+ alias Ecto.Changeset
+ alias Pleroma.FollowingRelationship
+ alias Pleroma.Repo
+ alias Pleroma.User
+ alias Pleroma.UserRelationship
+
+ schema "user_relationships" do
+ belongs_to(:source, User, type: FlakeId.Ecto.CompatType)
+ belongs_to(:target, User, type: FlakeId.Ecto.CompatType)
+ field(:relationship_type, Pleroma.UserRelationship.Type)
+
+ timestamps(updated_at: false)
+ end
+
+ for relationship_type <- Keyword.keys(Pleroma.UserRelationship.Type.__enum_map__()) do
+ # `def create_block/2`, `def create_mute/2`, `def create_reblog_mute/2`,
+ # `def create_notification_mute/2`, `def create_inverse_subscription/2`
+ def unquote(:"create_#{relationship_type}")(source, target),
+ do: create(unquote(relationship_type), source, target)
+
+ # `def delete_block/2`, `def delete_mute/2`, `def delete_reblog_mute/2`,
+ # `def delete_notification_mute/2`, `def delete_inverse_subscription/2`
+ def unquote(:"delete_#{relationship_type}")(source, target),
+ do: delete(unquote(relationship_type), source, target)
+
+ # `def block_exists?/2`, `def mute_exists?/2`, `def reblog_mute_exists?/2`,
+ # `def notification_mute_exists?/2`, `def inverse_subscription_exists?/2`
+ def unquote(:"#{relationship_type}_exists?")(source, target),
+ do: exists?(unquote(relationship_type), source, target)
+ end
+
+ def user_relationship_types, do: Keyword.keys(user_relationship_mappings())
+
+ def user_relationship_mappings, do: Pleroma.UserRelationship.Type.__enum_map__()
+
+ def changeset(%UserRelationship{} = user_relationship, params \\ %{}) do
+ user_relationship
+ |> cast(params, [:relationship_type, :source_id, :target_id])
+ |> validate_required([:relationship_type, :source_id, :target_id])
+ |> unique_constraint(:relationship_type,
+ name: :user_relationships_source_id_relationship_type_target_id_index
+ )
+ |> validate_not_self_relationship()
+ end
+
+ def exists?(relationship_type, %User{} = source, %User{} = target) do
+ UserRelationship
+ |> where(relationship_type: ^relationship_type, source_id: ^source.id, target_id: ^target.id)
+ |> Repo.exists?()
+ end
+
+ def create(relationship_type, %User{} = source, %User{} = target) do
+ %UserRelationship{}
+ |> changeset(%{
+ relationship_type: relationship_type,
+ source_id: source.id,
+ target_id: target.id
+ })
+ |> Repo.insert(
+ on_conflict: {:replace_all_except, [:id]},
+ conflict_target: [:source_id, :relationship_type, :target_id]
+ )
+ end
+
+ def delete(relationship_type, %User{} = source, %User{} = target) do
+ attrs = %{relationship_type: relationship_type, source_id: source.id, target_id: target.id}
+
+ case Repo.get_by(UserRelationship, attrs) do
+ %UserRelationship{} = existing_record -> Repo.delete(existing_record)
+ nil -> {:ok, nil}
+ end
+ end
+
+ def dictionary(
+ source_users,
+ target_users,
+ source_to_target_rel_types \\ nil,
+ target_to_source_rel_types \\ nil
+ )
+
+ def dictionary(
+ _source_users,
+ _target_users,
+ [] = _source_to_target_rel_types,
+ [] = _target_to_source_rel_types
+ ) do
+ []
+ end
+
+ def dictionary(
+ source_users,
+ target_users,
+ source_to_target_rel_types,
+ target_to_source_rel_types
+ )
+ when is_list(source_users) and is_list(target_users) do
+ source_user_ids = User.binary_id(source_users)
+ target_user_ids = User.binary_id(target_users)
+
+ get_rel_type_codes = fn rel_type -> user_relationship_mappings()[rel_type] end
+
+ source_to_target_rel_types =
+ Enum.map(source_to_target_rel_types || user_relationship_types(), &get_rel_type_codes.(&1))
+
+ target_to_source_rel_types =
+ Enum.map(target_to_source_rel_types || user_relationship_types(), &get_rel_type_codes.(&1))
+
+ __MODULE__
+ |> where(
+ fragment(
+ "(source_id = ANY(?) AND target_id = ANY(?) AND relationship_type = ANY(?)) OR \
+ (source_id = ANY(?) AND target_id = ANY(?) AND relationship_type = ANY(?))",
+ ^source_user_ids,
+ ^target_user_ids,
+ ^source_to_target_rel_types,
+ ^target_user_ids,
+ ^source_user_ids,
+ ^target_to_source_rel_types
+ )
+ )
+ |> select([ur], [ur.relationship_type, ur.source_id, ur.target_id])
+ |> Repo.all()
+ end
+
+ def exists?(dictionary, rel_type, source, target, func) do
+ cond do
+ is_nil(source) or is_nil(target) ->
+ false
+
+ dictionary ->
+ [rel_type, source.id, target.id] in dictionary
+
+ true ->
+ func.(source, target)
+ end
+ end
+
+ @doc ":relationships option for StatusView / AccountView / NotificationView"
+ def view_relationships_option(reading_user, actors, opts \\ [])
+
+ def view_relationships_option(nil = _reading_user, _actors, _opts) do
+ %{user_relationships: [], following_relationships: []}
+ end
+
+ def view_relationships_option(%User{} = reading_user, actors, opts) do
+ {source_to_target_rel_types, target_to_source_rel_types} =
+ case opts[:subset] do
+ :source_mutes ->
+ # Used for statuses rendering (FE needs `muted` flag for each status when statuses load)
+ {[:mute], []}
+
+ nil ->
+ {[:block, :mute, :notification_mute, :reblog_mute], [:block, :inverse_subscription]}
+
+ unknown ->
+ raise "Unsupported :subset option value: #{inspect(unknown)}"
+ end
+
+ user_relationships =
+ UserRelationship.dictionary(
+ [reading_user],
+ actors,
+ source_to_target_rel_types,
+ target_to_source_rel_types
+ )
+
+ following_relationships =
+ case opts[:subset] do
+ :source_mutes ->
+ []
+
+ nil ->
+ FollowingRelationship.all_between_user_sets([reading_user], actors)
+
+ unknown ->
+ raise "Unsupported :subset option value: #{inspect(unknown)}"
+ end
+
+ %{user_relationships: user_relationships, following_relationships: following_relationships}
+ end
+
+ defp validate_not_self_relationship(%Changeset{} = changeset) do
+ changeset
+ |> validate_source_id_target_id_inequality()
+ |> validate_target_id_source_id_inequality()
+ end
+
+ defp validate_source_id_target_id_inequality(%Changeset{} = changeset) do
+ validate_change(changeset, :source_id, fn _, source_id ->
+ if source_id == get_field(changeset, :target_id) do
+ [source_id: "can't be equal to target_id"]
+ else
+ []
+ end
+ end)
+ end
+
+ defp validate_target_id_source_id_inequality(%Changeset{} = changeset) do
+ validate_change(changeset, :target_id, fn _, target_id ->
+ if target_id == get_field(changeset, :source_id) do
+ [target_id: "can't be equal to source_id"]
+ else
+ []
+ end
+ end)
+ end
+end
diff --git a/lib/pleroma/utils.ex b/lib/pleroma/utils.ex
new file mode 100644
index 000000000..6b8e3accf
--- /dev/null
+++ b/lib/pleroma/utils.ex
@@ -0,0 +1,12 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Utils do
+ def compile_dir(dir) when is_binary(dir) do
+ dir
+ |> File.ls!()
+ |> Enum.map(&Path.join(dir, &1))
+ |> Kernel.ParallelCompiler.compile()
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/activity_pub.ex b/lib/pleroma/web/activity_pub/activity_pub.ex
index 9a0a3522a..d752f4f04 100644
--- a/lib/pleroma/web/activity_pub/activity_pub.ex
+++ b/lib/pleroma/web/activity_pub/activity_pub.ex
@@ -1,11 +1,12 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.ActivityPub do
alias Pleroma.Activity
alias Pleroma.Activity.Ir.Topics
alias Pleroma.Config
+ alias Pleroma.Constants
alias Pleroma.Conversation
alias Pleroma.Conversation.Participation
alias Pleroma.Notification
@@ -69,7 +70,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
defp check_actor_is_active(actor) do
if not is_nil(actor) do
with user <- User.get_cached_by_ap_id(actor),
- false <- user.info.deactivated do
+ false <- user.deactivated do
true
else
_e -> false
@@ -117,13 +118,30 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
def increase_poll_votes_if_vote(%{
"object" => %{"inReplyTo" => reply_ap_id, "name" => name},
- "type" => "Create"
+ "type" => "Create",
+ "actor" => actor
}) do
- Object.increase_vote_count(reply_ap_id, name)
+ Object.increase_vote_count(reply_ap_id, name, actor)
end
def increase_poll_votes_if_vote(_create_data), do: :noop
+ @spec persist(map(), keyword()) :: {:ok, Activity.t() | Object.t()}
+ def persist(object, meta) do
+ with local <- Keyword.fetch!(meta, :local),
+ {recipients, _, _} <- get_recipients(object),
+ {:ok, activity} <-
+ Repo.insert(%Activity{
+ data: object,
+ local: local,
+ recipients: recipients,
+ actor: object["actor"]
+ }) do
+ {:ok, activity, meta}
+ end
+ end
+
+ @spec insert(map(), boolean(), boolean(), boolean()) :: {:ok, Activity.t()} | {:error, any()}
def insert(map, local \\ true, fake \\ false, bypass_actor_check \\ false) when is_map(map) do
with nil <- Activity.normalize(map),
map <- lazy_put_activity_defaults(map, fake),
@@ -152,12 +170,6 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
BackgroundWorker.enqueue("fetch_data_for_activity", %{"activity_id" => activity.id})
- Notification.create_notifications(activity)
-
- conversation = create_or_bump_conversation(activity, map["actor"])
- participations = get_participations(conversation)
- stream_out(activity)
- stream_out_participations(participations)
{:ok, activity}
else
%Activity{} = activity ->
@@ -180,6 +192,15 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
end
end
+ def notify_and_stream(activity) do
+ Notification.create_notifications(activity)
+
+ conversation = create_or_bump_conversation(activity, activity.actor)
+ participations = get_participations(conversation)
+ stream_out(activity)
+ stream_out_participations(participations)
+ end
+
defp create_or_bump_conversation(activity, actor) do
with {:ok, conversation} <- Conversation.create_or_bump_for(activity),
%User{} = user <- User.get_cached_by_ap_id(actor),
@@ -231,12 +252,19 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
:noop
end
- def create(%{to: to, actor: actor, context: context, object: object} = params, fake \\ false) do
+ @spec create(map(), boolean()) :: {:ok, Activity.t()} | {:error, any()}
+ def create(params, fake \\ false) do
+ with {:ok, result} <- Repo.transaction(fn -> do_create(params, fake) end) do
+ result
+ end
+ end
+
+ defp do_create(%{to: to, actor: actor, context: context, object: object} = params, fake) do
additional = params[:additional] || %{}
# only accept false as false value
local = !(params[:local] == false)
published = params[:published]
- quick_insert? = Pleroma.Config.get([:env]) == :benchmark
+ quick_insert? = Config.get([:env]) == :benchmark
with create_data <-
make_create_data(
@@ -248,9 +276,8 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
_ <- increase_replies_count_if_reply(create_data),
_ <- increase_poll_votes_if_vote(create_data),
{:quick_insert, false, activity} <- {:quick_insert, quick_insert?, activity},
- # Changing note count prior to enqueuing federation task in order to avoid
- # race conditions on updating user.info
{:ok, _actor} <- increase_note_count_if_public(actor, activity),
+ _ <- notify_and_stream(activity),
:ok <- maybe_federate(activity) do
{:ok, activity}
else
@@ -261,10 +288,11 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
{:ok, activity}
{:error, message} ->
- {:error, message}
+ Repo.rollback(message)
end
end
+ @spec listen(map()) :: {:ok, Activity.t()} | {:error, any()}
def listen(%{to: to, actor: actor, context: context, object: object} = params) do
additional = params[:additional] || %{}
# only accept false as false value
@@ -277,22 +305,23 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
additional
),
{:ok, activity} <- insert(listen_data, local),
+ _ <- notify_and_stream(activity),
:ok <- maybe_federate(activity) do
{:ok, activity}
- else
- {:error, message} ->
- {:error, message}
end
end
+ @spec accept(map()) :: {:ok, Activity.t()} | {:error, any()}
def accept(params) do
accept_or_reject("Accept", params)
end
+ @spec reject(map()) :: {:ok, Activity.t()} | {:error, any()}
def reject(params) do
accept_or_reject("Reject", params)
end
+ @spec accept_or_reject(String.t(), map()) :: {:ok, Activity.t()} | {:error, any()}
def accept_or_reject(type, %{to: to, actor: actor, object: object} = params) do
local = Map.get(params, :local, true)
activity_id = Map.get(params, :activity_id, nil)
@@ -301,11 +330,13 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
%{"to" => to, "type" => type, "actor" => actor.ap_id, "object" => object}
|> Utils.maybe_put("id", activity_id),
{:ok, activity} <- insert(data, local),
+ _ <- notify_and_stream(activity),
:ok <- maybe_federate(activity) do
{:ok, activity}
end
end
+ @spec update(map()) :: {:ok, Activity.t()} | {:error, any()}
def update(%{to: to, cc: cc, actor: actor, object: object} = params) do
local = !(params[:local] == false)
activity_id = params[:activity_id]
@@ -319,43 +350,14 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
},
data <- Utils.maybe_put(data, "id", activity_id),
{:ok, activity} <- insert(data, local),
+ _ <- notify_and_stream(activity),
:ok <- maybe_federate(activity) do
{:ok, activity}
end
end
- # TODO: This is weird, maybe we shouldn't check here if we can make the activity.
- def like(
- %User{ap_id: ap_id} = user,
- %Object{data: %{"id" => _}} = object,
- activity_id \\ nil,
- local \\ true
- ) do
- with nil <- get_existing_like(ap_id, object),
- like_data <- make_like_data(user, object, activity_id),
- {:ok, activity} <- insert(like_data, local),
- {:ok, object} <- add_like_to_object(activity, object),
- :ok <- maybe_federate(activity) do
- {:ok, activity, object}
- else
- %Activity{} = activity -> {:ok, activity, object}
- error -> {:error, error}
- end
- end
-
- def unlike(%User{} = actor, %Object{} = object, activity_id \\ nil, local \\ true) do
- with %Activity{} = like_activity <- get_existing_like(actor.ap_id, object),
- unlike_data <- make_unlike_data(actor, like_activity, activity_id),
- {:ok, unlike_activity} <- insert(unlike_data, local),
- {:ok, _activity} <- Repo.delete(like_activity),
- {:ok, object} <- remove_like_from_object(like_activity, object),
- :ok <- maybe_federate(unlike_activity) do
- {:ok, unlike_activity, like_activity, object}
- else
- _e -> {:ok, object}
- end
- end
-
+ @spec announce(User.t(), Object.t(), String.t() | nil, boolean(), boolean()) ::
+ {:ok, Activity.t(), Object.t()} | {:error, any()}
def announce(
%User{ap_id: _} = user,
%Object{data: %{"id" => _}} = object,
@@ -363,99 +365,80 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
local \\ true,
public \\ true
) do
+ with {:ok, result} <-
+ Repo.transaction(fn -> do_announce(user, object, activity_id, local, public) end) do
+ result
+ end
+ end
+
+ defp do_announce(user, object, activity_id, local, public) do
with true <- is_announceable?(object, user, public),
+ object <- Object.get_by_id(object.id),
announce_data <- make_announce_data(user, object, activity_id, public),
{:ok, activity} <- insert(announce_data, local),
{:ok, object} <- add_announce_to_object(activity, object),
+ _ <- notify_and_stream(activity),
:ok <- maybe_federate(activity) do
{:ok, activity, object}
else
- error -> {:error, error}
+ false -> {:error, false}
+ {:error, error} -> Repo.rollback(error)
end
end
- def unannounce(
- %User{} = actor,
- %Object{} = object,
- activity_id \\ nil,
- local \\ true
- ) do
- with %Activity{} = announce_activity <- get_existing_announce(actor.ap_id, object),
- unannounce_data <- make_unannounce_data(actor, announce_activity, activity_id),
- {:ok, unannounce_activity} <- insert(unannounce_data, local),
- :ok <- maybe_federate(unannounce_activity),
- {:ok, _activity} <- Repo.delete(announce_activity),
- {:ok, object} <- remove_announce_from_object(announce_activity, object) do
- {:ok, unannounce_activity, object}
- else
- _e -> {:ok, object}
+ @spec follow(User.t(), User.t(), String.t() | nil, boolean()) ::
+ {:ok, Activity.t()} | {:error, any()}
+ def follow(follower, followed, activity_id \\ nil, local \\ true) do
+ with {:ok, result} <-
+ Repo.transaction(fn -> do_follow(follower, followed, activity_id, local) end) do
+ result
end
end
- def follow(follower, followed, activity_id \\ nil, local \\ true) do
+ defp do_follow(follower, followed, activity_id, local) do
with data <- make_follow_data(follower, followed, activity_id),
{:ok, activity} <- insert(data, local),
- :ok <- maybe_federate(activity),
- _ <- User.set_follow_state_cache(follower.ap_id, followed.ap_id, activity.data["state"]) do
+ _ <- notify_and_stream(activity),
+ :ok <- maybe_federate(activity) do
{:ok, activity}
+ else
+ {:error, error} -> Repo.rollback(error)
end
end
+ @spec unfollow(User.t(), User.t(), String.t() | nil, boolean()) ::
+ {:ok, Activity.t()} | nil | {:error, any()}
def unfollow(follower, followed, activity_id \\ nil, local \\ true) do
+ with {:ok, result} <-
+ Repo.transaction(fn -> do_unfollow(follower, followed, activity_id, local) end) do
+ result
+ end
+ end
+
+ defp do_unfollow(follower, followed, activity_id, local) do
with %Activity{} = follow_activity <- fetch_latest_follow(follower, followed),
{:ok, follow_activity} <- update_follow_state(follow_activity, "cancelled"),
unfollow_data <- make_unfollow_data(follower, followed, follow_activity, activity_id),
{:ok, activity} <- insert(unfollow_data, local),
+ _ <- notify_and_stream(activity),
:ok <- maybe_federate(activity) do
{:ok, activity}
+ else
+ nil -> nil
+ {:error, error} -> Repo.rollback(error)
end
end
- def delete(%User{ap_id: ap_id, follower_address: follower_address} = user) do
- with data <- %{
- "to" => [follower_address],
- "type" => "Delete",
- "actor" => ap_id,
- "object" => %{"type" => "Person", "id" => ap_id}
- },
- {:ok, activity} <- insert(data, true, true, true),
- :ok <- maybe_federate(activity) do
- {:ok, user}
- end
- end
-
- def delete(%Object{data: %{"id" => id, "actor" => actor}} = object, options \\ []) do
- local = Keyword.get(options, :local, true)
- activity_id = Keyword.get(options, :activity_id, nil)
- actor = Keyword.get(options, :actor, actor)
-
- user = User.get_cached_by_ap_id(actor)
- to = (object.data["to"] || []) ++ (object.data["cc"] || [])
-
- with {:ok, object, activity} <- Object.delete(object),
- data <-
- %{
- "type" => "Delete",
- "actor" => actor,
- "object" => id,
- "to" => to,
- "deleted_activity_id" => activity && activity.id
- }
- |> maybe_put("id", activity_id),
- {:ok, activity} <- insert(data, local, false),
- stream_out_participations(object, user),
- _ <- decrease_replies_count_if_reply(object),
- # Changing note count prior to enqueuing federation task in order to avoid
- # race conditions on updating user.info
- {:ok, _actor} <- decrease_note_count_if_public(user, object),
- :ok <- maybe_federate(activity) do
- {:ok, activity}
+ @spec block(User.t(), User.t(), String.t() | nil, boolean()) ::
+ {:ok, Activity.t()} | {:error, any()}
+ def block(blocker, blocked, activity_id \\ nil, local \\ true) do
+ with {:ok, result} <-
+ Repo.transaction(fn -> do_block(blocker, blocked, activity_id, local) end) do
+ result
end
end
- @spec block(User.t(), User.t(), String.t() | nil, boolean) :: {:ok, Activity.t() | nil}
- def block(blocker, blocked, activity_id \\ nil, local \\ true) do
- outgoing_blocks = Config.get([:activitypub, :outgoing_blocks])
+ defp do_block(blocker, blocked, activity_id, local) do
unfollow_blocked = Config.get([:activitypub, :unfollow_blocked])
if unfollow_blocked do
@@ -463,26 +446,17 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
if follow_activity, do: unfollow(blocker, blocked, nil, local)
end
- with true <- outgoing_blocks,
- block_data <- make_block_data(blocker, blocked, activity_id),
+ with block_data <- make_block_data(blocker, blocked, activity_id),
{:ok, activity} <- insert(block_data, local),
+ _ <- notify_and_stream(activity),
:ok <- maybe_federate(activity) do
{:ok, activity}
else
- _e -> {:ok, nil}
- end
- end
-
- def unblock(blocker, blocked, activity_id \\ nil, local \\ true) do
- with %Activity{} = block_activity <- fetch_latest_block(blocker, blocked),
- unblock_data <- make_unblock_data(blocker, blocked, block_activity, activity_id),
- {:ok, activity} <- insert(unblock_data, local),
- :ok <- maybe_federate(activity) do
- {:ok, activity}
+ {:error, error} -> Repo.rollback(error)
end
end
- @spec flag(map()) :: {:ok, Activity.t()} | any
+ @spec flag(map()) :: {:ok, Activity.t()} | {:error, any()}
def flag(
%{
actor: actor,
@@ -507,8 +481,12 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
with flag_data <- make_flag_data(params, additional),
{:ok, activity} <- insert(flag_data, local),
- :ok <- maybe_federate(activity) do
- Enum.each(User.all_superusers(), fn superuser ->
+ {:ok, stripped_activity} <- strip_report_status_data(activity),
+ _ <- notify_and_stream(activity),
+ :ok <- maybe_federate(stripped_activity) do
+ User.all_superusers()
+ |> Enum.filter(fn user -> not is_nil(user.email) end)
+ |> Enum.each(fn superuser ->
superuser
|> Pleroma.Emails.AdminEmail.report(actor, account, statuses, content)
|> Pleroma.Emails.Mailer.deliver_async()
@@ -518,11 +496,39 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
end
end
- defp fetch_activities_for_context_query(context, opts) do
- public = [Pleroma.Constants.as_public()]
+ @spec move(User.t(), User.t(), boolean()) :: {:ok, Activity.t()} | {:error, any()}
+ def move(%User{} = origin, %User{} = target, local \\ true) do
+ params = %{
+ "type" => "Move",
+ "actor" => origin.ap_id,
+ "object" => origin.ap_id,
+ "target" => target.ap_id
+ }
+
+ with true <- origin.ap_id in target.also_known_as,
+ {:ok, activity} <- insert(params, local),
+ _ <- notify_and_stream(activity) do
+ maybe_federate(activity)
+
+ BackgroundWorker.enqueue("move_following", %{
+ "origin_id" => origin.id,
+ "target_id" => target.id
+ })
+
+ {:ok, activity}
+ else
+ false -> {:error, "Target account must have the origin in `alsoKnownAs`"}
+ err -> err
+ end
+ end
+
+ def fetch_activities_for_context_query(context, opts) do
+ public = [Constants.as_public()]
recipients =
- if opts["user"], do: [opts["user"].ap_id | opts["user"].following] ++ public, else: public
+ if opts["user"],
+ do: [opts["user"].ap_id | User.following(opts["user"])] ++ public,
+ else: public
from(activity in Activity)
|> maybe_preload_objects(opts)
@@ -562,14 +568,14 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
|> Repo.one()
end
+ @spec fetch_public_activities(map(), Pagination.type()) :: [Activity.t()]
def fetch_public_activities(opts \\ %{}, pagination \\ :keyset) do
opts = Map.drop(opts, ["user"])
- [Pleroma.Constants.as_public()]
+ [Constants.as_public()]
|> fetch_activities_query(opts)
|> restrict_unlisted()
|> Pagination.fetch_paginated(opts, pagination)
- |> Enum.reverse()
end
@valid_visibilities ~w[direct unlisted public private]
@@ -648,7 +654,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
end
defp exclude_visibility(query, %{"exclude_visibilities" => visibility})
- when visibility not in @valid_visibilities do
+ when visibility not in [nil | @valid_visibilities] do
Logger.error("Could not exclude visibility to #{visibility}")
query
end
@@ -660,7 +666,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
defp restrict_thread_visibility(
query,
- %{"user" => %User{info: %{skip_thread_containment: true}}},
+ %{"user" => %User{skip_thread_containment: true}},
_
),
do: query
@@ -679,7 +685,6 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
params
|> Map.put("user", reading_user)
|> Map.put("actor_id", user.ap_id)
- |> Map.put("whole_db", true)
recipients =
user_activities_recipients(%{
@@ -697,8 +702,16 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
|> Map.put("type", ["Create", "Announce"])
|> Map.put("user", reading_user)
|> Map.put("actor_id", user.ap_id)
- |> Map.put("whole_db", true)
- |> Map.put("pinned_activity_ids", user.info.pinned_activities)
+ |> Map.put("pinned_activity_ids", user.pinned_activities)
+
+ params =
+ if User.blocks?(reading_user, user) do
+ params
+ else
+ params
+ |> Map.put("blocking_user", reading_user)
+ |> Map.put("muting_user", reading_user)
+ end
recipients =
user_activities_recipients(%{
@@ -710,15 +723,30 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
|> Enum.reverse()
end
+ def fetch_statuses(reading_user, params) do
+ params =
+ params
+ |> Map.put("type", ["Create", "Announce"])
+
+ recipients =
+ user_activities_recipients(%{
+ "godmode" => params["godmode"],
+ "reading_user" => reading_user
+ })
+
+ fetch_activities(recipients, params, :offset)
+ |> Enum.reverse()
+ end
+
defp user_activities_recipients(%{"godmode" => true}) do
[]
end
defp user_activities_recipients(%{"reading_user" => reading_user}) do
if reading_user do
- [Pleroma.Constants.as_public()] ++ [reading_user.ap_id | reading_user.following]
+ [Constants.as_public()] ++ [reading_user.ap_id | User.following(reading_user)]
else
- [Pleroma.Constants.as_public()]
+ [Constants.as_public()]
end
end
@@ -833,7 +861,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
raise "Can't use the child object without preloading!"
end
- defp restrict_media(query, %{"only_media" => val}) when val == "true" or val == "1" do
+ defp restrict_media(query, %{"only_media" => val}) when val in [true, "true", "1"] do
from(
[_activity, object] in query,
where: fragment("not (?)->'attachment' = (?)", object.data, ^[])
@@ -842,16 +870,51 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
defp restrict_media(query, _), do: query
- defp restrict_replies(query, %{"exclude_replies" => val}) when val == "true" or val == "1" do
+ defp restrict_replies(query, %{"exclude_replies" => val}) when val in [true, "true", "1"] do
from(
[_activity, object] in query,
where: fragment("?->>'inReplyTo' is null", object.data)
)
end
+ defp restrict_replies(query, %{
+ "reply_filtering_user" => user,
+ "reply_visibility" => "self"
+ }) do
+ from(
+ [activity, object] in query,
+ where:
+ fragment(
+ "?->>'inReplyTo' is null OR ? = ANY(?)",
+ object.data,
+ ^user.ap_id,
+ activity.recipients
+ )
+ )
+ end
+
+ defp restrict_replies(query, %{
+ "reply_filtering_user" => user,
+ "reply_visibility" => "following"
+ }) do
+ from(
+ [activity, object] in query,
+ where:
+ fragment(
+ "?->>'inReplyTo' is null OR ? && array_remove(?, ?) OR ? = ?",
+ object.data,
+ ^[user.ap_id | User.get_cached_user_friends_ap_ids(user)],
+ activity.recipients,
+ activity.actor,
+ activity.actor,
+ ^user.ap_id
+ )
+ )
+ end
+
defp restrict_replies(query, _), do: query
- defp restrict_reblogs(query, %{"exclude_reblogs" => val}) when val == "true" or val == "1" do
+ defp restrict_reblogs(query, %{"exclude_reblogs" => val}) when val in [true, "true", "1"] do
from(activity in query, where: fragment("?->>'type' != 'Announce'", activity.data))
end
@@ -859,8 +922,8 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
defp restrict_muted(query, %{"with_muted" => val}) when val in [true, "true", "1"], do: query
- defp restrict_muted(query, %{"muting_user" => %User{info: info}} = opts) do
- mutes = info.mutes
+ defp restrict_muted(query, %{"muting_user" => %User{} = user} = opts) do
+ mutes = opts["muted_users_ap_ids"] || User.muted_users_ap_ids(user)
query =
from([activity] in query,
@@ -877,26 +940,42 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
defp restrict_muted(query, _), do: query
- defp restrict_blocked(query, %{"blocking_user" => %User{info: info}}) do
- blocks = info.blocks || []
- domain_blocks = info.domain_blocks || []
+ defp restrict_blocked(query, %{"blocking_user" => %User{} = user} = opts) do
+ blocked_ap_ids = opts["blocked_users_ap_ids"] || User.blocked_users_ap_ids(user)
+ domain_blocks = user.domain_blocks || []
+
+ following_ap_ids = User.get_friends_ap_ids(user)
query =
if has_named_binding?(query, :object), do: query, else: Activity.with_joined_object(query)
from(
[activity, object: o] in query,
- where: fragment("not (? = ANY(?))", activity.actor, ^blocks),
- where: fragment("not (? && ?)", activity.recipients, ^blocks),
+ where: fragment("not (? = ANY(?))", activity.actor, ^blocked_ap_ids),
+ where: fragment("not (? && ?)", activity.recipients, ^blocked_ap_ids),
where:
fragment(
"not (?->>'type' = 'Announce' and ?->'to' \\?| ?)",
activity.data,
activity.data,
- ^blocks
+ ^blocked_ap_ids
),
- where: fragment("not (split_part(?, '/', 3) = ANY(?))", activity.actor, ^domain_blocks),
- where: fragment("not (split_part(?->>'actor', '/', 3) = ANY(?))", o.data, ^domain_blocks)
+ where:
+ fragment(
+ "(not (split_part(?, '/', 3) = ANY(?))) or ? = ANY(?)",
+ activity.actor,
+ ^domain_blocks,
+ activity.actor,
+ ^following_ap_ids
+ ),
+ where:
+ fragment(
+ "(not (split_part(?->>'actor', '/', 3) = ANY(?))) or (?->>'actor') = ANY(?)",
+ o.data,
+ ^domain_blocks,
+ o.data,
+ ^following_ap_ids
+ )
)
end
@@ -909,19 +988,24 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
fragment(
"not (coalesce(?->'cc', '{}'::jsonb) \\?| ?)",
activity.data,
- ^[Pleroma.Constants.as_public()]
+ ^[Constants.as_public()]
)
)
end
- defp restrict_pinned(query, %{"pinned" => "true", "pinned_activity_ids" => ids}) do
+ # TODO: when all endpoints migrated to OpenAPI compare `pinned` with `true` (boolean) only,
+ # the same for `restrict_media/2`, `restrict_replies/2`, 'restrict_reblogs/2'
+ # and `restrict_muted/2`
+
+ defp restrict_pinned(query, %{"pinned" => pinned, "pinned_activity_ids" => ids})
+ when pinned in [true, "true", "1"] do
from(activity in query, where: activity.id in ^ids)
end
defp restrict_pinned(query, _), do: query
- defp restrict_muted_reblogs(query, %{"muting_user" => %User{info: info}}) do
- muted_reblogs = info.muted_reblogs || []
+ defp restrict_muted_reblogs(query, %{"muting_user" => %User{} = user} = opts) do
+ muted_reblogs = opts["reblog_muted_users_ap_ids"] || User.reblog_muted_users_ap_ids(user)
from(
activity in query,
@@ -937,6 +1021,20 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
defp restrict_muted_reblogs(query, _), do: query
+ defp restrict_instance(query, %{"instance" => instance}) do
+ users =
+ from(
+ u in User,
+ select: u.ap_id,
+ where: fragment("? LIKE ?", u.nickname, ^"%@#{instance}")
+ )
+ |> Repo.all()
+
+ from(activity in query, where: activity.actor in ^users)
+ end
+
+ defp restrict_instance(query, _), do: query
+
defp exclude_poll_votes(query, %{"include_poll_votes" => true}), do: query
defp exclude_poll_votes(query, _) do
@@ -969,6 +1067,13 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
|> Activity.with_preloaded_bookmark(opts["user"])
end
+ defp maybe_preload_report_notes(query, %{"preload_report_notes" => true}) do
+ query
+ |> Activity.with_preloaded_report_notes()
+ end
+
+ defp maybe_preload_report_notes(query, _), do: query
+
defp maybe_set_thread_muted_field(query, %{"skip_preload" => true}), do: query
defp maybe_set_thread_muted_field(query, opts) do
@@ -988,7 +1093,33 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
defp maybe_order(query, _), do: query
+ defp fetch_activities_query_ap_ids_ops(opts) do
+ source_user = opts["muting_user"]
+ ap_id_relationships = if source_user, do: [:mute, :reblog_mute], else: []
+
+ ap_id_relationships =
+ ap_id_relationships ++
+ if opts["blocking_user"] && opts["blocking_user"] == source_user do
+ [:block]
+ else
+ []
+ end
+
+ preloaded_ap_ids = User.outgoing_relationships_ap_ids(source_user, ap_id_relationships)
+
+ restrict_blocked_opts = Map.merge(%{"blocked_users_ap_ids" => preloaded_ap_ids[:block]}, opts)
+ restrict_muted_opts = Map.merge(%{"muted_users_ap_ids" => preloaded_ap_ids[:mute]}, opts)
+
+ restrict_muted_reblogs_opts =
+ Map.merge(%{"reblog_muted_users_ap_ids" => preloaded_ap_ids[:reblog_mute]}, opts)
+
+ {restrict_blocked_opts, restrict_muted_opts, restrict_muted_reblogs_opts}
+ end
+
def fetch_activities_query(recipients, opts \\ %{}) do
+ {restrict_blocked_opts, restrict_muted_opts, restrict_muted_reblogs_opts} =
+ fetch_activities_query_ap_ids_ops(opts)
+
config = %{
skip_thread_containment: Config.get([:instance, :skip_thread_containment])
}
@@ -996,9 +1127,11 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
Activity
|> maybe_preload_objects(opts)
|> maybe_preload_bookmarks(opts)
+ |> maybe_preload_report_notes(opts)
|> maybe_set_thread_muted_field(opts)
|> maybe_order(opts)
|> restrict_recipients(recipients, opts["user"])
+ |> restrict_replies(opts)
|> restrict_tag(opts)
|> restrict_tag_reject(opts)
|> restrict_tag_all(opts)
@@ -1008,15 +1141,15 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
|> restrict_type(opts)
|> restrict_state(opts)
|> restrict_favorited_by(opts)
- |> restrict_blocked(opts)
- |> restrict_muted(opts)
+ |> restrict_blocked(restrict_blocked_opts)
+ |> restrict_muted(restrict_muted_opts)
|> restrict_media(opts)
|> restrict_visibility(opts)
|> restrict_thread_visibility(opts, config)
- |> restrict_replies(opts)
|> restrict_reblogs(opts)
|> restrict_pinned(opts)
- |> restrict_muted_reblogs(opts)
+ |> restrict_muted_reblogs(restrict_muted_reblogs_opts)
+ |> restrict_instance(opts)
|> Activity.restrict_deactivated_users()
|> exclude_poll_votes(opts)
|> exclude_visibility(opts)
@@ -1031,6 +1164,25 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
|> maybe_update_cc(list_memberships, opts["user"])
end
+ @doc """
+ Fetch favorites activities of user with order by sort adds to favorites
+ """
+ @spec fetch_favourites(User.t(), map(), Pagination.type()) :: list(Activity.t())
+ def fetch_favourites(user, params \\ %{}, pagination \\ :keyset) do
+ user.ap_id
+ |> Activity.Queries.by_actor()
+ |> Activity.Queries.by_type("Like")
+ |> Activity.with_joined_object()
+ |> Object.with_joined_activity()
+ |> select([_like, object, activity], %{activity | object: object})
+ |> order_by([like, _, _], desc: like.id)
+ |> Pagination.fetch_paginated(
+ Map.merge(params, %{"skip_order" => true}),
+ pagination,
+ :object_activity
+ )
+ end
+
defp maybe_update_cc(activities, list_memberships, %User{ap_id: user_ap_id})
when is_list(list_memberships) and length(list_memberships) > 0 do
Enum.map(activities, fn
@@ -1053,7 +1205,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
where:
fragment("? && ?", activity.recipients, ^recipients) or
(fragment("? && ?", activity.recipients, ^recipients_with_public) and
- ^Pleroma.Constants.as_public() in activity.recipients)
+ ^Constants.as_public() in activity.recipients)
)
end
@@ -1069,6 +1221,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
|> Enum.reverse()
end
+ @spec upload(Upload.source(), keyword()) :: {:ok, Object.t()} | {:error, any()}
def upload(file, opts \\ []) do
with {:ok, data} <- Upload.store(file, opts) do
obj_data =
@@ -1082,6 +1235,18 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
end
end
+ @spec get_actor_url(any()) :: binary() | nil
+ defp get_actor_url(url) when is_binary(url), do: url
+ defp get_actor_url(%{"href" => href}) when is_binary(href), do: href
+
+ defp get_actor_url(url) when is_list(url) do
+ url
+ |> List.first()
+ |> get_actor_url()
+ end
+
+ defp get_actor_url(_url), do: nil
+
defp object_to_user_data(data) do
avatar =
data["icon"]["url"] &&
@@ -1103,27 +1268,57 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
|> Enum.filter(fn %{"type" => t} -> t == "PropertyValue" end)
|> Enum.map(fn fields -> Map.take(fields, ["name", "value"]) end)
+ emojis =
+ data
+ |> Map.get("tag", [])
+ |> Enum.filter(fn
+ %{"type" => "Emoji"} -> true
+ _ -> false
+ end)
+ |> Enum.reduce(%{}, fn %{"icon" => %{"url" => url}, "name" => name}, acc ->
+ Map.put(acc, String.trim(name, ":"), url)
+ end)
+
locked = data["manuallyApprovesFollowers"] || false
data = Transmogrifier.maybe_fix_user_object(data)
discoverable = data["discoverable"] || false
invisible = data["invisible"] || false
+ actor_type = data["type"] || "Person"
+
+ public_key =
+ if is_map(data["publicKey"]) && is_binary(data["publicKey"]["publicKeyPem"]) do
+ data["publicKey"]["publicKeyPem"]
+ else
+ nil
+ end
+
+ shared_inbox =
+ if is_map(data["endpoints"]) && is_binary(data["endpoints"]["sharedInbox"]) do
+ data["endpoints"]["sharedInbox"]
+ else
+ nil
+ end
user_data = %{
ap_id: data["id"],
- info: %{
- ap_enabled: true,
- source_data: data,
- banner: banner,
- fields: fields,
- locked: locked,
- discoverable: discoverable,
- invisible: invisible
- },
+ uri: get_actor_url(data["url"]),
+ ap_enabled: true,
+ banner: banner,
+ fields: fields,
+ emoji: emojis,
+ locked: locked,
+ discoverable: discoverable,
+ invisible: invisible,
avatar: avatar,
name: data["name"],
follower_address: data["followers"],
following_address: data["following"],
- bio: data["summary"]
+ bio: data["summary"],
+ actor_type: actor_type,
+ also_known_as: Map.get(data, "alsoKnownAs", []),
+ public_key: public_key,
+ inbox: data["inbox"],
+ shared_inbox: shared_inbox
}
# nickname can be nil because of virtual actors
@@ -1144,68 +1339,74 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
def fetch_follow_information_for_user(user) do
with {:ok, following_data} <-
Fetcher.fetch_and_contain_remote_object_from_id(user.following_address),
- following_count when is_integer(following_count) <- following_data["totalItems"],
{:ok, hide_follows} <- collection_private(following_data),
{:ok, followers_data} <-
Fetcher.fetch_and_contain_remote_object_from_id(user.follower_address),
- followers_count when is_integer(followers_count) <- followers_data["totalItems"],
{:ok, hide_followers} <- collection_private(followers_data) do
{:ok,
%{
hide_follows: hide_follows,
- follower_count: followers_count,
- following_count: following_count,
+ follower_count: normalize_counter(followers_data["totalItems"]),
+ following_count: normalize_counter(following_data["totalItems"]),
hide_followers: hide_followers
}}
else
- {:error, _} = e ->
- e
-
- e ->
- {:error, e}
+ {:error, _} = e -> e
+ e -> {:error, e}
end
end
- defp maybe_update_follow_information(data) do
- with {:enabled, true} <-
- {:enabled, Pleroma.Config.get([:instance, :external_user_synchronization])},
- {:ok, info} <- fetch_follow_information_for_user(data) do
- info = Map.merge(data.info, info)
- Map.put(data, :info, info)
+ defp normalize_counter(counter) when is_integer(counter), do: counter
+ defp normalize_counter(_), do: 0
+
+ def maybe_update_follow_information(user_data) do
+ with {:enabled, true} <- {:enabled, Config.get([:instance, :external_user_synchronization])},
+ {_, true} <- {:user_type_check, user_data[:type] in ["Person", "Service"]},
+ {_, true} <-
+ {:collections_available,
+ !!(user_data[:following_address] && user_data[:follower_address])},
+ {:ok, info} <-
+ fetch_follow_information_for_user(user_data) do
+ info = Map.merge(user_data[:info] || %{}, info)
+
+ user_data
+ |> Map.put(:info, info)
else
+ {:user_type_check, false} ->
+ user_data
+
+ {:collections_available, false} ->
+ user_data
+
{:enabled, false} ->
- data
+ user_data
e ->
Logger.error(
- "Follower/Following counter update for #{data.ap_id} failed.\n" <> inspect(e)
+ "Follower/Following counter update for #{user_data.ap_id} failed.\n" <> inspect(e)
)
- data
+ user_data
end
end
- defp collection_private(data) do
- if is_map(data["first"]) and
- data["first"]["type"] in ["CollectionPage", "OrderedCollectionPage"] do
+ defp collection_private(%{"first" => %{"type" => type}})
+ when type in ["CollectionPage", "OrderedCollectionPage"],
+ do: {:ok, false}
+
+ defp collection_private(%{"first" => first}) do
+ with {:ok, %{"type" => type}} when type in ["CollectionPage", "OrderedCollectionPage"] <-
+ Fetcher.fetch_and_contain_remote_object_from_id(first) do
{:ok, false}
else
- with {:ok, %{"type" => type}} when type in ["CollectionPage", "OrderedCollectionPage"] <-
- Fetcher.fetch_and_contain_remote_object_from_id(data["first"]) do
- {:ok, false}
- else
- {:error, {:ok, %{status: code}}} when code in [401, 403] ->
- {:ok, true}
-
- {:error, _} = e ->
- e
-
- e ->
- {:error, e}
- end
+ {:error, {:ok, %{status: code}}} when code in [401, 403] -> {:ok, true}
+ {:error, _} = e -> e
+ e -> {:error, e}
end
end
+ defp collection_private(_data), do: {:ok, true}
+
def user_data_from_user_object(data) do
with {:ok, data} <- MRF.filter(data),
{:ok, data} <- object_to_user_data(data) do
@@ -1221,6 +1422,10 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
data <- maybe_update_follow_information(data) do
{:ok, data}
else
+ {:error, "Object has been deleted"} = e ->
+ Logger.debug("Could not decode user at fetch #{ap_id}, #{inspect(e)}")
+ {:error, e}
+
e ->
Logger.error("Could not decode user at fetch #{ap_id}, #{inspect(e)}")
{:error, e}
@@ -1228,11 +1433,22 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
end
def make_user_from_ap_id(ap_id) do
- if _user = User.get_cached_by_ap_id(ap_id) do
+ user = User.get_cached_by_ap_id(ap_id)
+
+ if user && !User.ap_enabled?(user) do
Transmogrifier.upgrade_user_from_ap_id(ap_id)
else
with {:ok, data} <- fetch_and_prepare_user_from_ap_id(ap_id) do
- User.insert_or_update_user(data)
+ if user do
+ user
+ |> User.remote_user_changeset(data)
+ |> User.update_and_set_cache()
+ else
+ data
+ |> User.remote_user_changeset()
+ |> Repo.insert()
+ |> User.set_cache()
+ end
else
e -> {:error, e}
end
diff --git a/lib/pleroma/web/activity_pub/activity_pub_controller.ex b/lib/pleroma/web/activity_pub/activity_pub_controller.ex
index 080030eb5..62ad15d85 100644
--- a/lib/pleroma/web/activity_pub/activity_pub_controller.ex
+++ b/lib/pleroma/web/activity_pub/activity_pub_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.ActivityPubController do
@@ -9,32 +9,50 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
alias Pleroma.Delivery
alias Pleroma.Object
alias Pleroma.Object.Fetcher
+ alias Pleroma.Plugs.EnsureAuthenticatedPlug
alias Pleroma.User
alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.Builder
alias Pleroma.Web.ActivityPub.InternalFetchActor
alias Pleroma.Web.ActivityPub.ObjectView
+ alias Pleroma.Web.ActivityPub.Pipeline
alias Pleroma.Web.ActivityPub.Relay
alias Pleroma.Web.ActivityPub.Transmogrifier
alias Pleroma.Web.ActivityPub.UserView
alias Pleroma.Web.ActivityPub.Utils
alias Pleroma.Web.ActivityPub.Visibility
+ alias Pleroma.Web.FederatingPlug
alias Pleroma.Web.Federator
require Logger
action_fallback(:errors)
+ @federating_only_actions [:internal_fetch, :relay, :relay_following, :relay_followers]
+
+ plug(FederatingPlug when action in @federating_only_actions)
+
+ plug(
+ EnsureAuthenticatedPlug,
+ [unless_func: &FederatingPlug.federating?/1] when action not in @federating_only_actions
+ )
+
+ # Note: :following and :followers must be served even without authentication (as via :api)
+ plug(
+ EnsureAuthenticatedPlug
+ when action in [:read_inbox, :update_outbox, :whoami, :upload_media]
+ )
+
plug(
Pleroma.Plugs.Cache,
[query_params: false, tracking_fun: &__MODULE__.track_object_fetch/2]
when action in [:activity, :object]
)
- plug(Pleroma.Web.FederatingPlug when action in [:inbox, :relay])
plug(:set_requester_reachable when action in [:inbox])
plug(:relay_active? when action in [:relay])
- def relay_active?(conn, _) do
+ defp relay_active?(conn, _) do
if Pleroma.Config.get([:instance, :allow_relay]) do
conn
else
@@ -45,7 +63,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
end
def user(conn, %{"nickname" => nickname}) do
- with %User{} = user <- User.get_cached_by_nickname(nickname),
+ with %User{local: true} = user <- User.get_cached_by_nickname(nickname),
{:ok, user} <- User.ensure_keys_present(user) do
conn
|> put_resp_content_type("application/activity+json")
@@ -53,6 +71,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
|> render("user.json", %{user: user})
else
nil -> {:error, :not_found}
+ %{local: false} -> {:error, :not_found}
end
end
@@ -126,18 +145,20 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
end
# GET /relay/following
- def following(%{assigns: %{relay: true}} = conn, _params) do
- conn
- |> put_resp_content_type("application/activity+json")
- |> put_view(UserView)
- |> render("following.json", %{user: Relay.get_actor()})
+ def relay_following(conn, _params) do
+ with %{halted: false} = conn <- FederatingPlug.call(conn, []) do
+ conn
+ |> put_resp_content_type("application/activity+json")
+ |> put_view(UserView)
+ |> render("following.json", %{user: Relay.get_actor()})
+ end
end
def following(%{assigns: %{user: for_user}} = conn, %{"nickname" => nickname, "page" => page}) do
with %User{} = user <- User.get_cached_by_nickname(nickname),
{user, for_user} <- ensure_user_keys_present_and_maybe_refresh_for_user(user, for_user),
{:show_follows, true} <-
- {:show_follows, (for_user && for_user == user) || !user.info.hide_follows} do
+ {:show_follows, (for_user && for_user == user) || !user.hide_follows} do
{page, _} = Integer.parse(page)
conn
@@ -163,18 +184,20 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
end
# GET /relay/followers
- def followers(%{assigns: %{relay: true}} = conn, _params) do
- conn
- |> put_resp_content_type("application/activity+json")
- |> put_view(UserView)
- |> render("followers.json", %{user: Relay.get_actor()})
+ def relay_followers(conn, _params) do
+ with %{halted: false} = conn <- FederatingPlug.call(conn, []) do
+ conn
+ |> put_resp_content_type("application/activity+json")
+ |> put_view(UserView)
+ |> render("followers.json", %{user: Relay.get_actor()})
+ end
end
def followers(%{assigns: %{user: for_user}} = conn, %{"nickname" => nickname, "page" => page}) do
with %User{} = user <- User.get_cached_by_nickname(nickname),
{user, for_user} <- ensure_user_keys_present_and_maybe_refresh_for_user(user, for_user),
{:show_followers, true} <-
- {:show_followers, (for_user && for_user == user) || !user.info.hide_followers} do
+ {:show_followers, (for_user && for_user == user) || !user.hide_followers} do
{page, _} = Integer.parse(page)
conn
@@ -199,13 +222,16 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
end
end
- def outbox(conn, %{"nickname" => nickname, "page" => page?} = params)
+ def outbox(
+ %{assigns: %{user: for_user}} = conn,
+ %{"nickname" => nickname, "page" => page?} = params
+ )
when page? in [true, "true"] do
with %User{} = user <- User.get_cached_by_nickname(nickname),
{:ok, user} <- User.ensure_keys_present(user) do
activities =
if params["max_id"] do
- ActivityPub.fetch_user_activities(user, nil, %{
+ ActivityPub.fetch_user_activities(user, for_user, %{
"max_id" => params["max_id"],
# This is a hack because postgres generates inefficient queries when filtering by
# 'Answer', poll votes will be hidden by the visibility filter in this case anyway
@@ -213,7 +239,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
"limit" => 10
})
else
- ActivityPub.fetch_user_activities(user, nil, %{
+ ActivityPub.fetch_user_activities(user, for_user, %{
"limit" => 10,
"include_poll_votes" => true
})
@@ -254,9 +280,17 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
json(conn, "ok")
end
- # only accept relayed Creates
- def inbox(conn, %{"type" => "Create"} = params) do
- Logger.info(
+ # POST /relay/inbox -or- POST /internal/fetch/inbox
+ def inbox(conn, params) do
+ if params["type"] == "Create" && FederatingPlug.federating?() do
+ post_inbox_relayed_create(conn, params)
+ else
+ post_inbox_fallback(conn, params)
+ end
+ end
+
+ defp post_inbox_relayed_create(conn, params) do
+ Logger.debug(
"Signature missing or not from author, relayed Create message, fetching object from source"
)
@@ -265,18 +299,21 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
json(conn, "ok")
end
- def inbox(conn, params) do
+ defp post_inbox_fallback(conn, params) do
headers = Enum.into(conn.req_headers, %{})
- if String.contains?(headers["signature"], params["actor"]) do
- Logger.info(
+ if headers["signature"] && params["actor"] &&
+ String.contains?(headers["signature"], params["actor"]) do
+ Logger.debug(
"Signature validation error for: #{params["actor"]}, make sure you are forwarding the HTTP Host header!"
)
- Logger.info(inspect(conn.req_headers))
+ Logger.debug(inspect(conn.req_headers))
end
- json(conn, dgettext("errors", "error"))
+ conn
+ |> put_status(:bad_request)
+ |> json(dgettext("errors", "error"))
end
defp represent_service_actor(%User{} = user, conn) do
@@ -310,21 +347,19 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
|> render("user.json", %{user: user})
end
- def whoami(_conn, _params), do: {:error, :not_found}
-
def read_inbox(
- %{assigns: %{user: %{nickname: nickname} = user}} = conn,
+ %{assigns: %{user: %User{nickname: nickname} = user}} = conn,
%{"nickname" => nickname, "page" => page?} = params
)
when page? in [true, "true"] do
activities =
if params["max_id"] do
- ActivityPub.fetch_activities([user.ap_id | user.following], %{
+ ActivityPub.fetch_activities([user.ap_id | User.following(user)], %{
"max_id" => params["max_id"],
"limit" => 10
})
else
- ActivityPub.fetch_activities([user.ap_id | user.following], %{"limit" => 10})
+ ActivityPub.fetch_activities([user.ap_id | User.following(user)], %{"limit" => 10})
end
conn
@@ -336,7 +371,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
})
end
- def read_inbox(%{assigns: %{user: %{nickname: nickname} = user}} = conn, %{
+ def read_inbox(%{assigns: %{user: %User{nickname: nickname} = user}} = conn, %{
"nickname" => nickname
}) do
with {:ok, user} <- User.ensure_keys_present(user) do
@@ -347,15 +382,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
end
end
- def read_inbox(%{assigns: %{user: nil}} = conn, %{"nickname" => nickname}) do
- err = dgettext("errors", "can't read inbox of %{nickname}", nickname: nickname)
-
- conn
- |> put_status(:forbidden)
- |> json(err)
- end
-
- def read_inbox(%{assigns: %{user: %{nickname: as_nickname}}} = conn, %{
+ def read_inbox(%{assigns: %{user: %User{nickname: as_nickname}}} = conn, %{
"nickname" => nickname
}) do
err =
@@ -369,7 +396,10 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
|> json(err)
end
- def handle_user_activity(user, %{"type" => "Create"} = params) do
+ defp handle_user_activity(
+ %User{} = user,
+ %{"type" => "Create", "object" => %{"type" => "Note"}} = params
+ ) do
object =
params["object"]
|> Map.merge(Map.take(params, ["to", "cc"]))
@@ -385,26 +415,30 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
})
end
- def handle_user_activity(user, %{"type" => "Delete"} = params) do
+ defp handle_user_activity(%User{} = user, %{"type" => "Delete"} = params) do
with %Object{} = object <- Object.normalize(params["object"]),
- true <- user.info.is_moderator || user.ap_id == object.data["actor"],
- {:ok, delete} <- ActivityPub.delete(object) do
+ true <- user.is_moderator || user.ap_id == object.data["actor"],
+ {:ok, delete_data, _} <- Builder.delete(user, object.data["id"]),
+ {:ok, delete, _} <- Pipeline.common_pipeline(delete_data, local: true) do
{:ok, delete}
else
_ -> {:error, dgettext("errors", "Can't delete object")}
end
end
- def handle_user_activity(user, %{"type" => "Like"} = params) do
+ defp handle_user_activity(%User{} = user, %{"type" => "Like"} = params) do
with %Object{} = object <- Object.normalize(params["object"]),
- {:ok, activity, _object} <- ActivityPub.like(user, object) do
+ {_, {:ok, like_object, meta}} <- {:build_object, Builder.like(user, object)},
+ {_, {:ok, %Activity{} = activity, _meta}} <-
+ {:common_pipeline,
+ Pipeline.common_pipeline(like_object, Keyword.put(meta, :local, true))} do
{:ok, activity}
else
_ -> {:error, dgettext("errors", "Can't like object")}
end
end
- def handle_user_activity(_, _) do
+ defp handle_user_activity(_, _) do
{:error, dgettext("errors", "Unhandled activity type")}
end
@@ -433,7 +467,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
end
end
- def update_outbox(%{assigns: %{user: user}} = conn, %{"nickname" => nickname} = _) do
+ def update_outbox(%{assigns: %{user: %User{} = user}} = conn, %{"nickname" => nickname}) do
err =
dgettext("errors", "can't update outbox of %{nickname} as %{as_nickname}",
nickname: nickname,
@@ -445,13 +479,13 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
|> json(err)
end
- def errors(conn, {:error, :not_found}) do
+ defp errors(conn, {:error, :not_found}) do
conn
|> put_status(:not_found)
|> json(dgettext("errors", "Not found"))
end
- def errors(conn, _e) do
+ defp errors(conn, _e) do
conn
|> put_status(:internal_server_error)
|> json(dgettext("errors", "error"))
@@ -491,7 +525,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPubController do
- HTTP Code: 201 Created
- HTTP Body: ActivityPub object to be inserted into another's `attachment` field
"""
- def upload_media(%{assigns: %{user: user}} = conn, %{"file" => file} = data) do
+ def upload_media(%{assigns: %{user: %User{} = user}} = conn, %{"file" => file} = data) do
with {:ok, object} <-
ActivityPub.upload(
file,
diff --git a/lib/pleroma/web/activity_pub/builder.ex b/lib/pleroma/web/activity_pub/builder.ex
new file mode 100644
index 000000000..4a247ad0c
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/builder.ex
@@ -0,0 +1,115 @@
+defmodule Pleroma.Web.ActivityPub.Builder do
+ @moduledoc """
+ This module builds the objects. Meant to be used for creating local objects.
+
+ This module encodes our addressing policies and general shape of our objects.
+ """
+
+ alias Pleroma.Object
+ alias Pleroma.User
+ alias Pleroma.Web.ActivityPub.Utils
+ alias Pleroma.Web.ActivityPub.Visibility
+
+ @spec emoji_react(User.t(), Object.t(), String.t()) :: {:ok, map(), keyword()}
+ def emoji_react(actor, object, emoji) do
+ with {:ok, data, meta} <- object_action(actor, object) do
+ data =
+ data
+ |> Map.put("content", emoji)
+ |> Map.put("type", "EmojiReact")
+
+ {:ok, data, meta}
+ end
+ end
+
+ @spec undo(User.t(), Activity.t()) :: {:ok, map(), keyword()}
+ def undo(actor, object) do
+ {:ok,
+ %{
+ "id" => Utils.generate_activity_id(),
+ "actor" => actor.ap_id,
+ "type" => "Undo",
+ "object" => object.data["id"],
+ "to" => object.data["to"] || [],
+ "cc" => object.data["cc"] || []
+ }, []}
+ end
+
+ @spec delete(User.t(), String.t()) :: {:ok, map(), keyword()}
+ def delete(actor, object_id) do
+ object = Object.normalize(object_id, false)
+
+ user = !object && User.get_cached_by_ap_id(object_id)
+
+ to =
+ case {object, user} do
+ {%Object{}, _} ->
+ # We are deleting an object, address everyone who was originally mentioned
+ (object.data["to"] || []) ++ (object.data["cc"] || [])
+
+ {_, %User{follower_address: follower_address}} ->
+ # We are deleting a user, address the followers of that user
+ [follower_address]
+ end
+
+ {:ok,
+ %{
+ "id" => Utils.generate_activity_id(),
+ "actor" => actor.ap_id,
+ "object" => object_id,
+ "to" => to,
+ "type" => "Delete"
+ }, []}
+ end
+
+ @spec tombstone(String.t(), String.t()) :: {:ok, map(), keyword()}
+ def tombstone(actor, id) do
+ {:ok,
+ %{
+ "id" => id,
+ "actor" => actor,
+ "type" => "Tombstone"
+ }, []}
+ end
+
+ @spec like(User.t(), Object.t()) :: {:ok, map(), keyword()}
+ def like(actor, object) do
+ with {:ok, data, meta} <- object_action(actor, object) do
+ data =
+ data
+ |> Map.put("type", "Like")
+
+ {:ok, data, meta}
+ end
+ end
+
+ @spec object_action(User.t(), Object.t()) :: {:ok, map(), keyword()}
+ defp object_action(actor, object) do
+ object_actor = User.get_cached_by_ap_id(object.data["actor"])
+
+ # Address the actor of the object, and our actor's follower collection if the post is public.
+ to =
+ if Visibility.is_public?(object) do
+ [actor.follower_address, object.data["actor"]]
+ else
+ [object.data["actor"]]
+ end
+
+ # CC everyone who's been addressed in the object, except ourself and the object actor's
+ # follower collection
+ cc =
+ (object.data["to"] ++ (object.data["cc"] || []))
+ |> List.delete(actor.ap_id)
+ |> List.delete(object_actor.follower_address)
+
+ {:ok,
+ %{
+ "id" => Utils.generate_activity_id(),
+ "actor" => actor.ap_id,
+ "object" => object.data["id"],
+ "to" => to,
+ "cc" => cc,
+ "context" => object.data["context"]
+ }, []}
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/internal_fetch_actor.ex b/lib/pleroma/web/activity_pub/internal_fetch_actor.ex
index 9213ddde7..c80272b8f 100644
--- a/lib/pleroma/web/activity_pub/internal_fetch_actor.ex
+++ b/lib/pleroma/web/activity_pub/internal_fetch_actor.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.InternalFetchActor do
diff --git a/lib/pleroma/web/activity_pub/mrf.ex b/lib/pleroma/web/activity_pub/mrf.ex
index 263ed11af..a0b3af432 100644
--- a/lib/pleroma/web/activity_pub/mrf.ex
+++ b/lib/pleroma/web/activity_pub/mrf.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF do
diff --git a/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex b/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex
index b3547ecd4..0270b96ae 100644
--- a/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.AntiFollowbotPolicy do
diff --git a/lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex b/lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex
index b90193ca0..9e7800997 100644
--- a/lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.AntiLinkSpamPolicy do
@@ -11,12 +11,13 @@ defmodule Pleroma.Web.ActivityPub.MRF.AntiLinkSpamPolicy do
# has the user successfully posted before?
defp old_user?(%User{} = u) do
- u.info.note_count > 0 || u.info.follower_count > 0
+ u.note_count > 0 || u.follower_count > 0
end
# does the post contain links?
defp contains_links?(%{"content" => content} = _object) do
content
+ |> Floki.parse_fragment!()
|> Floki.filter_out("a.mention,a.hashtag,a[rel~=\"tag\"],a.zrl")
|> Floki.attribute("a", "href")
|> length() > 0
diff --git a/lib/pleroma/web/activity_pub/mrf/drop_policy.ex b/lib/pleroma/web/activity_pub/mrf/drop_policy.ex
index f7831bc3e..5ab9844ff 100644
--- a/lib/pleroma/web/activity_pub/mrf/drop_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/drop_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.DropPolicy do
@@ -9,7 +9,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.DropPolicy do
@impl true
def filter(object) do
- Logger.info("REJECTING #{inspect(object)}")
+ Logger.debug("REJECTING #{inspect(object)}")
{:reject, object}
end
diff --git a/lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex b/lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex
index 3a3e72910..2627a0007 100644
--- a/lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex
+++ b/lib/pleroma/web/activity_pub/mrf/ensure_re_prepended.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.EnsureRePrepended do
diff --git a/lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex b/lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex
index b3c742954..1764bc789 100644
--- a/lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.HellthreadPolicy do
diff --git a/lib/pleroma/web/activity_pub/mrf/keyword_policy.ex b/lib/pleroma/web/activity_pub/mrf/keyword_policy.ex
index d6d1396bc..88b0d2b39 100644
--- a/lib/pleroma/web/activity_pub/mrf/keyword_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/keyword_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.KeywordPolicy do
diff --git a/lib/pleroma/web/activity_pub/mrf/mediaproxy_warming_policy.ex b/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex
index 26b8539fe..dfab105a3 100644
--- a/lib/pleroma/web/activity_pub/mrf/mediaproxy_warming_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/media_proxy_warming_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy do
@@ -12,17 +12,23 @@ defmodule Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy do
require Logger
- @hackney_options [
- pool: :media,
- recv_timeout: 10_000
+ @options [
+ pool: :media
]
def perform(:prefetch, url) do
- Logger.info("Prefetching #{inspect(url)}")
+ Logger.debug("Prefetching #{inspect(url)}")
+
+ opts =
+ if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do
+ Keyword.put(@options, :recv_timeout, 10_000)
+ else
+ @options
+ end
url
|> MediaProxy.url()
- |> HTTP.get([], adapter: @hackney_options)
+ |> HTTP.get([], adapter: opts)
end
def perform(:preload, %{"object" => %{"attachment" => attachments}} = _message) do
diff --git a/lib/pleroma/web/activity_pub/mrf/mention_policy.ex b/lib/pleroma/web/activity_pub/mrf/mention_policy.ex
index ce8bc4580..06f003921 100644
--- a/lib/pleroma/web/activity_pub/mrf/mention_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/mention_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.MentionPolicy do
diff --git a/lib/pleroma/web/activity_pub/mrf/noop_policy.ex b/lib/pleroma/web/activity_pub/mrf/no_op_policy.ex
index 878c57925..cc2ac9d08 100644
--- a/lib/pleroma/web/activity_pub/mrf/noop_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/no_op_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.NoOpPolicy do
diff --git a/lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex b/lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex
index f67f48ab6..fc3475048 100644
--- a/lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/no_placeholder_text_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.NoPlaceholderTextPolicy do
diff --git a/lib/pleroma/web/activity_pub/mrf/normalize_markup.ex b/lib/pleroma/web/activity_pub/mrf/normalize_markup.ex
index daa4c88ad..7abae37ae 100644
--- a/lib/pleroma/web/activity_pub/mrf/normalize_markup.ex
+++ b/lib/pleroma/web/activity_pub/mrf/normalize_markup.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.NormalizeMarkup do
diff --git a/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex b/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex
new file mode 100644
index 000000000..b0ccb63c8
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/mrf/object_age_policy.ex
@@ -0,0 +1,106 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy do
+ alias Pleroma.Config
+ alias Pleroma.User
+
+ require Pleroma.Constants
+
+ @moduledoc "Filter activities depending on their age"
+ @behaviour Pleroma.Web.ActivityPub.MRF
+
+ defp check_date(%{"object" => %{"published" => published}} = message) do
+ with %DateTime{} = now <- DateTime.utc_now(),
+ {:ok, %DateTime{} = then, _} <- DateTime.from_iso8601(published),
+ max_ttl <- Config.get([:mrf_object_age, :threshold]),
+ {:ttl, false} <- {:ttl, DateTime.diff(now, then) > max_ttl} do
+ {:ok, message}
+ else
+ {:ttl, true} ->
+ {:reject, nil}
+
+ e ->
+ {:error, e}
+ end
+ end
+
+ defp check_reject(message, actions) do
+ if :reject in actions do
+ {:reject, nil}
+ else
+ {:ok, message}
+ end
+ end
+
+ defp check_delist(message, actions) do
+ if :delist in actions do
+ with %User{} = user <- User.get_cached_by_ap_id(message["actor"]) do
+ to = List.delete(message["to"], Pleroma.Constants.as_public()) ++ [user.follower_address]
+ cc = List.delete(message["cc"], user.follower_address) ++ [Pleroma.Constants.as_public()]
+
+ message =
+ message
+ |> Map.put("to", to)
+ |> Map.put("cc", cc)
+
+ {:ok, message}
+ else
+ # Unhandleable error: somebody is messing around, just drop the message.
+ _e ->
+ {:reject, nil}
+ end
+ else
+ {:ok, message}
+ end
+ end
+
+ defp check_strip_followers(message, actions) do
+ if :strip_followers in actions do
+ with %User{} = user <- User.get_cached_by_ap_id(message["actor"]) do
+ to = List.delete(message["to"], user.follower_address)
+ cc = List.delete(message["cc"], user.follower_address)
+
+ message =
+ message
+ |> Map.put("to", to)
+ |> Map.put("cc", cc)
+
+ {:ok, message}
+ else
+ # Unhandleable error: somebody is messing around, just drop the message.
+ _e ->
+ {:reject, nil}
+ end
+ else
+ {:ok, message}
+ end
+ end
+
+ @impl true
+ def filter(%{"type" => "Create", "published" => _} = message) do
+ with actions <- Config.get([:mrf_object_age, :actions]),
+ {:reject, _} <- check_date(message),
+ {:ok, message} <- check_reject(message, actions),
+ {:ok, message} <- check_delist(message, actions),
+ {:ok, message} <- check_strip_followers(message, actions) do
+ {:ok, message}
+ else
+ # check_date() is allowed to short-circuit the pipeline
+ e -> e
+ end
+ end
+
+ @impl true
+ def filter(message), do: {:ok, message}
+
+ @impl true
+ def describe do
+ mrf_object_age =
+ Pleroma.Config.get(:mrf_object_age)
+ |> Enum.into(%{})
+
+ {:ok, %{mrf_object_age: mrf_object_age}}
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/mrf/reject_non_public.ex b/lib/pleroma/web/activity_pub/mrf/reject_non_public.ex
index 5a809a321..3092f3272 100644
--- a/lib/pleroma/web/activity_pub/mrf/reject_non_public.ex
+++ b/lib/pleroma/web/activity_pub/mrf/reject_non_public.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.RejectNonPublic do
diff --git a/lib/pleroma/web/activity_pub/mrf/simple_policy.ex b/lib/pleroma/web/activity_pub/mrf/simple_policy.ex
index 8e53296e7..b7dcb1b86 100644
--- a/lib/pleroma/web/activity_pub/mrf/simple_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/simple_policy.ex
@@ -1,12 +1,12 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do
alias Pleroma.User
alias Pleroma.Web.ActivityPub.MRF
@moduledoc "Filter activities depending on their origin instance"
- @behaviour MRF
+ @behaviour Pleroma.Web.ActivityPub.MRF
require Pleroma.Constants
@@ -149,6 +149,21 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do
defp check_banner_removal(_actor_info, object), do: {:ok, object}
@impl true
+ def filter(%{"type" => "Delete", "actor" => actor} = object) do
+ %{host: actor_host} = URI.parse(actor)
+
+ reject_deletes =
+ Pleroma.Config.get([:mrf_simple, :reject_deletes])
+ |> MRF.subdomains_regex()
+
+ if MRF.subdomain_match?(reject_deletes, actor_host) do
+ {:reject, nil}
+ else
+ {:ok, object}
+ end
+ end
+
+ @impl true
def filter(%{"actor" => actor} = object) do
actor_info = URI.parse(actor)
diff --git a/lib/pleroma/web/activity_pub/mrf/subchain_policy.ex b/lib/pleroma/web/activity_pub/mrf/subchain_policy.ex
index 566c1e191..c9f20571f 100644
--- a/lib/pleroma/web/activity_pub/mrf/subchain_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/subchain_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.SubchainPolicy do
@@ -8,7 +8,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.SubchainPolicy do
require Logger
- @behaviour MRF
+ @behaviour Pleroma.Web.ActivityPub.MRF
defp lookup_subchain(actor) do
with matches <- Config.get([:mrf_subchain, :match_actor]),
diff --git a/lib/pleroma/web/activity_pub/mrf/tag_policy.ex b/lib/pleroma/web/activity_pub/mrf/tag_policy.ex
index c1801d2ec..c310462cb 100644
--- a/lib/pleroma/web/activity_pub/mrf/tag_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/tag_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.TagPolicy do
diff --git a/lib/pleroma/web/activity_pub/mrf/user_allowlist_policy.ex b/lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex
index 7389d6a96..a927a4ed8 100644
--- a/lib/pleroma/web/activity_pub/mrf/user_allowlist_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.UserAllowListPolicy do
diff --git a/lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex b/lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex
index 4eaea00d8..6167a74e2 100644
--- a/lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex
+++ b/lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.MRF.VocabularyPolicy do
@@ -20,7 +20,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.VocabularyPolicy do
with accepted_vocabulary <- Pleroma.Config.get([:mrf_vocabulary, :accept]),
rejected_vocabulary <- Pleroma.Config.get([:mrf_vocabulary, :reject]),
true <-
- length(accepted_vocabulary) == 0 || Enum.member?(accepted_vocabulary, message_type),
+ Enum.empty?(accepted_vocabulary) || Enum.member?(accepted_vocabulary, message_type),
false <-
length(rejected_vocabulary) > 0 && Enum.member?(rejected_vocabulary, message_type),
{:ok, _} <- filter(message["object"]) do
diff --git a/lib/pleroma/web/activity_pub/object_validator.ex b/lib/pleroma/web/activity_pub/object_validator.ex
new file mode 100644
index 000000000..549e5e761
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validator.ex
@@ -0,0 +1,83 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidator do
+ @moduledoc """
+ This module is responsible for validating an object (which can be an activity)
+ and checking if it is both well formed and also compatible with our view of
+ the system.
+ """
+
+ alias Pleroma.Object
+ alias Pleroma.User
+ alias Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidator
+ alias Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactValidator
+ alias Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+ alias Pleroma.Web.ActivityPub.ObjectValidators.UndoValidator
+
+ @spec validate(map(), keyword()) :: {:ok, map(), keyword()} | {:error, any()}
+ def validate(object, meta)
+
+ def validate(%{"type" => "Undo"} = object, meta) do
+ with {:ok, object} <-
+ object
+ |> UndoValidator.cast_and_validate()
+ |> Ecto.Changeset.apply_action(:insert) do
+ object = stringify_keys(object)
+ {:ok, object, meta}
+ end
+ end
+
+ def validate(%{"type" => "Delete"} = object, meta) do
+ with cng <- DeleteValidator.cast_and_validate(object),
+ do_not_federate <- DeleteValidator.do_not_federate?(cng),
+ {:ok, object} <- Ecto.Changeset.apply_action(cng, :insert) do
+ object = stringify_keys(object)
+ meta = Keyword.put(meta, :do_not_federate, do_not_federate)
+ {:ok, object, meta}
+ end
+ end
+
+ def validate(%{"type" => "Like"} = object, meta) do
+ with {:ok, object} <-
+ object |> LikeValidator.cast_and_validate() |> Ecto.Changeset.apply_action(:insert) do
+ object = stringify_keys(object |> Map.from_struct())
+ {:ok, object, meta}
+ end
+ end
+
+ def validate(%{"type" => "EmojiReact"} = object, meta) do
+ with {:ok, object} <-
+ object
+ |> EmojiReactValidator.cast_and_validate()
+ |> Ecto.Changeset.apply_action(:insert) do
+ object = stringify_keys(object |> Map.from_struct())
+ {:ok, object, meta}
+ end
+ end
+
+ def stringify_keys(%{__struct__: _} = object) do
+ object
+ |> Map.from_struct()
+ |> stringify_keys
+ end
+
+ def stringify_keys(object) do
+ object
+ |> Map.new(fn {key, val} -> {to_string(key), val} end)
+ end
+
+ def fetch_actor(object) do
+ with {:ok, actor} <- Types.ObjectID.cast(object["actor"]) do
+ User.get_or_fetch_by_ap_id(actor)
+ end
+ end
+
+ def fetch_actor_and_object(object) do
+ fetch_actor(object)
+ Object.normalize(object["object"])
+ :ok
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/common_validations.ex b/lib/pleroma/web/activity_pub/object_validators/common_validations.ex
new file mode 100644
index 000000000..aeef31945
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/common_validations.ex
@@ -0,0 +1,80 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations do
+ import Ecto.Changeset
+
+ alias Pleroma.Activity
+ alias Pleroma.Object
+ alias Pleroma.User
+
+ def validate_recipients_presence(cng, fields \\ [:to, :cc]) do
+ non_empty =
+ fields
+ |> Enum.map(fn field -> get_field(cng, field) end)
+ |> Enum.any?(fn
+ [] -> false
+ _ -> true
+ end)
+
+ if non_empty do
+ cng
+ else
+ fields
+ |> Enum.reduce(cng, fn field, cng ->
+ cng
+ |> add_error(field, "no recipients in any field")
+ end)
+ end
+ end
+
+ def validate_actor_presence(cng, options \\ []) do
+ field_name = Keyword.get(options, :field_name, :actor)
+
+ cng
+ |> validate_change(field_name, fn field_name, actor ->
+ if User.get_cached_by_ap_id(actor) do
+ []
+ else
+ [{field_name, "can't find user"}]
+ end
+ end)
+ end
+
+ def validate_object_presence(cng, options \\ []) do
+ field_name = Keyword.get(options, :field_name, :object)
+ allowed_types = Keyword.get(options, :allowed_types, false)
+
+ cng
+ |> validate_change(field_name, fn field_name, object_id ->
+ object = Object.get_cached_by_ap_id(object_id) || Activity.get_by_ap_id(object_id)
+
+ cond do
+ !object ->
+ [{field_name, "can't find object"}]
+
+ object && allowed_types && object.data["type"] not in allowed_types ->
+ [{field_name, "object not in allowed types"}]
+
+ true ->
+ []
+ end
+ end)
+ end
+
+ def validate_object_or_user_presence(cng, options \\ []) do
+ field_name = Keyword.get(options, :field_name, :object)
+ options = Keyword.put(options, :field_name, field_name)
+
+ actor_cng =
+ cng
+ |> validate_actor_presence(options)
+
+ object_cng =
+ cng
+ |> validate_object_presence(options)
+
+ if actor_cng.valid?, do: actor_cng, else: object_cng
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/create_validator.ex b/lib/pleroma/web/activity_pub/object_validators/create_validator.ex
new file mode 100644
index 000000000..926804ce7
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/create_validator.ex
@@ -0,0 +1,30 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.CreateNoteValidator do
+ use Ecto.Schema
+
+ alias Pleroma.Web.ActivityPub.ObjectValidators.NoteValidator
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+
+ import Ecto.Changeset
+
+ @primary_key false
+
+ embedded_schema do
+ field(:id, Types.ObjectID, primary_key: true)
+ field(:actor, Types.ObjectID)
+ field(:type, :string)
+ field(:to, {:array, :string})
+ field(:cc, {:array, :string})
+ field(:bto, {:array, :string}, default: [])
+ field(:bcc, {:array, :string}, default: [])
+
+ embeds_one(:object, NoteValidator)
+ end
+
+ def cast_data(data) do
+ cast(%__MODULE__{}, data, __schema__(:fields))
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex b/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex
new file mode 100644
index 000000000..f42c03510
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/delete_validator.ex
@@ -0,0 +1,100 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidator do
+ use Ecto.Schema
+
+ alias Pleroma.Activity
+ alias Pleroma.User
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+
+ import Ecto.Changeset
+ import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations
+
+ @primary_key false
+
+ embedded_schema do
+ field(:id, Types.ObjectID, primary_key: true)
+ field(:type, :string)
+ field(:actor, Types.ObjectID)
+ field(:to, Types.Recipients, default: [])
+ field(:cc, Types.Recipients, default: [])
+ field(:deleted_activity_id, Types.ObjectID)
+ field(:object, Types.ObjectID)
+ end
+
+ def cast_data(data) do
+ %__MODULE__{}
+ |> cast(data, __schema__(:fields))
+ end
+
+ def add_deleted_activity_id(cng) do
+ object =
+ cng
+ |> get_field(:object)
+
+ with %Activity{id: id} <- Activity.get_create_by_object_ap_id(object) do
+ cng
+ |> put_change(:deleted_activity_id, id)
+ else
+ _ -> cng
+ end
+ end
+
+ @deletable_types ~w{
+ Answer
+ Article
+ Audio
+ Event
+ Note
+ Page
+ Question
+ Video
+ Tombstone
+ }
+ def validate_data(cng) do
+ cng
+ |> validate_required([:id, :type, :actor, :to, :cc, :object])
+ |> validate_inclusion(:type, ["Delete"])
+ |> validate_actor_presence()
+ |> validate_deletion_rights()
+ |> validate_object_or_user_presence(allowed_types: @deletable_types)
+ |> add_deleted_activity_id()
+ end
+
+ def do_not_federate?(cng) do
+ !same_domain?(cng)
+ end
+
+ defp same_domain?(cng) do
+ actor_uri =
+ cng
+ |> get_field(:actor)
+ |> URI.parse()
+
+ object_uri =
+ cng
+ |> get_field(:object)
+ |> URI.parse()
+
+ object_uri.host == actor_uri.host
+ end
+
+ def validate_deletion_rights(cng) do
+ actor = User.get_cached_by_ap_id(get_field(cng, :actor))
+
+ if User.superuser?(actor) || same_domain?(cng) do
+ cng
+ else
+ cng
+ |> add_error(:actor, "is not allowed to delete object")
+ end
+ end
+
+ def cast_and_validate(data) do
+ data
+ |> cast_data
+ |> validate_data
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex b/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex
new file mode 100644
index 000000000..e87519c59
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/emoji_react_validator.ex
@@ -0,0 +1,81 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactValidator do
+ use Ecto.Schema
+
+ alias Pleroma.Object
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+
+ import Ecto.Changeset
+ import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations
+
+ @primary_key false
+
+ embedded_schema do
+ field(:id, Types.ObjectID, primary_key: true)
+ field(:type, :string)
+ field(:object, Types.ObjectID)
+ field(:actor, Types.ObjectID)
+ field(:context, :string)
+ field(:content, :string)
+ field(:to, {:array, :string}, default: [])
+ field(:cc, {:array, :string}, default: [])
+ end
+
+ def cast_and_validate(data) do
+ data
+ |> cast_data()
+ |> validate_data()
+ end
+
+ def cast_data(data) do
+ %__MODULE__{}
+ |> changeset(data)
+ end
+
+ def changeset(struct, data) do
+ struct
+ |> cast(data, __schema__(:fields))
+ |> fix_after_cast()
+ end
+
+ def fix_after_cast(cng) do
+ cng
+ |> fix_context()
+ end
+
+ def fix_context(cng) do
+ object = get_field(cng, :object)
+
+ with nil <- get_field(cng, :context),
+ %Object{data: %{"context" => context}} <- Object.get_cached_by_ap_id(object) do
+ cng
+ |> put_change(:context, context)
+ else
+ _ ->
+ cng
+ end
+ end
+
+ def validate_emoji(cng) do
+ content = get_field(cng, :content)
+
+ if Pleroma.Emoji.is_unicode_emoji?(content) do
+ cng
+ else
+ cng
+ |> add_error(:content, "must be a single character emoji")
+ end
+ end
+
+ def validate_data(data_cng) do
+ data_cng
+ |> validate_inclusion(:type, ["EmojiReact"])
+ |> validate_required([:id, :type, :object, :actor, :context, :to, :cc, :content])
+ |> validate_actor_presence()
+ |> validate_object_presence()
+ |> validate_emoji()
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/like_validator.ex b/lib/pleroma/web/activity_pub/object_validators/like_validator.ex
new file mode 100644
index 000000000..034f25492
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/like_validator.ex
@@ -0,0 +1,99 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator do
+ use Ecto.Schema
+
+ alias Pleroma.Object
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+ alias Pleroma.Web.ActivityPub.Utils
+
+ import Ecto.Changeset
+ import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations
+
+ @primary_key false
+
+ embedded_schema do
+ field(:id, Types.ObjectID, primary_key: true)
+ field(:type, :string)
+ field(:object, Types.ObjectID)
+ field(:actor, Types.ObjectID)
+ field(:context, :string)
+ field(:to, Types.Recipients, default: [])
+ field(:cc, Types.Recipients, default: [])
+ end
+
+ def cast_and_validate(data) do
+ data
+ |> cast_data()
+ |> validate_data()
+ end
+
+ def cast_data(data) do
+ %__MODULE__{}
+ |> changeset(data)
+ end
+
+ def changeset(struct, data) do
+ struct
+ |> cast(data, __schema__(:fields))
+ |> fix_after_cast()
+ end
+
+ def fix_after_cast(cng) do
+ cng
+ |> fix_recipients()
+ |> fix_context()
+ end
+
+ def fix_context(cng) do
+ object = get_field(cng, :object)
+
+ with nil <- get_field(cng, :context),
+ %Object{data: %{"context" => context}} <- Object.get_cached_by_ap_id(object) do
+ cng
+ |> put_change(:context, context)
+ else
+ _ ->
+ cng
+ end
+ end
+
+ def fix_recipients(cng) do
+ to = get_field(cng, :to)
+ cc = get_field(cng, :cc)
+ object = get_field(cng, :object)
+
+ with {[], []} <- {to, cc},
+ %Object{data: %{"actor" => actor}} <- Object.get_cached_by_ap_id(object),
+ {:ok, actor} <- Types.ObjectID.cast(actor) do
+ cng
+ |> put_change(:to, [actor])
+ else
+ _ ->
+ cng
+ end
+ end
+
+ def validate_data(data_cng) do
+ data_cng
+ |> validate_inclusion(:type, ["Like"])
+ |> validate_required([:id, :type, :object, :actor, :context, :to, :cc])
+ |> validate_actor_presence()
+ |> validate_object_presence()
+ |> validate_existing_like()
+ end
+
+ def validate_existing_like(%{changes: %{actor: actor, object: object}} = cng) do
+ if Utils.get_existing_like(actor, %{data: %{"id" => object}}) do
+ cng
+ |> add_error(:actor, "already liked this object")
+ |> add_error(:object, "already liked by this actor")
+ else
+ cng
+ end
+ end
+
+ def validate_existing_like(cng), do: cng
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/note_validator.ex b/lib/pleroma/web/activity_pub/object_validators/note_validator.ex
new file mode 100644
index 000000000..462a5620a
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/note_validator.ex
@@ -0,0 +1,64 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.NoteValidator do
+ use Ecto.Schema
+
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+
+ import Ecto.Changeset
+
+ @primary_key false
+
+ embedded_schema do
+ field(:id, Types.ObjectID, primary_key: true)
+ field(:to, {:array, :string}, default: [])
+ field(:cc, {:array, :string}, default: [])
+ field(:bto, {:array, :string}, default: [])
+ field(:bcc, {:array, :string}, default: [])
+ # TODO: Write type
+ field(:tag, {:array, :map}, default: [])
+ field(:type, :string)
+ field(:content, :string)
+ field(:context, :string)
+ field(:actor, Types.ObjectID)
+ field(:attributedTo, Types.ObjectID)
+ field(:summary, :string)
+ field(:published, Types.DateTime)
+ # TODO: Write type
+ field(:emoji, :map, default: %{})
+ field(:sensitive, :boolean, default: false)
+ # TODO: Write type
+ field(:attachment, {:array, :map}, default: [])
+ field(:replies_count, :integer, default: 0)
+ field(:like_count, :integer, default: 0)
+ field(:announcement_count, :integer, default: 0)
+ field(:inRepyTo, :string)
+ field(:uri, Types.Uri)
+
+ field(:likes, {:array, :string}, default: [])
+ field(:announcements, {:array, :string}, default: [])
+
+ # see if needed
+ field(:conversation, :string)
+ field(:context_id, :string)
+ end
+
+ def cast_and_validate(data) do
+ data
+ |> cast_data()
+ |> validate_data()
+ end
+
+ def cast_data(data) do
+ %__MODULE__{}
+ |> cast(data, __schema__(:fields))
+ end
+
+ def validate_data(data_cng) do
+ data_cng
+ |> validate_inclusion(:type, ["Note"])
+ |> validate_required([:id, :actor, :to, :cc, :type, :content, :context])
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/types/date_time.ex b/lib/pleroma/web/activity_pub/object_validators/types/date_time.ex
new file mode 100644
index 000000000..4f412fcde
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/types/date_time.ex
@@ -0,0 +1,34 @@
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.DateTime do
+ @moduledoc """
+ The AP standard defines the date fields in AP as xsd:DateTime. Elixir's
+ DateTime can't parse this, but it can parse the related iso8601. This
+ module punches the date until it looks like iso8601 and normalizes to
+ it.
+
+ DateTimes without a timezone offset are treated as UTC.
+
+ Reference: https://www.w3.org/TR/activitystreams-vocabulary/#dfn-published
+ """
+ use Ecto.Type
+
+ def type, do: :string
+
+ def cast(datetime) when is_binary(datetime) do
+ with {:ok, datetime, _} <- DateTime.from_iso8601(datetime) do
+ {:ok, DateTime.to_iso8601(datetime)}
+ else
+ {:error, :missing_offset} -> cast("#{datetime}Z")
+ _e -> :error
+ end
+ end
+
+ def cast(_), do: :error
+
+ def dump(data) do
+ {:ok, data}
+ end
+
+ def load(data) do
+ {:ok, data}
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/types/object_id.ex b/lib/pleroma/web/activity_pub/object_validators/types/object_id.ex
new file mode 100644
index 000000000..f71f76370
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/types/object_id.ex
@@ -0,0 +1,23 @@
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.ObjectID do
+ use Ecto.Type
+
+ def type, do: :string
+
+ def cast(object) when is_binary(object) do
+ # Host has to be present and scheme has to be an http scheme (for now)
+ case URI.parse(object) do
+ %URI{host: nil} -> :error
+ %URI{host: ""} -> :error
+ %URI{scheme: scheme} when scheme in ["https", "http"] -> {:ok, object}
+ _ -> :error
+ end
+ end
+
+ def cast(%{"id" => object}), do: cast(object)
+
+ def cast(_), do: :error
+
+ def dump(data), do: {:ok, data}
+
+ def load(data), do: {:ok, data}
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/types/recipients.ex b/lib/pleroma/web/activity_pub/object_validators/types/recipients.ex
new file mode 100644
index 000000000..48fe61e1a
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/types/recipients.ex
@@ -0,0 +1,34 @@
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.Recipients do
+ use Ecto.Type
+
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types.ObjectID
+
+ def type, do: {:array, ObjectID}
+
+ def cast(object) when is_binary(object) do
+ cast([object])
+ end
+
+ def cast(data) when is_list(data) do
+ data
+ |> Enum.reduce({:ok, []}, fn element, acc ->
+ case {acc, ObjectID.cast(element)} do
+ {:error, _} -> :error
+ {_, :error} -> :error
+ {{:ok, list}, {:ok, id}} -> {:ok, [id | list]}
+ end
+ end)
+ end
+
+ def cast(_) do
+ :error
+ end
+
+ def dump(data) do
+ {:ok, data}
+ end
+
+ def load(data) do
+ {:ok, data}
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/types/uri.ex b/lib/pleroma/web/activity_pub/object_validators/types/uri.ex
new file mode 100644
index 000000000..24845bcc0
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/types/uri.ex
@@ -0,0 +1,20 @@
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.Types.Uri do
+ use Ecto.Type
+
+ def type, do: :string
+
+ def cast(uri) when is_binary(uri) do
+ case URI.parse(uri) do
+ %URI{host: nil} -> :error
+ %URI{host: ""} -> :error
+ %URI{scheme: scheme} when scheme in ["https", "http"] -> {:ok, uri}
+ _ -> :error
+ end
+ end
+
+ def cast(_), do: :error
+
+ def dump(data), do: {:ok, data}
+
+ def load(data), do: {:ok, data}
+end
diff --git a/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex b/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex
new file mode 100644
index 000000000..d0ba418e8
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/object_validators/undo_validator.ex
@@ -0,0 +1,62 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.UndoValidator do
+ use Ecto.Schema
+
+ alias Pleroma.Activity
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+
+ import Ecto.Changeset
+ import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations
+
+ @primary_key false
+
+ embedded_schema do
+ field(:id, Types.ObjectID, primary_key: true)
+ field(:type, :string)
+ field(:object, Types.ObjectID)
+ field(:actor, Types.ObjectID)
+ field(:to, {:array, :string}, default: [])
+ field(:cc, {:array, :string}, default: [])
+ end
+
+ def cast_and_validate(data) do
+ data
+ |> cast_data()
+ |> validate_data()
+ end
+
+ def cast_data(data) do
+ %__MODULE__{}
+ |> changeset(data)
+ end
+
+ def changeset(struct, data) do
+ struct
+ |> cast(data, __schema__(:fields))
+ end
+
+ def validate_data(data_cng) do
+ data_cng
+ |> validate_inclusion(:type, ["Undo"])
+ |> validate_required([:id, :type, :object, :actor, :to, :cc])
+ |> validate_actor_presence()
+ |> validate_object_presence()
+ |> validate_undo_rights()
+ end
+
+ def validate_undo_rights(cng) do
+ actor = get_field(cng, :actor)
+ object = get_field(cng, :object)
+
+ with %Activity{data: %{"actor" => object_actor}} <- Activity.get_by_ap_id(object),
+ true <- object_actor != actor do
+ cng
+ |> add_error(:actor, "not the same as object actor")
+ else
+ _ -> cng
+ end
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/pipeline.ex b/lib/pleroma/web/activity_pub/pipeline.ex
new file mode 100644
index 000000000..657cdfdb1
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/pipeline.ex
@@ -0,0 +1,59 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.Pipeline do
+ alias Pleroma.Activity
+ alias Pleroma.Object
+ alias Pleroma.Repo
+ alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.MRF
+ alias Pleroma.Web.ActivityPub.ObjectValidator
+ alias Pleroma.Web.ActivityPub.SideEffects
+ alias Pleroma.Web.Federator
+
+ @spec common_pipeline(map(), keyword()) ::
+ {:ok, Activity.t() | Object.t(), keyword()} | {:error, any()}
+ def common_pipeline(object, meta) do
+ case Repo.transaction(fn -> do_common_pipeline(object, meta) end) do
+ {:ok, value} ->
+ value
+
+ {:error, e} ->
+ {:error, e}
+ end
+ end
+
+ def do_common_pipeline(object, meta) do
+ with {_, {:ok, validated_object, meta}} <-
+ {:validate_object, ObjectValidator.validate(object, meta)},
+ {_, {:ok, mrfd_object}} <- {:mrf_object, MRF.filter(validated_object)},
+ {_, {:ok, activity, meta}} <-
+ {:persist_object, ActivityPub.persist(mrfd_object, meta)},
+ {_, {:ok, activity, meta}} <-
+ {:execute_side_effects, SideEffects.handle(activity, meta)},
+ {_, {:ok, _}} <- {:federation, maybe_federate(activity, meta)} do
+ {:ok, activity, meta}
+ else
+ {:mrf_object, {:reject, _}} -> {:ok, nil, meta}
+ e -> {:error, e}
+ end
+ end
+
+ defp maybe_federate(%Object{}, _), do: {:ok, :not_federated}
+
+ defp maybe_federate(%Activity{} = activity, meta) do
+ with {:ok, local} <- Keyword.fetch(meta, :local) do
+ do_not_federate = meta[:do_not_federate]
+
+ if !do_not_federate && local do
+ Federator.publish(activity)
+ {:ok, :federated}
+ else
+ {:ok, :not_federated}
+ end
+ else
+ _e -> {:error, :badarg}
+ end
+ end
+end
diff --git a/lib/pleroma/web/activity_pub/publisher.ex b/lib/pleroma/web/activity_pub/publisher.ex
index 2aac4e8b9..b70cbd043 100644
--- a/lib/pleroma/web/activity_pub/publisher.ex
+++ b/lib/pleroma/web/activity_pub/publisher.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.Publisher do
@@ -9,6 +9,7 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
alias Pleroma.HTTP
alias Pleroma.Instances
alias Pleroma.Object
+ alias Pleroma.Repo
alias Pleroma.User
alias Pleroma.Web.ActivityPub.Relay
alias Pleroma.Web.ActivityPub.Transmogrifier
@@ -47,7 +48,7 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
* `id`: the ActivityStreams URI of the message
"""
def publish_one(%{inbox: inbox, json: json, actor: %User{} = actor, id: id} = params) do
- Logger.info("Federating #{id} to #{inbox}")
+ Logger.debug("Federating #{id} to #{inbox}")
%{host: host, path: path} = URI.parse(inbox)
digest = "SHA-256=" <> (:crypto.hash(:sha256, json) |> Base.encode64())
@@ -140,8 +141,8 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
|> Enum.map(& &1.ap_id)
end
- defp maybe_use_sharedinbox(%User{info: %{source_data: data}}),
- do: (is_map(data["endpoints"]) && Map.get(data["endpoints"], "sharedInbox")) || data["inbox"]
+ defp maybe_use_sharedinbox(%User{shared_inbox: nil, inbox: inbox}), do: inbox
+ defp maybe_use_sharedinbox(%User{shared_inbox: shared_inbox}), do: shared_inbox
@doc """
Determine a user inbox to use based on heuristics. These heuristics
@@ -156,7 +157,7 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
"""
def determine_inbox(
%Activity{data: activity_data},
- %User{info: %{source_data: data}} = user
+ %User{inbox: inbox} = user
) do
to = activity_data["to"] || []
cc = activity_data["cc"] || []
@@ -173,7 +174,7 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
maybe_use_sharedinbox(user)
true ->
- data["inbox"]
+ inbox
end
end
@@ -188,31 +189,34 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
recipients = recipients(actor, activity)
- recipients
- |> Enum.filter(&User.ap_enabled?/1)
- |> Enum.map(fn %{info: %{source_data: data}} -> data["inbox"] end)
- |> Enum.filter(fn inbox -> should_federate?(inbox, public) end)
- |> Instances.filter_reachable()
- |> Enum.each(fn {inbox, unreachable_since} ->
- %User{ap_id: ap_id} =
- Enum.find(recipients, fn %{info: %{source_data: data}} -> data["inbox"] == inbox end)
-
- # Get all the recipients on the same host and add them to cc. Otherwise, a remote
- # instance would only accept a first message for the first recipient and ignore the rest.
- cc = get_cc_ap_ids(ap_id, recipients)
-
- json =
- data
- |> Map.put("cc", cc)
- |> Jason.encode!()
-
- Pleroma.Web.Federator.Publisher.enqueue_one(__MODULE__, %{
- inbox: inbox,
- json: json,
- actor_id: actor.id,
- id: activity.data["id"],
- unreachable_since: unreachable_since
- })
+ inboxes =
+ recipients
+ |> Enum.filter(&User.ap_enabled?/1)
+ |> Enum.map(fn actor -> actor.inbox end)
+ |> Enum.filter(fn inbox -> should_federate?(inbox, public) end)
+ |> Instances.filter_reachable()
+
+ Repo.checkout(fn ->
+ Enum.each(inboxes, fn {inbox, unreachable_since} ->
+ %User{ap_id: ap_id} = Enum.find(recipients, fn actor -> actor.inbox == inbox end)
+
+ # Get all the recipients on the same host and add them to cc. Otherwise, a remote
+ # instance would only accept a first message for the first recipient and ignore the rest.
+ cc = get_cc_ap_ids(ap_id, recipients)
+
+ json =
+ data
+ |> Map.put("cc", cc)
+ |> Jason.encode!()
+
+ Pleroma.Web.Federator.Publisher.enqueue_one(__MODULE__, %{
+ inbox: inbox,
+ json: json,
+ actor_id: actor.id,
+ id: activity.data["id"],
+ unreachable_since: unreachable_since
+ })
+ end)
end)
end
@@ -223,7 +227,7 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
public = is_public?(activity)
if public && Config.get([:instance, :allow_relay]) do
- Logger.info(fn -> "Relaying #{activity.data["id"]} out" end)
+ Logger.debug(fn -> "Relaying #{activity.data["id"]} out" end)
Relay.publish(activity)
end
@@ -259,6 +263,10 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
"rel" => "self",
"type" => "application/ld+json; profile=\"https://www.w3.org/ns/activitystreams\"",
"href" => user.ap_id
+ },
+ %{
+ "rel" => "http://ostatus.org/schema/1.0/subscribe",
+ "template" => "#{Pleroma.Web.base_url()}/ostatus_subscribe?acct={uri}"
}
]
end
diff --git a/lib/pleroma/web/activity_pub/relay.ex b/lib/pleroma/web/activity_pub/relay.ex
index de80612f1..729c23af7 100644
--- a/lib/pleroma/web/activity_pub/relay.ex
+++ b/lib/pleroma/web/activity_pub/relay.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.Relay do
@@ -9,15 +9,20 @@ defmodule Pleroma.Web.ActivityPub.Relay do
alias Pleroma.Web.ActivityPub.ActivityPub
require Logger
+ @relay_nickname "relay"
+
def get_actor do
actor =
- "#{Pleroma.Web.Endpoint.url()}/relay"
- |> User.get_or_create_service_actor_by_ap_id()
+ relay_ap_id()
+ |> User.get_or_create_service_actor_by_ap_id(@relay_nickname)
- {:ok, actor} = User.update_info(actor, &User.Info.set_invisible(&1, true))
actor
end
+ def relay_ap_id do
+ "#{Pleroma.Web.Endpoint.url()}/relay"
+ end
+
@spec follow(String.t()) :: {:ok, Activity.t()} | {:error, any()}
def follow(target_instance) do
with %User{} = local_user <- get_actor(),
@@ -55,14 +60,28 @@ defmodule Pleroma.Web.ActivityPub.Relay do
def publish(_), do: {:error, "Not implemented"}
- @spec list() :: {:ok, [String.t()]} | {:error, any()}
- def list do
- with %User{following: following} = _user <- get_actor() do
- list =
- following
+ @spec list(boolean()) :: {:ok, [String.t()]} | {:error, any()}
+ def list(with_not_accepted \\ false) do
+ with %User{} = user <- get_actor() do
+ accepted =
+ user
+ |> User.following()
|> Enum.map(fn entry -> URI.parse(entry).host end)
|> Enum.uniq()
+ list =
+ if with_not_accepted do
+ without_accept =
+ user
+ |> Pleroma.Activity.following_requests_for_actor()
+ |> Enum.map(fn a -> URI.parse(a.data["object"]).host <> " (no Accept received)" end)
+ |> Enum.uniq()
+
+ accepted ++ without_accept
+ else
+ accepted
+ end
+
{:ok, list}
else
error -> format_error(error)
diff --git a/lib/pleroma/web/activity_pub/side_effects.ex b/lib/pleroma/web/activity_pub/side_effects.ex
new file mode 100644
index 000000000..bfc2ab845
--- /dev/null
+++ b/lib/pleroma/web/activity_pub/side_effects.ex
@@ -0,0 +1,133 @@
+defmodule Pleroma.Web.ActivityPub.SideEffects do
+ @moduledoc """
+ This module looks at an inserted object and executes the side effects that it
+ implies. For example, a `Like` activity will increase the like count on the
+ liked object, a `Follow` activity will add the user to the follower
+ collection, and so on.
+ """
+ alias Pleroma.Activity
+ alias Pleroma.Notification
+ alias Pleroma.Object
+ alias Pleroma.Repo
+ alias Pleroma.User
+ alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.Utils
+
+ def handle(object, meta \\ [])
+
+ # Tasks this handles:
+ # - Add like to object
+ # - Set up notification
+ def handle(%{data: %{"type" => "Like"}} = object, meta) do
+ liked_object = Object.get_by_ap_id(object.data["object"])
+ Utils.add_like_to_object(object, liked_object)
+
+ Notification.create_notifications(object)
+
+ {:ok, object, meta}
+ end
+
+ def handle(%{data: %{"type" => "Undo", "object" => undone_object}} = object, meta) do
+ with undone_object <- Activity.get_by_ap_id(undone_object),
+ :ok <- handle_undoing(undone_object) do
+ {:ok, object, meta}
+ end
+ end
+
+ # Tasks this handles:
+ # - Add reaction to object
+ # - Set up notification
+ def handle(%{data: %{"type" => "EmojiReact"}} = object, meta) do
+ reacted_object = Object.get_by_ap_id(object.data["object"])
+ Utils.add_emoji_reaction_to_object(object, reacted_object)
+
+ Notification.create_notifications(object)
+
+ {:ok, object, meta}
+ end
+
+ # Tasks this handles:
+ # - Delete and unpins the create activity
+ # - Replace object with Tombstone
+ # - Set up notification
+ # - Reduce the user note count
+ # - Reduce the reply count
+ # - Stream out the activity
+ def handle(%{data: %{"type" => "Delete", "object" => deleted_object}} = object, meta) do
+ deleted_object =
+ Object.normalize(deleted_object, false) || User.get_cached_by_ap_id(deleted_object)
+
+ result =
+ case deleted_object do
+ %Object{} ->
+ with {:ok, deleted_object, activity} <- Object.delete(deleted_object),
+ %User{} = user <- User.get_cached_by_ap_id(deleted_object.data["actor"]) do
+ User.remove_pinnned_activity(user, activity)
+
+ {:ok, user} = ActivityPub.decrease_note_count_if_public(user, deleted_object)
+
+ if in_reply_to = deleted_object.data["inReplyTo"] do
+ Object.decrease_replies_count(in_reply_to)
+ end
+
+ ActivityPub.stream_out(object)
+ ActivityPub.stream_out_participations(deleted_object, user)
+ :ok
+ end
+
+ %User{} ->
+ with {:ok, _} <- User.delete(deleted_object) do
+ :ok
+ end
+ end
+
+ if result == :ok do
+ Notification.create_notifications(object)
+ {:ok, object, meta}
+ else
+ {:error, result}
+ end
+ end
+
+ # Nothing to do
+ def handle(object, meta) do
+ {:ok, object, meta}
+ end
+
+ def handle_undoing(%{data: %{"type" => "Like"}} = object) do
+ with %Object{} = liked_object <- Object.get_by_ap_id(object.data["object"]),
+ {:ok, _} <- Utils.remove_like_from_object(object, liked_object),
+ {:ok, _} <- Repo.delete(object) do
+ :ok
+ end
+ end
+
+ def handle_undoing(%{data: %{"type" => "EmojiReact"}} = object) do
+ with %Object{} = reacted_object <- Object.get_by_ap_id(object.data["object"]),
+ {:ok, _} <- Utils.remove_emoji_reaction_from_object(object, reacted_object),
+ {:ok, _} <- Repo.delete(object) do
+ :ok
+ end
+ end
+
+ def handle_undoing(%{data: %{"type" => "Announce"}} = object) do
+ with %Object{} = liked_object <- Object.get_by_ap_id(object.data["object"]),
+ {:ok, _} <- Utils.remove_announce_from_object(object, liked_object),
+ {:ok, _} <- Repo.delete(object) do
+ :ok
+ end
+ end
+
+ def handle_undoing(
+ %{data: %{"type" => "Block", "actor" => blocker, "object" => blocked}} = object
+ ) do
+ with %User{} = blocker <- User.get_cached_by_ap_id(blocker),
+ %User{} = blocked <- User.get_cached_by_ap_id(blocked),
+ {:ok, _} <- User.unblock(blocker, blocked),
+ {:ok, _} <- Repo.delete(object) do
+ :ok
+ end
+ end
+
+ def handle_undoing(object), do: {:error, ["don't know how to handle", object]}
+end
diff --git a/lib/pleroma/web/activity_pub/transmogrifier.ex b/lib/pleroma/web/activity_pub/transmogrifier.ex
index 4a250d131..80701bb63 100644
--- a/lib/pleroma/web/activity_pub/transmogrifier.ex
+++ b/lib/pleroma/web/activity_pub/transmogrifier.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.Transmogrifier do
@@ -7,11 +7,17 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
A module to handle coding from internal to wire ActivityPub and back.
"""
alias Pleroma.Activity
+ alias Pleroma.EarmarkRenderer
+ alias Pleroma.FollowingRelationship
alias Pleroma.Object
alias Pleroma.Object.Containment
alias Pleroma.Repo
alias Pleroma.User
alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.Builder
+ alias Pleroma.Web.ActivityPub.ObjectValidator
+ alias Pleroma.Web.ActivityPub.ObjectValidators.Types
+ alias Pleroma.Web.ActivityPub.Pipeline
alias Pleroma.Web.ActivityPub.Utils
alias Pleroma.Web.ActivityPub.Visibility
alias Pleroma.Web.Federator
@@ -39,6 +45,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
|> fix_addressing
|> fix_summary
|> fix_type(options)
+ |> fix_content
end
def fix_summary(%{"summary" => nil} = object) do
@@ -155,10 +162,11 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
when not is_nil(in_reply_to) do
in_reply_to_id = prepare_in_reply_to(in_reply_to)
object = Map.put(object, "inReplyToAtomUri", in_reply_to_id)
+ depth = (options[:depth] || 0) + 1
- if Federator.allowed_incoming_reply_depth?(options[:depth]) do
+ if Federator.allowed_thread_distance?(depth) do
with {:ok, replied_object} <- get_obj_helper(in_reply_to_id, options),
- %Activity{} = _ <- Activity.get_create_by_object_ap_id(replied_object.data["id"]) do
+ %Activity{} <- Activity.get_create_by_object_ap_id(replied_object.data["id"]) do
object
|> Map.put("inReplyTo", replied_object.data["id"])
|> Map.put("inReplyToAtomUri", object["inReplyToAtomUri"] || in_reply_to_id)
@@ -200,16 +208,46 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
|> Map.put("conversation", context)
end
+ defp add_if_present(map, _key, nil), do: map
+
+ defp add_if_present(map, key, value) do
+ Map.put(map, key, value)
+ end
+
def fix_attachments(%{"attachment" => attachment} = object) when is_list(attachment) do
attachments =
Enum.map(attachment, fn data ->
- media_type = data["mediaType"] || data["mimeType"]
- href = data["url"] || data["href"]
- url = [%{"type" => "Link", "mediaType" => media_type, "href" => href}]
-
- data
- |> Map.put("mediaType", media_type)
- |> Map.put("url", url)
+ url =
+ cond do
+ is_list(data["url"]) -> List.first(data["url"])
+ is_map(data["url"]) -> data["url"]
+ true -> nil
+ end
+
+ media_type =
+ cond do
+ is_map(url) && is_binary(url["mediaType"]) -> url["mediaType"]
+ is_binary(data["mediaType"]) -> data["mediaType"]
+ is_binary(data["mimeType"]) -> data["mimeType"]
+ true -> nil
+ end
+
+ href =
+ cond do
+ is_map(url) && is_binary(url["href"]) -> url["href"]
+ is_binary(data["url"]) -> data["url"]
+ is_binary(data["href"]) -> data["href"]
+ end
+
+ attachment_url =
+ %{"href" => href}
+ |> add_if_present("mediaType", media_type)
+ |> add_if_present("type", Map.get(url || %{}, "type"))
+
+ %{"url" => [attachment_url]}
+ |> add_if_present("mediaType", media_type)
+ |> add_if_present("type", data["type"])
+ |> add_if_present("name", data["name"])
end)
Map.put(object, "attachment", attachments)
@@ -227,7 +265,8 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
Map.put(object, "url", url["href"])
end
- def fix_url(%{"type" => "Video", "url" => url} = object) when is_list(url) do
+ def fix_url(%{"type" => object_type, "url" => url} = object)
+ when object_type in ["Video", "Audio"] and is_list(url) do
first_element = Enum.at(url, 0)
link_element = Enum.find(url, fn x -> is_map(x) and x["mimeType"] == "text/html" end)
@@ -311,7 +350,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
def fix_type(%{"inReplyTo" => reply_id, "name" => _} = object, options)
when is_binary(reply_id) do
- with true <- Federator.allowed_incoming_reply_depth?(options[:depth]),
+ with true <- Federator.allowed_thread_distance?(options[:depth]),
{:ok, %{data: %{"type" => "Question"} = _} = _} <- get_obj_helper(reply_id, options) do
Map.put(object, "type", "Answer")
else
@@ -321,6 +360,18 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
def fix_type(object, _), do: object
+ defp fix_content(%{"mediaType" => "text/markdown", "content" => content} = object)
+ when is_binary(content) do
+ html_content =
+ content
+ |> Earmark.as_html!(%Earmark.Options{renderer: EarmarkRenderer})
+ |> Pleroma.HTML.filter_tags()
+
+ Map.merge(object, %{"content" => html_content, "mediaType" => "text/html"})
+ end
+
+ defp fix_content(object), do: object
+
defp mastodon_follow_hack(%{"id" => id, "actor" => follower_id}, followed) do
with true <- id =~ "follows",
%User{local: true} = follower <- User.get_cached_by_ap_id(follower_id),
@@ -386,7 +437,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
def handle_incoming(%{"id" => nil}, _options), do: :error
def handle_incoming(%{"id" => ""}, _options), do: :error
# length of https:// = 8, should validate better, but good enough for now.
- def handle_incoming(%{"id" => id}, _options) when not (is_binary(id) and length(id) > 8),
+ def handle_incoming(%{"id" => id}, _options) when is_binary(id) and byte_size(id) < 8,
do: :error
# TODO: validate those with a Ecto scheme
@@ -396,7 +447,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
%{"type" => "Create", "object" => %{"type" => objtype} = object} = data,
options
)
- when objtype in ["Article", "Note", "Video", "Page", "Question", "Answer"] do
+ when objtype in ["Article", "Event", "Note", "Video", "Page", "Question", "Answer", "Audio"] do
actor = Containment.get_actor(data)
data =
@@ -405,8 +456,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
with nil <- Activity.get_create_by_object_ap_id(object["id"]),
{:ok, %User{} = user} <- User.get_or_fetch_by_ap_id(data["actor"]) do
- options = Keyword.put(options, :depth, (options[:depth] || 0) + 1)
- object = fix_object(data["object"], options)
+ object = fix_object(object, options)
params = %{
to: data["to"],
@@ -423,7 +473,20 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
])
}
- ActivityPub.create(params)
+ with {:ok, created_activity} <- ActivityPub.create(params) do
+ reply_depth = (options[:depth] || 0) + 1
+
+ if Federator.allowed_thread_distance?(reply_depth) do
+ for reply_id <- replies(object) do
+ Pleroma.Workers.RemoteFetcherWorker.enqueue("fetch_remote", %{
+ "id" => reply_id,
+ "depth" => reply_depth
+ })
+ end
+ end
+
+ {:ok, created_activity}
+ end
else
%Activity{} = activity -> {:ok, activity}
_e -> :error
@@ -441,7 +504,8 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
|> fix_addressing
with {:ok, %User{} = user} <- User.get_or_fetch_by_ap_id(data["actor"]) do
- options = Keyword.put(options, :depth, (options[:depth] || 0) + 1)
+ reply_depth = (options[:depth] || 0) + 1
+ options = Keyword.put(options, :depth, reply_depth)
object = fix_object(object, options)
params = %{
@@ -474,7 +538,9 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
{_, false} <- {:user_locked, User.locked?(followed)},
{_, {:ok, follower}} <- {:follow, User.follow(follower, followed)},
{_, {:ok, _}} <-
- {:follow_state_update, Utils.update_follow_state_for_all(activity, "accept")} do
+ {:follow_state_update, Utils.update_follow_state_for_all(activity, "accept")},
+ {:ok, _relationship} <-
+ FollowingRelationship.update(follower, followed, :follow_accept) do
ActivityPub.accept(%{
to: [follower.ap_id],
actor: followed,
@@ -484,6 +550,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
else
{:user_blocked, true} ->
{:ok, _} = Utils.update_follow_state_for_all(activity, "reject")
+ {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_reject)
ActivityPub.reject(%{
to: [follower.ap_id],
@@ -494,6 +561,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
{:follow, {:error, _}} ->
{:ok, _} = Utils.update_follow_state_for_all(activity, "reject")
+ {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_reject)
ActivityPub.reject(%{
to: [follower.ap_id],
@@ -503,6 +571,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
})
{:user_locked, true} ->
+ {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_pending)
:noop
end
@@ -522,7 +591,10 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
{:ok, follow_activity} <- get_follow_activity(follow_object, followed),
{:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "accept"),
%User{local: true} = follower <- User.get_cached_by_ap_id(follow_activity.data["actor"]),
- {:ok, _follower} = User.follow(follower, followed) do
+ {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_accept) do
+ User.update_follower_count(followed)
+ User.update_following_count(follower)
+
ActivityPub.accept(%{
to: follow_activity.data["to"],
type: "Accept",
@@ -532,7 +604,8 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
activity_id: id
})
else
- _e -> :error
+ _e ->
+ :error
end
end
@@ -545,6 +618,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
{:ok, follow_activity} <- get_follow_activity(follow_object, followed),
{:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "reject"),
%User{local: true} = follower <- User.get_cached_by_ap_id(follow_activity.data["actor"]),
+ {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_reject),
{:ok, activity} <-
ActivityPub.reject(%{
to: follow_activity.data["to"],
@@ -554,25 +628,47 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
local: false,
activity_id: id
}) do
- User.unfollow(follower, followed)
-
{:ok, activity}
else
_e -> :error
end
end
+ @misskey_reactions %{
+ "like" => "👍",
+ "love" => "❤️",
+ "laugh" => "😆",
+ "hmm" => "🤔",
+ "surprise" => "😮",
+ "congrats" => "🎉",
+ "angry" => "💢",
+ "confused" => "😥",
+ "rip" => "😇",
+ "pudding" => "🍮",
+ "star" => "⭐"
+ }
+
+ @doc "Rewrite misskey likes into EmojiReacts"
def handle_incoming(
- %{"type" => "Like", "object" => object_id, "actor" => _actor, "id" => id} = data,
- _options
+ %{
+ "type" => "Like",
+ "_misskey_reaction" => reaction
+ } = data,
+ options
) do
- with actor <- Containment.get_actor(data),
- {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor),
- {:ok, object} <- get_obj_helper(object_id),
- {:ok, activity, _object} <- ActivityPub.like(actor, object, id, false) do
+ data
+ |> Map.put("type", "EmojiReact")
+ |> Map.put("content", @misskey_reactions[reaction] || reaction)
+ |> handle_incoming(options)
+ end
+
+ def handle_incoming(%{"type" => type} = data, _options) when type in ["Like", "EmojiReact"] do
+ with :ok <- ObjectValidator.fetch_actor_and_object(data),
+ {:ok, activity, _meta} <-
+ Pipeline.common_pipeline(data, local: false) do
{:ok, activity}
else
- _e -> :error
+ e -> {:error, e}
end
end
@@ -605,23 +701,8 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
with %User{ap_id: ^actor_id} = actor <- User.get_cached_by_ap_id(object["id"]) do
{:ok, new_user_data} = ActivityPub.user_data_from_user_object(object)
- banner = new_user_data[:info][:banner]
- locked = new_user_data[:info][:locked] || false
- attachment = get_in(new_user_data, [:info, :source_data, "attachment"]) || []
- invisible = new_user_data[:info][:invisible] || false
-
- fields =
- attachment
- |> Enum.filter(fn %{"type" => t} -> t == "PropertyValue" end)
- |> Enum.map(fn fields -> Map.take(fields, ["name", "value"]) end)
-
- update_data =
- new_user_data
- |> Map.take([:name, :bio, :avatar])
- |> Map.put(:info, %{banner: banner, locked: locked, fields: fields, invisible: invisible})
-
actor
- |> User.upgrade_changeset(update_data, true)
+ |> User.remote_user_changeset(new_user_data)
|> User.update_and_set_cache()
ActivityPub.update(%{
@@ -639,55 +720,25 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
end
end
- # TODO: We presently assume that any actor on the same origin domain as the object being
- # deleted has the rights to delete that object. A better way to validate whether or not
- # the object should be deleted is to refetch the object URI, which should return either
- # an error or a tombstone. This would allow us to verify that a deletion actually took
- # place.
def handle_incoming(
- %{"type" => "Delete", "object" => object_id, "actor" => actor, "id" => id} = data,
+ %{"type" => "Delete"} = data,
_options
) do
- object_id = Utils.get_ap_id(object_id)
-
- with actor <- Containment.get_actor(data),
- {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor),
- {:ok, object} <- get_obj_helper(object_id),
- :ok <- Containment.contain_origin(actor.ap_id, object.data),
- {:ok, activity} <-
- ActivityPub.delete(object, local: false, activity_id: id, actor: actor.ap_id) do
+ with {:ok, activity, _} <- Pipeline.common_pipeline(data, local: false) do
{:ok, activity}
else
- nil ->
- case User.get_cached_by_ap_id(object_id) do
- %User{ap_id: ^actor} = user ->
- User.delete(user)
-
- nil ->
- :error
+ {:error, {:validate_object, _}} = e ->
+ # Check if we have a create activity for this
+ with {:ok, object_id} <- Types.ObjectID.cast(data["object"]),
+ %Activity{data: %{"actor" => actor}} <-
+ Activity.create_by_object_ap_id(object_id) |> Repo.one(),
+ # We have one, insert a tombstone and retry
+ {:ok, tombstone_data, _} <- Builder.tombstone(actor, object_id),
+ {:ok, _tombstone} <- Object.create(tombstone_data) do
+ handle_incoming(data)
+ else
+ _ -> e
end
-
- _e ->
- :error
- end
- end
-
- def handle_incoming(
- %{
- "type" => "Undo",
- "object" => %{"type" => "Announce", "object" => object_id},
- "actor" => _actor,
- "id" => id
- } = data,
- _options
- ) do
- with actor <- Containment.get_actor(data),
- {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor),
- {:ok, object} <- get_obj_helper(object_id),
- {:ok, activity, _} <- ActivityPub.unannounce(actor, object, id, false) do
- {:ok, activity}
- else
- _e -> :error
end
end
@@ -713,17 +764,29 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
def handle_incoming(
%{
"type" => "Undo",
- "object" => %{"type" => "Block", "object" => blocked},
- "actor" => blocker,
- "id" => id
- } = _data,
+ "object" => %{"type" => type}
+ } = data,
_options
- ) do
- with %User{local: true} = blocked <- User.get_cached_by_ap_id(blocked),
- {:ok, %User{} = blocker} <- User.get_or_fetch_by_ap_id(blocker),
- {:ok, activity} <- ActivityPub.unblock(blocker, blocked, id, false) do
- User.unblock(blocker, blocked)
+ )
+ when type in ["Like", "EmojiReact", "Announce", "Block"] do
+ with {:ok, activity, _} <- Pipeline.common_pipeline(data, local: false) do
{:ok, activity}
+ end
+ end
+
+ # For Undos that don't have the complete object attached, try to find it in our database.
+ def handle_incoming(
+ %{
+ "type" => "Undo",
+ "object" => object
+ } = activity,
+ options
+ )
+ when is_binary(object) do
+ with %Activity{data: data} <- Activity.get_by_ap_id(object) do
+ activity
+ |> Map.put("object", data)
+ |> handle_incoming(options)
else
_e -> :error
end
@@ -746,36 +809,17 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
def handle_incoming(
%{
- "type" => "Undo",
- "object" => %{"type" => "Like", "object" => object_id},
- "actor" => _actor,
- "id" => id
- } = data,
+ "type" => "Move",
+ "actor" => origin_actor,
+ "object" => origin_actor,
+ "target" => target_actor
+ },
_options
) do
- with actor <- Containment.get_actor(data),
- {:ok, %User{} = actor} <- User.get_or_fetch_by_ap_id(actor),
- {:ok, object} <- get_obj_helper(object_id),
- {:ok, activity, _, _} <- ActivityPub.unlike(actor, object, id, false) do
- {:ok, activity}
- else
- _e -> :error
- end
- end
-
- # For Undos that don't have the complete object attached, try to find it in our database.
- def handle_incoming(
- %{
- "type" => "Undo",
- "object" => object
- } = activity,
- options
- )
- when is_binary(object) do
- with %Activity{data: data} <- Activity.get_by_ap_id(object) do
- activity
- |> Map.put("object", data)
- |> handle_incoming(options)
+ with %User{} = origin_user <- User.get_cached_by_ap_id(origin_actor),
+ {:ok, %User{} = target_user} <- User.get_or_fetch_by_ap_id(target_actor),
+ true <- origin_actor in target_user.also_known_as do
+ ActivityPub.move(origin_user, target_user, false)
else
_e -> :error
end
@@ -825,6 +869,50 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
def set_reply_to_uri(obj), do: obj
+ @doc """
+ Serialized Mastodon-compatible `replies` collection containing _self-replies_.
+ Based on Mastodon's ActivityPub::NoteSerializer#replies.
+ """
+ def set_replies(obj_data) do
+ replies_uris =
+ with limit when limit > 0 <-
+ Pleroma.Config.get([:activitypub, :note_replies_output_limit], 0),
+ %Object{} = object <- Object.get_cached_by_ap_id(obj_data["id"]) do
+ object
+ |> Object.self_replies()
+ |> select([o], fragment("?->>'id'", o.data))
+ |> limit(^limit)
+ |> Repo.all()
+ else
+ _ -> []
+ end
+
+ set_replies(obj_data, replies_uris)
+ end
+
+ defp set_replies(obj, []) do
+ obj
+ end
+
+ defp set_replies(obj, replies_uris) do
+ replies_collection = %{
+ "type" => "Collection",
+ "items" => replies_uris
+ }
+
+ Map.merge(obj, %{"replies" => replies_collection})
+ end
+
+ def replies(%{"replies" => %{"first" => %{"items" => items}}}) when not is_nil(items) do
+ items
+ end
+
+ def replies(%{"replies" => %{"items" => items}}) when not is_nil(items) do
+ items
+ end
+
+ def replies(_), do: []
+
# Prepares the object of an outgoing create activity.
def prepare_object(object) do
object
@@ -836,6 +924,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
|> prepare_attachments
|> set_conversation
|> set_reply_to_uri
+ |> set_replies
|> strip_internal_fields
|> strip_internal_tags
|> set_type
@@ -971,13 +1060,11 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
end
def add_mention_tags(object) do
- mentions =
- object
- |> Utils.get_notified_from_object()
- |> Enum.map(&build_mention_tag/1)
+ {enabled_receivers, disabled_receivers} = Utils.get_notified_from_object(object)
+ potential_receivers = enabled_receivers ++ disabled_receivers
+ mentions = Enum.map(potential_receivers, &build_mention_tag/1)
tags = object["tag"] || []
-
Map.put(object, "tag", tags ++ mentions)
end
@@ -985,9 +1072,9 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
%{"type" => "Mention", "href" => ap_id, "name" => "@#{nickname}"}
end
- def take_emoji_tags(%User{info: %{emoji: emoji} = _user_info} = _user) do
+ def take_emoji_tags(%User{emoji: emoji}) do
emoji
- |> Enum.flat_map(&Map.to_list/1)
+ |> Map.to_list()
|> Enum.map(&build_emoji_tag/1)
end
@@ -1016,6 +1103,10 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
Map.put(object, "conversation", object["context"])
end
+ def set_sensitive(%{"sensitive" => true} = object) do
+ object
+ end
+
def set_sensitive(object) do
tags = object["tag"] || []
Map.put(object, "sensitive", "nsfw" in tags)
@@ -1034,18 +1125,24 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
def prepare_attachments(object) do
attachments =
- (object["attachment"] || [])
+ object
+ |> Map.get("attachment", [])
|> Enum.map(fn data ->
[%{"mediaType" => media_type, "href" => href} | _] = data["url"]
- %{"url" => href, "mediaType" => media_type, "name" => data["name"], "type" => "Document"}
+
+ %{
+ "url" => href,
+ "mediaType" => media_type,
+ "name" => data["name"],
+ "type" => "Document"
+ }
end)
Map.put(object, "attachment", attachments)
end
- defp strip_internal_fields(object) do
- object
- |> Map.drop(Pleroma.Constants.object_internal_fields())
+ def strip_internal_fields(object) do
+ Map.drop(object, Pleroma.Constants.object_internal_fields())
end
defp strip_internal_tags(%{"tag" => tags} = object) do
@@ -1060,54 +1157,29 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
# we pass a fake user so that the followers collection is stripped away
old_follower_address = User.ap_followers(%User{nickname: user.nickname})
- q =
- from(
- u in User,
- where: ^old_follower_address in u.following,
- update: [
- set: [
- following:
- fragment(
- "array_replace(?,?,?)",
- u.following,
- ^old_follower_address,
- ^user.follower_address
- )
- ]
- ]
- )
-
- Repo.update_all(q, [])
-
- q =
- from(
- a in Activity,
- where: ^old_follower_address in a.recipients,
- update: [
- set: [
- recipients:
- fragment(
- "array_replace(?,?,?)",
- a.recipients,
- ^old_follower_address,
- ^user.follower_address
- )
- ]
+ from(
+ a in Activity,
+ where: ^old_follower_address in a.recipients,
+ update: [
+ set: [
+ recipients:
+ fragment(
+ "array_replace(?,?,?)",
+ a.recipients,
+ ^old_follower_address,
+ ^user.follower_address
+ )
]
- )
-
- Repo.update_all(q, [])
+ ]
+ )
+ |> Repo.update_all([])
end
def upgrade_user_from_ap_id(ap_id) do
with %User{local: false} = user <- User.get_cached_by_ap_id(ap_id),
{:ok, data} <- ActivityPub.fetch_and_prepare_user_from_ap_id(ap_id),
- already_ap <- User.ap_enabled?(user),
- {:ok, user} <- upgrade_user(user, data) do
- if not already_ap do
- TransmogrifierWorker.enqueue("user_upgrade", %{"user_id" => user.id})
- end
-
+ {:ok, user} <- update_user(user, data) do
+ TransmogrifierWorker.enqueue("user_upgrade", %{"user_id" => user.id})
{:ok, user}
else
%User{} = user -> {:ok, user}
@@ -1115,9 +1187,9 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
end
end
- defp upgrade_user(user, data) do
+ defp update_user(user, data) do
user
- |> User.upgrade_changeset(data, true)
+ |> User.remote_user_changeset(data)
|> User.update_and_set_cache()
end
diff --git a/lib/pleroma/web/activity_pub/utils.ex b/lib/pleroma/web/activity_pub/utils.ex
index 6b28df92c..f2375bcc4 100644
--- a/lib/pleroma/web/activity_pub/utils.ex
+++ b/lib/pleroma/web/activity_pub/utils.ex
@@ -1,17 +1,20 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.Utils do
alias Ecto.Changeset
alias Ecto.UUID
alias Pleroma.Activity
+ alias Pleroma.Config
alias Pleroma.Notification
alias Pleroma.Object
alias Pleroma.Repo
alias Pleroma.User
alias Pleroma.Web
+ alias Pleroma.Web.ActivityPub.ActivityPub
alias Pleroma.Web.ActivityPub.Visibility
+ alias Pleroma.Web.AdminAPI.AccountView
alias Pleroma.Web.Endpoint
alias Pleroma.Web.Router.Helpers
@@ -20,7 +23,17 @@ defmodule Pleroma.Web.ActivityPub.Utils do
require Logger
require Pleroma.Constants
- @supported_object_types ["Article", "Note", "Video", "Page", "Question", "Answer", "Audio"]
+ @supported_object_types [
+ "Article",
+ "Note",
+ "Event",
+ "Video",
+ "Page",
+ "Question",
+ "Answer",
+ "Audio"
+ ]
+ @strip_status_report_states ~w(closed resolved)
@supported_report_states ~w(open closed resolved)
@valid_visibilities ~w(public unlisted private direct)
@@ -33,8 +46,8 @@ defmodule Pleroma.Web.ActivityPub.Utils do
Map.put(params, "actor", get_ap_id(params["actor"]))
end
- @spec determine_explicit_mentions(map()) :: map()
- def determine_explicit_mentions(%{"tag" => tag} = _) when is_list(tag) do
+ @spec determine_explicit_mentions(map()) :: [any]
+ def determine_explicit_mentions(%{"tag" => tag}) when is_list(tag) do
Enum.flat_map(tag, fn
%{"type" => "Mention", "href" => href} -> [href]
_ -> []
@@ -49,26 +62,28 @@ defmodule Pleroma.Web.ActivityPub.Utils do
def determine_explicit_mentions(_), do: []
- @spec recipient_in_collection(any(), any()) :: boolean()
- defp recipient_in_collection(ap_id, coll) when is_binary(coll), do: ap_id == coll
- defp recipient_in_collection(ap_id, coll) when is_list(coll), do: ap_id in coll
- defp recipient_in_collection(_, _), do: false
+ @spec label_in_collection?(any(), any()) :: boolean()
+ defp label_in_collection?(ap_id, coll) when is_binary(coll), do: ap_id == coll
+ defp label_in_collection?(ap_id, coll) when is_list(coll), do: ap_id in coll
+ defp label_in_collection?(_, _), do: false
+
+ @spec label_in_message?(String.t(), map()) :: boolean()
+ def label_in_message?(label, params),
+ do:
+ [params["to"], params["cc"], params["bto"], params["bcc"]]
+ |> Enum.any?(&label_in_collection?(label, &1))
+
+ @spec unaddressed_message?(map()) :: boolean()
+ def unaddressed_message?(params),
+ do:
+ [params["to"], params["cc"], params["bto"], params["bcc"]]
+ |> Enum.all?(&is_nil(&1))
@spec recipient_in_message(User.t(), User.t(), map()) :: boolean()
- def recipient_in_message(%User{ap_id: ap_id} = recipient, %User{} = actor, params) do
- addresses = [params["to"], params["cc"], params["bto"], params["bcc"]]
-
- cond do
- Enum.any?(addresses, &recipient_in_collection(ap_id, &1)) -> true
- # if the message is unaddressed at all, then assume it is directly addressed
- # to the recipient
- Enum.all?(addresses, &is_nil(&1)) -> true
- # if the message is sent from somebody the user is following, then assume it
- # is addressed to the recipient
- User.following?(recipient, actor) -> true
- true -> false
- end
- end
+ def recipient_in_message(%User{ap_id: ap_id} = recipient, %User{} = actor, params),
+ do:
+ label_in_message?(ap_id, params) || unaddressed_message?(params) ||
+ User.following?(recipient, actor)
defp extract_list(target) when is_binary(target), do: [target]
defp extract_list(lst) when is_list(lst), do: lst
@@ -76,8 +91,8 @@ defmodule Pleroma.Web.ActivityPub.Utils do
def maybe_splice_recipient(ap_id, params) do
need_splice? =
- !recipient_in_collection(ap_id, params["to"]) &&
- !recipient_in_collection(ap_id, params["cc"])
+ !label_in_collection?(ap_id, params["to"]) &&
+ !label_in_collection?(ap_id, params["cc"])
if need_splice? do
cc_list = extract_list(params["cc"])
@@ -155,8 +170,11 @@ defmodule Pleroma.Web.ActivityPub.Utils do
Enqueues an activity for federation if it's local
"""
@spec maybe_federate(any()) :: :ok
- def maybe_federate(%Activity{local: true} = activity) do
- if Pleroma.Config.get!([:instance, :federating]) do
+ def maybe_federate(%Activity{local: true, data: %{"type" => type}} = activity) do
+ outgoing_blocks = Config.get([:activitypub, :outgoing_blocks])
+
+ with true <- Config.get!([:instance, :federating]),
+ true <- type != "Block" || outgoing_blocks do
Pleroma.Web.Federator.publish(activity)
end
@@ -251,6 +269,16 @@ defmodule Pleroma.Web.ActivityPub.Utils do
|> Repo.one()
end
+ @doc """
+ Returns like activities targeting an object
+ """
+ def get_object_likes(%{data: %{"id" => id}}) do
+ id
+ |> Activity.Queries.by_object_id()
+ |> Activity.Queries.by_type("Like")
+ |> Repo.all()
+ end
+
@spec make_like_data(User.t(), map(), String.t()) :: map()
def make_like_data(
%User{ap_id: ap_id} = actor,
@@ -282,13 +310,23 @@ defmodule Pleroma.Web.ActivityPub.Utils do
|> maybe_put("id", activity_id)
end
- @spec update_element_in_object(String.t(), list(any), Object.t()) ::
+ def make_emoji_reaction_data(user, object, emoji, activity_id) do
+ make_like_data(user, object, activity_id)
+ |> Map.put("type", "EmojiReact")
+ |> Map.put("content", emoji)
+ end
+
+ @spec update_element_in_object(String.t(), list(any), Object.t(), integer() | nil) ::
{:ok, Object.t()} | {:error, Ecto.Changeset.t()}
- def update_element_in_object(property, element, object) do
+ def update_element_in_object(property, element, object, count \\ nil) do
+ length =
+ count ||
+ length(element)
+
data =
Map.merge(
object.data,
- %{"#{property}_count" => length(element), "#{property}s" => element}
+ %{"#{property}_count" => length, "#{property}s" => element}
)
object
@@ -296,6 +334,69 @@ defmodule Pleroma.Web.ActivityPub.Utils do
|> Object.update_and_set_cache()
end
+ @spec add_emoji_reaction_to_object(Activity.t(), Object.t()) ::
+ {:ok, Object.t()} | {:error, Ecto.Changeset.t()}
+
+ def add_emoji_reaction_to_object(
+ %Activity{data: %{"content" => emoji, "actor" => actor}},
+ object
+ ) do
+ reactions = get_cached_emoji_reactions(object)
+
+ new_reactions =
+ case Enum.find_index(reactions, fn [candidate, _] -> emoji == candidate end) do
+ nil ->
+ reactions ++ [[emoji, [actor]]]
+
+ index ->
+ List.update_at(
+ reactions,
+ index,
+ fn [emoji, users] -> [emoji, Enum.uniq([actor | users])] end
+ )
+ end
+
+ count = emoji_count(new_reactions)
+
+ update_element_in_object("reaction", new_reactions, object, count)
+ end
+
+ def emoji_count(reactions_list) do
+ Enum.reduce(reactions_list, 0, fn [_, users], acc -> acc + length(users) end)
+ end
+
+ def remove_emoji_reaction_from_object(
+ %Activity{data: %{"content" => emoji, "actor" => actor}},
+ object
+ ) do
+ reactions = get_cached_emoji_reactions(object)
+
+ new_reactions =
+ case Enum.find_index(reactions, fn [candidate, _] -> emoji == candidate end) do
+ nil ->
+ reactions
+
+ index ->
+ List.update_at(
+ reactions,
+ index,
+ fn [emoji, users] -> [emoji, List.delete(users, actor)] end
+ )
+ |> Enum.reject(fn [_, users] -> Enum.empty?(users) end)
+ end
+
+ count = emoji_count(new_reactions)
+ update_element_in_object("reaction", new_reactions, object, count)
+ end
+
+ def get_cached_emoji_reactions(object) do
+ if is_list(object.data["reactions"]) do
+ object.data["reactions"]
+ else
+ []
+ end
+ end
+
@spec add_like_to_object(Activity.t(), Object.t()) ::
{:ok, Object.t()} | {:error, Ecto.Changeset.t()}
def add_like_to_object(%Activity{data: %{"actor" => actor}}, object) do
@@ -330,7 +431,7 @@ defmodule Pleroma.Web.ActivityPub.Utils do
@doc """
Updates a follow activity's state (for locked accounts).
"""
- @spec update_follow_state_for_all(Activity.t(), String.t()) :: {:ok, Activity} | {:error, any()}
+ @spec update_follow_state_for_all(Activity.t(), String.t()) :: {:ok, Activity | nil}
def update_follow_state_for_all(
%Activity{data: %{"actor" => actor, "object" => object}} = activity,
state
@@ -343,22 +444,19 @@ defmodule Pleroma.Web.ActivityPub.Utils do
|> update(set: [data: fragment("jsonb_set(data, '{state}', ?)", ^state)])
|> Repo.update_all([])
- User.set_follow_state_cache(actor, object, state)
-
activity = Activity.get_by_id(activity.id)
{:ok, activity}
end
def update_follow_state(
- %Activity{data: %{"actor" => actor, "object" => object}} = activity,
+ %Activity{} = activity,
state
) do
new_data = Map.put(activity.data, "state", state)
changeset = Changeset.change(activity, data: new_data)
with {:ok, activity} <- Repo.update(changeset) do
- User.set_follow_state_cache(actor, object, state)
{:ok, activity}
end
end
@@ -393,10 +491,32 @@ defmodule Pleroma.Web.ActivityPub.Utils do
|> Repo.one()
end
+ def fetch_latest_undo(%User{ap_id: ap_id}) do
+ "Undo"
+ |> Activity.Queries.by_type()
+ |> where(actor: ^ap_id)
+ |> order_by([activity], fragment("? desc nulls last", activity.id))
+ |> limit(1)
+ |> Repo.one()
+ end
+
+ def get_latest_reaction(internal_activity_id, %{ap_id: ap_id}, emoji) do
+ %{data: %{"object" => object_ap_id}} = Activity.get_by_id(internal_activity_id)
+
+ "EmojiReact"
+ |> Activity.Queries.by_type()
+ |> where(actor: ^ap_id)
+ |> where([activity], fragment("?->>'content' = ?", activity.data, ^emoji))
+ |> Activity.Queries.by_object_id(object_ap_id)
+ |> order_by([activity], fragment("? desc nulls last", activity.id))
+ |> limit(1)
+ |> Repo.one()
+ end
+
#### Announce-related helpers
@doc """
- Retruns an existing announce activity if the notice has already been announced
+ Returns an existing announce activity if the notice has already been announced
"""
@spec get_existing_announce(String.t(), map()) :: Activity.t() | nil
def get_existing_announce(actor, %{data: %{"id" => ap_id}}) do
@@ -446,39 +566,19 @@ defmodule Pleroma.Web.ActivityPub.Utils do
|> maybe_put("id", activity_id)
end
- @doc """
- Make unannounce activity data for the given actor and object
- """
- def make_unannounce_data(
- %User{ap_id: ap_id} = user,
- %Activity{data: %{"context" => context, "object" => object}} = activity,
- activity_id
+ def make_undo_data(
+ %User{ap_id: actor, follower_address: follower_address},
+ %Activity{
+ data: %{"id" => undone_activity_id, "context" => context},
+ actor: undone_activity_actor
+ },
+ activity_id \\ nil
) do
- object = Object.normalize(object)
-
%{
"type" => "Undo",
- "actor" => ap_id,
- "object" => activity.data,
- "to" => [user.follower_address, object.data["actor"]],
- "cc" => [Pleroma.Constants.as_public()],
- "context" => context
- }
- |> maybe_put("id", activity_id)
- end
-
- def make_unlike_data(
- %User{ap_id: ap_id} = user,
- %Activity{data: %{"context" => context, "object" => object}} = activity,
- activity_id
- ) do
- object = Object.normalize(object)
-
- %{
- "type" => "Undo",
- "actor" => ap_id,
- "object" => activity.data,
- "to" => [user.follower_address, object.data["actor"]],
+ "actor" => actor,
+ "object" => undone_activity_id,
+ "to" => [follower_address, undone_activity_actor],
"cc" => [Pleroma.Constants.as_public()],
"context" => context
}
@@ -553,16 +653,6 @@ defmodule Pleroma.Web.ActivityPub.Utils do
|> maybe_put("id", activity_id)
end
- def make_unblock_data(blocker, blocked, block_activity, activity_id) do
- %{
- "type" => "Undo",
- "actor" => blocker.ap_id,
- "to" => [blocked.ap_id],
- "object" => block_activity.data
- }
- |> maybe_put("id", activity_id)
- end
-
#### Create-related helpers
def make_create_data(params, additional) do
@@ -611,56 +701,68 @@ defmodule Pleroma.Web.ActivityPub.Utils do
def make_flag_data(_, _), do: %{}
defp build_flag_object(%{account: account, statuses: statuses} = _) do
- [account.ap_id] ++
- Enum.map(statuses || [], fn
+ [account.ap_id] ++ build_flag_object(%{statuses: statuses})
+ end
+
+ defp build_flag_object(%{statuses: statuses}) do
+ Enum.map(statuses || [], &build_flag_object/1)
+ end
+
+ defp build_flag_object(act) when is_map(act) or is_binary(act) do
+ id =
+ case act do
%Activity{} = act -> act.data["id"]
act when is_map(act) -> act["id"]
act when is_binary(act) -> act
- end)
- end
+ end
- defp build_flag_object(_), do: []
+ case Activity.get_by_ap_id_with_object(id) do
+ %Activity{} = activity ->
+ %{
+ "type" => "Note",
+ "id" => activity.data["id"],
+ "content" => activity.object.data["content"],
+ "published" => activity.object.data["published"],
+ "actor" =>
+ AccountView.render("show.json", %{
+ user: User.get_by_ap_id(activity.object.data["actor"])
+ })
+ }
- @doc """
- Fetches the OrderedCollection/OrderedCollectionPage from `from`, limiting the amount of pages fetched after
- the first one to `pages_left` pages.
- If the amount of pages is higher than the collection has, it returns whatever was there.
- """
- def fetch_ordered_collection(from, pages_left, acc \\ []) do
- with {:ok, response} <- Tesla.get(from),
- {:ok, collection} <- Jason.decode(response.body) do
- case collection["type"] do
- "OrderedCollection" ->
- # If we've encountered the OrderedCollection and not the page,
- # just call the same function on the page address
- fetch_ordered_collection(collection["first"], pages_left)
-
- "OrderedCollectionPage" ->
- if pages_left > 0 do
- # There are still more pages
- if Map.has_key?(collection, "next") do
- # There are still more pages, go deeper saving what we have into the accumulator
- fetch_ordered_collection(
- collection["next"],
- pages_left - 1,
- acc ++ collection["orderedItems"]
- )
- else
- # No more pages left, just return whatever we already have
- acc ++ collection["orderedItems"]
- end
- else
- # Got the amount of pages needed, add them all to the accumulator
- acc ++ collection["orderedItems"]
- end
-
- _ ->
- {:error, "Not an OrderedCollection or OrderedCollectionPage"}
- end
+ _ ->
+ %{"id" => id, "deleted" => true}
end
end
+ defp build_flag_object(_), do: []
+
#### Report-related helpers
+ def get_reports(params, page, page_size) do
+ params =
+ params
+ |> Map.put("type", "Flag")
+ |> Map.put("skip_preload", true)
+ |> Map.put("preload_report_notes", true)
+ |> Map.put("total", true)
+ |> Map.put("limit", page_size)
+ |> Map.put("offset", (page - 1) * page_size)
+
+ ActivityPub.fetch_activities([], params, :offset)
+ end
+
+ def update_report_state(%Activity{} = activity, state)
+ when state in @strip_status_report_states do
+ {:ok, stripped_activity} = strip_report_status_data(activity)
+
+ new_data =
+ activity.data
+ |> Map.put("state", state)
+ |> Map.put("object", stripped_activity.data["object"])
+
+ activity
+ |> Changeset.change(data: new_data)
+ |> Repo.update()
+ end
def update_report_state(%Activity{} = activity, state) when state in @supported_report_states do
new_data = Map.put(activity.data, "state", state)
@@ -670,8 +772,34 @@ defmodule Pleroma.Web.ActivityPub.Utils do
|> Repo.update()
end
+ def update_report_state(activity_ids, state) when state in @supported_report_states do
+ activities_num = length(activity_ids)
+
+ from(a in Activity, where: a.id in ^activity_ids)
+ |> update(set: [data: fragment("jsonb_set(data, '{state}', ?)", ^state)])
+ |> Repo.update_all([])
+ |> case do
+ {^activities_num, _} -> :ok
+ _ -> {:error, activity_ids}
+ end
+ end
+
def update_report_state(_, _), do: {:error, "Unsupported state"}
+ def strip_report_status_data(activity) do
+ [actor | reported_activities] = activity.data["object"]
+
+ stripped_activities =
+ Enum.map(reported_activities, fn
+ act when is_map(act) -> act["id"]
+ act when is_binary(act) -> act
+ end)
+
+ new_data = put_in(activity.data, ["object"], [actor | stripped_activities])
+
+ {:ok, %{activity | data: new_data}}
+ end
+
def update_activity_visibility(activity, visibility) when visibility in @valid_visibilities do
[to, cc, recipients] =
activity
diff --git a/lib/pleroma/web/activity_pub/views/object_view.ex b/lib/pleroma/web/activity_pub/views/object_view.ex
index d8a3ec288..e555e9999 100644
--- a/lib/pleroma/web/activity_pub/views/object_view.ex
+++ b/lib/pleroma/web/activity_pub/views/object_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.ObjectView do
diff --git a/lib/pleroma/web/activity_pub/views/user_view.ex b/lib/pleroma/web/activity_pub/views/user_view.ex
index 8c5b4460b..34590b16d 100644
--- a/lib/pleroma/web/activity_pub/views/user_view.ex
+++ b/lib/pleroma/web/activity_pub/views/user_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.UserView do
@@ -73,25 +73,17 @@ defmodule Pleroma.Web.ActivityPub.UserView do
{:ok, _, public_key} = Keys.keys_from_pem(user.keys)
public_key = :public_key.pem_entry_encode(:SubjectPublicKeyInfo, public_key)
public_key = :public_key.pem_encode([public_key])
+ user = User.sanitize_html(user)
endpoints = render("endpoints.json", %{user: user})
emoji_tags = Transmogrifier.take_emoji_tags(user)
- fields =
- user.info
- |> User.Info.fields()
- |> Enum.map(fn %{"name" => name, "value" => value} ->
- %{
- "name" => Pleroma.HTML.strip_tags(name),
- "value" => Pleroma.HTML.filter_tags(value, Pleroma.HTML.Scrubber.LinksOnly)
- }
- end)
- |> Enum.map(&Map.put(&1, "type", "PropertyValue"))
+ fields = Enum.map(user.fields, &Map.put(&1, "type", "PropertyValue"))
%{
"id" => user.ap_id,
- "type" => "Person",
+ "type" => user.actor_type,
"following" => "#{user.ap_id}/following",
"followers" => "#{user.ap_id}/followers",
"inbox" => "#{user.ap_id}/inbox",
@@ -100,7 +92,7 @@ defmodule Pleroma.Web.ActivityPub.UserView do
"name" => user.name,
"summary" => user.bio,
"url" => user.ap_id,
- "manuallyApprovesFollowers" => user.info.locked,
+ "manuallyApprovesFollowers" => user.locked,
"publicKey" => %{
"id" => "#{user.ap_id}#main-key",
"owner" => user.ap_id,
@@ -108,8 +100,8 @@ defmodule Pleroma.Web.ActivityPub.UserView do
},
"endpoints" => endpoints,
"attachment" => fields,
- "tag" => (user.info.source_data["tag"] || []) ++ emoji_tags,
- "discoverable" => user.info.discoverable
+ "tag" => emoji_tags,
+ "discoverable" => user.discoverable
}
|> Map.merge(maybe_make_image(&User.avatar_url/2, "icon", user))
|> Map.merge(maybe_make_image(&User.banner_url/2, "image", user))
@@ -117,8 +109,8 @@ defmodule Pleroma.Web.ActivityPub.UserView do
end
def render("following.json", %{user: user, page: page} = opts) do
- showing_items = (opts[:for] && opts[:for] == user) || !user.info.hide_follows
- showing_count = showing_items || !user.info.hide_follows_count
+ showing_items = (opts[:for] && opts[:for] == user) || !user.hide_follows
+ showing_count = showing_items || !user.hide_follows_count
query = User.get_friends_query(user)
query = from(user in query, select: [:ap_id])
@@ -136,8 +128,8 @@ defmodule Pleroma.Web.ActivityPub.UserView do
end
def render("following.json", %{user: user} = opts) do
- showing_items = (opts[:for] && opts[:for] == user) || !user.info.hide_follows
- showing_count = showing_items || !user.info.hide_follows_count
+ showing_items = (opts[:for] && opts[:for] == user) || !user.hide_follows
+ showing_count = showing_items || !user.hide_follows_count
query = User.get_friends_query(user)
query = from(user in query, select: [:ap_id])
@@ -156,7 +148,7 @@ defmodule Pleroma.Web.ActivityPub.UserView do
"totalItems" => total,
"first" =>
if showing_items do
- collection(following, "#{user.ap_id}/following", 1, !user.info.hide_follows)
+ collection(following, "#{user.ap_id}/following", 1, !user.hide_follows)
else
"#{user.ap_id}/following?page=1"
end
@@ -165,8 +157,8 @@ defmodule Pleroma.Web.ActivityPub.UserView do
end
def render("followers.json", %{user: user, page: page} = opts) do
- showing_items = (opts[:for] && opts[:for] == user) || !user.info.hide_followers
- showing_count = showing_items || !user.info.hide_followers_count
+ showing_items = (opts[:for] && opts[:for] == user) || !user.hide_followers
+ showing_count = showing_items || !user.hide_followers_count
query = User.get_followers_query(user)
query = from(user in query, select: [:ap_id])
@@ -184,8 +176,8 @@ defmodule Pleroma.Web.ActivityPub.UserView do
end
def render("followers.json", %{user: user} = opts) do
- showing_items = (opts[:for] && opts[:for] == user) || !user.info.hide_followers
- showing_count = showing_items || !user.info.hide_followers_count
+ showing_items = (opts[:for] && opts[:for] == user) || !user.hide_followers
+ showing_count = showing_items || !user.hide_followers_count
query = User.get_followers_query(user)
query = from(user in query, select: [:ap_id])
@@ -201,7 +193,6 @@ defmodule Pleroma.Web.ActivityPub.UserView do
%{
"id" => "#{user.ap_id}/followers",
"type" => "OrderedCollection",
- "totalItems" => total,
"first" =>
if showing_items do
collection(followers, "#{user.ap_id}/followers", 1, showing_items, total)
@@ -209,6 +200,7 @@ defmodule Pleroma.Web.ActivityPub.UserView do
"#{user.ap_id}/followers?page=1"
end
}
+ |> maybe_put_total_items(showing_count, total)
|> Map.merge(Utils.make_json_ld_header())
end
@@ -251,6 +243,12 @@ defmodule Pleroma.Web.ActivityPub.UserView do
|> Map.merge(Utils.make_json_ld_header())
end
+ defp maybe_put_total_items(map, false, _total), do: map
+
+ defp maybe_put_total_items(map, true, total) do
+ Map.put(map, "totalItems", total)
+ end
+
def collection(collection, iri, page, show_items \\ true, total \\ nil) do
offset = (page - 1) * 10
items = Enum.slice(collection, offset, 10)
diff --git a/lib/pleroma/web/activity_pub/visibility.ex b/lib/pleroma/web/activity_pub/visibility.ex
index 270d0fa02..453a6842e 100644
--- a/lib/pleroma/web/activity_pub/visibility.ex
+++ b/lib/pleroma/web/activity_pub/visibility.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ActivityPub.Visibility do
@@ -7,15 +7,17 @@ defmodule Pleroma.Web.ActivityPub.Visibility do
alias Pleroma.Object
alias Pleroma.Repo
alias Pleroma.User
+ alias Pleroma.Web.ActivityPub.Utils
require Pleroma.Constants
@spec is_public?(Object.t() | Activity.t() | map()) :: boolean()
def is_public?(%Object{data: %{"type" => "Tombstone"}}), do: false
def is_public?(%Object{data: data}), do: is_public?(data)
+ def is_public?(%Activity{data: %{"type" => "Move"}}), do: true
def is_public?(%Activity{data: data}), do: is_public?(data)
def is_public?(%{"directMessage" => true}), do: false
- def is_public?(data), do: Pleroma.Constants.as_public() in (data["to"] ++ (data["cc"] || []))
+ def is_public?(data), do: Utils.label_in_message?(Pleroma.Constants.as_public(), data)
def is_private?(activity) do
with false <- is_public?(activity),
@@ -42,6 +44,7 @@ defmodule Pleroma.Web.ActivityPub.Visibility do
def is_list?(%{data: %{"listMessage" => _}}), do: true
def is_list?(_), do: false
+ @spec visible_for_user?(Activity.t(), User.t() | nil) :: boolean()
def visible_for_user?(%{actor: ap_id}, %User{ap_id: ap_id}), do: true
def visible_for_user?(%{data: %{"listMessage" => list_ap_id}} = activity, %User{} = user) do
@@ -53,14 +56,21 @@ defmodule Pleroma.Web.ActivityPub.Visibility do
def visible_for_user?(%{data: %{"listMessage" => _}}, nil), do: false
- def visible_for_user?(activity, nil) do
- is_public?(activity)
+ def visible_for_user?(%{local: local} = activity, nil) do
+ cfg_key =
+ if local,
+ do: :local,
+ else: :remote
+
+ if Pleroma.Config.get([:restrict_unauthenticated, :activities, cfg_key]),
+ do: false,
+ else: is_public?(activity)
end
def visible_for_user?(activity, user) do
- x = [user.ap_id | user.following]
+ x = [user.ap_id | User.following(user)]
y = [activity.actor] ++ activity.data["to"] ++ (activity.data["cc"] || [])
- visible_for_user?(activity, nil) || Enum.any?(x, &(&1 in y))
+ is_public?(activity) || Enum.any?(x, &(&1 in y))
end
def entire_thread_visible_for_user?(%Activity{} = activity, %User{} = user) do
diff --git a/lib/pleroma/web/admin_api/admin_api_controller.ex b/lib/pleroma/web/admin_api/admin_api_controller.ex
index b6d3f79c8..647ceb3ba 100644
--- a/lib/pleroma/web/admin_api/admin_api_controller.ex
+++ b/lib/pleroma/web/admin_api/admin_api_controller.ex
@@ -1,18 +1,29 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.AdminAPI.AdminAPIController do
use Pleroma.Web, :controller
+
+ import Pleroma.Web.ControllerHelper, only: [json_response: 3]
+
alias Pleroma.Activity
+ alias Pleroma.Config
+ alias Pleroma.ConfigDB
+ alias Pleroma.MFA
alias Pleroma.ModerationLog
alias Pleroma.Plugs.OAuthScopesPlug
+ alias Pleroma.ReportNote
+ alias Pleroma.Stats
alias Pleroma.User
alias Pleroma.UserInviteToken
alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.Builder
+ alias Pleroma.Web.ActivityPub.Pipeline
alias Pleroma.Web.ActivityPub.Relay
+ alias Pleroma.Web.ActivityPub.Utils
+ alias Pleroma.Web.AdminAPI
alias Pleroma.Web.AdminAPI.AccountView
- alias Pleroma.Web.AdminAPI.Config
alias Pleroma.Web.AdminAPI.ConfigView
alias Pleroma.Web.AdminAPI.ModerationLogView
alias Pleroma.Web.AdminAPI.Report
@@ -20,29 +31,28 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
alias Pleroma.Web.AdminAPI.Search
alias Pleroma.Web.CommonAPI
alias Pleroma.Web.Endpoint
- alias Pleroma.Web.MastodonAPI.StatusView
+ alias Pleroma.Web.MastodonAPI
+ alias Pleroma.Web.MastodonAPI.AppView
+ alias Pleroma.Web.OAuth.App
alias Pleroma.Web.Router
- import Pleroma.Web.ControllerHelper, only: [json_response: 3]
-
require Logger
+ @descriptions Pleroma.Docs.JSON.compile()
+ @users_page_size 50
+
plug(
OAuthScopesPlug,
- %{scopes: ["read:accounts"]}
- when action in [:list_users, :user_show, :right_get, :invites]
+ %{scopes: ["read:accounts"], admin: true}
+ when action in [:list_users, :user_show, :right_get, :show_user_credentials]
)
plug(
OAuthScopesPlug,
- %{scopes: ["write:accounts"]}
+ %{scopes: ["write:accounts"], admin: true}
when action in [
- :get_invite_token,
- :revoke_invite,
- :email_invite,
:get_password_reset,
- :user_follow,
- :user_unfollow,
+ :force_password_reset,
:user_delete,
:users_create,
:user_toggle_activation,
@@ -51,66 +61,97 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
:tag_users,
:untag_users,
:right_add,
+ :right_add_multiple,
:right_delete,
- :set_activation_status
+ :disable_mfa,
+ :right_delete_multiple,
+ :update_user_credentials
]
)
+ plug(OAuthScopesPlug, %{scopes: ["read:invites"], admin: true} when action == :invites)
+
plug(
OAuthScopesPlug,
- %{scopes: ["read:reports"]} when action in [:list_reports, :report_show]
+ %{scopes: ["write:invites"], admin: true}
+ when action in [:create_invite_token, :revoke_invite, :email_invite]
)
plug(
OAuthScopesPlug,
- %{scopes: ["write:reports"]}
- when action in [:report_update_state, :report_respond]
+ %{scopes: ["write:follows"], admin: true}
+ when action in [:user_follow, :user_unfollow, :relay_follow, :relay_unfollow]
)
plug(
OAuthScopesPlug,
- %{scopes: ["read:statuses"]} when action == :list_user_statuses
+ %{scopes: ["read:reports"], admin: true}
+ when action in [:list_reports, :report_show]
)
plug(
OAuthScopesPlug,
- %{scopes: ["write:statuses"]}
- when action in [:status_update, :status_delete]
+ %{scopes: ["write:reports"], admin: true}
+ when action in [:reports_update, :report_notes_create, :report_notes_delete]
)
plug(
OAuthScopesPlug,
- %{scopes: ["read"]}
- when action in [:config_show, :migrate_to_db, :migrate_from_db, :list_log]
+ %{scopes: ["read:statuses"], admin: true}
+ when action in [:list_statuses, :list_user_statuses, :list_instance_statuses, :status_show]
)
plug(
OAuthScopesPlug,
- %{scopes: ["write"]}
- when action in [:relay_follow, :relay_unfollow, :config_update]
+ %{scopes: ["write:statuses"], admin: true}
+ when action in [:status_update, :status_delete]
)
- @users_page_size 50
-
- action_fallback(:errors)
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["read"], admin: true}
+ when action in [
+ :config_show,
+ :list_log,
+ :stats,
+ :relay_list,
+ :config_descriptions,
+ :need_reboot
+ ]
+ )
- def user_delete(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do
- user = User.get_cached_by_nickname(nickname)
- User.delete(user)
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["write"], admin: true}
+ when action in [
+ :restart,
+ :config_update,
+ :resend_confirmation_email,
+ :confirm_email,
+ :oauth_app_create,
+ :oauth_app_list,
+ :oauth_app_update,
+ :oauth_app_delete,
+ :reload_emoji
+ ]
+ )
- ModerationLog.insert_log(%{
- actor: admin,
- subject: [user],
- action: "delete"
- })
+ action_fallback(:errors)
- conn
- |> json(nickname)
+ def user_delete(conn, %{"nickname" => nickname}) do
+ user_delete(conn, %{"nicknames" => [nickname]})
end
def user_delete(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) do
- users = nicknames |> Enum.map(&User.get_cached_by_nickname/1)
- User.delete(users)
+ users =
+ nicknames
+ |> Enum.map(&User.get_cached_by_nickname/1)
+
+ users
+ |> Enum.each(fn user ->
+ {:ok, delete_data, _} = Builder.delete(admin, user.ap_id)
+ Pipeline.common_pipeline(delete_data, local: true)
+ end)
ModerationLog.insert_log(%{
actor: admin,
@@ -227,7 +268,25 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
end
end
+ def list_instance_statuses(conn, %{"instance" => instance} = params) do
+ with_reblogs = params["with_reblogs"] == "true" || params["with_reblogs"] == true
+ {page, page_size} = page_params(params)
+
+ activities =
+ ActivityPub.fetch_statuses(nil, %{
+ "instance" => instance,
+ "limit" => page_size,
+ "offset" => (page - 1) * page_size,
+ "exclude_reblogs" => !with_reblogs && "true"
+ })
+
+ conn
+ |> put_view(AdminAPI.StatusView)
+ |> render("index.json", %{activities: activities, as: :activity})
+ end
+
def list_user_statuses(conn, %{"nickname" => nickname} = params) do
+ with_reblogs = params["with_reblogs"] == "true" || params["with_reblogs"] == true
godmode = params["godmode"] == "true" || params["godmode"] == true
with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do
@@ -236,11 +295,12 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
activities =
ActivityPub.fetch_user_activities(user, nil, %{
"limit" => page_size,
- "godmode" => godmode
+ "godmode" => godmode,
+ "exclude_reblogs" => !with_reblogs && "true"
})
conn
- |> put_view(StatusView)
+ |> put_view(MastodonAPI.StatusView)
|> render("index.json", %{activities: activities, as: :activity})
else
_ -> {:error, :not_found}
@@ -250,9 +310,9 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
def user_toggle_activation(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do
user = User.get_cached_by_nickname(nickname)
- {:ok, updated_user} = User.deactivate(user, !user.info.deactivated)
+ {:ok, updated_user} = User.deactivate(user, !user.deactivated)
- action = if user.info.deactivated, do: "activate", else: "deactivate"
+ action = if user.deactivated, do: "activate", else: "deactivate"
ModerationLog.insert_log(%{
actor: admin,
@@ -334,16 +394,12 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
email: params["email"]
}
- with {:ok, users, count} <- Search.user(Map.merge(search_params, filters)),
- do:
- conn
- |> json(
- AccountView.render("index.json",
- users: users,
- count: count,
- page_size: page_size
- )
- )
+ with {:ok, users, count} <- Search.user(Map.merge(search_params, filters)) do
+ json(
+ conn,
+ AccountView.render("index.json", users: users, count: count, page_size: page_size)
+ )
+ end
end
@filters ~w(local external active deactivated is_admin is_moderator)
@@ -364,11 +420,11 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
"nicknames" => nicknames
})
when permission_group in ["moderator", "admin"] do
- info = Map.put(%{}, "is_" <> permission_group, true)
+ update = %{:"is_#{permission_group}" => true}
users = nicknames |> Enum.map(&User.get_cached_by_nickname/1)
- User.update_info(users, &User.Info.admin_api_update(&1, info))
+ for u <- users, do: User.admin_api_update(u, update)
ModerationLog.insert_log(%{
action: "grant",
@@ -377,7 +433,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
permission: permission_group
})
- json(conn, info)
+ json(conn, update)
end
def right_add_multiple(conn, _) do
@@ -389,12 +445,12 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
"nickname" => nickname
})
when permission_group in ["moderator", "admin"] do
- info = Map.put(%{}, "is_" <> permission_group, true)
+ fields = %{:"is_#{permission_group}" => true}
{:ok, user} =
nickname
|> User.get_cached_by_nickname()
- |> User.update_info(&User.Info.admin_api_update(&1, info))
+ |> User.admin_api_update(fields)
ModerationLog.insert_log(%{
action: "grant",
@@ -403,7 +459,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
permission: permission_group
})
- json(conn, info)
+ json(conn, fields)
end
def right_add(conn, _) do
@@ -415,8 +471,8 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
conn
|> json(%{
- is_moderator: user.info.is_moderator,
- is_admin: user.info.is_admin
+ is_moderator: user.is_moderator,
+ is_admin: user.is_admin
})
end
@@ -429,11 +485,11 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
)
when permission_group in ["moderator", "admin"] do
with false <- Enum.member?(nicknames, admin_nickname) do
- info = Map.put(%{}, "is_" <> permission_group, false)
+ update = %{:"is_#{permission_group}" => false}
users = nicknames |> Enum.map(&User.get_cached_by_nickname/1)
- User.update_info(users, &User.Info.admin_api_update(&1, info))
+ for u <- users, do: User.admin_api_update(u, update)
ModerationLog.insert_log(%{
action: "revoke",
@@ -442,7 +498,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
permission: permission_group
})
- json(conn, info)
+ json(conn, update)
else
_ -> render_error(conn, :forbidden, "You can't revoke your own admin/moderator status.")
end
@@ -460,12 +516,12 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
}
)
when permission_group in ["moderator", "admin"] do
- info = Map.put(%{}, "is_" <> permission_group, false)
+ fields = %{:"is_#{permission_group}" => false}
{:ok, user} =
nickname
|> User.get_cached_by_nickname()
- |> User.update_info(&User.Info.admin_api_update(&1, info))
+ |> User.admin_api_update(fields)
ModerationLog.insert_log(%{
action: "revoke",
@@ -474,7 +530,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
permission: permission_group
})
- json(conn, info)
+ json(conn, fields)
end
def right_delete(%{assigns: %{user: %{nickname: nickname}}} = conn, %{"nickname" => nickname}) do
@@ -527,9 +583,8 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
@doc "Sends registration invite via email"
def email_invite(%{assigns: %{user: user}} = conn, %{"email" => email} = params) do
- with true <-
- Pleroma.Config.get([:instance, :invites_enabled]) &&
- !Pleroma.Config.get([:instance, :registrations_open]),
+ with {_, false} <- {:registrations_open, Config.get([:instance, :registrations_open])},
+ {_, true} <- {:invites_enabled, Config.get([:instance, :invites_enabled])},
{:ok, invite_token} <- UserInviteToken.create_invite(),
email <-
Pleroma.Emails.UserEmail.user_invitation_email(
@@ -540,6 +595,18 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
),
{:ok, _} <- Pleroma.Emails.Mailer.deliver(email) do
json_response(conn, :no_content, "")
+ else
+ {:registrations_open, _} ->
+ errors(
+ conn,
+ {:error, "To send invites you need to set the `registrations_open` option to false."}
+ )
+
+ {:invites_enabled, _} ->
+ errors(
+ conn,
+ {:error, "To send invites you need to set the `invites_enabled` option to true."}
+ )
end
end
@@ -596,26 +663,82 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
end
@doc "Force password reset for a given user"
- def force_password_reset(conn, %{"nickname" => nickname}) do
- (%User{local: true} = user) = User.get_cached_by_nickname(nickname)
+ def force_password_reset(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) do
+ users = nicknames |> Enum.map(&User.get_cached_by_nickname/1)
- User.force_password_reset_async(user)
+ Enum.each(users, &User.force_password_reset_async/1)
+
+ ModerationLog.insert_log(%{
+ actor: admin,
+ subject: users,
+ action: "force_password_reset"
+ })
json_response(conn, :no_content, "")
end
+ @doc "Disable mfa for user's account."
+ def disable_mfa(conn, %{"nickname" => nickname}) do
+ case User.get_by_nickname(nickname) do
+ %User{} = user ->
+ MFA.disable(user)
+ json(conn, nickname)
+
+ _ ->
+ {:error, :not_found}
+ end
+ end
+
+ @doc "Show a given user's credentials"
+ def show_user_credentials(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do
+ with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do
+ conn
+ |> put_view(AccountView)
+ |> render("credentials.json", %{user: user, for: admin})
+ else
+ _ -> {:error, :not_found}
+ end
+ end
+
+ @doc "Updates a given user"
+ def update_user_credentials(
+ %{assigns: %{user: admin}} = conn,
+ %{"nickname" => nickname} = params
+ ) do
+ with {_, user} <- {:user, User.get_cached_by_nickname(nickname)},
+ {:ok, _user} <-
+ User.update_as_admin(user, params) do
+ ModerationLog.insert_log(%{
+ actor: admin,
+ subject: [user],
+ action: "updated_users"
+ })
+
+ if params["password"] do
+ User.force_password_reset_async(user)
+ end
+
+ ModerationLog.insert_log(%{
+ actor: admin,
+ subject: [user],
+ action: "force_password_reset"
+ })
+
+ json(conn, %{status: "success"})
+ else
+ {:error, changeset} ->
+ {_, {error, _}} = Enum.at(changeset.errors, 0)
+ json(conn, %{error: "New password #{error}."})
+
+ _ ->
+ json(conn, %{error: "Unable to change password."})
+ end
+ end
+
def list_reports(conn, params) do
{page, page_size} = page_params(params)
- params =
- params
- |> Map.put("type", "Flag")
- |> Map.put("skip_preload", true)
- |> Map.put("total", true)
- |> Map.put("limit", page_size)
- |> Map.put("offset", (page - 1) * page_size)
-
- reports = ActivityPub.fetch_activities([], params, :offset)
+ reports = Utils.get_reports(params, page, page_size)
conn
|> put_view(ReportView)
@@ -632,63 +755,114 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
end
end
- def report_update_state(%{assigns: %{user: admin}} = conn, %{"id" => id, "state" => state}) do
- with {:ok, report} <- CommonAPI.update_report_state(id, state) do
- ModerationLog.insert_log(%{
- action: "report_update",
- actor: admin,
- subject: report
- })
+ def reports_update(%{assigns: %{user: admin}} = conn, %{"reports" => reports}) do
+ result =
+ reports
+ |> Enum.map(fn report ->
+ with {:ok, activity} <- CommonAPI.update_report_state(report["id"], report["state"]) do
+ ModerationLog.insert_log(%{
+ action: "report_update",
+ actor: admin,
+ subject: activity
+ })
+
+ activity
+ else
+ {:error, message} -> %{id: report["id"], error: message}
+ end
+ end)
- conn
- |> put_view(ReportView)
- |> render("show.json", Report.extract_report_info(report))
+ case Enum.any?(result, &Map.has_key?(&1, :error)) do
+ true -> json_response(conn, :bad_request, result)
+ false -> json_response(conn, :no_content, "")
end
end
- def report_respond(%{assigns: %{user: user}} = conn, %{"id" => id} = params) do
- with false <- is_nil(params["status"]),
- %Activity{} <- Activity.get_by_id(id) do
- params =
- params
- |> Map.put("in_reply_to_status_id", id)
- |> Map.put("visibility", "direct")
+ def report_notes_create(%{assigns: %{user: user}} = conn, %{
+ "id" => report_id,
+ "content" => content
+ }) do
+ with {:ok, _} <- ReportNote.create(user.id, report_id, content) do
+ ModerationLog.insert_log(%{
+ action: "report_note",
+ actor: user,
+ subject: Activity.get_by_id(report_id),
+ text: content
+ })
- {:ok, activity} = CommonAPI.post(user, params)
+ json_response(conn, :no_content, "")
+ else
+ _ -> json_response(conn, :bad_request, "")
+ end
+ end
+ def report_notes_delete(%{assigns: %{user: user}} = conn, %{
+ "id" => note_id,
+ "report_id" => report_id
+ }) do
+ with {:ok, note} <- ReportNote.destroy(note_id) do
ModerationLog.insert_log(%{
- action: "report_response",
+ action: "report_note_delete",
actor: user,
- subject: activity,
- text: params["status"]
+ subject: Activity.get_by_id(report_id),
+ text: note.content
})
+ json_response(conn, :no_content, "")
+ else
+ _ -> json_response(conn, :bad_request, "")
+ end
+ end
+
+ def list_statuses(%{assigns: %{user: _admin}} = conn, params) do
+ godmode = params["godmode"] == "true" || params["godmode"] == true
+ local_only = params["local_only"] == "true" || params["local_only"] == true
+ with_reblogs = params["with_reblogs"] == "true" || params["with_reblogs"] == true
+ {page, page_size} = page_params(params)
+
+ activities =
+ ActivityPub.fetch_statuses(nil, %{
+ "godmode" => godmode,
+ "local_only" => local_only,
+ "limit" => page_size,
+ "offset" => (page - 1) * page_size,
+ "exclude_reblogs" => !with_reblogs && "true"
+ })
+
+ conn
+ |> put_view(AdminAPI.StatusView)
+ |> render("index.json", %{activities: activities, as: :activity})
+ end
+
+ def status_show(conn, %{"id" => id}) do
+ with %Activity{} = activity <- Activity.get_by_id(id) do
conn
- |> put_view(StatusView)
+ |> put_view(MastodonAPI.StatusView)
|> render("show.json", %{activity: activity})
else
- true ->
- {:param_cast, nil}
-
- nil ->
- {:error, :not_found}
+ _ -> errors(conn, {:error, :not_found})
end
end
def status_update(%{assigns: %{user: admin}} = conn, %{"id" => id} = params) do
+ params =
+ params
+ |> Map.take(["sensitive", "visibility"])
+ |> Map.new(fn {key, value} -> {String.to_existing_atom(key), value} end)
+
with {:ok, activity} <- CommonAPI.update_activity_scope(id, params) do
- {:ok, sensitive} = Ecto.Type.cast(:boolean, params["sensitive"])
+ {:ok, sensitive} = Ecto.Type.cast(:boolean, params[:sensitive])
ModerationLog.insert_log(%{
action: "status_update",
actor: admin,
subject: activity,
sensitive: sensitive,
- visibility: params["visibility"]
+ visibility: params[:visibility]
})
conn
- |> put_view(StatusView)
+ |> put_view(MastodonAPI.StatusView)
|> render("show.json", %{activity: activity})
end
end
@@ -723,49 +897,148 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
|> render("index.json", %{log: log})
end
- def migrate_to_db(conn, _params) do
- Mix.Tasks.Pleroma.Config.run(["migrate_to_db"])
- json(conn, %{})
+ def config_descriptions(conn, _params) do
+ descriptions = Enum.filter(@descriptions, &whitelisted_config?/1)
+
+ json(conn, descriptions)
end
- def migrate_from_db(conn, _params) do
- Mix.Tasks.Pleroma.Config.run(["migrate_from_db", Pleroma.Config.get(:env), "true"])
- json(conn, %{})
+ def config_show(conn, %{"only_db" => true}) do
+ with :ok <- configurable_from_database(conn) do
+ configs = Pleroma.Repo.all(ConfigDB)
+
+ conn
+ |> put_view(ConfigView)
+ |> render("index.json", %{configs: configs})
+ end
end
def config_show(conn, _params) do
- configs = Pleroma.Repo.all(Config)
+ with :ok <- configurable_from_database(conn) do
+ configs = ConfigDB.get_all_as_keyword()
+
+ merged =
+ Config.Holder.default_config()
+ |> ConfigDB.merge(configs)
+ |> Enum.map(fn {group, values} ->
+ Enum.map(values, fn {key, value} ->
+ db =
+ if configs[group][key] do
+ ConfigDB.get_db_keys(configs[group][key], key)
+ end
+
+ db_value = configs[group][key]
+
+ merged_value =
+ if !is_nil(db_value) and Keyword.keyword?(db_value) and
+ ConfigDB.sub_key_full_update?(group, key, Keyword.keys(db_value)) do
+ ConfigDB.merge_group(group, key, value, db_value)
+ else
+ value
+ end
+
+ setting = %{
+ group: ConfigDB.convert(group),
+ key: ConfigDB.convert(key),
+ value: ConfigDB.convert(merged_value)
+ }
+
+ if db, do: Map.put(setting, :db, db), else: setting
+ end)
+ end)
+ |> List.flatten()
- conn
- |> put_view(ConfigView)
- |> render("index.json", %{configs: configs})
+ json(conn, %{configs: merged, need_reboot: Restarter.Pleroma.need_reboot?()})
+ end
end
def config_update(conn, %{"configs" => configs}) do
- updated =
- if Pleroma.Config.get([:instance, :dynamic_configuration]) do
- updated =
- Enum.map(configs, fn
- %{"group" => group, "key" => key, "delete" => "true"} = params ->
- {:ok, config} = Config.delete(%{group: group, key: key, subkeys: params["subkeys"]})
- config
-
- %{"group" => group, "key" => key, "value" => value} ->
- {:ok, config} = Config.update_or_create(%{group: group, key: key, value: value})
- config
+ with :ok <- configurable_from_database(conn) do
+ {_errors, results} =
+ configs
+ |> Enum.filter(&whitelisted_config?/1)
+ |> Enum.map(fn
+ %{"group" => group, "key" => key, "delete" => true} = params ->
+ ConfigDB.delete(%{group: group, key: key, subkeys: params["subkeys"]})
+
+ %{"group" => group, "key" => key, "value" => value} ->
+ ConfigDB.update_or_create(%{group: group, key: key, value: value})
+ end)
+ |> Enum.split_with(fn result -> elem(result, 0) == :error end)
+
+ {deleted, updated} =
+ results
+ |> Enum.map(fn {:ok, config} ->
+ Map.put(config, :db, ConfigDB.get_db_keys(config))
+ end)
+ |> Enum.split_with(fn config ->
+ Ecto.get_meta(config, :state) == :deleted
+ end)
+
+ Config.TransferTask.load_and_update_env(deleted, false)
+
+ if !Restarter.Pleroma.need_reboot?() do
+ changed_reboot_settings? =
+ (updated ++ deleted)
+ |> Enum.any?(fn config ->
+ group = ConfigDB.from_string(config.group)
+ key = ConfigDB.from_string(config.key)
+ value = ConfigDB.from_binary(config.value)
+ Config.TransferTask.pleroma_need_restart?(group, key, value)
end)
- |> Enum.reject(&is_nil(&1))
- Pleroma.Config.TransferTask.load_and_update_env()
- Mix.Tasks.Pleroma.Config.run(["migrate_from_db", Pleroma.Config.get(:env), "false"])
- updated
- else
- []
+ if changed_reboot_settings?, do: Restarter.Pleroma.need_reboot()
end
- conn
- |> put_view(ConfigView)
- |> render("index.json", %{configs: updated})
+ conn
+ |> put_view(ConfigView)
+ |> render("index.json", %{configs: updated, need_reboot: Restarter.Pleroma.need_reboot?()})
+ end
+ end
+
+ def restart(conn, _params) do
+ with :ok <- configurable_from_database(conn) do
+ Restarter.Pleroma.restart(Config.get(:env), 50)
+
+ json(conn, %{})
+ end
+ end
+
+ def need_reboot(conn, _params) do
+ json(conn, %{need_reboot: Restarter.Pleroma.need_reboot?()})
+ end
+
+ defp configurable_from_database(conn) do
+ if Config.get(:configurable_from_database) do
+ :ok
+ else
+ errors(
+ conn,
+ {:error, "To use this endpoint you need to enable configuration from database."}
+ )
+ end
+ end
+
+ defp whitelisted_config?(group, key) do
+ if whitelisted_configs = Config.get(:database_config_whitelist) do
+ Enum.any?(whitelisted_configs, fn
+ {whitelisted_group} ->
+ group == inspect(whitelisted_group)
+
+ {whitelisted_group, whitelisted_key} ->
+ group == inspect(whitelisted_group) && key == inspect(whitelisted_key)
+ end)
+ else
+ true
+ end
+ end
+
+ defp whitelisted_config?(%{"group" => group, "key" => key}) do
+ whitelisted_config?(group, key)
+ end
+
+ defp whitelisted_config?(%{:group => group} = config) do
+ whitelisted_config?(group, config[:key])
end
def reload_emoji(conn, _params) do
@@ -774,25 +1047,137 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
conn |> json("ok")
end
- def errors(conn, {:error, :not_found}) do
+ def confirm_email(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) do
+ users = nicknames |> Enum.map(&User.get_cached_by_nickname/1)
+
+ User.toggle_confirmation(users)
+
+ ModerationLog.insert_log(%{
+ actor: admin,
+ subject: users,
+ action: "confirm_email"
+ })
+
+ conn |> json("")
+ end
+
+ def resend_confirmation_email(%{assigns: %{user: admin}} = conn, %{"nicknames" => nicknames}) do
+ users = nicknames |> Enum.map(&User.get_cached_by_nickname/1)
+
+ User.try_send_confirmation_email(users)
+
+ ModerationLog.insert_log(%{
+ actor: admin,
+ subject: users,
+ action: "resend_confirmation_email"
+ })
+
+ conn |> json("")
+ end
+
+ def oauth_app_create(conn, params) do
+ params =
+ if params["name"] do
+ Map.put(params, "client_name", params["name"])
+ else
+ params
+ end
+
+ result =
+ case App.create(params) do
+ {:ok, app} ->
+ AppView.render("show.json", %{app: app, admin: true})
+
+ {:error, changeset} ->
+ App.errors(changeset)
+ end
+
+ json(conn, result)
+ end
+
+ def oauth_app_update(conn, params) do
+ params =
+ if params["name"] do
+ Map.put(params, "client_name", params["name"])
+ else
+ params
+ end
+
+ with {:ok, app} <- App.update(params) do
+ json(conn, AppView.render("show.json", %{app: app, admin: true}))
+ else
+ {:error, changeset} ->
+ json(conn, App.errors(changeset))
+
+ nil ->
+ json_response(conn, :bad_request, "")
+ end
+ end
+
+ def oauth_app_list(conn, params) do
+ {page, page_size} = page_params(params)
+
+ search_params = %{
+ client_name: params["name"],
+ client_id: params["client_id"],
+ page: page,
+ page_size: page_size
+ }
+
+ search_params =
+ if Map.has_key?(params, "trusted") do
+ Map.put(search_params, :trusted, params["trusted"])
+ else
+ search_params
+ end
+
+ with {:ok, apps, count} <- App.search(search_params) do
+ json(
+ conn,
+ AppView.render("index.json",
+ apps: apps,
+ count: count,
+ page_size: page_size,
+ admin: true
+ )
+ )
+ end
+ end
+
+ def oauth_app_delete(conn, params) do
+ with {:ok, _app} <- App.destroy(params["id"]) do
+ json_response(conn, :no_content, "")
+ else
+ _ -> json_response(conn, :bad_request, "")
+ end
+ end
+
+ def stats(conn, _) do
+ count = Stats.get_status_visibility_count()
+
+ conn
+ |> json(%{"status_visibility" => count})
+ end
+
+ defp errors(conn, {:error, :not_found}) do
conn
|> put_status(:not_found)
|> json(dgettext("errors", "Not found"))
end
- def errors(conn, {:error, reason}) do
+ defp errors(conn, {:error, reason}) do
conn
|> put_status(:bad_request)
|> json(reason)
end
- def errors(conn, {:param_cast, _}) do
+ defp errors(conn, {:param_cast, _}) do
conn
|> put_status(:bad_request)
|> json(dgettext("errors", "Invalid parameters"))
end
- def errors(conn, _) do
+ defp errors(conn, _) do
conn
|> put_status(:internal_server_error)
|> json(dgettext("errors", "Something went wrong"))
diff --git a/lib/pleroma/web/admin_api/config.ex b/lib/pleroma/web/admin_api/config.ex
deleted file mode 100644
index 1917a5580..000000000
--- a/lib/pleroma/web/admin_api/config.ex
+++ /dev/null
@@ -1,182 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Web.AdminAPI.Config do
- use Ecto.Schema
- import Ecto.Changeset
- import Pleroma.Web.Gettext
- alias __MODULE__
- alias Pleroma.Repo
-
- @type t :: %__MODULE__{}
-
- schema "config" do
- field(:key, :string)
- field(:group, :string)
- field(:value, :binary)
-
- timestamps()
- end
-
- @spec get_by_params(map()) :: Config.t() | nil
- def get_by_params(params), do: Repo.get_by(Config, params)
-
- @spec changeset(Config.t(), map()) :: Changeset.t()
- def changeset(config, params \\ %{}) do
- config
- |> cast(params, [:key, :group, :value])
- |> validate_required([:key, :group, :value])
- |> unique_constraint(:key, name: :config_group_key_index)
- end
-
- @spec create(map()) :: {:ok, Config.t()} | {:error, Changeset.t()}
- def create(params) do
- %Config{}
- |> changeset(Map.put(params, :value, transform(params[:value])))
- |> Repo.insert()
- end
-
- @spec update(Config.t(), map()) :: {:ok, Config} | {:error, Changeset.t()}
- def update(%Config{} = config, %{value: value}) do
- config
- |> change(value: transform(value))
- |> Repo.update()
- end
-
- @spec update_or_create(map()) :: {:ok, Config.t()} | {:error, Changeset.t()}
- def update_or_create(params) do
- with %Config{} = config <- Config.get_by_params(Map.take(params, [:group, :key])) do
- Config.update(config, params)
- else
- nil -> Config.create(params)
- end
- end
-
- @spec delete(map()) :: {:ok, Config.t()} | {:error, Changeset.t()}
- def delete(params) do
- with %Config{} = config <- Config.get_by_params(Map.delete(params, :subkeys)) do
- if params[:subkeys] do
- updated_value =
- Keyword.drop(
- :erlang.binary_to_term(config.value),
- Enum.map(params[:subkeys], &do_transform_string(&1))
- )
-
- Config.update(config, %{value: updated_value})
- else
- Repo.delete(config)
- {:ok, nil}
- end
- else
- nil ->
- err =
- dgettext("errors", "Config with params %{params} not found", params: inspect(params))
-
- {:error, err}
- end
- end
-
- @spec from_binary(binary()) :: term()
- def from_binary(binary), do: :erlang.binary_to_term(binary)
-
- @spec from_binary_with_convert(binary()) :: any()
- def from_binary_with_convert(binary) do
- from_binary(binary)
- |> do_convert()
- end
-
- defp do_convert(entity) when is_list(entity) do
- for v <- entity, into: [], do: do_convert(v)
- end
-
- defp do_convert(%Regex{} = entity), do: inspect(entity)
-
- defp do_convert(entity) when is_map(entity) do
- for {k, v} <- entity, into: %{}, do: {do_convert(k), do_convert(v)}
- end
-
- defp do_convert({:dispatch, [entity]}), do: %{"tuple" => [":dispatch", [inspect(entity)]]}
- defp do_convert({:partial_chain, entity}), do: %{"tuple" => [":partial_chain", inspect(entity)]}
-
- defp do_convert(entity) when is_tuple(entity),
- do: %{"tuple" => do_convert(Tuple.to_list(entity))}
-
- defp do_convert(entity) when is_boolean(entity) or is_number(entity) or is_nil(entity),
- do: entity
-
- defp do_convert(entity) when is_atom(entity) do
- string = to_string(entity)
-
- if String.starts_with?(string, "Elixir."),
- do: do_convert(string),
- else: ":" <> string
- end
-
- defp do_convert("Elixir." <> module_name), do: module_name
-
- defp do_convert(entity) when is_binary(entity), do: entity
-
- @spec transform(any()) :: binary()
- def transform(entity) when is_binary(entity) or is_map(entity) or is_list(entity) do
- :erlang.term_to_binary(do_transform(entity))
- end
-
- def transform(entity), do: :erlang.term_to_binary(entity)
-
- defp do_transform(%Regex{} = entity), do: entity
-
- defp do_transform(%{"tuple" => [":dispatch", [entity]]}) do
- {dispatch_settings, []} = do_eval(entity)
- {:dispatch, [dispatch_settings]}
- end
-
- defp do_transform(%{"tuple" => [":partial_chain", entity]}) do
- {partial_chain, []} = do_eval(entity)
- {:partial_chain, partial_chain}
- end
-
- defp do_transform(%{"tuple" => entity}) do
- Enum.reduce(entity, {}, fn val, acc -> Tuple.append(acc, do_transform(val)) end)
- end
-
- defp do_transform(entity) when is_map(entity) do
- for {k, v} <- entity, into: %{}, do: {do_transform(k), do_transform(v)}
- end
-
- defp do_transform(entity) when is_list(entity) do
- for v <- entity, into: [], do: do_transform(v)
- end
-
- defp do_transform(entity) when is_binary(entity) do
- String.trim(entity)
- |> do_transform_string()
- end
-
- defp do_transform(entity), do: entity
-
- defp do_transform_string("~r/" <> pattern) do
- modificator = String.split(pattern, "/") |> List.last()
- pattern = String.trim_trailing(pattern, "/" <> modificator)
-
- case modificator do
- "" -> ~r/#{pattern}/
- "i" -> ~r/#{pattern}/i
- "u" -> ~r/#{pattern}/u
- "s" -> ~r/#{pattern}/s
- end
- end
-
- defp do_transform_string(":" <> atom), do: String.to_atom(atom)
-
- defp do_transform_string(value) do
- if String.starts_with?(value, "Pleroma") or String.starts_with?(value, "Phoenix"),
- do: String.to_existing_atom("Elixir." <> value),
- else: value
- end
-
- defp do_eval(entity) do
- cleaned_string = String.replace(entity, ~r/[^\w|^{:,[|^,|^[|^\]^}|^\/|^\.|^"]^\s/, "")
- Code.eval_string(cleaned_string, [], requires: [], macros: [])
- end
-end
diff --git a/lib/pleroma/web/admin_api/report.ex b/lib/pleroma/web/admin_api/report.ex
index c751dc2be..8660d6520 100644
--- a/lib/pleroma/web/admin_api/report.ex
+++ b/lib/pleroma/web/admin_api/report.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.AdminAPI.Report do
@@ -13,8 +13,9 @@ defmodule Pleroma.Web.AdminAPI.Report do
account = User.get_cached_by_ap_id(account_ap_id)
statuses =
- Enum.map(status_ap_ids, fn ap_id ->
- Activity.get_by_ap_id_with_object(ap_id)
+ Enum.map(status_ap_ids, fn
+ act when is_map(act) -> Activity.get_by_ap_id_with_object(act["id"])
+ act when is_binary(act) -> Activity.get_by_ap_id_with_object(act)
end)
%{report: report, user: user, account: account, statuses: statuses}
diff --git a/lib/pleroma/web/admin_api/search.ex b/lib/pleroma/web/admin_api/search.ex
index ed919833e..c28efadd5 100644
--- a/lib/pleroma/web/admin_api/search.ex
+++ b/lib/pleroma/web/admin_api/search.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.AdminAPI.Search do
@@ -18,7 +18,12 @@ defmodule Pleroma.Web.AdminAPI.Search do
@spec user(map()) :: {:ok, [User.t()], pos_integer()}
def user(params \\ %{}) do
- query = User.Query.build(params) |> order_by([u], u.nickname)
+ query =
+ params
+ |> Map.drop([:page, :page_size])
+ |> Map.put(:exclude_service_users, true)
+ |> User.Query.build()
+ |> order_by([u], u.nickname)
paginated_query =
User.Query.paginate(query, params[:page] || 1, params[:page_size] || @page_size)
diff --git a/lib/pleroma/web/admin_api/views/account_view.ex b/lib/pleroma/web/admin_api/views/account_view.ex
index 441269162..46dadb5ee 100644
--- a/lib/pleroma/web/admin_api/views/account_view.ex
+++ b/lib/pleroma/web/admin_api/views/account_view.ex
@@ -1,14 +1,14 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.AdminAPI.AccountView do
use Pleroma.Web, :view
- alias Pleroma.HTML
alias Pleroma.User
- alias Pleroma.User.Info
+ alias Pleroma.Web.AdminAPI
alias Pleroma.Web.AdminAPI.AccountView
+ alias Pleroma.Web.MastodonAPI
alias Pleroma.Web.MediaProxy
def render("index.json", %{users: users, count: count, page_size: page_size}) do
@@ -25,19 +25,58 @@ defmodule Pleroma.Web.AdminAPI.AccountView do
}
end
+ def render("credentials.json", %{user: user, for: for_user}) do
+ user = User.sanitize_html(user, User.html_filter_policy(for_user))
+ avatar = User.avatar_url(user) |> MediaProxy.url()
+ banner = User.banner_url(user) |> MediaProxy.url()
+ background = image_url(user.background) |> MediaProxy.url()
+
+ user
+ |> Map.take([
+ :id,
+ :bio,
+ :email,
+ :fields,
+ :name,
+ :nickname,
+ :locked,
+ :no_rich_text,
+ :default_scope,
+ :hide_follows,
+ :hide_followers_count,
+ :hide_follows_count,
+ :hide_followers,
+ :hide_favorites,
+ :allow_following_move,
+ :show_role,
+ :skip_thread_containment,
+ :pleroma_settings_store,
+ :raw_fields,
+ :discoverable,
+ :actor_type
+ ])
+ |> Map.merge(%{
+ "avatar" => avatar,
+ "banner" => banner,
+ "background" => background
+ })
+ end
+
def render("show.json", %{user: user}) do
avatar = User.avatar_url(user) |> MediaProxy.url()
- display_name = HTML.strip_tags(user.name || user.nickname)
+ display_name = Pleroma.HTML.strip_tags(user.name || user.nickname)
+ user = User.sanitize_html(user, FastSanitize.Sanitizer.StripTags)
%{
"id" => user.id,
"avatar" => avatar,
"nickname" => user.nickname,
"display_name" => display_name,
- "deactivated" => user.info.deactivated,
+ "deactivated" => user.deactivated,
"local" => user.local,
- "roles" => Info.roles(user.info),
- "tags" => user.tags || []
+ "roles" => User.roles(user),
+ "tags" => user.tags || [],
+ "confirmation_pending" => user.confirmation_pending
}
end
@@ -82,6 +121,13 @@ defmodule Pleroma.Web.AdminAPI.AccountView do
}
end
+ def merge_account_views(%User{} = user) do
+ MastodonAPI.AccountView.render("show.json", %{user: user})
+ |> Map.merge(AdminAPI.AccountView.render("show.json", %{user: user}))
+ end
+
+ def merge_account_views(_), do: %{}
+
defp parse_error([]), do: ""
defp parse_error(errors) do
@@ -104,4 +150,7 @@ defmodule Pleroma.Web.AdminAPI.AccountView do
""
end
end
+
+ defp image_url(%{"url" => [%{"href" => href} | _]}), do: href
+ defp image_url(_), do: nil
end
diff --git a/lib/pleroma/web/admin_api/views/config_view.ex b/lib/pleroma/web/admin_api/views/config_view.ex
index 49add0b6e..587ef760e 100644
--- a/lib/pleroma/web/admin_api/views/config_view.ex
+++ b/lib/pleroma/web/admin_api/views/config_view.ex
@@ -1,21 +1,33 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.AdminAPI.ConfigView do
use Pleroma.Web, :view
- def render("index.json", %{configs: configs}) do
- %{
+ def render("index.json", %{configs: configs} = params) do
+ map = %{
configs: render_many(configs, __MODULE__, "show.json", as: :config)
}
+
+ if params[:need_reboot] do
+ Map.put(map, :need_reboot, true)
+ else
+ map
+ end
end
def render("show.json", %{config: config}) do
- %{
+ map = %{
key: config.key,
group: config.group,
- value: Pleroma.Web.AdminAPI.Config.from_binary_with_convert(config.value)
+ value: Pleroma.ConfigDB.from_binary_with_convert(config.value)
}
+
+ if config.db != [] do
+ Map.put(map, :db, config.db)
+ else
+ map
+ end
end
end
diff --git a/lib/pleroma/web/admin_api/views/moderation_log_view.ex b/lib/pleroma/web/admin_api/views/moderation_log_view.ex
index e7752d1f3..112f9e0e1 100644
--- a/lib/pleroma/web/admin_api/views/moderation_log_view.ex
+++ b/lib/pleroma/web/admin_api/views/moderation_log_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.AdminAPI.ModerationLogView do
diff --git a/lib/pleroma/web/admin_api/views/report_view.ex b/lib/pleroma/web/admin_api/views/report_view.ex
index 101a74c63..f432b8c2c 100644
--- a/lib/pleroma/web/admin_api/views/report_view.ex
+++ b/lib/pleroma/web/admin_api/views/report_view.ex
@@ -1,15 +1,19 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.AdminAPI.ReportView do
use Pleroma.Web, :view
+
alias Pleroma.HTML
alias Pleroma.User
+ alias Pleroma.Web.AdminAPI
alias Pleroma.Web.AdminAPI.Report
alias Pleroma.Web.CommonAPI.Utils
alias Pleroma.Web.MastodonAPI.StatusView
+ defdelegate merge_account_views(user), to: AdminAPI.AccountView
+
def render("index.json", %{reports: reports}) do
%{
reports:
@@ -37,15 +41,35 @@ defmodule Pleroma.Web.AdminAPI.ReportView do
actor: merge_account_views(user),
content: content,
created_at: created_at,
- statuses: StatusView.render("index.json", %{activities: statuses, as: :activity}),
- state: report.data["state"]
+ statuses:
+ StatusView.render("index.json", %{
+ activities: statuses,
+ as: :activity
+ }),
+ state: report.data["state"],
+ notes: render(__MODULE__, "index_notes.json", %{notes: report.report_notes})
}
end
- defp merge_account_views(%User{} = user) do
- Pleroma.Web.MastodonAPI.AccountView.render("show.json", %{user: user})
- |> Map.merge(Pleroma.Web.AdminAPI.AccountView.render("show.json", %{user: user}))
+ def render("index_notes.json", %{notes: notes}) when is_list(notes) do
+ Enum.map(notes, &render(__MODULE__, "show_note.json", &1))
end
- defp merge_account_views(_), do: %{}
+ def render("index_notes.json", _), do: []
+
+ def render("show_note.json", %{
+ id: id,
+ content: content,
+ user_id: user_id,
+ inserted_at: inserted_at
+ }) do
+ user = User.get_by_id(user_id)
+
+ %{
+ id: id,
+ content: content,
+ user: merge_account_views(user),
+ created_at: Utils.to_masto_date(inserted_at)
+ }
+ end
end
diff --git a/lib/pleroma/web/admin_api/views/status_view.ex b/lib/pleroma/web/admin_api/views/status_view.ex
new file mode 100644
index 000000000..500800be2
--- /dev/null
+++ b/lib/pleroma/web/admin_api/views/status_view.ex
@@ -0,0 +1,25 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.AdminAPI.StatusView do
+ use Pleroma.Web, :view
+
+ require Pleroma.Constants
+
+ alias Pleroma.Web.AdminAPI
+ alias Pleroma.Web.MastodonAPI
+
+ defdelegate merge_account_views(user), to: AdminAPI.AccountView
+
+ def render("index.json", opts) do
+ safe_render_many(opts.activities, __MODULE__, "show.json", opts)
+ end
+
+ def render("show.json", %{activity: %{data: %{"object" => _object}} = activity} = opts) do
+ user = MastodonAPI.StatusView.get_user(activity.data["actor"])
+
+ MastodonAPI.StatusView.render("show.json", opts)
+ |> Map.merge(%{account: merge_account_views(user)})
+ end
+end
diff --git a/lib/pleroma/web/api_spec.ex b/lib/pleroma/web/api_spec.ex
new file mode 100644
index 000000000..79fd5f871
--- /dev/null
+++ b/lib/pleroma/web/api_spec.ex
@@ -0,0 +1,57 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec do
+ alias OpenApiSpex.OpenApi
+ alias OpenApiSpex.Operation
+ alias Pleroma.Web.Endpoint
+ alias Pleroma.Web.Router
+
+ @behaviour OpenApi
+
+ @impl OpenApi
+ def spec do
+ %OpenApi{
+ servers: [
+ # Populate the Server info from a phoenix endpoint
+ OpenApiSpex.Server.from_endpoint(Endpoint)
+ ],
+ info: %OpenApiSpex.Info{
+ title: "Pleroma",
+ description: Application.spec(:pleroma, :description) |> to_string(),
+ version: Application.spec(:pleroma, :vsn) |> to_string()
+ },
+ # populate the paths from a phoenix router
+ paths: OpenApiSpex.Paths.from_router(Router),
+ components: %OpenApiSpex.Components{
+ parameters: %{
+ "accountIdOrNickname" =>
+ Operation.parameter(:id, :path, :string, "Account ID or nickname",
+ example: "123",
+ required: true
+ )
+ },
+ securitySchemes: %{
+ "oAuth" => %OpenApiSpex.SecurityScheme{
+ type: "oauth2",
+ flows: %OpenApiSpex.OAuthFlows{
+ password: %OpenApiSpex.OAuthFlow{
+ authorizationUrl: "/oauth/authorize",
+ tokenUrl: "/oauth/token",
+ scopes: %{
+ "read" => "read",
+ "write" => "write",
+ "follow" => "follow",
+ "push" => "push"
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ # discover request/response schemas from path specs
+ |> OpenApiSpex.resolve_schema_modules()
+ end
+end
diff --git a/lib/pleroma/web/api_spec/cast_and_validate.ex b/lib/pleroma/web/api_spec/cast_and_validate.ex
new file mode 100644
index 000000000..bd9026237
--- /dev/null
+++ b/lib/pleroma/web/api_spec/cast_and_validate.ex
@@ -0,0 +1,139 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2019-2020 Moxley Stratton, Mike Buhot <https://github.com/open-api-spex/open_api_spex>, MPL-2.0
+# Copyright © 2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.CastAndValidate do
+ @moduledoc """
+ This plug is based on [`OpenApiSpex.Plug.CastAndValidate`]
+ (https://github.com/open-api-spex/open_api_spex/blob/master/lib/open_api_spex/plug/cast_and_validate.ex).
+ The main difference is ignoring unexpected query params instead of throwing
+ an error and a config option (`[Pleroma.Web.ApiSpec.CastAndValidate, :strict]`)
+ to disable this behavior. Also, the default rendering error module
+ is `Pleroma.Web.ApiSpec.RenderError`.
+ """
+
+ @behaviour Plug
+
+ alias Plug.Conn
+
+ @impl Plug
+ def init(opts) do
+ opts
+ |> Map.new()
+ |> Map.put_new(:render_error, Pleroma.Web.ApiSpec.RenderError)
+ end
+
+ @impl Plug
+ def call(%{private: %{open_api_spex: private_data}} = conn, %{
+ operation_id: operation_id,
+ render_error: render_error
+ }) do
+ spec = private_data.spec
+ operation = private_data.operation_lookup[operation_id]
+
+ content_type =
+ case Conn.get_req_header(conn, "content-type") do
+ [header_value | _] ->
+ header_value
+ |> String.split(";")
+ |> List.first()
+
+ _ ->
+ nil
+ end
+
+ private_data = Map.put(private_data, :operation_id, operation_id)
+ conn = Conn.put_private(conn, :open_api_spex, private_data)
+
+ case cast_and_validate(spec, operation, conn, content_type, strict?()) do
+ {:ok, conn} ->
+ conn
+
+ {:error, reason} ->
+ opts = render_error.init(reason)
+
+ conn
+ |> render_error.call(opts)
+ |> Plug.Conn.halt()
+ end
+ end
+
+ def call(
+ %{
+ private: %{
+ phoenix_controller: controller,
+ phoenix_action: action,
+ open_api_spex: private_data
+ }
+ } = conn,
+ opts
+ ) do
+ operation =
+ case private_data.operation_lookup[{controller, action}] do
+ nil ->
+ operation_id = controller.open_api_operation(action).operationId
+ operation = private_data.operation_lookup[operation_id]
+
+ operation_lookup =
+ private_data.operation_lookup
+ |> Map.put({controller, action}, operation)
+
+ OpenApiSpex.Plug.Cache.adapter().put(
+ private_data.spec_module,
+ {private_data.spec, operation_lookup}
+ )
+
+ operation
+
+ operation ->
+ operation
+ end
+
+ if operation.operationId do
+ call(conn, Map.put(opts, :operation_id, operation.operationId))
+ else
+ raise "operationId was not found in action API spec"
+ end
+ end
+
+ def call(conn, opts), do: OpenApiSpex.Plug.CastAndValidate.call(conn, opts)
+
+ defp cast_and_validate(spec, operation, conn, content_type, true = _strict) do
+ OpenApiSpex.cast_and_validate(spec, operation, conn, content_type)
+ end
+
+ defp cast_and_validate(spec, operation, conn, content_type, false = _strict) do
+ case OpenApiSpex.cast_and_validate(spec, operation, conn, content_type) do
+ {:ok, conn} ->
+ {:ok, conn}
+
+ # Remove unexpected query params and cast/validate again
+ {:error, errors} ->
+ query_params =
+ Enum.reduce(errors, conn.query_params, fn
+ %{reason: :unexpected_field, name: name, path: [name]}, params ->
+ Map.delete(params, name)
+
+ %{reason: :invalid_enum, name: nil, path: path, value: value}, params ->
+ path = path |> Enum.reverse() |> tl() |> Enum.reverse() |> list_items_to_string()
+ update_in(params, path, &List.delete(&1, value))
+
+ _, params ->
+ params
+ end)
+
+ conn = %Conn{conn | query_params: query_params}
+ OpenApiSpex.cast_and_validate(spec, operation, conn, content_type)
+ end
+ end
+
+ defp list_items_to_string(list) do
+ Enum.map(list, fn
+ i when is_atom(i) -> to_string(i)
+ i -> i
+ end)
+ end
+
+ defp strict?, do: Pleroma.Config.get([__MODULE__, :strict], false)
+end
diff --git a/lib/pleroma/web/api_spec/helpers.ex b/lib/pleroma/web/api_spec/helpers.ex
new file mode 100644
index 000000000..a9cfe0fed
--- /dev/null
+++ b/lib/pleroma/web/api_spec/helpers.ex
@@ -0,0 +1,71 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Helpers do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.BooleanLike
+
+ def request_body(description, schema_ref, opts \\ []) do
+ media_types = ["application/json", "multipart/form-data", "application/x-www-form-urlencoded"]
+
+ content =
+ media_types
+ |> Enum.map(fn type ->
+ {type,
+ %OpenApiSpex.MediaType{
+ schema: schema_ref,
+ example: opts[:example],
+ examples: opts[:examples]
+ }}
+ end)
+ |> Enum.into(%{})
+
+ %OpenApiSpex.RequestBody{
+ description: description,
+ content: content,
+ required: opts[:required] || false
+ }
+ end
+
+ def pagination_params do
+ [
+ Operation.parameter(:max_id, :query, :string, "Return items older than this ID"),
+ Operation.parameter(:min_id, :query, :string, "Return the oldest items newer than this ID"),
+ Operation.parameter(
+ :since_id,
+ :query,
+ :string,
+ "Return the newest items newer than this ID"
+ ),
+ Operation.parameter(
+ :limit,
+ :query,
+ %Schema{type: :integer, default: 20},
+ "Maximum number of items to return. Will be ignored if it's more than 40"
+ )
+ ]
+ end
+
+ def with_relationships_param do
+ Operation.parameter(
+ :with_relationships,
+ :query,
+ BooleanLike,
+ "Embed relationships into accounts."
+ )
+ end
+
+ def empty_object_response do
+ Operation.response("Empty object", "application/json", %Schema{type: :object, example: %{}})
+ end
+
+ def empty_array_response do
+ Operation.response("Empty array", "application/json", %Schema{type: :array, example: []})
+ end
+
+ def no_content_response do
+ Operation.response("No Content", "application/json", %Schema{type: :string, example: ""})
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/account_operation.ex b/lib/pleroma/web/api_spec/operations/account_operation.ex
new file mode 100644
index 000000000..934f6038e
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/account_operation.ex
@@ -0,0 +1,730 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.AccountOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Reference
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Account
+ alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship
+ alias Pleroma.Web.ApiSpec.Schemas.ActorType
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.BooleanLike
+ alias Pleroma.Web.ApiSpec.Schemas.List
+ alias Pleroma.Web.ApiSpec.Schemas.Status
+ alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ @spec open_api_operation(atom) :: Operation.t()
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ @spec create_operation() :: Operation.t()
+ def create_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Register an account",
+ description:
+ "Creates a user and account records. Returns an account access token for the app that initiated the request. The app should save this token for later, and should wait for the user to confirm their account by clicking a link in their email inbox.",
+ operationId: "AccountController.create",
+ requestBody: request_body("Parameters", create_request(), required: true),
+ responses: %{
+ 200 => Operation.response("Account", "application/json", create_response()),
+ 400 => Operation.response("Error", "application/json", ApiError),
+ 403 => Operation.response("Error", "application/json", ApiError),
+ 429 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def verify_credentials_operation do
+ %Operation{
+ tags: ["accounts"],
+ description: "Test to make sure that the user token works.",
+ summary: "Verify account credentials",
+ operationId: "AccountController.verify_credentials",
+ security: [%{"oAuth" => ["read:accounts"]}],
+ responses: %{
+ 200 => Operation.response("Account", "application/json", Account)
+ }
+ }
+ end
+
+ def update_credentials_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Update account credentials",
+ description: "Update the user's display and preferences.",
+ operationId: "AccountController.update_credentials",
+ security: [%{"oAuth" => ["write:accounts"]}],
+ requestBody: request_body("Parameters", update_creadentials_request(), required: true),
+ responses: %{
+ 200 => Operation.response("Account", "application/json", Account),
+ 403 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def relationships_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Check relationships to other accounts",
+ operationId: "AccountController.relationships",
+ description: "Find out whether a given account is followed, blocked, muted, etc.",
+ security: [%{"oAuth" => ["read:follows"]}],
+ parameters: [
+ Operation.parameter(
+ :id,
+ :query,
+ %Schema{
+ oneOf: [%Schema{type: :array, items: %Schema{type: :string}}, %Schema{type: :string}]
+ },
+ "Account IDs",
+ example: "123"
+ )
+ ],
+ responses: %{
+ 200 => Operation.response("Account", "application/json", array_of_relationships())
+ }
+ }
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Account",
+ operationId: "AccountController.show",
+ description: "View information about a profile.",
+ parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}],
+ responses: %{
+ 200 => Operation.response("Account", "application/json", Account),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def statuses_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Statuses",
+ operationId: "AccountController.statuses",
+ description:
+ "Statuses posted to the given account. Public (for public statuses only), or user token + `read:statuses` (for private statuses the user is authorized to see)",
+ parameters:
+ [
+ %Reference{"$ref": "#/components/parameters/accountIdOrNickname"},
+ Operation.parameter(:pinned, :query, BooleanLike, "Include only pinned statuses"),
+ Operation.parameter(:tagged, :query, :string, "With tag"),
+ Operation.parameter(
+ :only_media,
+ :query,
+ BooleanLike,
+ "Include only statuses with media attached"
+ ),
+ Operation.parameter(
+ :with_muted,
+ :query,
+ BooleanLike,
+ "Include statuses from muted acccounts."
+ ),
+ Operation.parameter(:exclude_reblogs, :query, BooleanLike, "Exclude reblogs"),
+ Operation.parameter(:exclude_replies, :query, BooleanLike, "Exclude replies"),
+ Operation.parameter(
+ :exclude_visibilities,
+ :query,
+ %Schema{type: :array, items: VisibilityScope},
+ "Exclude visibilities"
+ )
+ ] ++ pagination_params(),
+ responses: %{
+ 200 => Operation.response("Statuses", "application/json", array_of_statuses()),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def followers_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Followers",
+ operationId: "AccountController.followers",
+ security: [%{"oAuth" => ["read:accounts"]}],
+ description:
+ "Accounts which follow the given account, if network is not hidden by the account owner.",
+ parameters: [
+ %Reference{"$ref": "#/components/parameters/accountIdOrNickname"},
+ with_relationships_param() | pagination_params()
+ ],
+ responses: %{
+ 200 => Operation.response("Accounts", "application/json", array_of_accounts())
+ }
+ }
+ end
+
+ def following_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Following",
+ operationId: "AccountController.following",
+ security: [%{"oAuth" => ["read:accounts"]}],
+ description:
+ "Accounts which the given account is following, if network is not hidden by the account owner.",
+ parameters: [
+ %Reference{"$ref": "#/components/parameters/accountIdOrNickname"},
+ with_relationships_param() | pagination_params()
+ ],
+ responses: %{200 => Operation.response("Accounts", "application/json", array_of_accounts())}
+ }
+ end
+
+ def lists_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Lists containing this account",
+ operationId: "AccountController.lists",
+ security: [%{"oAuth" => ["read:lists"]}],
+ description: "User lists that you have added this account to.",
+ parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}],
+ responses: %{200 => Operation.response("Lists", "application/json", array_of_lists())}
+ }
+ end
+
+ def follow_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Follow",
+ operationId: "AccountController.follow",
+ security: [%{"oAuth" => ["follow", "write:follows"]}],
+ description: "Follow the given account",
+ parameters: [
+ %Reference{"$ref": "#/components/parameters/accountIdOrNickname"},
+ Operation.parameter(
+ :reblogs,
+ :query,
+ BooleanLike,
+ "Receive this account's reblogs in home timeline? Defaults to true."
+ )
+ ],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship),
+ 400 => Operation.response("Error", "application/json", ApiError),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def unfollow_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Unfollow",
+ operationId: "AccountController.unfollow",
+ security: [%{"oAuth" => ["follow", "write:follows"]}],
+ description: "Unfollow the given account",
+ parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship),
+ 400 => Operation.response("Error", "application/json", ApiError),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def mute_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Mute",
+ operationId: "AccountController.mute",
+ security: [%{"oAuth" => ["follow", "write:mutes"]}],
+ requestBody: request_body("Parameters", mute_request()),
+ description:
+ "Mute the given account. Clients should filter statuses and notifications from this account, if received (e.g. due to a boost in the Home timeline).",
+ parameters: [
+ %Reference{"$ref": "#/components/parameters/accountIdOrNickname"},
+ Operation.parameter(
+ :notifications,
+ :query,
+ %Schema{allOf: [BooleanLike], default: true},
+ "Mute notifications in addition to statuses? Defaults to `true`."
+ )
+ ],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship)
+ }
+ }
+ end
+
+ def unmute_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Unmute",
+ operationId: "AccountController.unmute",
+ security: [%{"oAuth" => ["follow", "write:mutes"]}],
+ description: "Unmute the given account.",
+ parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship)
+ }
+ }
+ end
+
+ def block_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Block",
+ operationId: "AccountController.block",
+ security: [%{"oAuth" => ["follow", "write:blocks"]}],
+ description:
+ "Block the given account. Clients should filter statuses from this account if received (e.g. due to a boost in the Home timeline)",
+ parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship)
+ }
+ }
+ end
+
+ def unblock_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Unblock",
+ operationId: "AccountController.unblock",
+ security: [%{"oAuth" => ["follow", "write:blocks"]}],
+ description: "Unblock the given account.",
+ parameters: [%Reference{"$ref": "#/components/parameters/accountIdOrNickname"}],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship)
+ }
+ }
+ end
+
+ def follow_by_uri_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Follow by URI",
+ operationId: "AccountController.follows",
+ security: [%{"oAuth" => ["follow", "write:follows"]}],
+ requestBody: request_body("Parameters", follow_by_uri_request(), required: true),
+ responses: %{
+ 200 => Operation.response("Account", "application/json", AccountRelationship),
+ 400 => Operation.response("Error", "application/json", ApiError),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def mutes_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Muted accounts",
+ operationId: "AccountController.mutes",
+ description: "Accounts the user has muted.",
+ security: [%{"oAuth" => ["follow", "read:mutes"]}],
+ responses: %{
+ 200 => Operation.response("Accounts", "application/json", array_of_accounts())
+ }
+ }
+ end
+
+ def blocks_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Blocked users",
+ operationId: "AccountController.blocks",
+ description: "View your blocks. See also accounts/:id/{block,unblock}",
+ security: [%{"oAuth" => ["read:blocks"]}],
+ responses: %{
+ 200 => Operation.response("Accounts", "application/json", array_of_accounts())
+ }
+ }
+ end
+
+ def endorsements_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Endorsements",
+ operationId: "AccountController.endorsements",
+ description: "Not implemented",
+ security: [%{"oAuth" => ["read:accounts"]}],
+ responses: %{
+ 200 => empty_array_response()
+ }
+ }
+ end
+
+ def identity_proofs_operation do
+ %Operation{
+ tags: ["accounts"],
+ summary: "Identity proofs",
+ operationId: "AccountController.identity_proofs",
+ description: "Not implemented",
+ responses: %{
+ 200 => empty_array_response()
+ }
+ }
+ end
+
+ defp create_request do
+ %Schema{
+ title: "AccountCreateRequest",
+ description: "POST body for creating an account",
+ type: :object,
+ required: [:username, :password, :agreement],
+ properties: %{
+ reason: %Schema{
+ type: :string,
+ nullable: true,
+ description:
+ "Text that will be reviewed by moderators if registrations require manual approval"
+ },
+ username: %Schema{type: :string, description: "The desired username for the account"},
+ email: %Schema{
+ type: :string,
+ nullable: true,
+ description:
+ "The email address to be used for login. Required when `account_activation_required` is enabled.",
+ format: :email
+ },
+ password: %Schema{
+ type: :string,
+ description: "The password to be used for login",
+ format: :password
+ },
+ agreement: %Schema{
+ type: :boolean,
+ description:
+ "Whether the user agrees to the local rules, terms, and policies. These should be presented to the user in order to allow them to consent before setting this parameter to TRUE."
+ },
+ locale: %Schema{
+ type: :string,
+ nullable: true,
+ description: "The language of the confirmation email that will be sent"
+ },
+ # Pleroma-specific properties:
+ fullname: %Schema{type: :string, nullable: true, description: "Full name"},
+ bio: %Schema{type: :string, description: "Bio", nullable: true, default: ""},
+ captcha_solution: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Provider-specific captcha solution"
+ },
+ captcha_token: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Provider-specific captcha token"
+ },
+ captcha_answer_data: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Provider-specific captcha data"
+ },
+ token: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Invite token required when the registrations aren't public"
+ }
+ },
+ example: %{
+ "username" => "cofe",
+ "email" => "cofe@example.com",
+ "password" => "secret",
+ "agreement" => "true",
+ "bio" => "☕️"
+ }
+ }
+ end
+
+ defp create_response do
+ %Schema{
+ title: "AccountCreateResponse",
+ description: "Response schema for an account",
+ type: :object,
+ properties: %{
+ token_type: %Schema{type: :string},
+ access_token: %Schema{type: :string},
+ scope: %Schema{type: :array, items: %Schema{type: :string}},
+ created_at: %Schema{type: :integer, format: :"date-time"}
+ },
+ example: %{
+ "access_token" => "i9hAVVzGld86Pl5JtLtizKoXVvtTlSCJvwaugCxvZzk",
+ "created_at" => 1_585_918_714,
+ "scope" => ["read", "write", "follow", "push"],
+ "token_type" => "Bearer"
+ }
+ }
+ end
+
+ defp update_creadentials_request do
+ %Schema{
+ title: "AccountUpdateCredentialsRequest",
+ description: "POST body for creating an account",
+ type: :object,
+ properties: %{
+ bot: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Whether the account has a bot flag."
+ },
+ display_name: %Schema{
+ type: :string,
+ nullable: true,
+ description: "The display name to use for the profile."
+ },
+ note: %Schema{type: :string, description: "The account bio."},
+ avatar: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Avatar image encoded using multipart/form-data",
+ format: :binary
+ },
+ header: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Header image encoded using multipart/form-data",
+ format: :binary
+ },
+ locked: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Whether manual approval of follow requests is required."
+ },
+ fields_attributes: %Schema{
+ nullable: true,
+ oneOf: [
+ %Schema{type: :array, items: attribute_field()},
+ %Schema{type: :object, additionalProperties: %Schema{type: attribute_field()}}
+ ]
+ },
+ # NOTE: `source` field is not supported
+ #
+ # source: %Schema{
+ # type: :object,
+ # properties: %{
+ # privacy: %Schema{type: :string},
+ # sensitive: %Schema{type: :boolean},
+ # language: %Schema{type: :string}
+ # }
+ # },
+
+ # Pleroma-specific fields
+ no_rich_text: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "html tags are stripped from all statuses requested from the API"
+ },
+ hide_followers: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "user's followers will be hidden"
+ },
+ hide_follows: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "user's follows will be hidden"
+ },
+ hide_followers_count: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "user's follower count will be hidden"
+ },
+ hide_follows_count: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "user's follow count will be hidden"
+ },
+ hide_favorites: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "user's favorites timeline will be hidden"
+ },
+ show_role: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "user's role (e.g admin, moderator) will be exposed to anyone in the
+ API"
+ },
+ default_scope: VisibilityScope,
+ pleroma_settings_store: %Schema{
+ type: :object,
+ nullable: true,
+ description: "Opaque user settings to be saved on the backend."
+ },
+ skip_thread_containment: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Skip filtering out broken threads"
+ },
+ allow_following_move: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Allows automatically follow moved following accounts"
+ },
+ pleroma_background_image: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Sets the background image of the user.",
+ format: :binary
+ },
+ discoverable: %Schema{
+ type: :boolean,
+ nullable: true,
+ description:
+ "Discovery of this account in search results and other services is allowed."
+ },
+ actor_type: ActorType
+ },
+ example: %{
+ bot: false,
+ display_name: "cofe",
+ note: "foobar",
+ fields_attributes: [%{name: "foo", value: "bar"}],
+ no_rich_text: false,
+ hide_followers: true,
+ hide_follows: false,
+ hide_followers_count: false,
+ hide_follows_count: false,
+ hide_favorites: false,
+ show_role: false,
+ default_scope: "private",
+ pleroma_settings_store: %{"pleroma-fe" => %{"key" => "val"}},
+ skip_thread_containment: false,
+ allow_following_move: false,
+ discoverable: false,
+ actor_type: "Person"
+ }
+ }
+ end
+
+ def array_of_accounts do
+ %Schema{
+ title: "ArrayOfAccounts",
+ type: :array,
+ items: Account,
+ example: [Account.schema().example]
+ }
+ end
+
+ defp array_of_relationships do
+ %Schema{
+ title: "ArrayOfRelationships",
+ description: "Response schema for account relationships",
+ type: :array,
+ items: AccountRelationship,
+ example: [
+ %{
+ "id" => "1",
+ "following" => true,
+ "showing_reblogs" => true,
+ "followed_by" => true,
+ "blocking" => false,
+ "blocked_by" => true,
+ "muting" => false,
+ "muting_notifications" => false,
+ "requested" => false,
+ "domain_blocking" => false,
+ "subscribing" => false,
+ "endorsed" => true
+ },
+ %{
+ "id" => "2",
+ "following" => true,
+ "showing_reblogs" => true,
+ "followed_by" => true,
+ "blocking" => false,
+ "blocked_by" => true,
+ "muting" => true,
+ "muting_notifications" => false,
+ "requested" => true,
+ "domain_blocking" => false,
+ "subscribing" => false,
+ "endorsed" => false
+ },
+ %{
+ "id" => "3",
+ "following" => true,
+ "showing_reblogs" => true,
+ "followed_by" => true,
+ "blocking" => true,
+ "blocked_by" => false,
+ "muting" => true,
+ "muting_notifications" => false,
+ "requested" => false,
+ "domain_blocking" => true,
+ "subscribing" => true,
+ "endorsed" => false
+ }
+ ]
+ }
+ end
+
+ defp follow_by_uri_request do
+ %Schema{
+ title: "AccountFollowsRequest",
+ description: "POST body for muting an account",
+ type: :object,
+ properties: %{
+ uri: %Schema{type: :string, nullable: true, format: :uri}
+ },
+ required: [:uri]
+ }
+ end
+
+ defp mute_request do
+ %Schema{
+ title: "AccountMuteRequest",
+ description: "POST body for muting an account",
+ type: :object,
+ properties: %{
+ notifications: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Mute notifications in addition to statuses? Defaults to true.",
+ default: true
+ }
+ },
+ example: %{
+ "notifications" => true
+ }
+ }
+ end
+
+ defp array_of_lists do
+ %Schema{
+ title: "ArrayOfLists",
+ description: "Response schema for lists",
+ type: :array,
+ items: List,
+ example: [
+ %{"id" => "123", "title" => "my list"},
+ %{"id" => "1337", "title" => "anotehr list"}
+ ]
+ }
+ end
+
+ defp array_of_statuses do
+ %Schema{
+ title: "ArrayOfStatuses",
+ type: :array,
+ items: Status
+ }
+ end
+
+ defp attribute_field do
+ %Schema{
+ title: "AccountAttributeField",
+ description: "Request schema for account custom fields",
+ type: :object,
+ properties: %{
+ name: %Schema{type: :string},
+ value: %Schema{type: :string}
+ },
+ required: [:name, :value],
+ example: %{
+ "name" => "Website",
+ "value" => "https://pleroma.com"
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/app_operation.ex b/lib/pleroma/web/api_spec/operations/app_operation.ex
new file mode 100644
index 000000000..ae01cbbec
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/app_operation.ex
@@ -0,0 +1,148 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.AppOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Helpers
+
+ @spec open_api_operation(atom) :: Operation.t()
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ @spec create_operation() :: Operation.t()
+ def create_operation do
+ %Operation{
+ tags: ["apps"],
+ summary: "Create an application",
+ description: "Create a new application to obtain OAuth2 credentials",
+ operationId: "AppController.create",
+ requestBody: Helpers.request_body("Parameters", create_request(), required: true),
+ responses: %{
+ 200 => Operation.response("App", "application/json", create_response()),
+ 422 =>
+ Operation.response(
+ "Unprocessable Entity",
+ "application/json",
+ %Schema{
+ type: :object,
+ description:
+ "If a required parameter is missing or improperly formatted, the request will fail.",
+ properties: %{
+ error: %Schema{type: :string}
+ },
+ example: %{
+ "error" => "Validation failed: Redirect URI must be an absolute URI."
+ }
+ }
+ )
+ }
+ }
+ end
+
+ def verify_credentials_operation do
+ %Operation{
+ tags: ["apps"],
+ summary: "Verify your app works",
+ description: "Confirm that the app's OAuth2 credentials work.",
+ operationId: "AppController.verify_credentials",
+ security: [%{"oAuth" => ["read"]}],
+ responses: %{
+ 200 =>
+ Operation.response("App", "application/json", %Schema{
+ type: :object,
+ description:
+ "If the Authorization header was provided with a valid token, you should see your app returned as an Application entity.",
+ properties: %{
+ name: %Schema{type: :string},
+ vapid_key: %Schema{type: :string},
+ website: %Schema{type: :string, nullable: true}
+ },
+ example: %{
+ "name" => "My App",
+ "vapid_key" =>
+ "BCk-QqERU0q-CfYZjcuB6lnyyOYfJ2AifKqfeGIm7Z-HiTU5T9eTG5GxVA0_OH5mMlI4UkkDTpaZwozy0TzdZ2M=",
+ "website" => "https://myapp.com/"
+ }
+ }),
+ 422 =>
+ Operation.response(
+ "Unauthorized",
+ "application/json",
+ %Schema{
+ type: :object,
+ description:
+ "If the Authorization header contains an invalid token, is malformed, or is not present, an error will be returned indicating an authorization failure.",
+ properties: %{
+ error: %Schema{type: :string}
+ },
+ example: %{
+ "error" => "The access token is invalid."
+ }
+ }
+ )
+ }
+ }
+ end
+
+ defp create_request do
+ %Schema{
+ title: "AppCreateRequest",
+ description: "POST body for creating an app",
+ type: :object,
+ properties: %{
+ client_name: %Schema{type: :string, description: "A name for your application."},
+ redirect_uris: %Schema{
+ type: :string,
+ description:
+ "Where the user should be redirected after authorization. To display the authorization code to the user instead of redirecting to a web page, use `urn:ietf:wg:oauth:2.0:oob` in this parameter."
+ },
+ scopes: %Schema{
+ type: :string,
+ description: "Space separated list of scopes",
+ default: "read"
+ },
+ website: %Schema{
+ type: :string,
+ nullable: true,
+ description: "A URL to the homepage of your app"
+ }
+ },
+ required: [:client_name, :redirect_uris],
+ example: %{
+ "client_name" => "My App",
+ "redirect_uris" => "https://myapp.com/auth/callback",
+ "website" => "https://myapp.com/"
+ }
+ }
+ end
+
+ defp create_response do
+ %Schema{
+ title: "AppCreateResponse",
+ description: "Response schema for an app",
+ type: :object,
+ properties: %{
+ id: %Schema{type: :string},
+ name: %Schema{type: :string},
+ client_id: %Schema{type: :string},
+ client_secret: %Schema{type: :string},
+ redirect_uri: %Schema{type: :string},
+ vapid_key: %Schema{type: :string},
+ website: %Schema{type: :string, nullable: true}
+ },
+ example: %{
+ "id" => "123",
+ "name" => "My App",
+ "client_id" => "TWhM-tNSuncnqN7DBJmoyeLnk6K3iJJ71KKXxgL1hPM",
+ "client_secret" => "ZEaFUFmF0umgBX1qKJDjaU99Q31lDkOU8NutzTOoliw",
+ "vapid_key" =>
+ "BCk-QqERU0q-CfYZjcuB6lnyyOYfJ2AifKqfeGIm7Z-HiTU5T9eTG5GxVA0_OH5mMlI4UkkDTpaZwozy0TzdZ2M=",
+ "website" => "https://myapp.com/"
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/conversation_operation.ex b/lib/pleroma/web/api_spec/operations/conversation_operation.ex
new file mode 100644
index 000000000..475468893
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/conversation_operation.ex
@@ -0,0 +1,61 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.ConversationOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Conversation
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["Conversations"],
+ summary: "Show conversation",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ operationId: "ConversationController.index",
+ parameters: [
+ Operation.parameter(
+ :recipients,
+ :query,
+ %Schema{type: :array, items: FlakeID},
+ "Only return conversations with the given recipients (a list of user ids)"
+ )
+ | pagination_params()
+ ],
+ responses: %{
+ 200 =>
+ Operation.response("Array of Conversation", "application/json", %Schema{
+ type: :array,
+ items: Conversation,
+ example: [Conversation.schema().example]
+ })
+ }
+ }
+ end
+
+ def mark_as_read_operation do
+ %Operation{
+ tags: ["Conversations"],
+ summary: "Mark as read",
+ operationId: "ConversationController.mark_as_read",
+ parameters: [
+ Operation.parameter(:id, :path, :string, "Conversation ID",
+ example: "123",
+ required: true
+ )
+ ],
+ security: [%{"oAuth" => ["write:conversations"]}],
+ responses: %{
+ 200 => Operation.response("Conversation", "application/json", Conversation)
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/custom_emoji_operation.ex b/lib/pleroma/web/api_spec/operations/custom_emoji_operation.ex
new file mode 100644
index 000000000..2f812ac77
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/custom_emoji_operation.ex
@@ -0,0 +1,88 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.CustomEmojiOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Emoji
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["custom_emojis"],
+ summary: "List custom custom emojis",
+ description: "Returns custom emojis that are available on the server.",
+ operationId: "CustomEmojiController.index",
+ responses: %{
+ 200 => Operation.response("Custom Emojis", "application/json", resposnse())
+ }
+ }
+ end
+
+ defp resposnse do
+ %Schema{
+ title: "CustomEmojisResponse",
+ description: "Response schema for custom emojis",
+ type: :array,
+ items: custom_emoji(),
+ example: [
+ %{
+ "category" => "Fun",
+ "shortcode" => "blank",
+ "static_url" => "https://lain.com/emoji/blank.png",
+ "tags" => ["Fun"],
+ "url" => "https://lain.com/emoji/blank.png",
+ "visible_in_picker" => false
+ },
+ %{
+ "category" => "Gif,Fun",
+ "shortcode" => "firefox",
+ "static_url" => "https://lain.com/emoji/Firefox.gif",
+ "tags" => ["Gif", "Fun"],
+ "url" => "https://lain.com/emoji/Firefox.gif",
+ "visible_in_picker" => true
+ },
+ %{
+ "category" => "pack:mixed",
+ "shortcode" => "sadcat",
+ "static_url" => "https://lain.com/emoji/mixed/sadcat.png",
+ "tags" => ["pack:mixed"],
+ "url" => "https://lain.com/emoji/mixed/sadcat.png",
+ "visible_in_picker" => true
+ }
+ ]
+ }
+ end
+
+ defp custom_emoji do
+ %Schema{
+ title: "CustomEmoji",
+ description: "Schema for a CustomEmoji",
+ allOf: [
+ Emoji,
+ %Schema{
+ type: :object,
+ properties: %{
+ category: %Schema{type: :string},
+ tags: %Schema{type: :array}
+ }
+ }
+ ],
+ example: %{
+ "category" => "Fun",
+ "shortcode" => "aaaa",
+ "url" =>
+ "https://files.mastodon.social/custom_emojis/images/000/007/118/original/aaaa.png",
+ "static_url" =>
+ "https://files.mastodon.social/custom_emojis/images/000/007/118/static/aaaa.png",
+ "visible_in_picker" => true,
+ "tags" => ["Gif", "Fun"]
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/domain_block_operation.ex b/lib/pleroma/web/api_spec/operations/domain_block_operation.ex
new file mode 100644
index 000000000..049bcf931
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/domain_block_operation.ex
@@ -0,0 +1,83 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.DomainBlockOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["domain_blocks"],
+ summary: "Fetch domain blocks",
+ description: "View domains the user has blocked.",
+ security: [%{"oAuth" => ["follow", "read:blocks"]}],
+ operationId: "DomainBlockController.index",
+ responses: %{
+ 200 =>
+ Operation.response("Domain blocks", "application/json", %Schema{
+ description: "Response schema for domain blocks",
+ type: :array,
+ items: %Schema{type: :string},
+ example: ["google.com", "facebook.com"]
+ })
+ }
+ }
+ end
+
+ def create_operation do
+ %Operation{
+ tags: ["domain_blocks"],
+ summary: "Block a domain",
+ description: """
+ Block a domain to:
+
+ - hide all public posts from it
+ - hide all notifications from it
+ - remove all followers from it
+ - prevent following new users from it (but does not remove existing follows)
+ """,
+ operationId: "DomainBlockController.create",
+ requestBody: domain_block_request(),
+ security: [%{"oAuth" => ["follow", "write:blocks"]}],
+ responses: %{200 => empty_object_response()}
+ }
+ end
+
+ def delete_operation do
+ %Operation{
+ tags: ["domain_blocks"],
+ summary: "Unblock a domain",
+ description: "Remove a domain block, if it exists in the user's array of blocked domains.",
+ operationId: "DomainBlockController.delete",
+ requestBody: domain_block_request(),
+ security: [%{"oAuth" => ["follow", "write:blocks"]}],
+ responses: %{
+ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object})
+ }
+ }
+ end
+
+ defp domain_block_request do
+ request_body(
+ "Parameters",
+ %Schema{
+ type: :object,
+ properties: %{
+ domain: %Schema{type: :string}
+ },
+ required: [:domain]
+ },
+ required: true,
+ example: %{
+ "domain" => "facebook.com"
+ }
+ )
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/filter_operation.ex b/lib/pleroma/web/api_spec/operations/filter_operation.ex
new file mode 100644
index 000000000..7310c1c4d
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/filter_operation.ex
@@ -0,0 +1,229 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.FilterOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["apps"],
+ summary: "View all filters",
+ operationId: "FilterController.index",
+ security: [%{"oAuth" => ["read:filters"]}],
+ responses: %{
+ 200 => Operation.response("Filters", "application/json", array_of_filters())
+ }
+ }
+ end
+
+ def create_operation do
+ %Operation{
+ tags: ["apps"],
+ summary: "Create a filter",
+ operationId: "FilterController.create",
+ requestBody: Helpers.request_body("Parameters", create_request(), required: true),
+ security: [%{"oAuth" => ["write:filters"]}],
+ responses: %{200 => Operation.response("Filter", "application/json", filter())}
+ }
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["apps"],
+ summary: "View all filters",
+ parameters: [id_param()],
+ operationId: "FilterController.show",
+ security: [%{"oAuth" => ["read:filters"]}],
+ responses: %{
+ 200 => Operation.response("Filter", "application/json", filter())
+ }
+ }
+ end
+
+ def update_operation do
+ %Operation{
+ tags: ["apps"],
+ summary: "Update a filter",
+ parameters: [id_param()],
+ operationId: "FilterController.update",
+ requestBody: Helpers.request_body("Parameters", update_request(), required: true),
+ security: [%{"oAuth" => ["write:filters"]}],
+ responses: %{
+ 200 => Operation.response("Filter", "application/json", filter())
+ }
+ }
+ end
+
+ def delete_operation do
+ %Operation{
+ tags: ["apps"],
+ summary: "Remove a filter",
+ parameters: [id_param()],
+ operationId: "FilterController.delete",
+ security: [%{"oAuth" => ["write:filters"]}],
+ responses: %{
+ 200 =>
+ Operation.response("Filter", "application/json", %Schema{
+ type: :object,
+ description: "Empty object"
+ })
+ }
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, :string, "Filter ID", example: "123", required: true)
+ end
+
+ defp filter do
+ %Schema{
+ title: "Filter",
+ type: :object,
+ properties: %{
+ id: %Schema{type: :string},
+ phrase: %Schema{type: :string, description: "The text to be filtered"},
+ context: %Schema{
+ type: :array,
+ items: %Schema{type: :string, enum: ["home", "notifications", "public", "thread"]},
+ description: "The contexts in which the filter should be applied."
+ },
+ expires_at: %Schema{
+ type: :string,
+ format: :"date-time",
+ description:
+ "When the filter should no longer be applied. String (ISO 8601 Datetime), or null if the filter does not expire.",
+ nullable: true
+ },
+ irreversible: %Schema{
+ type: :boolean,
+ description:
+ "Should matching entities in home and notifications be dropped by the server?"
+ },
+ whole_word: %Schema{
+ type: :boolean,
+ description: "Should the filter consider word boundaries?"
+ }
+ },
+ example: %{
+ "id" => "5580",
+ "phrase" => "@twitter.com",
+ "context" => [
+ "home",
+ "notifications",
+ "public",
+ "thread"
+ ],
+ "whole_word" => false,
+ "expires_at" => nil,
+ "irreversible" => true
+ }
+ }
+ end
+
+ defp array_of_filters do
+ %Schema{
+ title: "ArrayOfFilters",
+ description: "Array of Filters",
+ type: :array,
+ items: filter(),
+ example: [
+ %{
+ "id" => "5580",
+ "phrase" => "@twitter.com",
+ "context" => [
+ "home",
+ "notifications",
+ "public",
+ "thread"
+ ],
+ "whole_word" => false,
+ "expires_at" => nil,
+ "irreversible" => true
+ },
+ %{
+ "id" => "6191",
+ "phrase" => ":eurovision2019:",
+ "context" => [
+ "home"
+ ],
+ "whole_word" => true,
+ "expires_at" => "2019-05-21T13:47:31.333Z",
+ "irreversible" => false
+ }
+ ]
+ }
+ end
+
+ defp create_request do
+ %Schema{
+ title: "FilterCreateRequest",
+ allOf: [
+ update_request(),
+ %Schema{
+ type: :object,
+ properties: %{
+ irreversible: %Schema{
+ type: :bolean,
+ description:
+ "Should the server irreversibly drop matching entities from home and notifications?",
+ default: false
+ }
+ }
+ }
+ ],
+ example: %{
+ "phrase" => "knights",
+ "context" => ["home"]
+ }
+ }
+ end
+
+ defp update_request do
+ %Schema{
+ title: "FilterUpdateRequest",
+ type: :object,
+ properties: %{
+ phrase: %Schema{type: :string, description: "The text to be filtered"},
+ context: %Schema{
+ type: :array,
+ items: %Schema{type: :string, enum: ["home", "notifications", "public", "thread"]},
+ description:
+ "Array of enumerable strings `home`, `notifications`, `public`, `thread`. At least one context must be specified."
+ },
+ irreversible: %Schema{
+ type: :boolean,
+ nullable: true,
+ description:
+ "Should the server irreversibly drop matching entities from home and notifications?"
+ },
+ whole_word: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Consider word boundaries?",
+ default: true
+ }
+ # TODO: probably should implement filter expiration
+ # expires_in: %Schema{
+ # type: :string,
+ # format: :"date-time",
+ # description:
+ # "ISO 8601 Datetime for when the filter expires. Otherwise,
+ # null for a filter that doesn't expire."
+ # }
+ },
+ required: [:phrase, :context],
+ example: %{
+ "phrase" => "knights",
+ "context" => ["home"]
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/follow_request_operation.ex b/lib/pleroma/web/api_spec/operations/follow_request_operation.ex
new file mode 100644
index 000000000..ac4aee6da
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/follow_request_operation.ex
@@ -0,0 +1,65 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.FollowRequestOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Account
+ alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["Follow Requests"],
+ summary: "Pending Follows",
+ security: [%{"oAuth" => ["read:follows", "follow"]}],
+ operationId: "FollowRequestController.index",
+ responses: %{
+ 200 =>
+ Operation.response("Array of Account", "application/json", %Schema{
+ type: :array,
+ items: Account,
+ example: [Account.schema().example]
+ })
+ }
+ }
+ end
+
+ def authorize_operation do
+ %Operation{
+ tags: ["Follow Requests"],
+ summary: "Accept Follow",
+ operationId: "FollowRequestController.authorize",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["follow", "write:follows"]}],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship)
+ }
+ }
+ end
+
+ def reject_operation do
+ %Operation{
+ tags: ["Follow Requests"],
+ summary: "Reject Follow",
+ operationId: "FollowRequestController.reject",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["follow", "write:follows"]}],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship)
+ }
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, :string, "Conversation ID",
+ example: "123",
+ required: true
+ )
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/instance_operation.ex b/lib/pleroma/web/api_spec/operations/instance_operation.ex
new file mode 100644
index 000000000..880bd3f1b
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/instance_operation.ex
@@ -0,0 +1,169 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.InstanceOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["Instance"],
+ summary: "Fetch instance",
+ description: "Information about the server",
+ operationId: "InstanceController.show",
+ responses: %{
+ 200 => Operation.response("Instance", "application/json", instance())
+ }
+ }
+ end
+
+ def peers_operation do
+ %Operation{
+ tags: ["Instance"],
+ summary: "List of known hosts",
+ operationId: "InstanceController.peers",
+ responses: %{
+ 200 => Operation.response("Array of domains", "application/json", array_of_domains())
+ }
+ }
+ end
+
+ defp instance do
+ %Schema{
+ type: :object,
+ properties: %{
+ uri: %Schema{type: :string, description: "The domain name of the instance"},
+ title: %Schema{type: :string, description: "The title of the website"},
+ description: %Schema{
+ type: :string,
+ description: "Admin-defined description of the Pleroma site"
+ },
+ version: %Schema{
+ type: :string,
+ description: "The version of Pleroma installed on the instance"
+ },
+ email: %Schema{
+ type: :string,
+ description: "An email that may be contacted for any inquiries",
+ format: :email
+ },
+ urls: %Schema{
+ type: :object,
+ description: "URLs of interest for clients apps",
+ properties: %{
+ streaming_api: %Schema{
+ type: :string,
+ description: "Websockets address for push streaming"
+ }
+ }
+ },
+ stats: %Schema{
+ type: :object,
+ description: "Statistics about how much information the instance contains",
+ properties: %{
+ user_count: %Schema{
+ type: :integer,
+ description: "Users registered on this instance"
+ },
+ status_count: %Schema{
+ type: :integer,
+ description: "Statuses authored by users on instance"
+ },
+ domain_count: %Schema{
+ type: :integer,
+ description: "Domains federated with this instance"
+ }
+ }
+ },
+ thumbnail: %Schema{
+ type: :string,
+ description: "Banner image for the website",
+ nullable: true
+ },
+ languages: %Schema{
+ type: :array,
+ items: %Schema{type: :string},
+ description: "Primary langauges of the website and its staff"
+ },
+ registrations: %Schema{type: :boolean, description: "Whether registrations are enabled"},
+ # Extra (not present in Mastodon):
+ max_toot_chars: %Schema{
+ type: :integer,
+ description: ": Posts character limit (CW/Subject included in the counter)"
+ },
+ poll_limits: %Schema{
+ type: :object,
+ description: "A map with poll limits for local polls",
+ properties: %{
+ max_options: %Schema{
+ type: :integer,
+ description: "Maximum number of options."
+ },
+ max_option_chars: %Schema{
+ type: :integer,
+ description: "Maximum number of characters per option."
+ },
+ min_expiration: %Schema{
+ type: :integer,
+ description: "Minimum expiration time (in seconds)."
+ },
+ max_expiration: %Schema{
+ type: :integer,
+ description: "Maximum expiration time (in seconds)."
+ }
+ }
+ },
+ upload_limit: %Schema{
+ type: :integer,
+ description: "File size limit of uploads (except for avatar, background, banner)"
+ },
+ avatar_upload_limit: %Schema{type: :integer, description: "The title of the website"},
+ background_upload_limit: %Schema{type: :integer, description: "The title of the website"},
+ banner_upload_limit: %Schema{type: :integer, description: "The title of the website"}
+ },
+ example: %{
+ "avatar_upload_limit" => 2_000_000,
+ "background_upload_limit" => 4_000_000,
+ "banner_upload_limit" => 4_000_000,
+ "description" => "A Pleroma instance, an alternative fediverse server",
+ "email" => "lain@lain.com",
+ "languages" => ["en"],
+ "max_toot_chars" => 5000,
+ "poll_limits" => %{
+ "max_expiration" => 31_536_000,
+ "max_option_chars" => 200,
+ "max_options" => 20,
+ "min_expiration" => 0
+ },
+ "registrations" => false,
+ "stats" => %{
+ "domain_count" => 2996,
+ "status_count" => 15_802,
+ "user_count" => 5
+ },
+ "thumbnail" => "https://lain.com/instance/thumbnail.jpeg",
+ "title" => "lain.com",
+ "upload_limit" => 16_000_000,
+ "uri" => "https://lain.com",
+ "urls" => %{
+ "streaming_api" => "wss://lain.com"
+ },
+ "version" => "2.7.2 (compatible; Pleroma 2.0.50-536-g25eec6d7-develop)"
+ }
+ }
+ end
+
+ defp array_of_domains do
+ %Schema{
+ type: :array,
+ items: %Schema{type: :string},
+ example: ["pleroma.site", "lain.com", "bikeshed.party"]
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/list_operation.ex b/lib/pleroma/web/api_spec/operations/list_operation.ex
new file mode 100644
index 000000000..c88ed5dd0
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/list_operation.ex
@@ -0,0 +1,188 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.ListOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Account
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+ alias Pleroma.Web.ApiSpec.Schemas.List
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["Lists"],
+ summary: "Show user's lists",
+ description: "Fetch all lists that the user owns",
+ security: [%{"oAuth" => ["read:lists"]}],
+ operationId: "ListController.index",
+ responses: %{
+ 200 => Operation.response("Array of List", "application/json", array_of_lists())
+ }
+ }
+ end
+
+ def create_operation do
+ %Operation{
+ tags: ["Lists"],
+ summary: "Create a list",
+ description: "Fetch the list with the given ID. Used for verifying the title of a list.",
+ operationId: "ListController.create",
+ requestBody: create_update_request(),
+ security: [%{"oAuth" => ["write:lists"]}],
+ responses: %{
+ 200 => Operation.response("List", "application/json", List),
+ 400 => Operation.response("Error", "application/json", ApiError),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["Lists"],
+ summary: "Show a single list",
+ description: "Fetch the list with the given ID. Used for verifying the title of a list.",
+ operationId: "ListController.show",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["read:lists"]}],
+ responses: %{
+ 200 => Operation.response("List", "application/json", List),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def update_operation do
+ %Operation{
+ tags: ["Lists"],
+ summary: "Update a list",
+ description: "Change the title of a list",
+ operationId: "ListController.update",
+ parameters: [id_param()],
+ requestBody: create_update_request(),
+ security: [%{"oAuth" => ["write:lists"]}],
+ responses: %{
+ 200 => Operation.response("List", "application/json", List),
+ 422 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def delete_operation do
+ %Operation{
+ tags: ["Lists"],
+ summary: "Delete a list",
+ operationId: "ListController.delete",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["write:lists"]}],
+ responses: %{
+ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object})
+ }
+ }
+ end
+
+ def list_accounts_operation do
+ %Operation{
+ tags: ["Lists"],
+ summary: "View accounts in list",
+ operationId: "ListController.list_accounts",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["read:lists"]}],
+ responses: %{
+ 200 =>
+ Operation.response("Array of Account", "application/json", %Schema{
+ type: :array,
+ items: Account
+ })
+ }
+ }
+ end
+
+ def add_to_list_operation do
+ %Operation{
+ tags: ["Lists"],
+ summary: "Add accounts to list",
+ description: "Add accounts to the given list.",
+ operationId: "ListController.add_to_list",
+ parameters: [id_param()],
+ requestBody: add_remove_accounts_request(),
+ security: [%{"oAuth" => ["write:lists"]}],
+ responses: %{
+ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object})
+ }
+ }
+ end
+
+ def remove_from_list_operation do
+ %Operation{
+ tags: ["Lists"],
+ summary: "Remove accounts from list",
+ operationId: "ListController.remove_from_list",
+ parameters: [id_param()],
+ requestBody: add_remove_accounts_request(),
+ security: [%{"oAuth" => ["write:lists"]}],
+ responses: %{
+ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object})
+ }
+ }
+ end
+
+ defp array_of_lists do
+ %Schema{
+ title: "ArrayOfLists",
+ description: "Response schema for lists",
+ type: :array,
+ items: List,
+ example: [
+ %{"id" => "123", "title" => "my list"},
+ %{"id" => "1337", "title" => "another list"}
+ ]
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, :string, "List ID",
+ example: "123",
+ required: true
+ )
+ end
+
+ defp create_update_request do
+ request_body(
+ "Parameters",
+ %Schema{
+ description: "POST body for creating or updating a List",
+ type: :object,
+ properties: %{
+ title: %Schema{type: :string, description: "List title"}
+ },
+ required: [:title]
+ },
+ required: true
+ )
+ end
+
+ defp add_remove_accounts_request do
+ request_body(
+ "Parameters",
+ %Schema{
+ description: "POST body for adding/removing accounts to/from a List",
+ type: :object,
+ properties: %{
+ account_ids: %Schema{type: :array, description: "Array of account IDs", items: FlakeID}
+ },
+ required: [:account_ids]
+ },
+ required: true
+ )
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/marker_operation.ex b/lib/pleroma/web/api_spec/operations/marker_operation.ex
new file mode 100644
index 000000000..714ef1f99
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/marker_operation.ex
@@ -0,0 +1,142 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.MarkerOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["Markers"],
+ summary: "Get saved timeline position",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ operationId: "MarkerController.index",
+ parameters: [
+ Operation.parameter(
+ :timeline,
+ :query,
+ %Schema{
+ type: :array,
+ items: %Schema{type: :string, enum: ["home", "notifications"]}
+ },
+ "Array of markers to fetch. If not provided, an empty object will be returned."
+ )
+ ],
+ responses: %{
+ 200 => Operation.response("Marker", "application/json", response()),
+ 403 => Operation.response("Error", "application/json", api_error())
+ }
+ }
+ end
+
+ def upsert_operation do
+ %Operation{
+ tags: ["Markers"],
+ summary: "Save position in timeline",
+ operationId: "MarkerController.upsert",
+ requestBody: Helpers.request_body("Parameters", upsert_request(), required: true),
+ security: [%{"oAuth" => ["follow", "write:blocks"]}],
+ responses: %{
+ 200 => Operation.response("Marker", "application/json", response()),
+ 403 => Operation.response("Error", "application/json", api_error())
+ }
+ }
+ end
+
+ defp marker do
+ %Schema{
+ title: "Marker",
+ description: "Schema for a marker",
+ type: :object,
+ properties: %{
+ last_read_id: %Schema{type: :string},
+ version: %Schema{type: :integer},
+ updated_at: %Schema{type: :string},
+ pleroma: %Schema{
+ type: :object,
+ properties: %{
+ unread_count: %Schema{type: :integer}
+ }
+ }
+ },
+ example: %{
+ "last_read_id" => "35098814",
+ "version" => 361,
+ "updated_at" => "2019-11-26T22:37:25.239Z",
+ "pleroma" => %{"unread_count" => 5}
+ }
+ }
+ end
+
+ defp response do
+ %Schema{
+ title: "MarkersResponse",
+ description: "Response schema for markers",
+ type: :object,
+ properties: %{
+ notifications: %Schema{allOf: [marker()], nullable: true},
+ home: %Schema{allOf: [marker()], nullable: true}
+ },
+ items: %Schema{type: :string},
+ example: %{
+ "notifications" => %{
+ "last_read_id" => "35098814",
+ "version" => 361,
+ "updated_at" => "2019-11-26T22:37:25.239Z",
+ "pleroma" => %{"unread_count" => 0}
+ },
+ "home" => %{
+ "last_read_id" => "103206604258487607",
+ "version" => 468,
+ "updated_at" => "2019-11-26T22:37:25.235Z",
+ "pleroma" => %{"unread_count" => 10}
+ }
+ }
+ }
+ end
+
+ defp upsert_request do
+ %Schema{
+ title: "MarkersUpsertRequest",
+ description: "Request schema for marker upsert",
+ type: :object,
+ properties: %{
+ notifications: %Schema{
+ type: :object,
+ nullable: true,
+ properties: %{
+ last_read_id: %Schema{nullable: true, type: :string}
+ }
+ },
+ home: %Schema{
+ type: :object,
+ nullable: true,
+ properties: %{
+ last_read_id: %Schema{nullable: true, type: :string}
+ }
+ }
+ },
+ example: %{
+ "home" => %{
+ "last_read_id" => "103194548672408537",
+ "version" => 462,
+ "updated_at" => "2019-11-24T19:39:39.337Z"
+ }
+ }
+ }
+ end
+
+ defp api_error do
+ %Schema{
+ type: :object,
+ properties: %{error: %Schema{type: :string}}
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/media_operation.ex b/lib/pleroma/web/api_spec/operations/media_operation.ex
new file mode 100644
index 000000000..d9c3c42db
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/media_operation.ex
@@ -0,0 +1,132 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.MediaOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Helpers
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.Attachment
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def create_operation do
+ %Operation{
+ tags: ["media"],
+ summary: "Upload media as attachment",
+ description: "Creates an attachment to be used with a new status.",
+ operationId: "MediaController.create",
+ security: [%{"oAuth" => ["write:media"]}],
+ requestBody: Helpers.request_body("Parameters", create_request()),
+ responses: %{
+ 200 => Operation.response("Media", "application/json", Attachment),
+ 401 => Operation.response("Media", "application/json", ApiError),
+ 422 => Operation.response("Media", "application/json", ApiError)
+ }
+ }
+ end
+
+ defp create_request do
+ %Schema{
+ title: "MediaCreateRequest",
+ description: "POST body for creating an attachment",
+ type: :object,
+ required: [:file],
+ properties: %{
+ file: %Schema{
+ type: :string,
+ format: :binary,
+ description: "The file to be attached, using multipart form data."
+ },
+ description: %Schema{
+ type: :string,
+ description: "A plain-text description of the media, for accessibility purposes."
+ },
+ focus: %Schema{
+ type: :string,
+ description: "Two floating points (x,y), comma-delimited, ranging from -1.0 to 1.0."
+ }
+ }
+ }
+ end
+
+ def update_operation do
+ %Operation{
+ tags: ["media"],
+ summary: "Upload media as attachment",
+ description: "Creates an attachment to be used with a new status.",
+ operationId: "MediaController.update",
+ security: [%{"oAuth" => ["write:media"]}],
+ parameters: [id_param()],
+ requestBody: Helpers.request_body("Parameters", update_request()),
+ responses: %{
+ 200 => Operation.response("Media", "application/json", Attachment),
+ 400 => Operation.response("Media", "application/json", ApiError),
+ 401 => Operation.response("Media", "application/json", ApiError),
+ 422 => Operation.response("Media", "application/json", ApiError)
+ }
+ }
+ end
+
+ defp update_request do
+ %Schema{
+ title: "MediaUpdateRequest",
+ description: "POST body for updating an attachment",
+ type: :object,
+ properties: %{
+ file: %Schema{
+ type: :string,
+ format: :binary,
+ description: "The file to be attached, using multipart form data."
+ },
+ description: %Schema{
+ type: :string,
+ description: "A plain-text description of the media, for accessibility purposes."
+ },
+ focus: %Schema{
+ type: :string,
+ description: "Two floating points (x,y), comma-delimited, ranging from -1.0 to 1.0."
+ }
+ }
+ }
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["media"],
+ summary: "Show Uploaded media attachment",
+ operationId: "MediaController.show",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["read:media"]}],
+ responses: %{
+ 200 => Operation.response("Media", "application/json", Attachment),
+ 401 => Operation.response("Media", "application/json", ApiError),
+ 422 => Operation.response("Media", "application/json", ApiError)
+ }
+ }
+ end
+
+ def create2_operation do
+ %Operation{
+ tags: ["media"],
+ summary: "Upload media as attachment",
+ description: "Creates an attachment to be used with a new status.",
+ operationId: "MediaController.create2",
+ security: [%{"oAuth" => ["write:media"]}],
+ requestBody: Helpers.request_body("Parameters", create_request()),
+ responses: %{
+ 202 => Operation.response("Media", "application/json", Attachment),
+ 422 => Operation.response("Media", "application/json", ApiError),
+ 500 => Operation.response("Media", "application/json", ApiError)
+ }
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, :string, "The ID of the Attachment entity")
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/notification_operation.ex b/lib/pleroma/web/api_spec/operations/notification_operation.ex
new file mode 100644
index 000000000..64adc5319
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/notification_operation.ex
@@ -0,0 +1,211 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.NotificationOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Account
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.BooleanLike
+ alias Pleroma.Web.ApiSpec.Schemas.Status
+ alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["Notifications"],
+ summary: "Get all notifications",
+ description:
+ "Notifications concerning the user. This API returns Link headers containing links to the next/previous page. However, the links can also be constructed dynamically using query params and `id` values.",
+ operationId: "NotificationController.index",
+ security: [%{"oAuth" => ["read:notifications"]}],
+ parameters:
+ [
+ Operation.parameter(
+ :exclude_types,
+ :query,
+ %Schema{type: :array, items: notification_type()},
+ "Array of types to exclude"
+ ),
+ Operation.parameter(
+ :account_id,
+ :query,
+ %Schema{type: :string},
+ "Return only notifications received from this account"
+ ),
+ Operation.parameter(
+ :exclude_visibilities,
+ :query,
+ %Schema{type: :array, items: VisibilityScope},
+ "Exclude the notifications for activities with the given visibilities"
+ ),
+ Operation.parameter(
+ :include_types,
+ :query,
+ %Schema{type: :array, items: notification_type()},
+ "Include the notifications for activities with the given types"
+ ),
+ Operation.parameter(
+ :with_muted,
+ :query,
+ BooleanLike,
+ "Include the notifications from muted users"
+ )
+ ] ++ pagination_params(),
+ responses: %{
+ 200 =>
+ Operation.response("Array of notifications", "application/json", %Schema{
+ type: :array,
+ items: notification()
+ }),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["Notifications"],
+ summary: "Get a single notification",
+ description: "View information about a notification with a given ID.",
+ operationId: "NotificationController.show",
+ security: [%{"oAuth" => ["read:notifications"]}],
+ parameters: [id_param()],
+ responses: %{
+ 200 => Operation.response("Notification", "application/json", notification())
+ }
+ }
+ end
+
+ def clear_operation do
+ %Operation{
+ tags: ["Notifications"],
+ summary: "Dismiss all notifications",
+ description: "Clear all notifications from the server.",
+ operationId: "NotificationController.clear",
+ security: [%{"oAuth" => ["write:notifications"]}],
+ responses: %{200 => empty_object_response()}
+ }
+ end
+
+ def dismiss_operation do
+ %Operation{
+ tags: ["Notifications"],
+ summary: "Dismiss a single notification",
+ description: "Clear a single notification from the server.",
+ operationId: "NotificationController.dismiss",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["write:notifications"]}],
+ responses: %{200 => empty_object_response()}
+ }
+ end
+
+ def dismiss_via_body_operation do
+ %Operation{
+ tags: ["Notifications"],
+ summary: "Dismiss a single notification",
+ deprecated: true,
+ description: "Clear a single notification from the server.",
+ operationId: "NotificationController.dismiss_via_body",
+ requestBody:
+ request_body(
+ "Parameters",
+ %Schema{type: :object, properties: %{id: %Schema{type: :string}}},
+ required: true
+ ),
+ security: [%{"oAuth" => ["write:notifications"]}],
+ responses: %{200 => empty_object_response()}
+ }
+ end
+
+ def destroy_multiple_operation do
+ %Operation{
+ tags: ["Notifications"],
+ summary: "Dismiss multiple notifications",
+ operationId: "NotificationController.destroy_multiple",
+ security: [%{"oAuth" => ["write:notifications"]}],
+ parameters: [
+ Operation.parameter(
+ :ids,
+ :query,
+ %Schema{type: :array, items: %Schema{type: :string}},
+ "Array of notification IDs to dismiss",
+ required: true
+ )
+ ],
+ responses: %{200 => empty_object_response()}
+ }
+ end
+
+ defp notification do
+ %Schema{
+ title: "Notification",
+ description: "Response schema for a notification",
+ type: :object,
+ properties: %{
+ id: %Schema{type: :string},
+ type: notification_type(),
+ created_at: %Schema{type: :string, format: :"date-time"},
+ account: %Schema{
+ allOf: [Account],
+ description: "The account that performed the action that generated the notification."
+ },
+ status: %Schema{
+ allOf: [Status],
+ description:
+ "Status that was the object of the notification, e.g. in mentions, reblogs, favourites, or polls.",
+ nullable: true
+ }
+ },
+ example: %{
+ "id" => "34975861",
+ "type" => "mention",
+ "created_at" => "2019-11-23T07:49:02.064Z",
+ "account" => Account.schema().example,
+ "status" => Status.schema().example
+ }
+ }
+ end
+
+ defp notification_type do
+ %Schema{
+ type: :string,
+ enum: [
+ "follow",
+ "favourite",
+ "reblog",
+ "mention",
+ "poll",
+ "pleroma:emoji_reaction",
+ "move",
+ "follow_request"
+ ],
+ description: """
+ The type of event that resulted in the notification.
+
+ - `follow` - Someone followed you
+ - `mention` - Someone mentioned you in their status
+ - `reblog` - Someone boosted one of your statuses
+ - `favourite` - Someone favourited one of your statuses
+ - `poll` - A poll you have voted in or created has ended
+ - `move` - Someone moved their account
+ - `pleroma:emoji_reaction` - Someone reacted with emoji to your status
+ """
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, :string, "Notification ID",
+ example: "123",
+ required: true
+ )
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex b/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex
new file mode 100644
index 000000000..90922c064
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/pleroma_account_operation.ex
@@ -0,0 +1,187 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.PleromaAccountOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+ alias Pleroma.Web.ApiSpec.StatusOperation
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def confirmation_resend_operation do
+ %Operation{
+ tags: ["Accounts"],
+ summary: "Resend confirmation email. Expects `email` or `nickname`",
+ operationId: "PleromaAPI.AccountController.confirmation_resend",
+ parameters: [
+ Operation.parameter(:email, :query, :string, "Email of that needs to be verified",
+ example: "cofe@cofe.io"
+ ),
+ Operation.parameter(
+ :nickname,
+ :query,
+ :string,
+ "Nickname of user that needs to be verified",
+ example: "cofefe"
+ )
+ ],
+ responses: %{
+ 204 => no_content_response()
+ }
+ }
+ end
+
+ def update_avatar_operation do
+ %Operation{
+ tags: ["Accounts"],
+ summary: "Set/clear user avatar image",
+ operationId: "PleromaAPI.AccountController.update_avatar",
+ requestBody:
+ request_body("Parameters", update_avatar_or_background_request(), required: true),
+ security: [%{"oAuth" => ["write:accounts"]}],
+ responses: %{
+ 200 => update_response(),
+ 403 => Operation.response("Forbidden", "application/json", ApiError)
+ }
+ }
+ end
+
+ def update_banner_operation do
+ %Operation{
+ tags: ["Accounts"],
+ summary: "Set/clear user banner image",
+ operationId: "PleromaAPI.AccountController.update_banner",
+ requestBody: request_body("Parameters", update_banner_request(), required: true),
+ security: [%{"oAuth" => ["write:accounts"]}],
+ responses: %{
+ 200 => update_response()
+ }
+ }
+ end
+
+ def update_background_operation do
+ %Operation{
+ tags: ["Accounts"],
+ summary: "Set/clear user background image",
+ operationId: "PleromaAPI.AccountController.update_background",
+ security: [%{"oAuth" => ["write:accounts"]}],
+ requestBody:
+ request_body("Parameters", update_avatar_or_background_request(), required: true),
+ responses: %{
+ 200 => update_response()
+ }
+ }
+ end
+
+ def favourites_operation do
+ %Operation{
+ tags: ["Accounts"],
+ summary: "Returns favorites timeline of any user",
+ operationId: "PleromaAPI.AccountController.favourites",
+ parameters: [id_param() | pagination_params()],
+ security: [%{"oAuth" => ["read:favourites"]}],
+ responses: %{
+ 200 =>
+ Operation.response(
+ "Array of Statuses",
+ "application/json",
+ StatusOperation.array_of_statuses()
+ ),
+ 403 => Operation.response("Forbidden", "application/json", ApiError),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def subscribe_operation do
+ %Operation{
+ tags: ["Accounts"],
+ summary: "Subscribe to receive notifications for all statuses posted by a user",
+ operationId: "PleromaAPI.AccountController.subscribe",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["follow", "write:follows"]}],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def unsubscribe_operation do
+ %Operation{
+ tags: ["Accounts"],
+ summary: "Unsubscribe to stop receiving notifications from user statuses",
+ operationId: "PleromaAPI.AccountController.unsubscribe",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["follow", "write:follows"]}],
+ responses: %{
+ 200 => Operation.response("Relationship", "application/json", AccountRelationship),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, FlakeID, "Account ID",
+ example: "9umDrYheeY451cQnEe",
+ required: true
+ )
+ end
+
+ defp update_avatar_or_background_request do
+ %Schema{
+ title: "PleromaAccountUpdateAvatarOrBackgroundRequest",
+ type: :object,
+ properties: %{
+ img: %Schema{
+ nullable: true,
+ type: :string,
+ format: :binary,
+ description: "Image encoded using `multipart/form-data` or an empty string to clear"
+ }
+ }
+ }
+ end
+
+ defp update_banner_request do
+ %Schema{
+ title: "PleromaAccountUpdateBannerRequest",
+ type: :object,
+ properties: %{
+ banner: %Schema{
+ type: :string,
+ nullable: true,
+ format: :binary,
+ description: "Image encoded using `multipart/form-data` or an empty string to clear"
+ }
+ }
+ }
+ end
+
+ defp update_response do
+ Operation.response("PleromaAccountUpdateResponse", "application/json", %Schema{
+ type: :object,
+ properties: %{
+ url: %Schema{
+ type: :string,
+ format: :uri,
+ nullable: true,
+ description: "Image URL"
+ }
+ },
+ example: %{
+ "url" =>
+ "https://cofe.party/media/9d0add56-bcb6-4c0f-8225-cbbd0b6dd773/13eadb6972c9ccd3f4ffa3b8196f0e0d38b4d2f27594457c52e52946c054cd9a.gif"
+ }
+ })
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/poll_operation.ex b/lib/pleroma/web/api_spec/operations/poll_operation.ex
new file mode 100644
index 000000000..e15c7dc95
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/poll_operation.ex
@@ -0,0 +1,76 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.PollOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+ alias Pleroma.Web.ApiSpec.Schemas.Poll
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["Polls"],
+ summary: "View a poll",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: [id_param()],
+ operationId: "PollController.show",
+ responses: %{
+ 200 => Operation.response("Poll", "application/json", Poll),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def vote_operation do
+ %Operation{
+ tags: ["Polls"],
+ summary: "Vote on a poll",
+ parameters: [id_param()],
+ operationId: "PollController.vote",
+ requestBody: vote_request(),
+ security: [%{"oAuth" => ["write:statuses"]}],
+ responses: %{
+ 200 => Operation.response("Poll", "application/json", Poll),
+ 422 => Operation.response("Error", "application/json", ApiError),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, FlakeID, "Poll ID",
+ example: "123",
+ required: true
+ )
+ end
+
+ defp vote_request do
+ request_body(
+ "Parameters",
+ %Schema{
+ type: :object,
+ properties: %{
+ choices: %Schema{
+ type: :array,
+ items: %Schema{type: :integer},
+ description: "Array of own votes containing index for each option (starting from 0)"
+ }
+ },
+ required: [:choices]
+ },
+ required: true,
+ example: %{
+ "choices" => [0, 1, 2]
+ }
+ )
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/report_operation.ex b/lib/pleroma/web/api_spec/operations/report_operation.ex
new file mode 100644
index 000000000..882177c96
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/report_operation.ex
@@ -0,0 +1,81 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.ReportOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Helpers
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def create_operation do
+ %Operation{
+ tags: ["reports"],
+ summary: "File a report",
+ description: "Report problematic users to your moderators",
+ operationId: "ReportController.create",
+ security: [%{"oAuth" => ["follow", "write:reports"]}],
+ requestBody: Helpers.request_body("Parameters", create_request(), required: true),
+ responses: %{
+ 200 => Operation.response("Report", "application/json", create_response()),
+ 400 => Operation.response("Report", "application/json", ApiError)
+ }
+ }
+ end
+
+ defp create_request do
+ %Schema{
+ title: "ReportCreateRequest",
+ description: "POST body for creating a report",
+ type: :object,
+ properties: %{
+ account_id: %Schema{type: :string, description: "ID of the account to report"},
+ status_ids: %Schema{
+ type: :array,
+ nullable: true,
+ items: %Schema{type: :string},
+ description: "Array of Statuses to attach to the report, for context"
+ },
+ comment: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Reason for the report"
+ },
+ forward: %Schema{
+ type: :boolean,
+ nullable: true,
+ default: false,
+ description:
+ "If the account is remote, should the report be forwarded to the remote admin?"
+ }
+ },
+ required: [:account_id],
+ example: %{
+ "account_id" => "123",
+ "status_ids" => ["1337"],
+ "comment" => "bad status!",
+ "forward" => "false"
+ }
+ }
+ end
+
+ defp create_response do
+ %Schema{
+ title: "ReportResponse",
+ type: :object,
+ properties: %{
+ id: %Schema{type: :string, description: "Report ID"},
+ action_taken: %Schema{type: :boolean, description: "Is action taken?"}
+ },
+ example: %{
+ "id" => "123",
+ "action_taken" => false
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/scheduled_activity_operation.ex b/lib/pleroma/web/api_spec/operations/scheduled_activity_operation.ex
new file mode 100644
index 000000000..fe675a923
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/scheduled_activity_operation.ex
@@ -0,0 +1,96 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.ScheduledActivityOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+ alias Pleroma.Web.ApiSpec.Schemas.ScheduledStatus
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["Scheduled Statuses"],
+ summary: "View scheduled statuses",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: pagination_params(),
+ operationId: "ScheduledActivity.index",
+ responses: %{
+ 200 =>
+ Operation.response("Array of ScheduledStatus", "application/json", %Schema{
+ type: :array,
+ items: ScheduledStatus
+ })
+ }
+ }
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["Scheduled Statuses"],
+ summary: "View a single scheduled status",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: [id_param()],
+ operationId: "ScheduledActivity.show",
+ responses: %{
+ 200 => Operation.response("Scheduled Status", "application/json", ScheduledStatus),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def update_operation do
+ %Operation{
+ tags: ["Scheduled Statuses"],
+ summary: "Schedule a status",
+ operationId: "ScheduledActivity.update",
+ security: [%{"oAuth" => ["write:statuses"]}],
+ parameters: [id_param()],
+ requestBody:
+ request_body("Parameters", %Schema{
+ type: :object,
+ properties: %{
+ scheduled_at: %Schema{
+ type: :string,
+ format: :"date-time",
+ description:
+ "ISO 8601 Datetime at which the status will be published. Must be at least 5 minutes into the future."
+ }
+ }
+ }),
+ responses: %{
+ 200 => Operation.response("Scheduled Status", "application/json", ScheduledStatus),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def delete_operation do
+ %Operation{
+ tags: ["Scheduled Statuses"],
+ summary: "Cancel a scheduled status",
+ security: [%{"oAuth" => ["write:statuses"]}],
+ parameters: [id_param()],
+ operationId: "ScheduledActivity.delete",
+ responses: %{
+ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, FlakeID, "Poll ID",
+ example: "123",
+ required: true
+ )
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/search_operation.ex b/lib/pleroma/web/api_spec/operations/search_operation.ex
new file mode 100644
index 000000000..169c36d87
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/search_operation.ex
@@ -0,0 +1,208 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.SearchOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.AccountOperation
+ alias Pleroma.Web.ApiSpec.Schemas.Account
+ alias Pleroma.Web.ApiSpec.Schemas.BooleanLike
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+ alias Pleroma.Web.ApiSpec.Schemas.Status
+ alias Pleroma.Web.ApiSpec.Schemas.Tag
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ # Note: `with_relationships` param is not supported (PleromaFE uses this op for autocomplete)
+ def account_search_operation do
+ %Operation{
+ tags: ["Search"],
+ summary: "Search for matching accounts by username or display name",
+ operationId: "SearchController.account_search",
+ parameters: [
+ Operation.parameter(:q, :query, %Schema{type: :string}, "What to search for",
+ required: true
+ ),
+ Operation.parameter(
+ :limit,
+ :query,
+ %Schema{type: :integer, default: 40},
+ "Maximum number of results"
+ ),
+ Operation.parameter(
+ :resolve,
+ :query,
+ %Schema{allOf: [BooleanLike], default: false},
+ "Attempt WebFinger lookup. Use this when `q` is an exact address."
+ ),
+ Operation.parameter(
+ :following,
+ :query,
+ %Schema{allOf: [BooleanLike], default: false},
+ "Only include accounts that the user is following"
+ )
+ ],
+ responses: %{
+ 200 =>
+ Operation.response(
+ "Array of Account",
+ "application/json",
+ AccountOperation.array_of_accounts()
+ )
+ }
+ }
+ end
+
+ def search_operation do
+ %Operation{
+ tags: ["Search"],
+ summary: "Search results",
+ security: [%{"oAuth" => ["read:search"]}],
+ operationId: "SearchController.search",
+ deprecated: true,
+ parameters: [
+ Operation.parameter(
+ :account_id,
+ :query,
+ FlakeID,
+ "If provided, statuses returned will be authored only by this account"
+ ),
+ Operation.parameter(
+ :type,
+ :query,
+ %Schema{type: :string, enum: ["accounts", "hashtags", "statuses"]},
+ "Search type"
+ ),
+ Operation.parameter(:q, :query, %Schema{type: :string}, "The search query", required: true),
+ Operation.parameter(
+ :resolve,
+ :query,
+ %Schema{allOf: [BooleanLike], default: false},
+ "Attempt WebFinger lookup"
+ ),
+ Operation.parameter(
+ :following,
+ :query,
+ %Schema{allOf: [BooleanLike], default: false},
+ "Only include accounts that the user is following"
+ ),
+ Operation.parameter(
+ :offset,
+ :query,
+ %Schema{type: :integer},
+ "Offset"
+ ),
+ with_relationships_param() | pagination_params()
+ ],
+ responses: %{
+ 200 => Operation.response("Results", "application/json", results())
+ }
+ }
+ end
+
+ def search2_operation do
+ %Operation{
+ tags: ["Search"],
+ summary: "Search results",
+ security: [%{"oAuth" => ["read:search"]}],
+ operationId: "SearchController.search2",
+ parameters: [
+ Operation.parameter(
+ :account_id,
+ :query,
+ FlakeID,
+ "If provided, statuses returned will be authored only by this account"
+ ),
+ Operation.parameter(
+ :type,
+ :query,
+ %Schema{type: :string, enum: ["accounts", "hashtags", "statuses"]},
+ "Search type"
+ ),
+ Operation.parameter(:q, :query, %Schema{type: :string}, "What to search for",
+ required: true
+ ),
+ Operation.parameter(
+ :resolve,
+ :query,
+ %Schema{allOf: [BooleanLike], default: false},
+ "Attempt WebFinger lookup"
+ ),
+ Operation.parameter(
+ :following,
+ :query,
+ %Schema{allOf: [BooleanLike], default: false},
+ "Only include accounts that the user is following"
+ ),
+ with_relationships_param() | pagination_params()
+ ],
+ responses: %{
+ 200 => Operation.response("Results", "application/json", results2())
+ }
+ }
+ end
+
+ defp results2 do
+ %Schema{
+ title: "SearchResults",
+ type: :object,
+ properties: %{
+ accounts: %Schema{
+ type: :array,
+ items: Account,
+ description: "Accounts which match the given query"
+ },
+ statuses: %Schema{
+ type: :array,
+ items: Status,
+ description: "Statuses which match the given query"
+ },
+ hashtags: %Schema{
+ type: :array,
+ items: Tag,
+ description: "Hashtags which match the given query"
+ }
+ },
+ example: %{
+ "accounts" => [Account.schema().example],
+ "statuses" => [Status.schema().example],
+ "hashtags" => [Tag.schema().example]
+ }
+ }
+ end
+
+ defp results do
+ %Schema{
+ title: "SearchResults",
+ type: :object,
+ properties: %{
+ accounts: %Schema{
+ type: :array,
+ items: Account,
+ description: "Accounts which match the given query"
+ },
+ statuses: %Schema{
+ type: :array,
+ items: Status,
+ description: "Statuses which match the given query"
+ },
+ hashtags: %Schema{
+ type: :array,
+ items: %Schema{type: :string},
+ description: "Hashtags which match the given query"
+ }
+ },
+ example: %{
+ "accounts" => [Account.schema().example],
+ "statuses" => [Status.schema().example],
+ "hashtags" => ["cofe"]
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/status_operation.ex b/lib/pleroma/web/api_spec/operations/status_operation.ex
new file mode 100644
index 000000000..4b284c537
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/status_operation.ex
@@ -0,0 +1,517 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.StatusOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.AccountOperation
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+ alias Pleroma.Web.ApiSpec.Schemas.ScheduledStatus
+ alias Pleroma.Web.ApiSpec.Schemas.Status
+ alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def index_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Get multiple statuses by IDs",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: [
+ Operation.parameter(
+ :ids,
+ :query,
+ %Schema{type: :array, items: FlakeID},
+ "Array of status IDs"
+ )
+ ],
+ operationId: "StatusController.index",
+ responses: %{
+ 200 => Operation.response("Array of Status", "application/json", array_of_statuses())
+ }
+ }
+ end
+
+ def create_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Publish new status",
+ security: [%{"oAuth" => ["write:statuses"]}],
+ description: "Post a new status",
+ operationId: "StatusController.create",
+ requestBody: request_body("Parameters", create_request(), required: true),
+ responses: %{
+ 200 =>
+ Operation.response(
+ "Status. When `scheduled_at` is present, ScheduledStatus is returned instead",
+ "application/json",
+ %Schema{oneOf: [Status, ScheduledStatus]}
+ ),
+ 422 => Operation.response("Bad Request", "application/json", ApiError)
+ }
+ }
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "View specific status",
+ description: "View information about a status",
+ operationId: "StatusController.show",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response(),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def delete_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Delete status",
+ security: [%{"oAuth" => ["write:statuses"]}],
+ description: "Delete one of your own statuses",
+ operationId: "StatusController.delete",
+ parameters: [id_param()],
+ responses: %{
+ 200 => empty_object_response(),
+ 403 => Operation.response("Forbidden", "application/json", ApiError),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def reblog_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Boost",
+ security: [%{"oAuth" => ["write:statuses"]}],
+ description: "Share a status",
+ operationId: "StatusController.reblog",
+ parameters: [id_param()],
+ requestBody:
+ request_body("Parameters", %Schema{
+ type: :object,
+ properties: %{
+ visibility: %Schema{allOf: [VisibilityScope], default: "public"}
+ }
+ }),
+ responses: %{
+ 200 => status_response(),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def unreblog_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Undo boost",
+ security: [%{"oAuth" => ["write:statuses"]}],
+ description: "Undo a reshare of a status",
+ operationId: "StatusController.unreblog",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response(),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def favourite_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Favourite",
+ security: [%{"oAuth" => ["write:favourites"]}],
+ description: "Add a status to your favourites list",
+ operationId: "StatusController.favourite",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response(),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def unfavourite_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Undo favourite",
+ security: [%{"oAuth" => ["write:favourites"]}],
+ description: "Remove a status from your favourites list",
+ operationId: "StatusController.unfavourite",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response(),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def pin_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Pin to profile",
+ security: [%{"oAuth" => ["write:accounts"]}],
+ description: "Feature one of your own public statuses at the top of your profile",
+ operationId: "StatusController.pin",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response(),
+ 400 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def unpin_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Unpin to profile",
+ security: [%{"oAuth" => ["write:accounts"]}],
+ description: "Unfeature a status from the top of your profile",
+ operationId: "StatusController.unpin",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response(),
+ 400 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def bookmark_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Bookmark",
+ security: [%{"oAuth" => ["write:bookmarks"]}],
+ description: "Privately bookmark a status",
+ operationId: "StatusController.bookmark",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response()
+ }
+ }
+ end
+
+ def unbookmark_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Undo bookmark",
+ security: [%{"oAuth" => ["write:bookmarks"]}],
+ description: "Remove a status from your private bookmarks",
+ operationId: "StatusController.unbookmark",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response()
+ }
+ }
+ end
+
+ def mute_conversation_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Mute conversation",
+ security: [%{"oAuth" => ["write:mutes"]}],
+ description: "Do not receive notifications for the thread that this status is part of.",
+ operationId: "StatusController.mute_conversation",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response(),
+ 400 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def unmute_conversation_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Unmute conversation",
+ security: [%{"oAuth" => ["write:mutes"]}],
+ description:
+ "Start receiving notifications again for the thread that this status is part of",
+ operationId: "StatusController.unmute_conversation",
+ parameters: [id_param()],
+ responses: %{
+ 200 => status_response(),
+ 400 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def card_operation do
+ %Operation{
+ tags: ["Statuses"],
+ deprecated: true,
+ summary: "Preview card",
+ description: "Deprecated in favor of card property inlined on Status entity",
+ operationId: "StatusController.card",
+ parameters: [id_param()],
+ security: [%{"oAuth" => ["read:statuses"]}],
+ responses: %{
+ 200 =>
+ Operation.response("Card", "application/json", %Schema{
+ type: :object,
+ nullable: true,
+ properties: %{
+ type: %Schema{type: :string, enum: ["link", "photo", "video", "rich"]},
+ provider_name: %Schema{type: :string, nullable: true},
+ provider_url: %Schema{type: :string, format: :uri},
+ url: %Schema{type: :string, format: :uri},
+ image: %Schema{type: :string, nullable: true, format: :uri},
+ title: %Schema{type: :string},
+ description: %Schema{type: :string}
+ }
+ })
+ }
+ }
+ end
+
+ def favourited_by_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Favourited by",
+ description: "View who favourited a given status",
+ operationId: "StatusController.favourited_by",
+ security: [%{"oAuth" => ["read:accounts"]}],
+ parameters: [id_param()],
+ responses: %{
+ 200 =>
+ Operation.response(
+ "Array of Accounts",
+ "application/json",
+ AccountOperation.array_of_accounts()
+ ),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def reblogged_by_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Boosted by",
+ description: "View who boosted a given status",
+ operationId: "StatusController.reblogged_by",
+ security: [%{"oAuth" => ["read:accounts"]}],
+ parameters: [id_param()],
+ responses: %{
+ 200 =>
+ Operation.response(
+ "Array of Accounts",
+ "application/json",
+ AccountOperation.array_of_accounts()
+ ),
+ 404 => Operation.response("Not Found", "application/json", ApiError)
+ }
+ }
+ end
+
+ def context_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Parent and child statuses",
+ description: "View statuses above and below this status in the thread",
+ operationId: "StatusController.context",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: [id_param()],
+ responses: %{
+ 200 => Operation.response("Context", "application/json", context())
+ }
+ }
+ end
+
+ def favourites_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Favourited statuses",
+ description: "Statuses the user has favourited",
+ operationId: "StatusController.favourites",
+ parameters: pagination_params(),
+ security: [%{"oAuth" => ["read:favourites"]}],
+ responses: %{
+ 200 => Operation.response("Array of Statuses", "application/json", array_of_statuses())
+ }
+ }
+ end
+
+ def bookmarks_operation do
+ %Operation{
+ tags: ["Statuses"],
+ summary: "Bookmarked statuses",
+ description: "Statuses the user has bookmarked",
+ operationId: "StatusController.bookmarks",
+ parameters: pagination_params(),
+ security: [%{"oAuth" => ["read:bookmarks"]}],
+ responses: %{
+ 200 => Operation.response("Array of Statuses", "application/json", array_of_statuses())
+ }
+ }
+ end
+
+ def array_of_statuses do
+ %Schema{type: :array, items: Status, example: [Status.schema().example]}
+ end
+
+ defp create_request do
+ %Schema{
+ title: "StatusCreateRequest",
+ type: :object,
+ properties: %{
+ status: %Schema{
+ type: :string,
+ nullable: true,
+ description:
+ "Text content of the status. If `media_ids` is provided, this becomes optional. Attaching a `poll` is optional while `status` is provided."
+ },
+ media_ids: %Schema{
+ nullable: true,
+ type: :array,
+ items: %Schema{type: :string},
+ description: "Array of Attachment ids to be attached as media."
+ },
+ poll: %Schema{
+ nullable: true,
+ type: :object,
+ required: [:options],
+ properties: %{
+ options: %Schema{
+ type: :array,
+ items: %Schema{type: :string},
+ description: "Array of possible answers. Must be provided with `poll[expires_in]`."
+ },
+ expires_in: %Schema{
+ type: :integer,
+ nullable: true,
+ description:
+ "Duration the poll should be open, in seconds. Must be provided with `poll[options]`"
+ },
+ multiple: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Allow multiple choices?"
+ },
+ hide_totals: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Hide vote counts until the poll ends?"
+ }
+ }
+ },
+ in_reply_to_id: %Schema{
+ nullable: true,
+ allOf: [FlakeID],
+ description: "ID of the status being replied to, if status is a reply"
+ },
+ sensitive: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Mark status and attached media as sensitive?"
+ },
+ spoiler_text: %Schema{
+ type: :string,
+ nullable: true,
+ description:
+ "Text to be shown as a warning or subject before the actual content. Statuses are generally collapsed behind this field."
+ },
+ scheduled_at: %Schema{
+ type: :string,
+ format: :"date-time",
+ nullable: true,
+ description:
+ "ISO 8601 Datetime at which to schedule a status. Providing this paramter will cause ScheduledStatus to be returned instead of Status. Must be at least 5 minutes in the future."
+ },
+ language: %Schema{
+ type: :string,
+ nullable: true,
+ description: "ISO 639 language code for this status."
+ },
+ # Pleroma-specific properties:
+ preview: %Schema{
+ type: :boolean,
+ nullable: true,
+ description:
+ "If set to `true` the post won't be actually posted, but the status entitiy would still be rendered back. This could be useful for previewing rich text/custom emoji, for example"
+ },
+ content_type: %Schema{
+ type: :string,
+ nullable: true,
+ description:
+ "The MIME type of the status, it is transformed into HTML by the backend. You can get the list of the supported MIME types with the nodeinfo endpoint."
+ },
+ to: %Schema{
+ type: :array,
+ nullable: true,
+ items: %Schema{type: :string},
+ description:
+ "A list of nicknames (like `lain@soykaf.club` or `lain` on the local server) that will be used to determine who is going to be addressed by this post. Using this will disable the implicit addressing by mentioned names in the `status` body, only the people in the `to` list will be addressed. The normal rules for for post visibility are not affected by this and will still apply"
+ },
+ visibility: %Schema{
+ nullable: true,
+ anyOf: [
+ VisibilityScope,
+ %Schema{type: :string, description: "`list:LIST_ID`", example: "LIST:123"}
+ ],
+ description:
+ "Visibility of the posted status. Besides standard MastoAPI values (`direct`, `private`, `unlisted` or `public`) it can be used to address a List by setting it to `list:LIST_ID`"
+ },
+ expires_in: %Schema{
+ nullable: true,
+ type: :integer,
+ description:
+ "The number of seconds the posted activity should expire in. When a posted activity expires it will be deleted from the server, and a delete request for it will be federated. This needs to be longer than an hour."
+ },
+ in_reply_to_conversation_id: %Schema{
+ nullable: true,
+ type: :string,
+ description:
+ "Will reply to a given conversation, addressing only the people who are part of the recipient set of that conversation. Sets the visibility to `direct`."
+ }
+ },
+ example: %{
+ "status" => "What time is it?",
+ "sensitive" => "false",
+ "poll" => %{
+ "options" => ["Cofe", "Adventure"],
+ "expires_in" => 420
+ }
+ }
+ }
+ end
+
+ defp id_param do
+ Operation.parameter(:id, :path, FlakeID, "Status ID",
+ example: "9umDrYheeY451cQnEe",
+ required: true
+ )
+ end
+
+ defp status_response do
+ Operation.response("Status", "application/json", Status)
+ end
+
+ defp context do
+ %Schema{
+ title: "StatusContext",
+ description:
+ "Represents the tree around a given status. Used for reconstructing threads of statuses.",
+ type: :object,
+ required: [:ancestors, :descendants],
+ properties: %{
+ ancestors: array_of_statuses(),
+ descendants: array_of_statuses()
+ },
+ example: %{
+ "ancestors" => [Status.schema().example],
+ "descendants" => [Status.schema().example]
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/subscription_operation.ex b/lib/pleroma/web/api_spec/operations/subscription_operation.ex
new file mode 100644
index 000000000..cf6dcb068
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/subscription_operation.ex
@@ -0,0 +1,226 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.SubscriptionOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Helpers
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.PushSubscription
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def create_operation do
+ %Operation{
+ tags: ["Push Subscriptions"],
+ summary: "Subscribe to push notifications",
+ description:
+ "Add a Web Push API subscription to receive notifications. Each access token can have one push subscription. If you create a new subscription, the old subscription is deleted.",
+ operationId: "SubscriptionController.create",
+ security: [%{"oAuth" => ["push"]}],
+ requestBody: Helpers.request_body("Parameters", create_request(), required: true),
+ responses: %{
+ 200 => Operation.response("Push Subscription", "application/json", PushSubscription),
+ 400 => Operation.response("Error", "application/json", ApiError),
+ 403 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def show_operation do
+ %Operation{
+ tags: ["Push Subscriptions"],
+ summary: "Get current subscription",
+ description: "View the PushSubscription currently associated with this access token.",
+ operationId: "SubscriptionController.show",
+ security: [%{"oAuth" => ["push"]}],
+ responses: %{
+ 200 => Operation.response("Push Subscription", "application/json", PushSubscription),
+ 403 => Operation.response("Error", "application/json", ApiError),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def update_operation do
+ %Operation{
+ tags: ["Push Subscriptions"],
+ summary: "Change types of notifications",
+ description:
+ "Updates the current push subscription. Only the data part can be updated. To change fundamentals, a new subscription must be created instead.",
+ operationId: "SubscriptionController.update",
+ security: [%{"oAuth" => ["push"]}],
+ requestBody: Helpers.request_body("Parameters", update_request(), required: true),
+ responses: %{
+ 200 => Operation.response("Push Subscription", "application/json", PushSubscription),
+ 403 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def delete_operation do
+ %Operation{
+ tags: ["Push Subscriptions"],
+ summary: "Remove current subscription",
+ description: "Removes the current Web Push API subscription.",
+ operationId: "SubscriptionController.delete",
+ security: [%{"oAuth" => ["push"]}],
+ responses: %{
+ 200 => Operation.response("Empty object", "application/json", %Schema{type: :object}),
+ 403 => Operation.response("Error", "application/json", ApiError),
+ 404 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ defp create_request do
+ %Schema{
+ title: "SubscriptionCreateRequest",
+ description: "POST body for creating a push subscription",
+ type: :object,
+ properties: %{
+ subscription: %Schema{
+ type: :object,
+ properties: %{
+ endpoint: %Schema{
+ type: :string,
+ description: "Endpoint URL that is called when a notification event occurs."
+ },
+ keys: %Schema{
+ type: :object,
+ properties: %{
+ p256dh: %Schema{
+ type: :string,
+ description:
+ "User agent public key. Base64 encoded string of public key of ECDH key using `prime256v1` curve."
+ },
+ auth: %Schema{
+ type: :string,
+ description: "Auth secret. Base64 encoded string of 16 bytes of random data."
+ }
+ },
+ required: [:p256dh, :auth]
+ }
+ },
+ required: [:endpoint, :keys]
+ },
+ data: %Schema{
+ nullable: true,
+ type: :object,
+ properties: %{
+ alerts: %Schema{
+ nullable: true,
+ type: :object,
+ properties: %{
+ follow: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive follow notifications?"
+ },
+ favourite: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive favourite notifications?"
+ },
+ reblog: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive reblog notifications?"
+ },
+ mention: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive mention notifications?"
+ },
+ poll: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive poll notifications?"
+ }
+ }
+ }
+ }
+ }
+ },
+ required: [:subscription],
+ example: %{
+ "subscription" => %{
+ "endpoint" => "https://example.com/example/1234",
+ "keys" => %{
+ "auth" => "8eDyX_uCN0XRhSbY5hs7Hg==",
+ "p256dh" =>
+ "BCIWgsnyXDv1VkhqL2P7YRBvdeuDnlwAPT2guNhdIoW3IP7GmHh1SMKPLxRf7x8vJy6ZFK3ol2ohgn_-0yP7QQA="
+ }
+ },
+ "data" => %{
+ "alerts" => %{
+ "follow" => true,
+ "mention" => true,
+ "poll" => false
+ }
+ }
+ }
+ }
+ end
+
+ defp update_request do
+ %Schema{
+ title: "SubscriptionUpdateRequest",
+ type: :object,
+ properties: %{
+ data: %Schema{
+ nullable: true,
+ type: :object,
+ properties: %{
+ alerts: %Schema{
+ nullable: true,
+ type: :object,
+ properties: %{
+ follow: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive follow notifications?"
+ },
+ favourite: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive favourite notifications?"
+ },
+ reblog: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive reblog notifications?"
+ },
+ mention: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive mention notifications?"
+ },
+ poll: %Schema{
+ type: :boolean,
+ nullable: true,
+ description: "Receive poll notifications?"
+ }
+ }
+ }
+ }
+ }
+ },
+ example: %{
+ "data" => %{
+ "alerts" => %{
+ "follow" => true,
+ "favourite" => true,
+ "reblog" => true,
+ "mention" => true,
+ "poll" => true
+ }
+ }
+ }
+ }
+ end
+end
diff --git a/lib/pleroma/web/api_spec/operations/timeline_operation.ex b/lib/pleroma/web/api_spec/operations/timeline_operation.ex
new file mode 100644
index 000000000..cb9d75841
--- /dev/null
+++ b/lib/pleroma/web/api_spec/operations/timeline_operation.ex
@@ -0,0 +1,191 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.TimelineOperation do
+ alias OpenApiSpex.Operation
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.ApiError
+ alias Pleroma.Web.ApiSpec.Schemas.BooleanLike
+ alias Pleroma.Web.ApiSpec.Schemas.Status
+ alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope
+
+ import Pleroma.Web.ApiSpec.Helpers
+
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
+ end
+
+ def home_operation do
+ %Operation{
+ tags: ["Timelines"],
+ summary: "Home timeline",
+ description: "View statuses from followed users",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: [
+ local_param(),
+ with_muted_param(),
+ exclude_visibilities_param(),
+ reply_visibility_param() | pagination_params()
+ ],
+ operationId: "TimelineController.home",
+ responses: %{
+ 200 => Operation.response("Array of Status", "application/json", array_of_statuses())
+ }
+ }
+ end
+
+ def direct_operation do
+ %Operation{
+ tags: ["Timelines"],
+ summary: "Direct timeline",
+ description:
+ "View statuses with a “direct” privacy, from your account or in your notifications",
+ deprecated: true,
+ parameters: pagination_params(),
+ security: [%{"oAuth" => ["read:statuses"]}],
+ operationId: "TimelineController.direct",
+ responses: %{
+ 200 => Operation.response("Array of Status", "application/json", array_of_statuses())
+ }
+ }
+ end
+
+ def public_operation do
+ %Operation{
+ tags: ["Timelines"],
+ summary: "Public timeline",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: [
+ local_param(),
+ only_media_param(),
+ with_muted_param(),
+ exclude_visibilities_param(),
+ reply_visibility_param() | pagination_params()
+ ],
+ operationId: "TimelineController.public",
+ responses: %{
+ 200 => Operation.response("Array of Status", "application/json", array_of_statuses()),
+ 401 => Operation.response("Error", "application/json", ApiError)
+ }
+ }
+ end
+
+ def hashtag_operation do
+ %Operation{
+ tags: ["Timelines"],
+ summary: "Hashtag timeline",
+ description: "View public statuses containing the given hashtag",
+ security: [%{"oAuth" => ["read:statuses"]}],
+ parameters: [
+ Operation.parameter(
+ :tag,
+ :path,
+ %Schema{type: :string},
+ "Content of a #hashtag, not including # symbol.",
+ required: true
+ ),
+ Operation.parameter(
+ :any,
+ :query,
+ %Schema{type: :array, items: %Schema{type: :string}},
+ "Statuses that also includes any of these tags"
+ ),
+ Operation.parameter(
+ :all,
+ :query,
+ %Schema{type: :array, items: %Schema{type: :string}},
+ "Statuses that also includes all of these tags"
+ ),
+ Operation.parameter(
+ :none,
+ :query,
+ %Schema{type: :array, items: %Schema{type: :string}},
+ "Statuses that do not include these tags"
+ ),
+ local_param(),
+ only_media_param(),
+ with_muted_param(),
+ exclude_visibilities_param() | pagination_params()
+ ],
+ operationId: "TimelineController.hashtag",
+ responses: %{
+ 200 => Operation.response("Array of Status", "application/json", array_of_statuses())
+ }
+ }
+ end
+
+ def list_operation do
+ %Operation{
+ tags: ["Timelines"],
+ summary: "List timeline",
+ description: "View statuses in the given list timeline",
+ security: [%{"oAuth" => ["read:lists"]}],
+ parameters: [
+ Operation.parameter(
+ :list_id,
+ :path,
+ %Schema{type: :string},
+ "Local ID of the list in the database",
+ required: true
+ ),
+ with_muted_param(),
+ exclude_visibilities_param() | pagination_params()
+ ],
+ operationId: "TimelineController.list",
+ responses: %{
+ 200 => Operation.response("Array of Status", "application/json", array_of_statuses())
+ }
+ }
+ end
+
+ defp array_of_statuses do
+ %Schema{
+ title: "ArrayOfStatuses",
+ type: :array,
+ items: Status,
+ example: [Status.schema().example]
+ }
+ end
+
+ defp local_param do
+ Operation.parameter(
+ :local,
+ :query,
+ %Schema{allOf: [BooleanLike], default: false},
+ "Show only local statuses?"
+ )
+ end
+
+ defp with_muted_param do
+ Operation.parameter(:with_muted, :query, BooleanLike, "Includeactivities by muted users")
+ end
+
+ defp exclude_visibilities_param do
+ Operation.parameter(
+ :exclude_visibilities,
+ :query,
+ %Schema{type: :array, items: VisibilityScope},
+ "Exclude the statuses with the given visibilities"
+ )
+ end
+
+ defp reply_visibility_param do
+ Operation.parameter(
+ :reply_visibility,
+ :query,
+ %Schema{type: :string, enum: ["following", "self"]},
+ "Filter replies. Possible values: without parameter (default) shows all replies, `following` - replies directed to you or users you follow, `self` - replies directed to you."
+ )
+ end
+
+ defp only_media_param do
+ Operation.parameter(
+ :only_media,
+ :query,
+ %Schema{allOf: [BooleanLike], default: false},
+ "Show only statuses with media attached?"
+ )
+ end
+end
diff --git a/lib/pleroma/web/api_spec/render_error.ex b/lib/pleroma/web/api_spec/render_error.ex
new file mode 100644
index 000000000..d476b8ef3
--- /dev/null
+++ b/lib/pleroma/web/api_spec/render_error.ex
@@ -0,0 +1,234 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.RenderError do
+ @behaviour Plug
+
+ import Plug.Conn, only: [put_status: 2]
+ import Phoenix.Controller, only: [json: 2]
+ import Pleroma.Web.Gettext
+
+ @impl Plug
+ def init(opts), do: opts
+
+ @impl Plug
+
+ def call(conn, errors) do
+ errors =
+ Enum.map(errors, fn
+ %{name: nil, reason: :invalid_enum} = err ->
+ %OpenApiSpex.Cast.Error{err | name: err.value}
+
+ %{name: nil} = err ->
+ %OpenApiSpex.Cast.Error{err | name: List.last(err.path)}
+
+ err ->
+ err
+ end)
+
+ conn
+ |> put_status(:bad_request)
+ |> json(%{
+ error: errors |> Enum.map(&message/1) |> Enum.join(" "),
+ errors: errors |> Enum.map(&render_error/1)
+ })
+ end
+
+ defp render_error(error) do
+ pointer = OpenApiSpex.path_to_string(error)
+
+ %{
+ title: "Invalid value",
+ source: %{
+ pointer: pointer
+ },
+ message: OpenApiSpex.Cast.Error.message(error)
+ }
+ end
+
+ defp message(%{reason: :invalid_schema_type, type: type, name: name}) do
+ gettext("%{name} - Invalid schema.type. Got: %{type}.",
+ name: name,
+ type: inspect(type)
+ )
+ end
+
+ defp message(%{reason: :null_value, name: name} = error) do
+ case error.type do
+ nil ->
+ gettext("%{name} - null value.", name: name)
+
+ type ->
+ gettext("%{name} - null value where %{type} expected.",
+ name: name,
+ type: type
+ )
+ end
+ end
+
+ defp message(%{reason: :all_of, meta: %{invalid_schema: invalid_schema}}) do
+ gettext(
+ "Failed to cast value as %{invalid_schema}. Value must be castable using `allOf` schemas listed.",
+ invalid_schema: invalid_schema
+ )
+ end
+
+ defp message(%{reason: :any_of, meta: %{failed_schemas: failed_schemas}}) do
+ gettext("Failed to cast value using any of: %{failed_schemas}.",
+ failed_schemas: failed_schemas
+ )
+ end
+
+ defp message(%{reason: :one_of, meta: %{failed_schemas: failed_schemas}}) do
+ gettext("Failed to cast value to one of: %{failed_schemas}.", failed_schemas: failed_schemas)
+ end
+
+ defp message(%{reason: :min_length, length: length, name: name}) do
+ gettext("%{name} - String length is smaller than minLength: %{length}.",
+ name: name,
+ length: length
+ )
+ end
+
+ defp message(%{reason: :max_length, length: length, name: name}) do
+ gettext("%{name} - String length is larger than maxLength: %{length}.",
+ name: name,
+ length: length
+ )
+ end
+
+ defp message(%{reason: :unique_items, name: name}) do
+ gettext("%{name} - Array items must be unique.", name: name)
+ end
+
+ defp message(%{reason: :min_items, length: min, value: array, name: name}) do
+ gettext("%{name} - Array length %{length} is smaller than minItems: %{min}.",
+ name: name,
+ length: length(array),
+ min: min
+ )
+ end
+
+ defp message(%{reason: :max_items, length: max, value: array, name: name}) do
+ gettext("%{name} - Array length %{length} is larger than maxItems: %{}.",
+ name: name,
+ length: length(array),
+ max: max
+ )
+ end
+
+ defp message(%{reason: :multiple_of, length: multiple, value: count, name: name}) do
+ gettext("%{name} - %{count} is not a multiple of %{multiple}.",
+ name: name,
+ count: count,
+ multiple: multiple
+ )
+ end
+
+ defp message(%{reason: :exclusive_max, length: max, value: value, name: name})
+ when value >= max do
+ gettext("%{name} - %{value} is larger than exclusive maximum %{max}.",
+ name: name,
+ value: value,
+ max: max
+ )
+ end
+
+ defp message(%{reason: :maximum, length: max, value: value, name: name})
+ when value > max do
+ gettext("%{name} - %{value} is larger than inclusive maximum %{max}.",
+ name: name,
+ value: value,
+ max: max
+ )
+ end
+
+ defp message(%{reason: :exclusive_multiple, length: min, value: value, name: name})
+ when value <= min do
+ gettext("%{name} - %{value} is smaller than exclusive minimum %{min}.",
+ name: name,
+ value: value,
+ min: min
+ )
+ end
+
+ defp message(%{reason: :minimum, length: min, value: value, name: name})
+ when value < min do
+ gettext("%{name} - %{value} is smaller than inclusive minimum %{min}.",
+ name: name,
+ value: value,
+ min: min
+ )
+ end
+
+ defp message(%{reason: :invalid_type, type: type, value: value, name: name}) do
+ gettext("%{name} - Invalid %{type}. Got: %{value}.",
+ name: name,
+ value: OpenApiSpex.TermType.type(value),
+ type: type
+ )
+ end
+
+ defp message(%{reason: :invalid_format, format: format, name: name}) do
+ gettext("%{name} - Invalid format. Expected %{format}.", name: name, format: inspect(format))
+ end
+
+ defp message(%{reason: :invalid_enum, name: name}) do
+ gettext("%{name} - Invalid value for enum.", name: name)
+ end
+
+ defp message(%{reason: :polymorphic_failed, type: polymorphic_type}) do
+ gettext("Failed to cast to any schema in %{polymorphic_type}",
+ polymorphic_type: polymorphic_type
+ )
+ end
+
+ defp message(%{reason: :unexpected_field, name: name}) do
+ gettext("Unexpected field: %{name}.", name: safe_string(name))
+ end
+
+ defp message(%{reason: :no_value_for_discriminator, name: field}) do
+ gettext("Value used as discriminator for `%{field}` matches no schemas.", name: field)
+ end
+
+ defp message(%{reason: :invalid_discriminator_value, name: field}) do
+ gettext("No value provided for required discriminator `%{field}`.", name: field)
+ end
+
+ defp message(%{reason: :unknown_schema, name: name}) do
+ gettext("Unknown schema: %{name}.", name: name)
+ end
+
+ defp message(%{reason: :missing_field, name: name}) do
+ gettext("Missing field: %{name}.", name: name)
+ end
+
+ defp message(%{reason: :missing_header, name: name}) do
+ gettext("Missing header: %{name}.", name: name)
+ end
+
+ defp message(%{reason: :invalid_header, name: name}) do
+ gettext("Invalid value for header: %{name}.", name: name)
+ end
+
+ defp message(%{reason: :max_properties, meta: meta}) do
+ gettext(
+ "Object property count %{property_count} is greater than maxProperties: %{max_properties}.",
+ property_count: meta.property_count,
+ max_properties: meta.max_properties
+ )
+ end
+
+ defp message(%{reason: :min_properties, meta: meta}) do
+ gettext(
+ "Object property count %{property_count} is less than minProperties: %{min_properties}",
+ property_count: meta.property_count,
+ min_properties: meta.min_properties
+ )
+ end
+
+ defp safe_string(string) do
+ to_string(string) |> String.slice(0..39)
+ end
+end
diff --git a/lib/pleroma/web/api_spec/schemas/account.ex b/lib/pleroma/web/api_spec/schemas/account.ex
new file mode 100644
index 000000000..d54e2158d
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/account.ex
@@ -0,0 +1,167 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.Account do
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.AccountField
+ alias Pleroma.Web.ApiSpec.Schemas.AccountRelationship
+ alias Pleroma.Web.ApiSpec.Schemas.ActorType
+ alias Pleroma.Web.ApiSpec.Schemas.Emoji
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+ alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "Account",
+ description: "Response schema for an account",
+ type: :object,
+ properties: %{
+ acct: %Schema{type: :string},
+ avatar_static: %Schema{type: :string, format: :uri},
+ avatar: %Schema{type: :string, format: :uri},
+ bot: %Schema{type: :boolean},
+ created_at: %Schema{type: :string, format: "date-time"},
+ display_name: %Schema{type: :string},
+ emojis: %Schema{type: :array, items: Emoji},
+ fields: %Schema{type: :array, items: AccountField},
+ follow_requests_count: %Schema{type: :integer},
+ followers_count: %Schema{type: :integer},
+ following_count: %Schema{type: :integer},
+ header_static: %Schema{type: :string, format: :uri},
+ header: %Schema{type: :string, format: :uri},
+ id: FlakeID,
+ locked: %Schema{type: :boolean},
+ note: %Schema{type: :string, format: :html},
+ statuses_count: %Schema{type: :integer},
+ url: %Schema{type: :string, format: :uri},
+ username: %Schema{type: :string},
+ pleroma: %Schema{
+ type: :object,
+ properties: %{
+ allow_following_move: %Schema{type: :boolean},
+ background_image: %Schema{type: :string, nullable: true},
+ chat_token: %Schema{type: :string},
+ confirmation_pending: %Schema{type: :boolean},
+ hide_favorites: %Schema{type: :boolean},
+ hide_followers_count: %Schema{type: :boolean},
+ hide_followers: %Schema{type: :boolean},
+ hide_follows_count: %Schema{type: :boolean},
+ hide_follows: %Schema{type: :boolean},
+ is_admin: %Schema{type: :boolean},
+ is_moderator: %Schema{type: :boolean},
+ skip_thread_containment: %Schema{type: :boolean},
+ tags: %Schema{type: :array, items: %Schema{type: :string}},
+ unread_conversation_count: %Schema{type: :integer},
+ notification_settings: %Schema{
+ type: :object,
+ properties: %{
+ followers: %Schema{type: :boolean},
+ follows: %Schema{type: :boolean},
+ non_followers: %Schema{type: :boolean},
+ non_follows: %Schema{type: :boolean},
+ privacy_option: %Schema{type: :boolean}
+ }
+ },
+ relationship: AccountRelationship,
+ settings_store: %Schema{
+ type: :object
+ }
+ }
+ },
+ source: %Schema{
+ type: :object,
+ properties: %{
+ fields: %Schema{type: :array, items: AccountField},
+ note: %Schema{type: :string},
+ privacy: VisibilityScope,
+ sensitive: %Schema{type: :boolean},
+ pleroma: %Schema{
+ type: :object,
+ properties: %{
+ actor_type: ActorType,
+ discoverable: %Schema{type: :boolean},
+ no_rich_text: %Schema{type: :boolean},
+ show_role: %Schema{type: :boolean}
+ }
+ }
+ }
+ }
+ },
+ example: %{
+ "acct" => "foobar",
+ "avatar" => "https://mypleroma.com/images/avi.png",
+ "avatar_static" => "https://mypleroma.com/images/avi.png",
+ "bot" => false,
+ "created_at" => "2020-03-24T13:05:58.000Z",
+ "display_name" => "foobar",
+ "emojis" => [],
+ "fields" => [],
+ "follow_requests_count" => 0,
+ "followers_count" => 0,
+ "following_count" => 1,
+ "header" => "https://mypleroma.com/images/banner.png",
+ "header_static" => "https://mypleroma.com/images/banner.png",
+ "id" => "9tKi3esbG7OQgZ2920",
+ "locked" => false,
+ "note" => "cofe",
+ "pleroma" => %{
+ "allow_following_move" => true,
+ "background_image" => nil,
+ "confirmation_pending" => true,
+ "hide_favorites" => true,
+ "hide_followers" => false,
+ "hide_followers_count" => false,
+ "hide_follows" => false,
+ "hide_follows_count" => false,
+ "is_admin" => false,
+ "is_moderator" => false,
+ "skip_thread_containment" => false,
+ "chat_token" =>
+ "SFMyNTY.g3QAAAACZAAEZGF0YW0AAAASOXRLaTNlc2JHN09RZ1oyOTIwZAAGc2lnbmVkbgYARNplS3EB.Mb_Iaqew2bN1I1o79B_iP7encmVCpTKC4OtHZRxdjKc",
+ "unread_conversation_count" => 0,
+ "tags" => [],
+ "notification_settings" => %{
+ "followers" => true,
+ "follows" => true,
+ "non_followers" => true,
+ "non_follows" => true,
+ "privacy_option" => false
+ },
+ "relationship" => %{
+ "blocked_by" => false,
+ "blocking" => false,
+ "domain_blocking" => false,
+ "endorsed" => false,
+ "followed_by" => false,
+ "following" => false,
+ "id" => "9tKi3esbG7OQgZ2920",
+ "muting" => false,
+ "muting_notifications" => false,
+ "requested" => false,
+ "showing_reblogs" => true,
+ "subscribing" => false
+ },
+ "settings_store" => %{
+ "pleroma-fe" => %{}
+ }
+ },
+ "source" => %{
+ "fields" => [],
+ "note" => "foobar",
+ "pleroma" => %{
+ "actor_type" => "Person",
+ "discoverable" => false,
+ "no_rich_text" => false,
+ "show_role" => true
+ },
+ "privacy" => "public",
+ "sensitive" => false
+ },
+ "statuses_count" => 0,
+ "url" => "https://mypleroma.com/users/foobar",
+ "username" => "foobar"
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/account_field.ex b/lib/pleroma/web/api_spec/schemas/account_field.ex
new file mode 100644
index 000000000..fa97073a0
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/account_field.ex
@@ -0,0 +1,26 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.AccountField do
+ alias OpenApiSpex.Schema
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "AccountField",
+ description: "Response schema for account custom fields",
+ type: :object,
+ properties: %{
+ name: %Schema{type: :string},
+ value: %Schema{type: :string, format: :html},
+ verified_at: %Schema{type: :string, format: :"date-time", nullable: true}
+ },
+ example: %{
+ "name" => "Website",
+ "value" =>
+ "<a href=\"https://pleroma.com\" rel=\"me nofollow noopener noreferrer\" target=\"_blank\"><span class=\"invisible\">https://</span><span class=\"\">pleroma.com</span><span class=\"invisible\"></span></a>",
+ "verified_at" => "2019-08-29T04:14:55.571+00:00"
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/account_relationship.ex b/lib/pleroma/web/api_spec/schemas/account_relationship.ex
new file mode 100644
index 000000000..8b982669e
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/account_relationship.ex
@@ -0,0 +1,44 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.AccountRelationship do
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "AccountRelationship",
+ description: "Response schema for relationship",
+ type: :object,
+ properties: %{
+ blocked_by: %Schema{type: :boolean},
+ blocking: %Schema{type: :boolean},
+ domain_blocking: %Schema{type: :boolean},
+ endorsed: %Schema{type: :boolean},
+ followed_by: %Schema{type: :boolean},
+ following: %Schema{type: :boolean},
+ id: FlakeID,
+ muting: %Schema{type: :boolean},
+ muting_notifications: %Schema{type: :boolean},
+ requested: %Schema{type: :boolean},
+ showing_reblogs: %Schema{type: :boolean},
+ subscribing: %Schema{type: :boolean}
+ },
+ example: %{
+ "blocked_by" => false,
+ "blocking" => false,
+ "domain_blocking" => false,
+ "endorsed" => false,
+ "followed_by" => false,
+ "following" => false,
+ "id" => "9tKi3esbG7OQgZ2920",
+ "muting" => false,
+ "muting_notifications" => false,
+ "requested" => false,
+ "showing_reblogs" => true,
+ "subscribing" => false
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/actor_type.ex b/lib/pleroma/web/api_spec/schemas/actor_type.ex
new file mode 100644
index 000000000..ac9b46678
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/actor_type.ex
@@ -0,0 +1,13 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.ActorType do
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "ActorType",
+ type: :string,
+ enum: ["Application", "Group", "Organization", "Person", "Service"]
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/api_error.ex b/lib/pleroma/web/api_spec/schemas/api_error.ex
new file mode 100644
index 000000000..5815df94c
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/api_error.ex
@@ -0,0 +1,19 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.ApiError do
+ alias OpenApiSpex.Schema
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "ApiError",
+ description: "Response schema for API error",
+ type: :object,
+ properties: %{error: %Schema{type: :string}},
+ example: %{
+ "error" => "Something went wrong"
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/attachment.ex b/lib/pleroma/web/api_spec/schemas/attachment.ex
new file mode 100644
index 000000000..c6edf6d36
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/attachment.ex
@@ -0,0 +1,68 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.Attachment do
+ alias OpenApiSpex.Schema
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "Attachment",
+ description: "Represents a file or media attachment that can be added to a status.",
+ type: :object,
+ requried: [:id, :url, :preview_url],
+ properties: %{
+ id: %Schema{type: :string, description: "The ID of the attachment in the database."},
+ url: %Schema{
+ type: :string,
+ format: :uri,
+ description: "The location of the original full-size attachment"
+ },
+ remote_url: %Schema{
+ type: :string,
+ format: :uri,
+ description:
+ "The location of the full-size original attachment on the remote website. String (URL), or null if the attachment is local",
+ nullable: true
+ },
+ preview_url: %Schema{
+ type: :string,
+ format: :uri,
+ description: "The location of a scaled-down preview of the attachment"
+ },
+ text_url: %Schema{
+ type: :string,
+ format: :uri,
+ description: "A shorter URL for the attachment"
+ },
+ description: %Schema{
+ type: :string,
+ nullable: true,
+ description:
+ "Alternate text that describes what is in the media attachment, to be used for the visually impaired or when media attachments do not load"
+ },
+ type: %Schema{
+ type: :string,
+ enum: ["image", "video", "audio", "unknown"],
+ description: "The type of the attachment"
+ },
+ pleroma: %Schema{
+ type: :object,
+ properties: %{
+ mime_type: %Schema{type: :string, description: "mime type of the attachment"}
+ }
+ }
+ },
+ example: %{
+ id: "1638338801",
+ type: "image",
+ url: "someurl",
+ remote_url: "someurl",
+ preview_url: "someurl",
+ text_url: "someurl",
+ description: nil,
+ pleroma: %{mime_type: "image/png"}
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/boolean_like.ex b/lib/pleroma/web/api_spec/schemas/boolean_like.ex
new file mode 100644
index 000000000..f3bfb74da
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/boolean_like.ex
@@ -0,0 +1,36 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.BooleanLike do
+ alias OpenApiSpex.Schema
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "BooleanLike",
+ description: """
+ The following values will be treated as `false`:
+ - false
+ - 0
+ - "0",
+ - "f",
+ - "F",
+ - "false",
+ - "FALSE",
+ - "off",
+ - "OFF"
+
+ All other non-null values will be treated as `true`
+ """,
+ anyOf: [
+ %Schema{type: :boolean},
+ %Schema{type: :string},
+ %Schema{type: :integer}
+ ]
+ })
+
+ def after_cast(value, _schmea) do
+ {:ok, Pleroma.Web.ControllerHelper.truthy_param?(value)}
+ end
+end
diff --git a/lib/pleroma/web/api_spec/schemas/conversation.ex b/lib/pleroma/web/api_spec/schemas/conversation.ex
new file mode 100644
index 000000000..d8ff5ba26
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/conversation.ex
@@ -0,0 +1,41 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.Conversation do
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Account
+ alias Pleroma.Web.ApiSpec.Schemas.Status
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "Conversation",
+ description: "Represents a conversation with \"direct message\" visibility.",
+ type: :object,
+ required: [:id, :accounts, :unread],
+ properties: %{
+ id: %Schema{type: :string},
+ accounts: %Schema{
+ type: :array,
+ items: Account,
+ description: "Participants in the conversation"
+ },
+ unread: %Schema{
+ type: :boolean,
+ description: "Is the conversation currently marked as unread?"
+ },
+ # last_status: Status
+ last_status: %Schema{
+ allOf: [Status],
+ description: "The last status in the conversation, to be used for optional display"
+ }
+ },
+ example: %{
+ "id" => "418450",
+ "unread" => true,
+ "accounts" => [Account.schema().example],
+ "last_status" => Status.schema().example
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/emoji.ex b/lib/pleroma/web/api_spec/schemas/emoji.ex
new file mode 100644
index 000000000..26f35e648
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/emoji.ex
@@ -0,0 +1,29 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.Emoji do
+ alias OpenApiSpex.Schema
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "Emoji",
+ description: "Response schema for an emoji",
+ type: :object,
+ properties: %{
+ shortcode: %Schema{type: :string},
+ url: %Schema{type: :string, format: :uri},
+ static_url: %Schema{type: :string, format: :uri},
+ visible_in_picker: %Schema{type: :boolean}
+ },
+ example: %{
+ "shortcode" => "fatyoshi",
+ "url" =>
+ "https://files.mastodon.social/custom_emojis/images/000/023/920/original/e57ecb623faa0dc9.png",
+ "static_url" =>
+ "https://files.mastodon.social/custom_emojis/images/000/023/920/static/e57ecb623faa0dc9.png",
+ "visible_in_picker" => true
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/flake_id.ex b/lib/pleroma/web/api_spec/schemas/flake_id.ex
new file mode 100644
index 000000000..3b5f6477a
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/flake_id.ex
@@ -0,0 +1,14 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.FlakeID do
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "FlakeID",
+ description:
+ "Pleroma uses 128-bit ids as opposed to Mastodon's 64 bits. However just like Mastodon's ids they are lexically sortable strings",
+ type: :string
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/list.ex b/lib/pleroma/web/api_spec/schemas/list.ex
new file mode 100644
index 000000000..b7d1685c9
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/list.ex
@@ -0,0 +1,23 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.List do
+ alias OpenApiSpex.Schema
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "List",
+ description: "Represents a list of users",
+ type: :object,
+ properties: %{
+ id: %Schema{type: :string, description: "The internal database ID of the list"},
+ title: %Schema{type: :string, description: "The user-defined title of the list"}
+ },
+ example: %{
+ "id" => "12249",
+ "title" => "Friends"
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/poll.ex b/lib/pleroma/web/api_spec/schemas/poll.ex
new file mode 100644
index 000000000..c62096db0
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/poll.ex
@@ -0,0 +1,82 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.Poll do
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Emoji
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "Poll",
+ description: "Represents a poll attached to a status",
+ type: :object,
+ properties: %{
+ id: FlakeID,
+ expires_at: %Schema{
+ type: :string,
+ format: :"date-time",
+ nullable: true,
+ description: "When the poll ends"
+ },
+ expired: %Schema{type: :boolean, description: "Is the poll currently expired?"},
+ multiple: %Schema{
+ type: :boolean,
+ description: "Does the poll allow multiple-choice answers?"
+ },
+ votes_count: %Schema{
+ type: :integer,
+ nullable: true,
+ description: "How many votes have been received. Number, or null if `multiple` is false."
+ },
+ voted: %Schema{
+ type: :boolean,
+ nullable: true,
+ description:
+ "When called with a user token, has the authorized user voted? Boolean, or null if no current user."
+ },
+ emojis: %Schema{
+ type: :array,
+ items: Emoji,
+ description: "Custom emoji to be used for rendering poll options."
+ },
+ options: %Schema{
+ type: :array,
+ items: %Schema{
+ title: "PollOption",
+ type: :object,
+ properties: %{
+ title: %Schema{type: :string},
+ votes_count: %Schema{type: :integer}
+ }
+ },
+ description: "Possible answers for the poll."
+ }
+ },
+ example: %{
+ id: "34830",
+ expires_at: "2019-12-05T04:05:08.302Z",
+ expired: true,
+ multiple: false,
+ votes_count: 10,
+ voters_count: nil,
+ voted: true,
+ own_votes: [
+ 1
+ ],
+ options: [
+ %{
+ title: "accept",
+ votes_count: 6
+ },
+ %{
+ title: "deny",
+ votes_count: 4
+ }
+ ],
+ emojis: []
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/push_subscription.ex b/lib/pleroma/web/api_spec/schemas/push_subscription.ex
new file mode 100644
index 000000000..cc91b95b8
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/push_subscription.ex
@@ -0,0 +1,66 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.PushSubscription do
+ alias OpenApiSpex.Schema
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "PushSubscription",
+ description: "Response schema for a push subscription",
+ type: :object,
+ properties: %{
+ id: %Schema{
+ anyOf: [%Schema{type: :string}, %Schema{type: :integer}],
+ description: "The id of the push subscription in the database."
+ },
+ endpoint: %Schema{type: :string, description: "Where push alerts will be sent to."},
+ server_key: %Schema{type: :string, description: "The streaming server's VAPID key."},
+ alerts: %Schema{
+ type: :object,
+ description: "Which alerts should be delivered to the endpoint.",
+ properties: %{
+ follow: %Schema{
+ type: :boolean,
+ description: "Receive a push notification when someone has followed you?"
+ },
+ favourite: %Schema{
+ type: :boolean,
+ description:
+ "Receive a push notification when a status you created has been favourited by someone else?"
+ },
+ reblog: %Schema{
+ type: :boolean,
+ description:
+ "Receive a push notification when a status you created has been boosted by someone else?"
+ },
+ mention: %Schema{
+ type: :boolean,
+ description:
+ "Receive a push notification when someone else has mentioned you in a status?"
+ },
+ poll: %Schema{
+ type: :boolean,
+ description:
+ "Receive a push notification when a poll you voted in or created has ended? "
+ }
+ }
+ }
+ },
+ example: %{
+ "id" => "328_183",
+ "endpoint" => "https://yourdomain.example/listener",
+ "alerts" => %{
+ "follow" => true,
+ "favourite" => true,
+ "reblog" => true,
+ "mention" => true,
+ "poll" => true
+ },
+ "server_key" =>
+ "BCk-QqERU0q-CfYZjcuB6lnyyOYfJ2AifKqfeGIm7Z-HiTU5T9eTG5GxVA0_OH5mMlI4UkkDTpaZwozy0TzdZ2M="
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/scheduled_status.ex b/lib/pleroma/web/api_spec/schemas/scheduled_status.ex
new file mode 100644
index 000000000..0520d0848
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/scheduled_status.ex
@@ -0,0 +1,54 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.ScheduledStatus do
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Attachment
+ alias Pleroma.Web.ApiSpec.Schemas.Poll
+ alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "ScheduledStatus",
+ description: "Represents a status that will be published at a future scheduled date.",
+ type: :object,
+ required: [:id, :scheduled_at, :params],
+ properties: %{
+ id: %Schema{type: :string},
+ scheduled_at: %Schema{type: :string, format: :"date-time"},
+ media_attachments: %Schema{type: :array, items: Attachment},
+ params: %Schema{
+ type: :object,
+ required: [:text, :visibility],
+ properties: %{
+ text: %Schema{type: :string, nullable: true},
+ media_ids: %Schema{type: :array, nullable: true, items: %Schema{type: :string}},
+ sensitive: %Schema{type: :boolean, nullable: true},
+ spoiler_text: %Schema{type: :string, nullable: true},
+ visibility: %Schema{type: VisibilityScope, nullable: true},
+ scheduled_at: %Schema{type: :string, format: :"date-time", nullable: true},
+ poll: %Schema{type: Poll, nullable: true},
+ in_reply_to_id: %Schema{type: :string, nullable: true}
+ }
+ }
+ },
+ example: %{
+ id: "3221",
+ scheduled_at: "2019-12-05T12:33:01.000Z",
+ params: %{
+ text: "test content",
+ media_ids: nil,
+ sensitive: nil,
+ spoiler_text: nil,
+ visibility: nil,
+ scheduled_at: nil,
+ poll: nil,
+ idempotency: nil,
+ in_reply_to_id: nil
+ },
+ media_attachments: [Attachment.schema().example]
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/status.ex b/lib/pleroma/web/api_spec/schemas/status.ex
new file mode 100644
index 000000000..8b87cb25b
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/status.ex
@@ -0,0 +1,325 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.Status do
+ alias OpenApiSpex.Schema
+ alias Pleroma.Web.ApiSpec.Schemas.Account
+ alias Pleroma.Web.ApiSpec.Schemas.Attachment
+ alias Pleroma.Web.ApiSpec.Schemas.Emoji
+ alias Pleroma.Web.ApiSpec.Schemas.FlakeID
+ alias Pleroma.Web.ApiSpec.Schemas.Poll
+ alias Pleroma.Web.ApiSpec.Schemas.Tag
+ alias Pleroma.Web.ApiSpec.Schemas.VisibilityScope
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "Status",
+ description: "Response schema for a status",
+ type: :object,
+ properties: %{
+ account: %Schema{allOf: [Account], description: "The account that authored this status"},
+ application: %Schema{
+ description: "The application used to post this status",
+ type: :object,
+ properties: %{
+ name: %Schema{type: :string},
+ website: %Schema{type: :string, nullable: true, format: :uri}
+ }
+ },
+ bookmarked: %Schema{type: :boolean, description: "Have you bookmarked this status?"},
+ card: %Schema{
+ type: :object,
+ nullable: true,
+ description: "Preview card for links included within status content",
+ required: [:url, :title, :description, :type],
+ properties: %{
+ type: %Schema{
+ type: :string,
+ enum: ["link", "photo", "video", "rich"],
+ description: "The type of the preview card"
+ },
+ provider_name: %Schema{
+ type: :string,
+ nullable: true,
+ description: "The provider of the original resource"
+ },
+ provider_url: %Schema{
+ type: :string,
+ format: :uri,
+ description: "A link to the provider of the original resource"
+ },
+ url: %Schema{type: :string, format: :uri, description: "Location of linked resource"},
+ image: %Schema{
+ type: :string,
+ nullable: true,
+ format: :uri,
+ description: "Preview thumbnail"
+ },
+ title: %Schema{type: :string, description: "Title of linked resource"},
+ description: %Schema{type: :string, description: "Description of preview"}
+ }
+ },
+ content: %Schema{type: :string, format: :html, description: "HTML-encoded status content"},
+ created_at: %Schema{
+ type: :string,
+ format: "date-time",
+ description: "The date when this status was created"
+ },
+ emojis: %Schema{
+ type: :array,
+ items: Emoji,
+ description: "Custom emoji to be used when rendering status content"
+ },
+ favourited: %Schema{type: :boolean, description: "Have you favourited this status?"},
+ favourites_count: %Schema{
+ type: :integer,
+ description: "How many favourites this status has received"
+ },
+ id: FlakeID,
+ in_reply_to_account_id: %Schema{
+ allOf: [FlakeID],
+ nullable: true,
+ description: "ID of the account being replied to"
+ },
+ in_reply_to_id: %Schema{
+ allOf: [FlakeID],
+ nullable: true,
+ description: "ID of the status being replied"
+ },
+ language: %Schema{
+ type: :string,
+ nullable: true,
+ description: "Primary language of this status"
+ },
+ media_attachments: %Schema{
+ type: :array,
+ items: Attachment,
+ description: "Media that is attached to this status"
+ },
+ mentions: %Schema{
+ type: :array,
+ description: "Mentions of users within the status content",
+ items: %Schema{
+ type: :object,
+ properties: %{
+ id: %Schema{allOf: [FlakeID], description: "The account id of the mentioned user"},
+ acct: %Schema{
+ type: :string,
+ description:
+ "The webfinger acct: URI of the mentioned user. Equivalent to `username` for local users, or `username@domain` for remote users."
+ },
+ username: %Schema{type: :string, description: "The username of the mentioned user"},
+ url: %Schema{
+ type: :string,
+ format: :uri,
+ description: "The location of the mentioned user's profile"
+ }
+ }
+ }
+ },
+ muted: %Schema{
+ type: :boolean,
+ description: "Have you muted notifications for this status's conversation?"
+ },
+ pinned: %Schema{
+ type: :boolean,
+ description: "Have you pinned this status? Only appears if the status is pinnable."
+ },
+ pleroma: %Schema{
+ type: :object,
+ properties: %{
+ content: %Schema{
+ type: :object,
+ additionalProperties: %Schema{type: :string},
+ description:
+ "A map consisting of alternate representations of the `content` property with the key being it's mimetype. Currently the only alternate representation supported is `text/plain`"
+ },
+ conversation_id: %Schema{
+ type: :integer,
+ description: "The ID of the AP context the status is associated with (if any)"
+ },
+ direct_conversation_id: %Schema{
+ type: :integer,
+ nullable: true,
+ description:
+ "The ID of the Mastodon direct message conversation the status is associated with (if any)"
+ },
+ emoji_reactions: %Schema{
+ type: :array,
+ description:
+ "A list with emoji / reaction maps. Contains no information about the reacting users, for that use the /statuses/:id/reactions endpoint.",
+ items: %Schema{
+ type: :object,
+ properties: %{
+ name: %Schema{type: :string},
+ count: %Schema{type: :integer},
+ me: %Schema{type: :boolean}
+ }
+ }
+ },
+ expires_at: %Schema{
+ type: :string,
+ format: "date-time",
+ nullable: true,
+ description:
+ "A datetime (ISO 8601) that states when the post will expire (be deleted automatically), or empty if the post won't expire"
+ },
+ in_reply_to_account_acct: %Schema{
+ type: :string,
+ nullable: true,
+ description: "The `acct` property of User entity for replied user (if any)"
+ },
+ local: %Schema{
+ type: :boolean,
+ description: "`true` if the post was made on the local instance"
+ },
+ spoiler_text: %Schema{
+ type: :object,
+ additionalProperties: %Schema{type: :string},
+ description:
+ "A map consisting of alternate representations of the `spoiler_text` property with the key being it's mimetype. Currently the only alternate representation supported is `text/plain`."
+ },
+ thread_muted: %Schema{
+ type: :boolean,
+ description: "`true` if the thread the post belongs to is muted"
+ }
+ }
+ },
+ poll: %Schema{allOf: [Poll], nullable: true, description: "The poll attached to the status"},
+ reblog: %Schema{
+ allOf: [%OpenApiSpex.Reference{"$ref": "#/components/schemas/Status"}],
+ nullable: true,
+ description: "The status being reblogged"
+ },
+ reblogged: %Schema{type: :boolean, description: "Have you boosted this status?"},
+ reblogs_count: %Schema{
+ type: :integer,
+ description: "How many boosts this status has received"
+ },
+ replies_count: %Schema{
+ type: :integer,
+ description: "How many replies this status has received"
+ },
+ sensitive: %Schema{
+ type: :boolean,
+ description: "Is this status marked as sensitive content?"
+ },
+ spoiler_text: %Schema{
+ type: :string,
+ description:
+ "Subject or summary line, below which status content is collapsed until expanded"
+ },
+ tags: %Schema{type: :array, items: Tag},
+ uri: %Schema{
+ type: :string,
+ format: :uri,
+ description: "URI of the status used for federation"
+ },
+ url: %Schema{
+ type: :string,
+ nullable: true,
+ format: :uri,
+ description: "A link to the status's HTML representation"
+ },
+ visibility: %Schema{
+ allOf: [VisibilityScope],
+ description: "Visibility of this status"
+ }
+ },
+ example: %{
+ "account" => %{
+ "acct" => "nick6",
+ "avatar" => "http://localhost:4001/images/avi.png",
+ "avatar_static" => "http://localhost:4001/images/avi.png",
+ "bot" => false,
+ "created_at" => "2020-04-07T19:48:51.000Z",
+ "display_name" => "Test テスト User 6",
+ "emojis" => [],
+ "fields" => [],
+ "followers_count" => 1,
+ "following_count" => 0,
+ "header" => "http://localhost:4001/images/banner.png",
+ "header_static" => "http://localhost:4001/images/banner.png",
+ "id" => "9toJCsKN7SmSf3aj5c",
+ "locked" => false,
+ "note" => "Tester Number 6",
+ "pleroma" => %{
+ "background_image" => nil,
+ "confirmation_pending" => false,
+ "hide_favorites" => true,
+ "hide_followers" => false,
+ "hide_followers_count" => false,
+ "hide_follows" => false,
+ "hide_follows_count" => false,
+ "is_admin" => false,
+ "is_moderator" => false,
+ "relationship" => %{
+ "blocked_by" => false,
+ "blocking" => false,
+ "domain_blocking" => false,
+ "endorsed" => false,
+ "followed_by" => false,
+ "following" => true,
+ "id" => "9toJCsKN7SmSf3aj5c",
+ "muting" => false,
+ "muting_notifications" => false,
+ "requested" => false,
+ "showing_reblogs" => true,
+ "subscribing" => false
+ },
+ "skip_thread_containment" => false,
+ "tags" => []
+ },
+ "source" => %{
+ "fields" => [],
+ "note" => "Tester Number 6",
+ "pleroma" => %{"actor_type" => "Person", "discoverable" => false},
+ "sensitive" => false
+ },
+ "statuses_count" => 1,
+ "url" => "http://localhost:4001/users/nick6",
+ "username" => "nick6"
+ },
+ "application" => %{"name" => "Web", "website" => nil},
+ "bookmarked" => false,
+ "card" => nil,
+ "content" => "foobar",
+ "created_at" => "2020-04-07T19:48:51.000Z",
+ "emojis" => [],
+ "favourited" => false,
+ "favourites_count" => 0,
+ "id" => "9toJCu5YZW7O7gfvH6",
+ "in_reply_to_account_id" => nil,
+ "in_reply_to_id" => nil,
+ "language" => nil,
+ "media_attachments" => [],
+ "mentions" => [],
+ "muted" => false,
+ "pinned" => false,
+ "pleroma" => %{
+ "content" => %{"text/plain" => "foobar"},
+ "conversation_id" => 345_972,
+ "direct_conversation_id" => nil,
+ "emoji_reactions" => [],
+ "expires_at" => nil,
+ "in_reply_to_account_acct" => nil,
+ "local" => true,
+ "spoiler_text" => %{"text/plain" => ""},
+ "thread_muted" => false
+ },
+ "poll" => nil,
+ "reblog" => nil,
+ "reblogged" => false,
+ "reblogs_count" => 0,
+ "replies_count" => 0,
+ "sensitive" => false,
+ "spoiler_text" => "",
+ "tags" => [],
+ "uri" => "http://localhost:4001/objects/0f5dad44-0e9e-4610-b377-a2631e499190",
+ "url" => "http://localhost:4001/notice/9toJCu5YZW7O7gfvH6",
+ "visibility" => "private"
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/tag.ex b/lib/pleroma/web/api_spec/schemas/tag.ex
new file mode 100644
index 000000000..e693fb83e
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/tag.ex
@@ -0,0 +1,27 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.Tag do
+ alias OpenApiSpex.Schema
+
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "Tag",
+ description: "Represents a hashtag used within the content of a status",
+ type: :object,
+ properties: %{
+ name: %Schema{type: :string, description: "The value of the hashtag after the # sign"},
+ url: %Schema{
+ type: :string,
+ format: :uri,
+ description: "A link to the hashtag on the instance"
+ }
+ },
+ example: %{
+ name: "cofe",
+ url: "https://lain.com/tag/cofe"
+ }
+ })
+end
diff --git a/lib/pleroma/web/api_spec/schemas/visibility_scope.ex b/lib/pleroma/web/api_spec/schemas/visibility_scope.ex
new file mode 100644
index 000000000..831734e27
--- /dev/null
+++ b/lib/pleroma/web/api_spec/schemas/visibility_scope.ex
@@ -0,0 +1,14 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ApiSpec.Schemas.VisibilityScope do
+ require OpenApiSpex
+
+ OpenApiSpex.schema(%{
+ title: "VisibilityScope",
+ description: "Status visibility",
+ type: :string,
+ enum: ["public", "unlisted", "private", "direct", "list"]
+ })
+end
diff --git a/lib/pleroma/web/auth/authenticator.ex b/lib/pleroma/web/auth/authenticator.ex
index dd49987f7..b4db312fb 100644
--- a/lib/pleroma/web/auth/authenticator.ex
+++ b/lib/pleroma/web/auth/authenticator.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Auth.Authenticator do
diff --git a/lib/pleroma/web/auth/ldap_authenticator.ex b/lib/pleroma/web/auth/ldap_authenticator.ex
index 177c05636..f63a66c03 100644
--- a/lib/pleroma/web/auth/ldap_authenticator.ex
+++ b/lib/pleroma/web/auth/ldap_authenticator.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Auth.LDAPAuthenticator do
diff --git a/lib/pleroma/web/auth/pleroma_authenticator.ex b/lib/pleroma/web/auth/pleroma_authenticator.ex
index f4234b743..200ca03dc 100644
--- a/lib/pleroma/web/auth/pleroma_authenticator.ex
+++ b/lib/pleroma/web/auth/pleroma_authenticator.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Auth.PleromaAuthenticator do
@@ -16,11 +16,12 @@ defmodule Pleroma.Web.Auth.PleromaAuthenticator do
def get_user(%Plug.Conn{} = conn) do
with {:ok, {name, password}} <- fetch_credentials(conn),
{_, %User{} = user} <- {:user, fetch_user(name)},
- {_, true} <- {:checkpw, AuthenticationPlug.checkpw(password, user.password_hash)} do
+ {_, true} <- {:checkpw, AuthenticationPlug.checkpw(password, user.password_hash)},
+ {:ok, user} <- AuthenticationPlug.maybe_update_password(user, password) do
{:ok, user}
else
- error ->
- {:error, error}
+ {:error, _reason} = error -> error
+ error -> {:error, error}
end
end
diff --git a/lib/pleroma/web/auth/totp_authenticator.ex b/lib/pleroma/web/auth/totp_authenticator.ex
new file mode 100644
index 000000000..ce8a76219
--- /dev/null
+++ b/lib/pleroma/web/auth/totp_authenticator.ex
@@ -0,0 +1,45 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.Auth.TOTPAuthenticator do
+ alias Pleroma.MFA
+ alias Pleroma.MFA.TOTP
+ alias Pleroma.Plugs.AuthenticationPlug
+ alias Pleroma.User
+
+ @doc "Verify code or check backup code."
+ @spec verify(String.t(), User.t()) ::
+ {:ok, :pass} | {:error, :invalid_token | :invalid_secret_and_token}
+ def verify(
+ token,
+ %User{
+ multi_factor_authentication_settings:
+ %{enabled: true, totp: %{secret: secret, confirmed: true}} = _
+ } = _user
+ )
+ when is_binary(token) and byte_size(token) > 0 do
+ TOTP.validate_token(secret, token)
+ end
+
+ def verify(_, _), do: {:error, :invalid_token}
+
+ @spec verify_recovery_code(User.t(), String.t()) ::
+ {:ok, :pass} | {:error, :invalid_token}
+ def verify_recovery_code(
+ %User{multi_factor_authentication_settings: %{enabled: true, backup_codes: codes}} = user,
+ code
+ )
+ when is_list(codes) and is_binary(code) do
+ hash_code = Enum.find(codes, fn hash -> AuthenticationPlug.checkpw(code, hash) end)
+
+ if hash_code do
+ MFA.invalidate_backup_code(user, hash_code)
+ {:ok, :pass}
+ else
+ {:error, :invalid_token}
+ end
+ end
+
+ def verify_recovery_code(_, _), do: {:error, :invalid_token}
+end
diff --git a/lib/pleroma/web/channels/user_socket.ex b/lib/pleroma/web/channels/user_socket.ex
index 8e2759e3b..306ef1916 100644
--- a/lib/pleroma/web/channels/user_socket.ex
+++ b/lib/pleroma/web/channels/user_socket.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.UserSocket do
diff --git a/lib/pleroma/web/chat_channel.ex b/lib/pleroma/web/chat_channel.ex
index 08841a3e8..bce27897f 100644
--- a/lib/pleroma/web/chat_channel.ex
+++ b/lib/pleroma/web/chat_channel.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ChatChannel do
@@ -20,9 +20,10 @@ defmodule Pleroma.Web.ChatChannel do
def handle_in("new_msg", %{"text" => text}, %{assigns: %{user_name: user_name}} = socket) do
text = String.trim(text)
- if String.length(text) > 0 do
+ if String.length(text) in 1..Pleroma.Config.get([:instance, :chat_limit]) do
author = User.get_cached_by_nickname(user_name)
author = Pleroma.Web.MastodonAPI.AccountView.render("show.json", user: author)
+
message = ChatChannelState.add_message(%{text: text, author: author})
broadcast!(socket, "new_msg", message)
diff --git a/lib/pleroma/web/common_api/activity_draft.ex b/lib/pleroma/web/common_api/activity_draft.ex
index f7da81b34..3f1a50b96 100644
--- a/lib/pleroma/web/common_api/activity_draft.ex
+++ b/lib/pleroma/web/common_api/activity_draft.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.CommonAPI.ActivityDraft do
@@ -58,16 +58,16 @@ defmodule Pleroma.Web.CommonAPI.ActivityDraft do
end
defp put_params(draft, params) do
- params = Map.put_new(params, "in_reply_to_status_id", params["in_reply_to_id"])
+ params = Map.put_new(params, :in_reply_to_status_id, params[:in_reply_to_id])
%__MODULE__{draft | params: params}
end
- defp status(%{params: %{"status" => status}} = draft) do
+ defp status(%{params: %{status: status}} = draft) do
%__MODULE__{draft | status: String.trim(status)}
end
defp summary(%{params: params} = draft) do
- %__MODULE__{draft | summary: Map.get(params, "spoiler_text", "")}
+ %__MODULE__{draft | summary: Map.get(params, :spoiler_text, "")}
end
defp full_payload(%{status: status, summary: summary} = draft) do
@@ -84,16 +84,20 @@ defmodule Pleroma.Web.CommonAPI.ActivityDraft do
%__MODULE__{draft | attachments: attachments}
end
- defp in_reply_to(draft) do
- case Map.get(draft.params, "in_reply_to_status_id") do
- "" -> draft
- nil -> draft
- id -> %__MODULE__{draft | in_reply_to: Activity.get_by_id(id)}
- end
+ defp in_reply_to(%{params: %{in_reply_to_status_id: ""}} = draft), do: draft
+
+ defp in_reply_to(%{params: %{in_reply_to_status_id: id}} = draft) when is_binary(id) do
+ %__MODULE__{draft | in_reply_to: Activity.get_by_id(id)}
end
+ defp in_reply_to(%{params: %{in_reply_to_status_id: %Activity{} = in_reply_to}} = draft) do
+ %__MODULE__{draft | in_reply_to: in_reply_to}
+ end
+
+ defp in_reply_to(draft), do: draft
+
defp in_reply_to_conversation(draft) do
- in_reply_to_conversation = Participation.get(draft.params["in_reply_to_conversation_id"])
+ in_reply_to_conversation = Participation.get(draft.params[:in_reply_to_conversation_id])
%__MODULE__{draft | in_reply_to_conversation: in_reply_to_conversation}
end
@@ -108,7 +112,7 @@ defmodule Pleroma.Web.CommonAPI.ActivityDraft do
end
defp expires_at(draft) do
- case CommonAPI.check_expiry_date(draft.params["expires_in"]) do
+ case CommonAPI.check_expiry_date(draft.params[:expires_in]) do
{:ok, expires_at} -> %__MODULE__{draft | expires_at: expires_at}
{:error, message} -> add_error(draft, message)
end
@@ -140,7 +144,7 @@ defmodule Pleroma.Web.CommonAPI.ActivityDraft do
addressed_users =
draft.mentions
|> Enum.map(fn {_, mentioned_user} -> mentioned_user.ap_id end)
- |> Utils.get_addressed_users(draft.params["to"])
+ |> Utils.get_addressed_users(draft.params[:to])
{to, cc} =
Utils.get_to_and_cc(
@@ -160,7 +164,7 @@ defmodule Pleroma.Web.CommonAPI.ActivityDraft do
end
defp sensitive(draft) do
- sensitive = draft.params["sensitive"] || Enum.member?(draft.tags, {"#nsfw", "nsfw"})
+ sensitive = draft.params[:sensitive] || Enum.member?(draft.tags, {"#nsfw", "nsfw"})
%__MODULE__{draft | sensitive: sensitive}
end
@@ -187,7 +191,7 @@ defmodule Pleroma.Web.CommonAPI.ActivityDraft do
end
defp preview?(draft) do
- preview? = Pleroma.Web.ControllerHelper.truthy_param?(draft.params["preview"]) || false
+ preview? = Pleroma.Web.ControllerHelper.truthy_param?(draft.params[:preview])
%__MODULE__{draft | preview?: preview?}
end
diff --git a/lib/pleroma/web/common_api/common_api.ex b/lib/pleroma/web/common_api/common_api.ex
index 386408d51..7c94f16b6 100644
--- a/lib/pleroma/web/common_api/common_api.ex
+++ b/lib/pleroma/web/common_api/common_api.ex
@@ -1,15 +1,20 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.CommonAPI do
alias Pleroma.Activity
alias Pleroma.ActivityExpiration
alias Pleroma.Conversation.Participation
+ alias Pleroma.FollowingRelationship
+ alias Pleroma.Notification
alias Pleroma.Object
alias Pleroma.ThreadMute
alias Pleroma.User
+ alias Pleroma.UserRelationship
alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.Builder
+ alias Pleroma.Web.ActivityPub.Pipeline
alias Pleroma.Web.ActivityPub.Utils
alias Pleroma.Web.ActivityPub.Visibility
@@ -17,6 +22,26 @@ defmodule Pleroma.Web.CommonAPI do
import Pleroma.Web.CommonAPI.Utils
require Pleroma.Constants
+ require Logger
+
+ def unblock(blocker, blocked) do
+ with {_, %Activity{} = block} <- {:fetch_block, Utils.fetch_latest_block(blocker, blocked)},
+ {:ok, unblock_data, _} <- Builder.undo(blocker, block),
+ {:ok, unblock, _} <- Pipeline.common_pipeline(unblock_data, local: true) do
+ {:ok, unblock}
+ else
+ {:fetch_block, nil} ->
+ if User.blocks?(blocker, blocked) do
+ User.unblock(blocker, blocked)
+ {:ok, :no_activity}
+ else
+ {:error, :not_blocking}
+ end
+
+ e ->
+ e
+ end
+ end
def follow(follower, followed) do
timeout = Pleroma.Config.get([:activitypub, :follow_handshake_timeout])
@@ -31,15 +56,16 @@ defmodule Pleroma.Web.CommonAPI do
def unfollow(follower, unfollowed) do
with {:ok, follower, _follow_activity} <- User.unfollow(follower, unfollowed),
{:ok, _activity} <- ActivityPub.unfollow(follower, unfollowed),
- {:ok, _unfollowed} <- User.unsubscribe(follower, unfollowed) do
+ {:ok, _subscription} <- User.unsubscribe(follower, unfollowed) do
{:ok, follower}
end
end
def accept_follow_request(follower, followed) do
- with {:ok, follower} <- User.follow(follower, followed),
- %Activity{} = follow_activity <- Utils.fetch_latest_follow(follower, followed),
+ with %Activity{} = follow_activity <- Utils.fetch_latest_follow(follower, followed),
+ {:ok, follower} <- User.follow(follower, followed),
{:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "accept"),
+ {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_accept),
{:ok, _activity} <-
ActivityPub.accept(%{
to: [follower.ap_id],
@@ -54,6 +80,8 @@ defmodule Pleroma.Web.CommonAPI do
def reject_follow_request(follower, followed) do
with %Activity{} = follow_activity <- Utils.fetch_latest_follow(follower, followed),
{:ok, follow_activity} <- Utils.update_follow_state_for_all(follow_activity, "reject"),
+ {:ok, _relationship} <- FollowingRelationship.update(follower, followed, :follow_reject),
+ {:ok, _notifications} <- Notification.dismiss(follow_activity),
{:ok, _activity} <-
ActivityPub.reject(%{
to: [follower.ap_id],
@@ -66,57 +94,153 @@ defmodule Pleroma.Web.CommonAPI do
end
def delete(activity_id, user) do
- with %Activity{data: %{"object" => _}} = activity <-
- Activity.get_by_id_with_object(activity_id),
- %Object{} = object <- Object.normalize(activity),
+ with {_, %Activity{data: %{"object" => _, "type" => "Create"}} = activity} <-
+ {:find_activity, Activity.get_by_id(activity_id)},
+ {_, %Object{} = object, _} <-
+ {:find_object, Object.normalize(activity, false), activity},
true <- User.superuser?(user) || user.ap_id == object.data["actor"],
- {:ok, _} <- unpin(activity_id, user),
- {:ok, delete} <- ActivityPub.delete(object) do
+ {:ok, delete_data, _} <- Builder.delete(user, object.data["id"]),
+ {:ok, delete, _} <- Pipeline.common_pipeline(delete_data, local: true) do
{:ok, delete}
else
- _ -> {:error, dgettext("errors", "Could not delete")}
+ {:find_activity, _} ->
+ {:error, :not_found}
+
+ {:find_object, nil, %Activity{data: %{"actor" => actor, "object" => object}}} ->
+ # We have the create activity, but not the object, it was probably pruned.
+ # Insert a tombstone and try again
+ with {:ok, tombstone_data, _} <- Builder.tombstone(actor, object),
+ {:ok, _tombstone} <- Object.create(tombstone_data) do
+ delete(activity_id, user)
+ else
+ _ ->
+ Logger.error(
+ "Could not insert tombstone for missing object on deletion. Object is #{object}."
+ )
+
+ {:error, dgettext("errors", "Could not delete")}
+ end
+
+ _ ->
+ {:error, dgettext("errors", "Could not delete")}
end
end
- def repeat(id_or_ap_id, user, params \\ %{}) do
- with %Activity{} = activity <- get_by_id_or_ap_id(id_or_ap_id),
- object <- Object.normalize(activity),
- nil <- Utils.get_existing_announce(user.ap_id, object),
- public <- public_announce?(object, params) do
- ActivityPub.announce(user, object, nil, true, public)
+ def repeat(id, user, params \\ %{}) do
+ with %Activity{data: %{"type" => "Create"}} = activity <- Activity.get_by_id(id) do
+ object = Object.normalize(activity)
+ announce_activity = Utils.get_existing_announce(user.ap_id, object)
+ public = public_announce?(object, params)
+
+ if announce_activity do
+ {:ok, announce_activity, object}
+ else
+ ActivityPub.announce(user, object, nil, true, public)
+ end
else
- _ -> {:error, dgettext("errors", "Could not repeat")}
+ _ -> {:error, :not_found}
end
end
- def unrepeat(id_or_ap_id, user) do
- with %Activity{} = activity <- get_by_id_or_ap_id(id_or_ap_id) do
- object = Object.normalize(activity)
- ActivityPub.unannounce(user, object)
+ def unrepeat(id, user) do
+ with {_, %Activity{data: %{"type" => "Create"}} = activity} <-
+ {:find_activity, Activity.get_by_id(id)},
+ %Object{} = note <- Object.normalize(activity, false),
+ %Activity{} = announce <- Utils.get_existing_announce(user.ap_id, note),
+ {:ok, undo, _} <- Builder.undo(user, announce),
+ {:ok, activity, _} <- Pipeline.common_pipeline(undo, local: true) do
+ {:ok, activity}
else
+ {:find_activity, _} -> {:error, :not_found}
_ -> {:error, dgettext("errors", "Could not unrepeat")}
end
end
- def favorite(id_or_ap_id, user) do
- with %Activity{} = activity <- get_by_id_or_ap_id(id_or_ap_id),
- object <- Object.normalize(activity),
- nil <- Utils.get_existing_like(user.ap_id, object) do
- ActivityPub.like(user, object)
+ @spec favorite(User.t(), binary()) :: {:ok, Activity.t() | :already_liked} | {:error, any()}
+ def favorite(%User{} = user, id) do
+ case favorite_helper(user, id) do
+ {:ok, _} = res ->
+ res
+
+ {:error, :not_found} = res ->
+ res
+
+ {:error, e} ->
+ Logger.error("Could not favorite #{id}. Error: #{inspect(e, pretty: true)}")
+ {:error, dgettext("errors", "Could not favorite")}
+ end
+ end
+
+ def favorite_helper(user, id) do
+ with {_, %Activity{object: object}} <- {:find_object, Activity.get_by_id_with_object(id)},
+ {_, {:ok, like_object, meta}} <- {:build_object, Builder.like(user, object)},
+ {_, {:ok, %Activity{} = activity, _meta}} <-
+ {:common_pipeline,
+ Pipeline.common_pipeline(like_object, Keyword.put(meta, :local, true))} do
+ {:ok, activity}
else
- _ -> {:error, dgettext("errors", "Could not favorite")}
+ {:find_object, _} ->
+ {:error, :not_found}
+
+ {:common_pipeline,
+ {
+ :error,
+ {
+ :validate_object,
+ {
+ :error,
+ changeset
+ }
+ }
+ }} = e ->
+ if {:object, {"already liked by this actor", []}} in changeset.errors do
+ {:ok, :already_liked}
+ else
+ {:error, e}
+ end
+
+ e ->
+ {:error, e}
end
end
- def unfavorite(id_or_ap_id, user) do
- with %Activity{} = activity <- get_by_id_or_ap_id(id_or_ap_id) do
- object = Object.normalize(activity)
- ActivityPub.unlike(user, object)
+ def unfavorite(id, user) do
+ with {_, %Activity{data: %{"type" => "Create"}} = activity} <-
+ {:find_activity, Activity.get_by_id(id)},
+ %Object{} = note <- Object.normalize(activity, false),
+ %Activity{} = like <- Utils.get_existing_like(user.ap_id, note),
+ {:ok, undo, _} <- Builder.undo(user, like),
+ {:ok, activity, _} <- Pipeline.common_pipeline(undo, local: true) do
+ {:ok, activity}
else
+ {:find_activity, _} -> {:error, :not_found}
_ -> {:error, dgettext("errors", "Could not unfavorite")}
end
end
+ def react_with_emoji(id, user, emoji) do
+ with %Activity{} = activity <- Activity.get_by_id(id),
+ object <- Object.normalize(activity),
+ {:ok, emoji_react, _} <- Builder.emoji_react(user, object, emoji),
+ {:ok, activity, _} <- Pipeline.common_pipeline(emoji_react, local: true) do
+ {:ok, activity}
+ else
+ _ ->
+ {:error, dgettext("errors", "Could not add reaction emoji")}
+ end
+ end
+
+ def unreact_with_emoji(id, user, emoji) do
+ with %Activity{} = reaction_activity <- Utils.get_latest_reaction(id, user, emoji),
+ {:ok, undo, _} <- Builder.undo(user, reaction_activity),
+ {:ok, activity, _} <- Pipeline.common_pipeline(undo, local: true) do
+ {:ok, activity}
+ else
+ _ ->
+ {:error, dgettext("errors", "Could not remove reaction emoji")}
+ end
+ end
+
def vote(user, %{data: %{"type" => "Question"}} = object, choices) do
with :ok <- validate_not_author(object, user),
:ok <- validate_existing_votes(user, object),
@@ -172,7 +296,7 @@ defmodule Pleroma.Web.CommonAPI do
end
end
- def public_announce?(_, %{"visibility" => visibility})
+ def public_announce?(_, %{visibility: visibility})
when visibility in ~w{public unlisted private direct},
do: visibility in ~w(public unlisted)
@@ -182,11 +306,11 @@ defmodule Pleroma.Web.CommonAPI do
def get_visibility(_, _, %Participation{}), do: {"direct", "direct"}
- def get_visibility(%{"visibility" => visibility}, in_reply_to, _)
+ def get_visibility(%{visibility: visibility}, in_reply_to, _)
when visibility in ~w{public unlisted private direct},
do: {visibility, get_replied_to_visibility(in_reply_to)}
- def get_visibility(%{"visibility" => "list:" <> list_id}, in_reply_to, _) do
+ def get_visibility(%{visibility: "list:" <> list_id}, in_reply_to, _) do
visibility = {:list, String.to_integer(list_id)}
{visibility, get_replied_to_visibility(in_reply_to)}
end
@@ -244,7 +368,7 @@ defmodule Pleroma.Web.CommonAPI do
end
end
- def post(user, %{"status" => _} = data) do
+ def post(user, %{status: _} = data) do
with {:ok, draft} <- Pleroma.Web.CommonAPI.ActivityDraft.create(user, data) do
draft.changes
|> ActivityPub.create(draft.preview?)
@@ -260,47 +384,28 @@ defmodule Pleroma.Web.CommonAPI do
defp maybe_create_activity_expiration(result, _), do: result
- # Updates the emojis for a user based on their profile
- def update(user) do
- emoji = emoji_from_profile(user)
- source_data = user.info |> Map.get(:source_data, %{}) |> Map.put("tag", emoji)
-
- user =
- case User.update_info(user, &User.Info.set_source_data(&1, source_data)) do
- {:ok, user} -> user
- _ -> user
- end
-
- ActivityPub.update(%{
- local: true,
- to: [Pleroma.Constants.as_public(), user.follower_address],
- cc: [],
- actor: user.ap_id,
- object: Pleroma.Web.ActivityPub.UserView.render("user.json", %{user: user})
- })
- end
-
- def pin(id_or_ap_id, %{ap_id: user_ap_id} = user) do
+ def pin(id, %{ap_id: user_ap_id} = user) do
with %Activity{
actor: ^user_ap_id,
data: %{"type" => "Create"},
- object: %Object{data: %{"type" => "Note"}}
- } = activity <- get_by_id_or_ap_id(id_or_ap_id),
+ object: %Object{data: %{"type" => object_type}}
+ } = activity <- Activity.get_by_id_with_object(id),
+ true <- object_type in ["Note", "Article", "Question"],
true <- Visibility.is_public?(activity),
- {:ok, _user} <- User.update_info(user, &User.Info.add_pinnned_activity(&1, activity)) do
+ {:ok, _user} <- User.add_pinnned_activity(user, activity) do
{:ok, activity}
else
- {:error, %{changes: %{info: %{errors: [pinned_activities: {err, _}]}}}} -> {:error, err}
+ {:error, %{errors: [pinned_activities: {err, _}]}} -> {:error, err}
_ -> {:error, dgettext("errors", "Could not pin")}
end
end
- def unpin(id_or_ap_id, user) do
- with %Activity{} = activity <- get_by_id_or_ap_id(id_or_ap_id),
- {:ok, _user} <- User.update_info(user, &User.Info.remove_pinnned_activity(&1, activity)) do
+ def unpin(id, user) do
+ with %Activity{data: %{"type" => "Create"}} = activity <- Activity.get_by_id(id),
+ {:ok, _user} <- User.remove_pinnned_activity(user, activity) do
{:ok, activity}
else
- %{errors: [pinned_activities: {err, _}]} -> {:error, err}
+ {:error, %{errors: [pinned_activities: {err, _}]}} -> {:error, err}
_ -> {:error, dgettext("errors", "Could not unpin")}
end
end
@@ -321,12 +426,12 @@ defmodule Pleroma.Web.CommonAPI do
def thread_muted?(%{id: nil} = _user, _activity), do: false
def thread_muted?(user, activity) do
- ThreadMute.check_muted(user.id, activity.data["context"]) != []
+ ThreadMute.exists?(user.id, activity.data["context"])
end
- def report(user, %{"account_id" => account_id} = data) do
- with {:ok, account} <- get_reported_account(account_id),
- {:ok, {content_html, _, _}} <- make_report_content_html(data["comment"]),
+ def report(user, data) do
+ with {:ok, account} <- get_reported_account(data.account_id),
+ {:ok, {content_html, _, _}} <- make_report_content_html(data[:comment]),
{:ok, statuses} <- get_report_statuses(account, data) do
ActivityPub.flag(%{
context: Utils.generate_context_id(),
@@ -334,13 +439,11 @@ defmodule Pleroma.Web.CommonAPI do
account: account,
statuses: statuses,
content: content_html,
- forward: data["forward"] || false
+ forward: Map.get(data, :forward, false)
})
end
end
- def report(_user, _params), do: {:error, dgettext("errors", "Valid `account_id` required")}
-
defp get_reported_account(account_id) do
case User.get_cached_by_id(account_id) do
%User{} = account -> {:ok, account}
@@ -348,6 +451,13 @@ defmodule Pleroma.Web.CommonAPI do
end
end
+ def update_report_state(activity_ids, state) when is_list(activity_ids) do
+ case Utils.update_report_state(activity_ids, state) do
+ :ok -> {:ok, activity_ids}
+ _ -> {:error, dgettext("errors", "Could not update state")}
+ end
+ end
+
def update_report_state(activity_id, state) do
with %Activity{} = activity <- Activity.get_by_id(activity_id) do
Utils.update_report_state(activity, state)
@@ -367,11 +477,11 @@ defmodule Pleroma.Web.CommonAPI do
end
end
- defp toggle_sensitive(activity, %{"sensitive" => sensitive}) when sensitive in ~w(true false) do
- toggle_sensitive(activity, %{"sensitive" => String.to_existing_atom(sensitive)})
+ defp toggle_sensitive(activity, %{sensitive: sensitive}) when sensitive in ~w(true false) do
+ toggle_sensitive(activity, %{sensitive: String.to_existing_atom(sensitive)})
end
- defp toggle_sensitive(%Activity{object: object} = activity, %{"sensitive" => sensitive})
+ defp toggle_sensitive(%Activity{object: object} = activity, %{sensitive: sensitive})
when is_boolean(sensitive) do
new_data = Map.put(object.data, "sensitive", sensitive)
@@ -385,21 +495,17 @@ defmodule Pleroma.Web.CommonAPI do
defp toggle_sensitive(activity, _), do: {:ok, activity}
- defp set_visibility(activity, %{"visibility" => visibility}) do
+ defp set_visibility(activity, %{visibility: visibility}) do
Utils.update_activity_visibility(activity, visibility)
end
defp set_visibility(activity, _), do: {:ok, activity}
- def hide_reblogs(user, %{ap_id: ap_id} = _muted) do
- if ap_id not in user.info.muted_reblogs do
- User.update_info(user, &User.Info.add_reblog_mute(&1, ap_id))
- end
+ def hide_reblogs(%User{} = user, %User{} = target) do
+ UserRelationship.create_reblog_mute(user, target)
end
- def show_reblogs(user, %{ap_id: ap_id} = _muted) do
- if ap_id in user.info.muted_reblogs do
- User.update_info(user, &User.Info.remove_reblog_mute(&1, ap_id))
- end
+ def show_reblogs(%User{} = user, %User{} = target) do
+ UserRelationship.delete_reblog_mute(user, target)
end
end
diff --git a/lib/pleroma/web/common_api/utils.ex b/lib/pleroma/web/common_api/utils.ex
index 88a5f434a..e8deee223 100644
--- a/lib/pleroma/web/common_api/utils.ex
+++ b/lib/pleroma/web/common_api/utils.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.CommonAPI.Utils do
@@ -10,7 +10,6 @@ defmodule Pleroma.Web.CommonAPI.Utils do
alias Pleroma.Activity
alias Pleroma.Config
alias Pleroma.Conversation.Participation
- alias Pleroma.Emoji
alias Pleroma.Formatter
alias Pleroma.Object
alias Pleroma.Plugs.AuthenticationPlug
@@ -18,35 +17,16 @@ defmodule Pleroma.Web.CommonAPI.Utils do
alias Pleroma.User
alias Pleroma.Web.ActivityPub.Utils
alias Pleroma.Web.ActivityPub.Visibility
- alias Pleroma.Web.Endpoint
alias Pleroma.Web.MediaProxy
require Logger
require Pleroma.Constants
- # This is a hack for twidere.
- def get_by_id_or_ap_id(id) do
- activity =
- with true <- FlakeId.flake_id?(id),
- %Activity{} = activity <- Activity.get_by_id_with_object(id) do
- activity
- else
- _ -> Activity.get_create_by_object_ap_id_with_object(id)
- end
-
- activity &&
- if activity.data["type"] == "Create" do
- activity
- else
- Activity.get_create_by_object_ap_id_with_object(activity.data["object"])
- end
- end
-
- def attachments_from_ids(%{"media_ids" => ids, "descriptions" => desc} = _) do
+ def attachments_from_ids(%{media_ids: ids, descriptions: desc}) do
attachments_from_ids_descs(ids, desc)
end
- def attachments_from_ids(%{"media_ids" => ids} = _) do
+ def attachments_from_ids(%{media_ids: ids}) do
attachments_from_ids_no_descs(ids)
end
@@ -57,11 +37,11 @@ defmodule Pleroma.Web.CommonAPI.Utils do
def attachments_from_ids_no_descs(ids) do
Enum.map(ids, fn media_id ->
case Repo.get(Object, media_id) do
- %Object{data: data} = _ -> data
+ %Object{data: data} -> data
_ -> nil
end
end)
- |> Enum.filter(& &1)
+ |> Enum.reject(&is_nil/1)
end
def attachments_from_ids_descs([], _), do: []
@@ -71,14 +51,14 @@ defmodule Pleroma.Web.CommonAPI.Utils do
Enum.map(ids, fn media_id ->
case Repo.get(Object, media_id) do
- %Object{data: data} = _ ->
+ %Object{data: data} ->
Map.put(data, "name", descs[media_id])
_ ->
nil
end
end)
- |> Enum.filter(& &1)
+ |> Enum.reject(&is_nil/1)
end
@spec get_to_and_cc(
@@ -160,7 +140,7 @@ defmodule Pleroma.Web.CommonAPI.Utils do
|> make_poll_data()
end
- def make_poll_data(%{"poll" => %{"options" => options, "expires_in" => expires_in}} = data)
+ def make_poll_data(%{poll: %{options: options, expires_in: expires_in}} = data)
when is_list(options) do
limits = Pleroma.Config.get([:instance, :poll_limits])
@@ -175,15 +155,15 @@ defmodule Pleroma.Web.CommonAPI.Utils do
"replies" => %{"type" => "Collection", "totalItems" => 0}
}
- {note, Map.merge(emoji, Emoji.Formatter.get_emoji_map(option))}
+ {note, Map.merge(emoji, Pleroma.Emoji.Formatter.get_emoji_map(option))}
end)
end_time =
- NaiveDateTime.utc_now()
- |> NaiveDateTime.add(expires_in)
- |> NaiveDateTime.to_iso8601()
+ DateTime.utc_now()
+ |> DateTime.add(expires_in)
+ |> DateTime.to_iso8601()
- key = if truthy_param?(data["poll"]["multiple"]), do: "anyOf", else: "oneOf"
+ key = if truthy_param?(data.poll[:multiple]), do: "anyOf", else: "oneOf"
poll = %{"type" => "Question", key => option_notes, "closed" => end_time}
{:ok, {poll, emoji}}
@@ -228,12 +208,12 @@ defmodule Pleroma.Web.CommonAPI.Utils do
data,
visibility
) do
- no_attachment_links =
+ attachment_links =
data
- |> Map.get("no_attachment_links", Config.get([:instance, :no_attachment_links]))
+ |> Map.get("attachment_links", Config.get([:instance, :attachment_links]))
|> truthy_param?()
- content_type = get_content_type(data["content_type"])
+ content_type = get_content_type(data[:content_type])
options =
if visibility == "direct" && Config.get([:instance, :safe_dm_mentions]) do
@@ -244,7 +224,7 @@ defmodule Pleroma.Web.CommonAPI.Utils do
status
|> format_input(content_type, options)
- |> maybe_add_attachments(attachments, no_attachment_links)
+ |> maybe_add_attachments(attachments, attachment_links)
|> maybe_add_nsfw_tag(data)
end
@@ -270,7 +250,7 @@ defmodule Pleroma.Web.CommonAPI.Utils do
def make_context(%Activity{data: %{"context" => context}}, _), do: context
def make_context(_, _), do: Utils.generate_context_id()
- def maybe_add_attachments(parsed, _attachments, true = _no_links), do: parsed
+ def maybe_add_attachments(parsed, _attachments, false = _no_links), do: parsed
def maybe_add_attachments({text, mentions, tags}, attachments, _no_links) do
text = add_attachments(text, attachments)
@@ -331,7 +311,7 @@ defmodule Pleroma.Web.CommonAPI.Utils do
def format_input(text, "text/markdown", options) do
text
|> Formatter.mentions_escape(options)
- |> Earmark.as_html!()
+ |> Earmark.as_html!(%Earmark.Options{renderer: Pleroma.EarmarkRenderer})
|> Formatter.linkify(options)
|> Formatter.html_escape("text/html")
end
@@ -422,6 +402,7 @@ defmodule Pleroma.Web.CommonAPI.Utils do
end
end
+ @spec confirm_current_password(User.t(), String.t()) :: {:ok, User.t()} | {:error, String.t()}
def confirm_current_password(user, password) do
with %User{local: true} = db_user <- User.get_cached_by_id(user.id),
true <- AuthenticationPlug.checkpw(password, db_user.password_hash) do
@@ -431,19 +412,6 @@ defmodule Pleroma.Web.CommonAPI.Utils do
end
end
- def emoji_from_profile(%User{bio: bio, name: name}) do
- [bio, name]
- |> Enum.map(&Emoji.Formatter.get_emoji/1)
- |> Enum.concat()
- |> Enum.map(fn {shortcode, %Emoji{file: path}} ->
- %{
- "type" => "Emoji",
- "icon" => %{"type" => "Image", "url" => "#{Endpoint.url()}#{path}"},
- "name" => ":#{shortcode}:"
- }
- end)
- end
-
def maybe_notify_to_recipients(
recipients,
%Activity{data: %{"to" => to, "type" => _type}} = _activity
@@ -451,6 +419,8 @@ defmodule Pleroma.Web.CommonAPI.Utils do
recipients ++ to
end
+ def maybe_notify_to_recipients(recipients, _), do: recipients
+
def maybe_notify_mentioned_recipients(
recipients,
%Activity{data: %{"to" => _to, "type" => type} = data} = activity
@@ -492,7 +462,7 @@ defmodule Pleroma.Web.CommonAPI.Utils do
with %User{} = user <- User.get_cached_by_ap_id(actor) do
subscriber_ids =
user
- |> User.subscribers()
+ |> User.subscriber_users()
|> Enum.filter(&Visibility.visible_for_user?(activity, &1))
|> Enum.map(& &1.ap_id)
@@ -502,6 +472,17 @@ defmodule Pleroma.Web.CommonAPI.Utils do
def maybe_notify_subscribers(recipients, _), do: recipients
+ def maybe_notify_followers(recipients, %Activity{data: %{"type" => "Move"}} = activity) do
+ with %User{} = user <- User.get_cached_by_ap_id(activity.actor) do
+ user
+ |> User.get_followers()
+ |> Enum.map(& &1.ap_id)
+ |> Enum.concat(recipients)
+ end
+ end
+
+ def maybe_notify_followers(recipients, _), do: recipients
+
def maybe_extract_mentions(%{"tag" => tag}) do
tag
|> Enum.filter(fn x -> is_map(x) && x["type"] == "Mention" end)
@@ -524,7 +505,8 @@ defmodule Pleroma.Web.CommonAPI.Utils do
end
end
- def get_report_statuses(%User{ap_id: actor}, %{"status_ids" => status_ids}) do
+ def get_report_statuses(%User{ap_id: actor}, %{status_ids: status_ids})
+ when is_list(status_ids) do
{:ok, Activity.all_by_actor_and_id(actor, status_ids)}
end
@@ -578,7 +560,7 @@ defmodule Pleroma.Web.CommonAPI.Utils do
limit = Pleroma.Config.get([:instance, :limit])
length = String.length(full_payload)
- if length < limit do
+ if length <= limit do
:ok
else
{:error, dgettext("errors", "The status is over the character limit")}
diff --git a/lib/pleroma/web/controller_helper.ex b/lib/pleroma/web/controller_helper.ex
index 9a4e322c9..5a1316a5f 100644
--- a/lib/pleroma/web/controller_helper.ex
+++ b/lib/pleroma/web/controller_helper.ex
@@ -1,14 +1,20 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ControllerHelper do
use Pleroma.Web, :controller
- # As in MastoAPI, per https://api.rubyonrails.org/classes/ActiveModel/Type/Boolean.html
+ # As in Mastodon API, per https://api.rubyonrails.org/classes/ActiveModel/Type/Boolean.html
@falsy_param_values [false, 0, "0", "f", "F", "false", "False", "FALSE", "off", "OFF"]
- def truthy_param?(blank_value) when blank_value in [nil, ""], do: nil
- def truthy_param?(value), do: value not in @falsy_param_values
+
+ def explicitly_falsy_param?(value), do: value in @falsy_param_values
+
+ # Note: `nil` and `""` are considered falsy values in Pleroma
+ def falsy_param?(value),
+ do: explicitly_falsy_param?(value) or value in [nil, ""]
+
+ def truthy_param?(value), do: not falsy_param?(value)
def json_response(conn, status, json) do
conn
@@ -34,7 +40,12 @@ defmodule Pleroma.Web.ControllerHelper do
defp param_to_integer(_, default), do: default
- def add_link_headers(conn, activities, extra_params \\ %{}) do
+ def add_link_headers(conn, activities, extra_params \\ %{})
+
+ def add_link_headers(%{assigns: %{skip_link_headers: true}} = conn, _activities, _extra_params),
+ do: conn
+
+ def add_link_headers(conn, activities, extra_params) do
case List.last(activities) do
%{id: max_id} ->
params =
@@ -69,15 +80,15 @@ defmodule Pleroma.Web.ControllerHelper do
end
end
- def assign_account_by_id(%{params: %{"id" => id}} = conn, _) do
- case Pleroma.User.get_cached_by_id(id) do
+ def assign_account_by_id(conn, _) do
+ # TODO: use `conn.params[:id]` only after moving to OpenAPI
+ case Pleroma.User.get_cached_by_id(conn.params[:id] || conn.params["id"]) do
%Pleroma.User{} = account -> assign(conn, :account, account)
nil -> Pleroma.Web.MastodonAPI.FallbackController.call(conn, {:error, :not_found}) |> halt()
end
end
- def try_render(conn, target, params)
- when is_binary(target) do
+ def try_render(conn, target, params) when is_binary(target) do
case render(conn, target, params) do
nil -> render_error(conn, :not_implemented, "Can't display this activity")
res -> res
@@ -87,4 +98,22 @@ defmodule Pleroma.Web.ControllerHelper do
def try_render(conn, _, _) do
render_error(conn, :not_implemented, "Can't display this activity")
end
+
+ @spec put_if_exist(map(), atom() | String.t(), any) :: map()
+ def put_if_exist(map, _key, nil), do: map
+
+ def put_if_exist(map, key, value), do: Map.put(map, key, value)
+
+ @doc """
+ Returns true if request specifies to include embedded relationships in account objects.
+ May only be used in selected account-related endpoints; has no effect for status- or
+ notification-related endpoints.
+ """
+ # Intended for PleromaFE: https://git.pleroma.social/pleroma/pleroma-fe/-/issues/838
+ def embed_relationships?(params) do
+ # To do once OpenAPI transition mess is over: just `truthy_param?(params[:with_relationships])`
+ params
+ |> Map.get(:with_relationships, params["with_relationships"])
+ |> truthy_param?()
+ end
end
diff --git a/lib/pleroma/web/endpoint.ex b/lib/pleroma/web/endpoint.ex
index 2212e93f4..226d42c2c 100644
--- a/lib/pleroma/web/endpoint.ex
+++ b/lib/pleroma/web/endpoint.ex
@@ -1,10 +1,12 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Endpoint do
use Phoenix.Endpoint, otp_app: :pleroma
+ require Pleroma.Constants
+
socket("/socket", Pleroma.Web.UserSocket)
plug(Pleroma.Plugs.SetLocalePlug)
@@ -34,8 +36,7 @@ defmodule Pleroma.Web.Endpoint do
Plug.Static,
at: "/",
from: :pleroma,
- only:
- ~w(index.html robots.txt static finmoji emoji packs sounds images instance sw.js sw-pleroma.js favicon.png schemas doc),
+ only: Pleroma.Constants.static_only_files(),
# credo:disable-for-previous-line Credo.Check.Readability.MaxLineLength
gzip: true,
cache_control_for_etags: @static_cache_control,
@@ -59,11 +60,14 @@ defmodule Pleroma.Web.Endpoint do
plug(Pleroma.Plugs.TrailingFormatPlug)
plug(Plug.RequestId)
- plug(Plug.Logger)
-
- plug(
- Plug.Parsers,
- parsers: [:urlencoded, :multipart, :json],
+ plug(Plug.Logger, log: :debug)
+
+ plug(Plug.Parsers,
+ parsers: [
+ :urlencoded,
+ {:multipart, length: {Pleroma.Config, :get, [[:instance, :upload_limit]]}},
+ :json
+ ],
pass: ["*/*"],
json_decoder: Jason,
length: Pleroma.Config.get([:instance, :upload_limit]),
diff --git a/lib/pleroma/web/fallback_redirect_controller.ex b/lib/pleroma/web/fallback_redirect_controller.ex
index 5fbf3695f..0d9d578fc 100644
--- a/lib/pleroma/web/fallback_redirect_controller.ex
+++ b/lib/pleroma/web/fallback_redirect_controller.ex
@@ -1,10 +1,12 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Fallback.RedirectController do
use Pleroma.Web, :controller
+
require Logger
+
alias Pleroma.User
alias Pleroma.Web.Metadata
diff --git a/lib/pleroma/web/federator/federator.ex b/lib/pleroma/web/federator/federator.ex
index e8a56ebd7..f5803578d 100644
--- a/lib/pleroma/web/federator/federator.ex
+++ b/lib/pleroma/web/federator/federator.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Federator do
@@ -15,13 +15,19 @@ defmodule Pleroma.Web.Federator do
require Logger
- @doc "Addresses [memory leaks on recursive replies fetching](https://git.pleroma.social/pleroma/pleroma/issues/161)"
+ @doc """
+ Returns `true` if the distance to target object does not exceed max configured value.
+ Serves to prevent fetching of very long threads, especially useful on smaller instances.
+ Addresses [memory leaks on recursive replies fetching](https://git.pleroma.social/pleroma/pleroma/issues/161).
+ Applies to fetching of both ancestor (reply-to) and child (reply) objects.
+ """
# credo:disable-for-previous-line Credo.Check.Readability.MaxLineLength
- def allowed_incoming_reply_depth?(depth) do
- max_replies_depth = Pleroma.Config.get([:instance, :federation_incoming_replies_max_depth])
+ def allowed_thread_distance?(distance) do
+ max_distance = Pleroma.Config.get([:instance, :federation_incoming_replies_max_depth])
- if max_replies_depth do
- (depth || 1) <= max_replies_depth
+ if max_distance && max_distance >= 0 do
+ # Default depth is 0 (an object has zero distance from itself in its thread)
+ (distance || 0) <= max_distance
else
true
end
@@ -58,7 +64,7 @@ defmodule Pleroma.Web.Federator do
end
def perform(:incoming_ap_doc, params) do
- Logger.info("Handling incoming AP activity")
+ Logger.debug("Handling incoming AP activity")
params = Utils.normalize_params(params)
@@ -66,19 +72,24 @@ defmodule Pleroma.Web.Federator do
# actor shouldn't be acting on objects outside their own AP server.
with {:ok, _user} <- ap_enabled_actor(params["actor"]),
nil <- Activity.normalize(params["id"]),
- :ok <- Containment.contain_origin_from_id(params["actor"], params),
+ {_, :ok} <-
+ {:correct_origin?, Containment.contain_origin_from_id(params["actor"], params)},
{:ok, activity} <- Transmogrifier.handle_incoming(params) do
{:ok, activity}
else
+ {:correct_origin?, _} ->
+ Logger.debug("Origin containment failure for #{params["id"]}")
+ {:error, :origin_containment_failed}
+
%Activity{} ->
- Logger.info("Already had #{params["id"]}")
- :error
+ Logger.debug("Already had #{params["id"]}")
+ {:error, :already_present}
- _e ->
+ e ->
# Just drop those for now
- Logger.info("Unhandled activity")
- Logger.info(Jason.encode!(params, pretty: true))
- :error
+ Logger.debug("Unhandled activity")
+ Logger.debug(Jason.encode!(params, pretty: true))
+ {:error, e}
end
end
diff --git a/lib/pleroma/web/federator/publisher.ex b/lib/pleroma/web/federator/publisher.ex
index fb9b26649..ad0201361 100644
--- a/lib/pleroma/web/federator/publisher.ex
+++ b/lib/pleroma/web/federator/publisher.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Federator.Publisher do
@@ -47,7 +47,7 @@ defmodule Pleroma.Web.Federator.Publisher do
Config.get([:instance, :federation_publisher_modules])
|> Enum.each(fn module ->
if module.is_representable?(activity) do
- Logger.info("Publishing #{activity.data["id"]} using #{inspect(module)}")
+ Logger.debug("Publishing #{activity.data["id"]} using #{inspect(module)}")
module.publish(user, activity)
end
end)
diff --git a/lib/pleroma/web/feed/feed_view.ex b/lib/pleroma/web/feed/feed_view.ex
index 5eef1e757..1ae03e7e2 100644
--- a/lib/pleroma/web/feed/feed_view.ex
+++ b/lib/pleroma/web/feed/feed_view.ex
@@ -1,53 +1,89 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Feed.FeedView do
use Phoenix.HTML
use Pleroma.Web, :view
+ alias Pleroma.Formatter
alias Pleroma.Object
alias Pleroma.User
alias Pleroma.Web.MediaProxy
require Pleroma.Constants
+ @spec pub_date(String.t() | DateTime.t()) :: String.t()
+ def pub_date(date) when is_binary(date) do
+ date
+ |> Timex.parse!("{ISO:Extended}")
+ |> pub_date
+ end
+
+ def pub_date(%DateTime{} = date), do: Timex.format!(date, "{RFC822}")
+
+ def prepare_activity(activity, opts \\ []) do
+ object = Object.normalize(activity)
+
+ actor =
+ if opts[:actor] do
+ Pleroma.User.get_cached_by_ap_id(activity.actor)
+ end
+
+ %{
+ activity: activity,
+ data: Map.get(object, :data),
+ actor: actor
+ }
+ end
+
+ def most_recent_update(activities) do
+ with %{updated_at: updated_at} <- List.first(activities) do
+ NaiveDateTime.to_iso8601(updated_at)
+ end
+ end
+
def most_recent_update(activities, user) do
(List.first(activities) || user).updated_at
|> NaiveDateTime.to_iso8601()
end
+ def feed_logo do
+ case Pleroma.Config.get([:feed, :logo]) do
+ nil ->
+ "#{Pleroma.Web.base_url()}/static/logo.png"
+
+ logo ->
+ "#{Pleroma.Web.base_url()}#{logo}"
+ end
+ |> MediaProxy.url()
+ end
+
def logo(user) do
user
|> User.avatar_url()
|> MediaProxy.url()
end
- def last_activity(activities) do
- List.last(activities)
- end
-
- def activity_object(activity) do
- Object.normalize(activity)
- end
+ def last_activity(activities), do: List.last(activities)
- def activity_object_data(activity) do
- activity
- |> activity_object()
- |> Map.get(:data)
+ def activity_title(%{"content" => content}, opts \\ %{}) do
+ content
+ |> Pleroma.Web.Metadata.Utils.scrub_html()
+ |> Pleroma.Emoji.Formatter.demojify()
+ |> Formatter.truncate(opts[:max_length], opts[:omission])
+ |> escape()
end
- def activity_content(activity) do
- content = activity_object_data(activity)["content"]
-
+ def activity_content(%{"content" => content}) do
content
|> String.replace(~r/[\n\r]/, "")
|> escape()
end
- def activity_context(activity) do
- activity.data["context"]
- end
+ def activity_content(_), do: ""
+
+ def activity_context(activity), do: activity.data["context"]
def attachment_href(attachment) do
attachment["url"]
diff --git a/lib/pleroma/web/feed/tag_controller.ex b/lib/pleroma/web/feed/tag_controller.ex
new file mode 100644
index 000000000..8133f8480
--- /dev/null
+++ b/lib/pleroma/web/feed/tag_controller.ex
@@ -0,0 +1,41 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.Feed.TagController do
+ use Pleroma.Web, :controller
+
+ alias Pleroma.Config
+ alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.Feed.FeedView
+
+ import Pleroma.Web.ControllerHelper, only: [put_if_exist: 3]
+
+ def feed(conn, %{"tag" => raw_tag} = params) do
+ {format, tag} = parse_tag(raw_tag)
+
+ activities =
+ %{"type" => ["Create"], "tag" => tag}
+ |> put_if_exist("max_id", params["max_id"])
+ |> ActivityPub.fetch_public_activities()
+
+ conn
+ |> put_resp_content_type("application/#{format}+xml")
+ |> put_view(FeedView)
+ |> render("tag.#{format}",
+ activities: activities,
+ tag: tag,
+ feed_config: Config.get([:feed])
+ )
+ end
+
+ @spec parse_tag(binary() | any()) :: {format :: String.t(), tag :: String.t()}
+ defp parse_tag(raw_tag) when is_binary(raw_tag) do
+ case Enum.reverse(String.split(raw_tag, ".")) do
+ [format | tag] when format in ["atom", "rss"] -> {format, Enum.join(tag, ".")}
+ _ -> {"rss", raw_tag}
+ end
+ end
+
+ defp parse_tag(raw_tag), do: {"rss", raw_tag}
+end
diff --git a/lib/pleroma/web/feed/feed_controller.ex b/lib/pleroma/web/feed/user_controller.ex
index d91ecef9c..1b72e23dc 100644
--- a/lib/pleroma/web/feed/feed_controller.ex
+++ b/lib/pleroma/web/feed/user_controller.ex
@@ -1,14 +1,17 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
-defmodule Pleroma.Web.Feed.FeedController do
+defmodule Pleroma.Web.Feed.UserController do
use Pleroma.Web, :controller
alias Fallback.RedirectController
alias Pleroma.User
alias Pleroma.Web.ActivityPub.ActivityPub
alias Pleroma.Web.ActivityPub.ActivityPubController
+ alias Pleroma.Web.Feed.FeedView
+
+ import Pleroma.Web.ControllerHelper, only: [put_if_exist: 3]
plug(Pleroma.Plugs.SetFormatPlug when action in [:feed_redirect])
@@ -22,32 +25,47 @@ defmodule Pleroma.Web.Feed.FeedController do
def feed_redirect(%{assigns: %{format: format}} = conn, _params)
when format in ["json", "activity+json"] do
- ActivityPubController.call(conn, :user)
+ with %{halted: false} = conn <-
+ Pleroma.Plugs.EnsureAuthenticatedPlug.call(conn,
+ unless_func: &Pleroma.Web.FederatingPlug.federating?/1
+ ) do
+ ActivityPubController.call(conn, :user)
+ end
end
def feed_redirect(conn, %{"nickname" => nickname}) do
with {_, %User{} = user} <- {:fetch_user, User.get_cached_by_nickname(nickname)} do
- redirect(conn, external: "#{feed_url(conn, :feed, user.nickname)}.atom")
+ redirect(conn, external: "#{user_feed_url(conn, :feed, user.nickname)}.atom")
end
end
def feed(conn, %{"nickname" => nickname} = params) do
- with {_, %User{} = user} <- {:fetch_user, User.get_cached_by_nickname(nickname)} do
- query_params =
- params
- |> Map.take(["max_id"])
- |> Map.put("type", ["Create"])
- |> Map.put("whole_db", true)
- |> Map.put("actor_id", user.ap_id)
+ format = get_format(conn)
+ format =
+ if format in ["rss", "atom"] do
+ format
+ else
+ "atom"
+ end
+
+ with {_, %User{} = user} <- {:fetch_user, User.get_cached_by_nickname(nickname)} do
activities =
- query_params
+ %{
+ "type" => ["Create"],
+ "actor_id" => user.ap_id
+ }
+ |> put_if_exist("max_id", params["max_id"])
|> ActivityPub.fetch_public_activities()
- |> Enum.reverse()
conn
- |> put_resp_content_type("application/atom+xml")
- |> render("feed.xml", user: user, activities: activities)
+ |> put_resp_content_type("application/#{format}+xml")
+ |> put_view(FeedView)
+ |> render("user.#{format}",
+ user: user,
+ activities: activities,
+ feed_config: Pleroma.Config.get([:feed])
+ )
end
end
diff --git a/lib/pleroma/web/gettext.ex b/lib/pleroma/web/gettext.ex
index 1328b46cc..0adf428ec 100644
--- a/lib/pleroma/web/gettext.ex
+++ b/lib/pleroma/web/gettext.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Gettext do
diff --git a/lib/pleroma/web/masto_fe_controller.ex b/lib/pleroma/web/masto_fe_controller.ex
index 93b38e8f4..d0d8bc8eb 100644
--- a/lib/pleroma/web/masto_fe_controller.ex
+++ b/lib/pleroma/web/masto_fe_controller.ex
@@ -1,37 +1,46 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastoFEController do
use Pleroma.Web, :controller
+ alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.User
plug(OAuthScopesPlug, %{scopes: ["write:accounts"]} when action == :put_settings)
# Note: :index action handles attempt of unauthenticated access to private instance with redirect
+ plug(:skip_plug, EnsurePublicOrAuthenticatedPlug when action == :index)
+
plug(
OAuthScopesPlug,
- %{scopes: ["read"], fallback: :proceed_unauthenticated, skip_instance_privacy_check: true}
+ %{scopes: ["read"], fallback: :proceed_unauthenticated}
when action == :index
)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug when action != :index)
+ plug(
+ :skip_plug,
+ [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] when action == :manifest
+ )
@doc "GET /web/*path"
- def index(%{assigns: %{user: user}} = conn, _params) do
- token = get_session(conn, :oauth_token)
+ def index(%{assigns: %{user: user, token: token}} = conn, _params)
+ when not is_nil(user) and not is_nil(token) do
+ conn
+ |> put_layout(false)
+ |> render("index.html",
+ token: token.token,
+ user: user,
+ custom_emojis: Pleroma.Emoji.get_all()
+ )
+ end
- if user && token do
- conn
- |> put_layout(false)
- |> render("index.html", token: token, user: user, custom_emojis: Pleroma.Emoji.get_all())
- else
- conn
- |> put_session(:return_to, conn.request_path)
- |> redirect(to: "/web/login")
- end
+ def index(conn, _params) do
+ conn
+ |> put_session(:return_to, conn.request_path)
+ |> redirect(to: "/web/login")
end
@doc "GET /web/manifest.json"
@@ -42,7 +51,7 @@ defmodule Pleroma.Web.MastoFEController do
@doc "PUT /api/web/settings"
def put_settings(%{assigns: %{user: user}} = conn, %{"data" => settings} = _params) do
- with {:ok, _} <- User.update_info(user, &User.Info.mastodon_settings_update(&1, settings)) do
+ with {:ok, _} <- User.mastodon_settings_update(user, settings) do
json(conn, %{})
else
e ->
diff --git a/lib/pleroma/web/mastodon_api/controllers/account_controller.ex b/lib/pleroma/web/mastodon_api/controllers/account_controller.ex
index 9ef7fd48d..ef41f9e96 100644
--- a/lib/pleroma/web/mastodon_api/controllers/account_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/account_controller.ex
@@ -1,14 +1,20 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.AccountController do
use Pleroma.Web, :controller
import Pleroma.Web.ControllerHelper,
- only: [add_link_headers: 2, truthy_param?: 1, assign_account_by_id: 2, json_response: 3]
-
- alias Pleroma.Emoji
+ only: [
+ add_link_headers: 2,
+ truthy_param?: 1,
+ assign_account_by_id: 2,
+ embed_relationships?: 1,
+ json_response: 3
+ ]
+
+ alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.Plugs.RateLimiter
alias Pleroma.User
@@ -16,20 +22,33 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
alias Pleroma.Web.CommonAPI
alias Pleroma.Web.MastodonAPI.ListView
alias Pleroma.Web.MastodonAPI.MastodonAPI
+ alias Pleroma.Web.MastodonAPI.MastodonAPIController
alias Pleroma.Web.MastodonAPI.StatusView
alias Pleroma.Web.OAuth.Token
alias Pleroma.Web.TwitterAPI.TwitterAPI
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+
+ plug(:skip_plug, [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] when action == :create)
+
+ plug(:skip_plug, EnsurePublicOrAuthenticatedPlug when action in [:show, :statuses])
+
plug(
OAuthScopesPlug,
%{fallback: :proceed_unauthenticated, scopes: ["read:accounts"]}
- when action == :show
+ when action in [:show, :followers, :following]
+ )
+
+ plug(
+ OAuthScopesPlug,
+ %{fallback: :proceed_unauthenticated, scopes: ["read:statuses"]}
+ when action == :statuses
)
plug(
OAuthScopesPlug,
%{scopes: ["read:accounts"]}
- when action in [:endorsements, :verify_credentials, :followers, :following]
+ when action in [:verify_credentials, :endorsements, :identity_proofs]
)
plug(OAuthScopesPlug, %{scopes: ["write:accounts"]} when action == :update_credentials)
@@ -48,52 +67,36 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
plug(OAuthScopesPlug, %{scopes: ["read:follows"]} when action == :relationships)
- # Note: :follows (POST /api/v1/follows) is the same as :follow, consider removing :follows
plug(
OAuthScopesPlug,
- %{scopes: ["follow", "write:follows"]} when action in [:follows, :follow, :unfollow]
+ %{scopes: ["follow", "write:follows"]} when action in [:follow_by_uri, :follow, :unfollow]
)
plug(OAuthScopesPlug, %{scopes: ["follow", "read:mutes"]} when action == :mutes)
plug(OAuthScopesPlug, %{scopes: ["follow", "write:mutes"]} when action in [:mute, :unmute])
+ @relationship_actions [:follow, :unfollow]
+ @needs_account ~W(followers following lists follow unfollow mute unmute block unblock)a
+
plug(
- Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
- when action != :create
+ RateLimiter,
+ [name: :relation_id_action, params: ["id", "uri"]] when action in @relationship_actions
)
- @relations [:follow, :unfollow]
- @needs_account ~W(followers following lists follow unfollow mute unmute block unblock)a
-
- plug(RateLimiter, {:relations_id_action, params: ["id", "uri"]} when action in @relations)
- plug(RateLimiter, :relations_actions when action in @relations)
- plug(RateLimiter, :app_account_creation when action == :create)
+ plug(RateLimiter, [name: :relations_actions] when action in @relationship_actions)
+ plug(RateLimiter, [name: :app_account_creation] when action == :create)
plug(:assign_account_by_id when action in @needs_account)
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.AccountOperation
+
@doc "POST /api/v1/accounts"
- def create(
- %{assigns: %{app: app}} = conn,
- %{"username" => nickname, "email" => _, "password" => _, "agreement" => true} = params
- ) do
- params =
- params
- |> Map.take([
- "email",
- "captcha_solution",
- "captcha_token",
- "captcha_answer_data",
- "token",
- "password"
- ])
- |> Map.put("nickname", nickname)
- |> Map.put("fullname", params["fullname"] || nickname)
- |> Map.put("bio", params["bio"] || "")
- |> Map.put("confirm", params["password"])
-
- with {:ok, user} <- TwitterAPI.register_user(params, need_confirmation: true),
+ def create(%{assigns: %{app: app}, body_params: params} = conn, _params) do
+ with :ok <- validate_email_param(params),
+ :ok <- TwitterAPI.validate_captcha(app, params),
+ {:ok, user} <- TwitterAPI.register_user(params, need_confirmation: true),
{:ok, token} <- Token.create_token(app, user, %{scopes: app.scopes}) do
json(conn, %{
token_type: "Bearer",
@@ -102,7 +105,7 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
created_at: Token.Utils.format_created_at(token)
})
else
- {:error, errors} -> json_response(conn, :bad_request, errors)
+ {:error, error} -> json_response(conn, :bad_request, %{error: error})
end
end
@@ -114,6 +117,15 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
render_error(conn, :forbidden, "Invalid credentials")
end
+ defp validate_email_param(%{email: email}) when not is_nil(email), do: :ok
+
+ defp validate_email_param(_) do
+ case Pleroma.Config.get([:instance, :account_activation_required]) do
+ true -> {:error, dgettext("errors", "Missing parameter: %{name}", name: "email")}
+ _ -> :ok
+ end
+ end
+
@doc "GET /api/v1/accounts/verify_credentials"
def verify_credentials(%{assigns: %{user: user}} = conn, _) do
chat_token = Phoenix.Token.sign(conn, "user socket", user.id)
@@ -127,40 +139,15 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
end
@doc "PATCH /api/v1/accounts/update_credentials"
- def update_credentials(%{assigns: %{user: original_user}} = conn, params) do
+ def update_credentials(%{assigns: %{user: original_user}, body_params: params} = conn, _params) do
user = original_user
- user_params =
- %{}
- |> add_if_present(params, "display_name", :name)
- |> add_if_present(params, "note", :bio, fn value -> {:ok, User.parse_bio(value, user)} end)
- |> add_if_present(params, "avatar", :avatar, fn value ->
- with %Plug.Upload{} <- value,
- {:ok, object} <- ActivityPub.upload(value, type: :avatar) do
- {:ok, object.data}
- end
- end)
-
- emojis_text = (user_params["display_name"] || "") <> (user_params["note"] || "")
-
- user_info_emojis =
- user.info
- |> Map.get(:emoji, [])
- |> Enum.concat(Emoji.Formatter.get_emoji_map(emojis_text))
- |> Enum.dedup()
-
params =
- if Map.has_key?(params, "fields_attributes") do
- Map.update!(params, "fields_attributes", fn fields ->
- fields
- |> normalize_fields_attributes()
- |> Enum.filter(fn %{"name" => n} -> n != "" end)
- end)
- else
- params
- end
+ params
+ |> Enum.filter(fn {_, value} -> not is_nil(value) end)
+ |> Enum.into(%{})
- info_params =
+ user_params =
[
:no_rich_text,
:locked,
@@ -171,43 +158,30 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
:hide_favorites,
:show_role,
:skip_thread_containment,
+ :allow_following_move,
:discoverable
]
|> Enum.reduce(%{}, fn key, acc ->
- add_if_present(acc, params, to_string(key), key, &{:ok, truthy_param?(&1)})
- end)
- |> add_if_present(params, "default_scope", :default_scope)
- |> add_if_present(params, "fields_attributes", :fields, fn fields ->
- fields = Enum.map(fields, fn f -> Map.update!(f, "value", &AutoLinker.link(&1)) end)
-
- {:ok, fields}
- end)
- |> add_if_present(params, "fields_attributes", :raw_fields)
- |> add_if_present(params, "pleroma_settings_store", :pleroma_settings_store, fn value ->
- {:ok, Map.merge(user.info.pleroma_settings_store, value)}
- end)
- |> add_if_present(params, "header", :banner, fn value ->
- with %Plug.Upload{} <- value,
- {:ok, object} <- ActivityPub.upload(value, type: :banner) do
- {:ok, object.data}
- end
- end)
- |> add_if_present(params, "pleroma_background_image", :background, fn value ->
- with %Plug.Upload{} <- value,
- {:ok, object} <- ActivityPub.upload(value, type: :background) do
- {:ok, object.data}
- end
+ add_if_present(acc, params, key, key, &{:ok, truthy_param?(&1)})
end)
- |> Map.put(:emoji, user_info_emojis)
-
- changeset =
- user
- |> User.update_changeset(user_params)
- |> User.change_info(&User.Info.profile_update(&1, info_params))
+ |> add_if_present(params, :display_name, :name)
+ |> add_if_present(params, :note, :bio)
+ |> add_if_present(params, :avatar, :avatar)
+ |> add_if_present(params, :header, :banner)
+ |> add_if_present(params, :pleroma_background_image, :background)
+ |> add_if_present(
+ params,
+ :fields_attributes,
+ :raw_fields,
+ &{:ok, normalize_fields_attributes(&1)}
+ )
+ |> add_if_present(params, :pleroma_settings_store, :pleroma_settings_store)
+ |> add_if_present(params, :default_scope, :default_scope)
+ |> add_if_present(params, :actor_type, :actor_type)
+
+ changeset = User.update_changeset(user, user_params)
with {:ok, user} <- User.update_and_set_cache(changeset) do
- if original_user != user, do: CommonAPI.update(user)
-
render(conn, "show.json", user: user, for: user, with_pleroma_settings: true)
else
_e -> render_error(conn, :forbidden, "Invalid request")
@@ -216,7 +190,7 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
defp add_if_present(map, params, params_field, map_field, value_function \\ &{:ok, &1}) do
with true <- Map.has_key?(params, params_field),
- {:ok, new_value} <- value_function.(params[params_field]) do
+ {:ok, new_value} <- value_function.(Map.get(params, params_field)) do
Map.put(map, map_field, new_value)
else
_ -> map
@@ -227,12 +201,15 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
if Enum.all?(fields, &is_tuple/1) do
Enum.map(fields, fn {_, v} -> v end)
else
- fields
+ Enum.map(fields, fn
+ %{} = field -> %{"name" => field.name, "value" => field.value}
+ field -> field
+ end)
end
end
@doc "GET /api/v1/accounts/relationships"
- def relationships(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def relationships(%{assigns: %{user: user}} = conn, %{id: id}) do
targets = User.get_all_by_ids(List.wrap(id))
render(conn, "relationships.json", user: user, targets: targets)
@@ -242,9 +219,9 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
def relationships(%{assigns: %{user: _user}} = conn, _), do: json(conn, [])
@doc "GET /api/v1/accounts/:id"
- def show(%{assigns: %{user: for_user}} = conn, %{"id" => nickname_or_id}) do
+ def show(%{assigns: %{user: for_user}} = conn, %{id: nickname_or_id}) do
with %User{} = user <- User.get_cached_by_nickname_or_id(nickname_or_id, for: for_user),
- true <- User.auth_active?(user) || user.id == for_user.id || User.superuser?(for_user) do
+ true <- User.visible_for?(user, for_user) do
render(conn, "show.json", user: user, for: for_user)
else
_e -> render_error(conn, :not_found, "Can't find user")
@@ -253,43 +230,78 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
@doc "GET /api/v1/accounts/:id/statuses"
def statuses(%{assigns: %{user: reading_user}} = conn, params) do
- with %User{} = user <- User.get_cached_by_nickname_or_id(params["id"], for: reading_user) do
- params = Map.put(params, "tag", params["tagged"])
+ with %User{} = user <- User.get_cached_by_nickname_or_id(params.id, for: reading_user),
+ true <- User.visible_for?(user, reading_user) do
+ params =
+ params
+ |> Map.delete(:tagged)
+ |> Enum.filter(&(not is_nil(&1)))
+ |> Map.new(fn {key, value} -> {to_string(key), value} end)
+ |> Map.put("tag", params[:tagged])
+
activities = ActivityPub.fetch_user_activities(user, reading_user, params)
conn
|> add_link_headers(activities)
|> put_view(StatusView)
- |> render("index.json", activities: activities, for: reading_user, as: :activity)
+ |> render("index.json",
+ activities: activities,
+ for: reading_user,
+ as: :activity
+ )
+ else
+ _e -> render_error(conn, :not_found, "Can't find user")
end
end
@doc "GET /api/v1/accounts/:id/followers"
def followers(%{assigns: %{user: for_user, account: user}} = conn, params) do
+ params =
+ params
+ |> Enum.map(fn {key, value} -> {to_string(key), value} end)
+ |> Enum.into(%{})
+
followers =
cond do
for_user && user.id == for_user.id -> MastodonAPI.get_followers(user, params)
- user.info.hide_followers -> []
+ user.hide_followers -> []
true -> MastodonAPI.get_followers(user, params)
end
conn
|> add_link_headers(followers)
- |> render("index.json", for: for_user, users: followers, as: :user)
+ # https://git.pleroma.social/pleroma/pleroma-fe/-/issues/838#note_59223
+ |> render("index.json",
+ for: for_user,
+ users: followers,
+ as: :user,
+ embed_relationships: embed_relationships?(params)
+ )
end
@doc "GET /api/v1/accounts/:id/following"
def following(%{assigns: %{user: for_user, account: user}} = conn, params) do
+ params =
+ params
+ |> Enum.map(fn {key, value} -> {to_string(key), value} end)
+ |> Enum.into(%{})
+
followers =
cond do
for_user && user.id == for_user.id -> MastodonAPI.get_friends(user, params)
- user.info.hide_follows -> []
+ user.hide_follows -> []
true -> MastodonAPI.get_friends(user, params)
end
conn
|> add_link_headers(followers)
- |> render("index.json", for: for_user, users: followers, as: :user)
+ # https://git.pleroma.social/pleroma/pleroma-fe/-/issues/838#note_59223
+ |> render("index.json",
+ for: for_user,
+ users: followers,
+ as: :user,
+ embed_relationships: embed_relationships?(params)
+ )
end
@doc "GET /api/v1/accounts/:id/lists"
@@ -303,11 +315,11 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
@doc "POST /api/v1/accounts/:id/follow"
def follow(%{assigns: %{user: %{id: id}, account: %{id: id}}}, _params) do
- {:error, :not_found}
+ {:error, "Can not follow yourself"}
end
- def follow(%{assigns: %{user: follower, account: followed}} = conn, _params) do
- with {:ok, follower} <- MastodonAPI.follow(follower, followed, conn.params) do
+ def follow(%{assigns: %{user: follower, account: followed}} = conn, params) do
+ with {:ok, follower} <- MastodonAPI.follow(follower, followed, params) do
render(conn, "relationship.json", user: follower, target: followed)
else
{:error, message} -> json_response(conn, :forbidden, %{error: message})
@@ -316,7 +328,7 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
@doc "POST /api/v1/accounts/:id/unfollow"
def unfollow(%{assigns: %{user: %{id: id}, account: %{id: id}}}, _params) do
- {:error, :not_found}
+ {:error, "Can not unfollow yourself"}
end
def unfollow(%{assigns: %{user: follower, account: followed}} = conn, _params) do
@@ -326,10 +338,8 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
end
@doc "POST /api/v1/accounts/:id/mute"
- def mute(%{assigns: %{user: muter, account: muted}} = conn, params) do
- notifications? = params |> Map.get("notifications", true) |> truthy_param?()
-
- with {:ok, muter} <- User.mute(muter, muted, notifications?) do
+ def mute(%{assigns: %{user: muter, account: muted}, body_params: params} = conn, _params) do
+ with {:ok, _user_relationships} <- User.mute(muter, muted, params.notifications) do
render(conn, "relationship.json", user: muter, target: muted)
else
{:error, message} -> json_response(conn, :forbidden, %{error: message})
@@ -338,7 +348,7 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
@doc "POST /api/v1/accounts/:id/unmute"
def unmute(%{assigns: %{user: muter, account: muted}} = conn, _params) do
- with {:ok, muter} <- User.unmute(muter, muted) do
+ with {:ok, _user_relationships} <- User.unmute(muter, muted) do
render(conn, "relationship.json", user: muter, target: muted)
else
{:error, message} -> json_response(conn, :forbidden, %{error: message})
@@ -347,7 +357,7 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
@doc "POST /api/v1/accounts/:id/block"
def block(%{assigns: %{user: blocker, account: blocked}} = conn, _params) do
- with {:ok, blocker} <- User.block(blocker, blocked),
+ with {:ok, _user_block} <- User.block(blocker, blocked),
{:ok, _activity} <- ActivityPub.block(blocker, blocked) do
render(conn, "relationship.json", user: blocker, target: blocked)
else
@@ -357,8 +367,7 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
@doc "POST /api/v1/accounts/:id/unblock"
def unblock(%{assigns: %{user: blocker, account: blocked}} = conn, _params) do
- with {:ok, blocker} <- User.unblock(blocker, blocked),
- {:ok, _activity} <- ActivityPub.unblock(blocker, blocked) do
+ with {:ok, _activity} <- CommonAPI.unblock(blocker, blocked) do
render(conn, "relationship.json", user: blocker, target: blocked)
else
{:error, message} -> json_response(conn, :forbidden, %{error: message})
@@ -366,28 +375,33 @@ defmodule Pleroma.Web.MastodonAPI.AccountController do
end
@doc "POST /api/v1/follows"
- def follows(%{assigns: %{user: follower}} = conn, %{"uri" => uri}) do
- with {_, %User{} = followed} <- {:followed, User.get_cached_by_nickname(uri)},
- {_, true} <- {:followed, follower.id != followed.id},
- {:ok, follower, followed, _} <- CommonAPI.follow(follower, followed) do
- render(conn, "show.json", user: followed, for: follower)
- else
- {:followed, _} -> {:error, :not_found}
- {:error, message} -> json_response(conn, :forbidden, %{error: message})
+ def follow_by_uri(%{body_params: %{uri: uri}} = conn, _) do
+ case User.get_cached_by_nickname(uri) do
+ %User{} = user ->
+ conn
+ |> assign(:account, user)
+ |> follow(%{})
+
+ nil ->
+ {:error, :not_found}
end
end
@doc "GET /api/v1/mutes"
def mutes(%{assigns: %{user: user}} = conn, _) do
- render(conn, "index.json", users: User.muted_users(user), for: user, as: :user)
+ users = User.muted_users(user, _restrict_deactivated = true)
+ render(conn, "index.json", users: users, for: user, as: :user)
end
@doc "GET /api/v1/blocks"
def blocks(%{assigns: %{user: user}} = conn, _) do
- render(conn, "index.json", users: User.blocked_users(user), for: user, as: :user)
+ users = User.blocked_users(user, _restrict_deactivated = true)
+ render(conn, "index.json", users: users, for: user, as: :user)
end
@doc "GET /api/v1/endorsements"
- def endorsements(conn, params),
- do: Pleroma.Web.MastodonAPI.MastodonAPIController.empty_array(conn, params)
+ def endorsements(conn, params), do: MastodonAPIController.empty_array(conn, params)
+
+ @doc "GET /api/v1/identity_proofs"
+ def identity_proofs(conn, params), do: MastodonAPIController.empty_array(conn, params)
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/app_controller.ex b/lib/pleroma/web/mastodon_api/controllers/app_controller.ex
index 13a30a34d..a516b6c20 100644
--- a/lib/pleroma/web/mastodon_api/controllers/app_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/app_controller.ex
@@ -1,10 +1,11 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.AppController do
use Pleroma.Web, :controller
+ alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.Repo
alias Pleroma.Web.OAuth.App
@@ -13,18 +14,28 @@ defmodule Pleroma.Web.MastodonAPI.AppController do
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ plug(
+ :skip_plug,
+ [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug]
+ when action == :create
+ )
+
plug(OAuthScopesPlug, %{scopes: ["read"]} when action == :verify_credentials)
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+
@local_mastodon_name "Mastodon-Local"
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.AppOperation
+
@doc "POST /api/v1/apps"
- def create(conn, params) do
+ def create(%{body_params: params} = conn, _params) do
scopes = Scopes.fetch_scopes(params, ["read"])
app_attrs =
params
- |> Map.drop(["scope", "scopes"])
- |> Map.put("scopes", scopes)
+ |> Map.take([:client_name, :redirect_uris, :website])
+ |> Map.put(:scopes, scopes)
with cs <- App.register_changeset(%App{}, app_attrs),
false <- cs.changes[:client_name] == @local_mastodon_name,
diff --git a/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex b/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex
index bfd5120ba..753b3db3e 100644
--- a/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/auth_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.AuthController do
@@ -13,9 +13,9 @@ defmodule Pleroma.Web.MastodonAPI.AuthController do
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
- @local_mastodon_name "Mastodon-Local"
+ plug(Pleroma.Plugs.RateLimiter, [name: :password_reset] when action == :password_reset)
- plug(Pleroma.Plugs.RateLimiter, :password_reset when action == :password_reset)
+ @local_mastodon_name "Mastodon-Local"
@doc "GET /web/login"
def login(%{assigns: %{user: %User{}}} = conn, _params) do
@@ -86,6 +86,6 @@ defmodule Pleroma.Web.MastodonAPI.AuthController do
@spec get_or_make_app() :: {:ok, App.t()} | {:error, Ecto.Changeset.t()}
defp get_or_make_app do
%{client_name: @local_mastodon_name, redirect_uris: "."}
- |> App.get_or_make(["read", "write", "follow", "push"])
+ |> App.get_or_make(["read", "write", "follow", "push", "admin"])
end
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex b/lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex
index 6c0584c54..f35ec3596 100644
--- a/lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/conversation_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.ConversationController do
@@ -13,10 +13,11 @@ defmodule Pleroma.Web.MastodonAPI.ConversationController do
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
plug(OAuthScopesPlug, %{scopes: ["read:statuses"]} when action == :index)
- plug(OAuthScopesPlug, %{scopes: ["write:conversations"]} when action == :read)
+ plug(OAuthScopesPlug, %{scopes: ["write:conversations"]} when action != :index)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.ConversationOperation
@doc "GET /api/v1/conversations"
def index(%{assigns: %{user: user}} = conn, params) do
@@ -28,7 +29,7 @@ defmodule Pleroma.Web.MastodonAPI.ConversationController do
end
@doc "POST /api/v1/conversations/:id/read"
- def read(%{assigns: %{user: user}} = conn, %{"id" => participation_id}) do
+ def mark_as_read(%{assigns: %{user: user}} = conn, %{id: participation_id}) do
with %Participation{} = participation <-
Repo.get_by(Participation, id: participation_id, user_id: user.id),
{:ok, participation} <- Participation.mark_as_read(participation) do
diff --git a/lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex b/lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex
index 391c0648b..c5f47c5df 100644
--- a/lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/custom_emoji_controller.ex
@@ -1,10 +1,20 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.CustomEmojiController do
use Pleroma.Web, :controller
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+
+ plug(
+ :skip_plug,
+ [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug]
+ when action == :index
+ )
+
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.CustomEmojiOperation
+
def index(conn, _params) do
render(conn, "index.json", custom_emojis: Pleroma.Emoji.get_all())
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex b/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex
index c7606246b..825b231ab 100644
--- a/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/domain_block_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.DomainBlockController do
@@ -8,6 +8,9 @@ defmodule Pleroma.Web.MastodonAPI.DomainBlockController do
alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.User
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.DomainBlockOperation
+
plug(
OAuthScopesPlug,
%{scopes: ["follow", "read:blocks"]} when action == :index
@@ -18,21 +21,19 @@ defmodule Pleroma.Web.MastodonAPI.DomainBlockController do
%{scopes: ["follow", "write:blocks"]} when action != :index
)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
-
@doc "GET /api/v1/domain_blocks"
- def index(%{assigns: %{user: %{info: info}}} = conn, _) do
- json(conn, Map.get(info, :domain_blocks, []))
+ def index(%{assigns: %{user: user}} = conn, _) do
+ json(conn, Map.get(user, :domain_blocks, []))
end
@doc "POST /api/v1/domain_blocks"
- def create(%{assigns: %{user: blocker}} = conn, %{"domain" => domain}) do
+ def create(%{assigns: %{user: blocker}, body_params: %{domain: domain}} = conn, _params) do
User.block_domain(blocker, domain)
json(conn, %{})
end
@doc "DELETE /api/v1/domain_blocks"
- def delete(%{assigns: %{user: blocker}} = conn, %{"domain" => domain}) do
+ def delete(%{assigns: %{user: blocker}, body_params: %{domain: domain}} = conn, _params) do
User.unblock_domain(blocker, domain)
json(conn, %{})
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex b/lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex
index 41243d5e7..8af557b61 100644
--- a/lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/fallback_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.FallbackController do
@@ -20,6 +20,10 @@ defmodule Pleroma.Web.MastodonAPI.FallbackController do
render_error(conn, :not_found, "Record not found")
end
+ def call(conn, {:error, :forbidden}) do
+ render_error(conn, :forbidden, "Access denied")
+ end
+
def call(conn, {:error, error_message}) do
conn
|> put_status(:bad_request)
diff --git a/lib/pleroma/web/mastodon_api/controllers/filter_controller.ex b/lib/pleroma/web/mastodon_api/controllers/filter_controller.ex
index cadef72e1..abbf0ce02 100644
--- a/lib/pleroma/web/mastodon_api/controllers/filter_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/filter_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.FilterController do
@@ -10,6 +10,7 @@ defmodule Pleroma.Web.MastodonAPI.FilterController do
@oauth_read_actions [:show, :index]
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
plug(OAuthScopesPlug, %{scopes: ["read:filters"]} when action in @oauth_read_actions)
plug(
@@ -17,62 +18,60 @@ defmodule Pleroma.Web.MastodonAPI.FilterController do
%{scopes: ["write:filters"]} when action not in @oauth_read_actions
)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.FilterOperation
@doc "GET /api/v1/filters"
def index(%{assigns: %{user: user}} = conn, _) do
filters = Filter.get_filters(user)
- render(conn, "filters.json", filters: filters)
+ render(conn, "index.json", filters: filters)
end
@doc "POST /api/v1/filters"
- def create(
- %{assigns: %{user: user}} = conn,
- %{"phrase" => phrase, "context" => context} = params
- ) do
+ def create(%{assigns: %{user: user}, body_params: params} = conn, _) do
query = %Filter{
user_id: user.id,
- phrase: phrase,
- context: context,
- hide: Map.get(params, "irreversible", false),
- whole_word: Map.get(params, "boolean", true)
- # expires_at
+ phrase: params.phrase,
+ context: params.context,
+ hide: params.irreversible,
+ whole_word: params.whole_word
+ # TODO: support `expires_in` parameter (as in Mastodon API)
}
{:ok, response} = Filter.create(query)
- render(conn, "filter.json", filter: response)
+ render(conn, "show.json", filter: response)
end
@doc "GET /api/v1/filters/:id"
- def show(%{assigns: %{user: user}} = conn, %{"id" => filter_id}) do
+ def show(%{assigns: %{user: user}} = conn, %{id: filter_id}) do
filter = Filter.get(filter_id, user)
- render(conn, "filter.json", filter: filter)
+ render(conn, "show.json", filter: filter)
end
@doc "PUT /api/v1/filters/:id"
def update(
- %{assigns: %{user: user}} = conn,
- %{"phrase" => phrase, "context" => context, "id" => filter_id} = params
+ %{assigns: %{user: user}, body_params: params} = conn,
+ %{id: filter_id}
) do
- query = %Filter{
- user_id: user.id,
- filter_id: filter_id,
- phrase: phrase,
- context: context,
- hide: Map.get(params, "irreversible", nil),
- whole_word: Map.get(params, "boolean", true)
- # expires_at
- }
-
- {:ok, response} = Filter.update(query)
- render(conn, "filter.json", filter: response)
+ params =
+ params
+ |> Map.delete(:irreversible)
+ |> Map.put(:hide, params[:irreversible])
+ |> Enum.reject(fn {_key, value} -> is_nil(value) end)
+ |> Map.new()
+
+ # TODO: support `expires_in` parameter (as in Mastodon API)
+
+ with %Filter{} = filter <- Filter.get(filter_id, user),
+ {:ok, %Filter{} = filter} <- Filter.update(filter, params) do
+ render(conn, "show.json", filter: filter)
+ end
end
@doc "DELETE /api/v1/filters/:id"
- def delete(%{assigns: %{user: user}} = conn, %{"id" => filter_id}) do
+ def delete(%{assigns: %{user: user}} = conn, %{id: filter_id}) do
query = %Filter{
user_id: user.id,
filter_id: filter_id
diff --git a/lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex b/lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex
index 3ccbdf1c6..748b6b475 100644
--- a/lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/follow_request_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.FollowRequestController do
@@ -10,6 +10,7 @@ defmodule Pleroma.Web.MastodonAPI.FollowRequestController do
alias Pleroma.Web.CommonAPI
plug(:put_view, Pleroma.Web.MastodonAPI.AccountView)
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
plug(:assign_follower when action != :index)
action_fallback(:errors)
@@ -21,7 +22,7 @@ defmodule Pleroma.Web.MastodonAPI.FollowRequestController do
%{scopes: ["follow", "write:follows"]} when action != :index
)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.FollowRequestOperation
@doc "GET /api/v1/follow_requests"
def index(%{assigns: %{user: followed}} = conn, _params) do
@@ -44,7 +45,7 @@ defmodule Pleroma.Web.MastodonAPI.FollowRequestController do
end
end
- defp assign_follower(%{params: %{"id" => id}} = conn, _) do
+ defp assign_follower(%{params: %{id: id}} = conn, _) do
case User.get_cached_by_id(id) do
%User{} = follower -> assign(conn, :follower, follower)
nil -> Pleroma.Web.MastodonAPI.FallbackController.call(conn, {:error, :not_found}) |> halt()
diff --git a/lib/pleroma/web/mastodon_api/controllers/instance_controller.ex b/lib/pleroma/web/mastodon_api/controllers/instance_controller.ex
index a55f60fec..d8859731d 100644
--- a/lib/pleroma/web/mastodon_api/controllers/instance_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/instance_controller.ex
@@ -1,10 +1,20 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.InstanceController do
use Pleroma.Web, :controller
+ plug(OpenApiSpex.Plug.CastAndValidate)
+
+ plug(
+ :skip_plug,
+ [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug]
+ when action in [:show, :peers]
+ )
+
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.InstanceOperation
+
@doc "GET /api/v1/instance"
def show(conn, _params) do
render(conn, "show.json")
diff --git a/lib/pleroma/web/mastodon_api/controllers/list_controller.ex b/lib/pleroma/web/mastodon_api/controllers/list_controller.ex
index e0ffdba21..acdc76fd2 100644
--- a/lib/pleroma/web/mastodon_api/controllers/list_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/list_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.ListController do
@@ -9,20 +9,17 @@ defmodule Pleroma.Web.MastodonAPI.ListController do
alias Pleroma.User
alias Pleroma.Web.MastodonAPI.AccountView
- plug(:list_by_id_and_user when action not in [:index, :create])
-
- plug(OAuthScopesPlug, %{scopes: ["read:lists"]} when action in [:index, :show, :list_accounts])
-
- plug(
- OAuthScopesPlug,
- %{scopes: ["write:lists"]}
- when action in [:create, :update, :delete, :add_to_list, :remove_from_list]
- )
+ @oauth_read_actions [:index, :show, :list_accounts]
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+ plug(:list_by_id_and_user when action not in [:index, :create])
+ plug(OAuthScopesPlug, %{scopes: ["read:lists"]} when action in @oauth_read_actions)
+ plug(OAuthScopesPlug, %{scopes: ["write:lists"]} when action not in @oauth_read_actions)
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.ListOperation
+
# GET /api/v1/lists
def index(%{assigns: %{user: user}} = conn, opts) do
lists = Pleroma.List.for_user(user, opts)
@@ -30,7 +27,7 @@ defmodule Pleroma.Web.MastodonAPI.ListController do
end
# POST /api/v1/lists
- def create(%{assigns: %{user: user}} = conn, %{"title" => title}) do
+ def create(%{assigns: %{user: user}, body_params: %{title: title}} = conn, _) do
with {:ok, %Pleroma.List{} = list} <- Pleroma.List.create(title, user) do
render(conn, "show.json", list: list)
end
@@ -42,7 +39,7 @@ defmodule Pleroma.Web.MastodonAPI.ListController do
end
# PUT /api/v1/lists/:id
- def update(%{assigns: %{list: list}} = conn, %{"title" => title}) do
+ def update(%{assigns: %{list: list}, body_params: %{title: title}} = conn, _) do
with {:ok, list} <- Pleroma.List.rename(list, title) do
render(conn, "show.json", list: list)
end
@@ -65,7 +62,7 @@ defmodule Pleroma.Web.MastodonAPI.ListController do
end
# POST /api/v1/lists/:id/accounts
- def add_to_list(%{assigns: %{list: list}} = conn, %{"account_ids" => account_ids}) do
+ def add_to_list(%{assigns: %{list: list}, body_params: %{account_ids: account_ids}} = conn, _) do
Enum.each(account_ids, fn account_id ->
with %User{} = followed <- User.get_cached_by_id(account_id) do
Pleroma.List.follow(list, followed)
@@ -76,7 +73,10 @@ defmodule Pleroma.Web.MastodonAPI.ListController do
end
# DELETE /api/v1/lists/:id/accounts
- def remove_from_list(%{assigns: %{list: list}} = conn, %{"account_ids" => account_ids}) do
+ def remove_from_list(
+ %{assigns: %{list: list}, body_params: %{account_ids: account_ids}} = conn,
+ _
+ ) do
Enum.each(account_ids, fn account_id ->
with %User{} = followed <- User.get_cached_by_id(account_id) do
Pleroma.List.unfollow(list, followed)
@@ -86,7 +86,7 @@ defmodule Pleroma.Web.MastodonAPI.ListController do
json(conn, %{})
end
- defp list_by_id_and_user(%{assigns: %{user: user}, params: %{"id" => id}} = conn, _) do
+ defp list_by_id_and_user(%{assigns: %{user: user}, params: %{id: id}} = conn, _) do
case Pleroma.List.get(id, user) do
%Pleroma.List{} = list -> assign(conn, :list, list)
nil -> conn |> render_error(:not_found, "List not found") |> halt()
diff --git a/lib/pleroma/web/mastodon_api/controllers/marker_controller.ex b/lib/pleroma/web/mastodon_api/controllers/marker_controller.ex
index ce025624d..85310edfa 100644
--- a/lib/pleroma/web/mastodon_api/controllers/marker_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/marker_controller.ex
@@ -1,11 +1,13 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.MarkerController do
use Pleroma.Web, :controller
alias Pleroma.Plugs.OAuthScopesPlug
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+
plug(
OAuthScopesPlug,
%{scopes: ["read:statuses"]}
@@ -13,17 +15,21 @@ defmodule Pleroma.Web.MastodonAPI.MarkerController do
)
plug(OAuthScopesPlug, %{scopes: ["write:statuses"]} when action == :upsert)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.MarkerOperation
+
# GET /api/v1/markers
def index(%{assigns: %{user: user}} = conn, params) do
- markers = Pleroma.Marker.get_markers(user, params["timeline"])
+ markers = Pleroma.Marker.get_markers(user, params[:timeline])
render(conn, "markers.json", %{markers: markers})
end
# POST /api/v1/markers
- def upsert(%{assigns: %{user: user}} = conn, params) do
+ def upsert(%{assigns: %{user: user}, body_params: params} = conn, _) do
+ params = Map.new(params, fn {key, value} -> {to_string(key), value} end)
+
with {:ok, result} <- Pleroma.Marker.upsert(user, params),
markers <- Map.values(result) do
render(conn, "markers.json", %{markers: markers})
diff --git a/lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex b/lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex
index 7d839a8cf..e7767de4e 100644
--- a/lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/mastodon_api_controller.ex
@@ -1,23 +1,35 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.MastodonAPIController do
+ @moduledoc """
+ Contains stubs for unimplemented Mastodon API endpoints.
+
+ Note: instead of routing directly to this controller's action,
+ it's preferable to define an action in relevant (non-generic) controller,
+ set up OAuth rules for it and call this controller's function from it.
+ """
+
use Pleroma.Web, :controller
require Logger
+ plug(
+ :skip_plug,
+ [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug]
+ when action in [:empty_array, :empty_object]
+ )
+
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
- # Stubs for unimplemented mastodon api
- #
def empty_array(conn, _) do
- Logger.debug("Unimplemented, returning an empty array")
+ Logger.debug("Unimplemented, returning an empty array (list)")
json(conn, [])
end
def empty_object(conn, _) do
- Logger.debug("Unimplemented, returning an empty object")
+ Logger.debug("Unimplemented, returning an empty object (map)")
json(conn, %{})
end
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/media_controller.ex b/lib/pleroma/web/mastodon_api/controllers/media_controller.ex
index ed4c08d99..513de279f 100644
--- a/lib/pleroma/web/mastodon_api/controllers/media_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/media_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.MediaController do
@@ -11,19 +11,21 @@ defmodule Pleroma.Web.MastodonAPI.MediaController do
alias Pleroma.Web.ActivityPub.ActivityPub
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
plug(:put_view, Pleroma.Web.MastodonAPI.StatusView)
- plug(OAuthScopesPlug, %{scopes: ["write:media"]})
+ plug(OAuthScopesPlug, %{scopes: ["read:media"]} when action == :show)
+ plug(OAuthScopesPlug, %{scopes: ["write:media"]} when action != :show)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.MediaOperation
@doc "POST /api/v1/media"
- def create(%{assigns: %{user: user}} = conn, %{"file" => file} = data) do
+ def create(%{assigns: %{user: user}, body_params: %{file: file} = data} = conn, _) do
with {:ok, object} <-
ActivityPub.upload(
file,
actor: User.ap_id(user),
- description: Map.get(data, "description")
+ description: Map.get(data, :description)
) do
attachment_data = Map.put(object.data, "id", object.id)
@@ -31,11 +33,30 @@ defmodule Pleroma.Web.MastodonAPI.MediaController do
end
end
+ def create(_conn, _data), do: {:error, :bad_request}
+
+ @doc "POST /api/v2/media"
+ def create2(%{assigns: %{user: user}, body_params: %{file: file} = data} = conn, _) do
+ with {:ok, object} <-
+ ActivityPub.upload(
+ file,
+ actor: User.ap_id(user),
+ description: Map.get(data, :description)
+ ) do
+ attachment_data = Map.put(object.data, "id", object.id)
+
+ conn
+ |> put_status(202)
+ |> render("attachment.json", %{attachment: attachment_data})
+ end
+ end
+
+ def create2(_conn, _data), do: {:error, :bad_request}
+
@doc "PUT /api/v1/media/:id"
- def update(%{assigns: %{user: user}} = conn, %{"id" => id, "description" => description})
- when is_binary(description) do
+ def update(%{assigns: %{user: user}, body_params: %{description: description}} = conn, %{id: id}) do
with %Object{} = object <- Object.get_by_id(id),
- true <- Object.authorize_mutation(object, user),
+ :ok <- Object.authorize_access(object, user),
{:ok, %Object{data: data}} <- Object.update_data(object, %{"name" => description}) do
attachment_data = Map.put(data, "id", object.id)
@@ -43,5 +64,17 @@ defmodule Pleroma.Web.MastodonAPI.MediaController do
end
end
- def update(_conn, _data), do: {:error, :bad_request}
+ def update(conn, data), do: show(conn, data)
+
+ @doc "GET /api/v1/media/:id"
+ def show(%{assigns: %{user: user}} = conn, %{id: id}) do
+ with %Object{data: data, id: object_id} = object <- Object.get_by_id(id),
+ :ok <- Object.authorize_access(object, user) do
+ attachment_data = Map.put(data, "id", object_id)
+
+ render(conn, "attachment.json", %{attachment: attachment_data})
+ end
+ end
+
+ def show(_conn, _data), do: {:error, :bad_request}
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/notification_controller.ex b/lib/pleroma/web/mastodon_api/controllers/notification_controller.ex
index 16759be6a..bcd12c73f 100644
--- a/lib/pleroma/web/mastodon_api/controllers/notification_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/notification_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.NotificationController do
@@ -13,6 +13,8 @@ defmodule Pleroma.Web.MastodonAPI.NotificationController do
@oauth_read_actions [:show, :index]
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+
plug(
OAuthScopesPlug,
%{scopes: ["read:notifications"]} when action in @oauth_read_actions
@@ -20,19 +22,40 @@ defmodule Pleroma.Web.MastodonAPI.NotificationController do
plug(OAuthScopesPlug, %{scopes: ["write:notifications"]} when action not in @oauth_read_actions)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.NotificationOperation
# GET /api/v1/notifications
+ def index(conn, %{account_id: account_id} = params) do
+ case Pleroma.User.get_cached_by_id(account_id) do
+ %{ap_id: account_ap_id} ->
+ params =
+ params
+ |> Map.delete(:account_id)
+ |> Map.put(:account_ap_id, account_ap_id)
+
+ index(conn, params)
+
+ _ ->
+ conn
+ |> put_status(:not_found)
+ |> json(%{"error" => "Account is not found"})
+ end
+ end
+
def index(%{assigns: %{user: user}} = conn, params) do
+ params = Map.new(params, fn {k, v} -> {to_string(k), v} end)
notifications = MastodonAPI.get_notifications(user, params)
conn
|> add_link_headers(notifications)
- |> render("index.json", notifications: notifications, for: user)
+ |> render("index.json",
+ notifications: notifications,
+ for: user
+ )
end
# GET /api/v1/notifications/:id
- def show(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def show(%{assigns: %{user: user}} = conn, %{id: id}) do
with {:ok, notification} <- Notification.get(user, id) do
render(conn, "show.json", notification: notification, for: user)
else
@@ -49,8 +72,9 @@ defmodule Pleroma.Web.MastodonAPI.NotificationController do
json(conn, %{})
end
- # POST /api/v1/notifications/dismiss
- def dismiss(%{assigns: %{user: user}} = conn, %{"id" => id} = _params) do
+ # POST /api/v1/notifications/:id/dismiss
+
+ def dismiss(%{assigns: %{user: user}} = conn, %{id: id} = _params) do
with {:ok, _notif} <- Notification.dismiss(user, id) do
json(conn, %{})
else
@@ -61,8 +85,13 @@ defmodule Pleroma.Web.MastodonAPI.NotificationController do
end
end
+ # POST /api/v1/notifications/dismiss (deprecated)
+ def dismiss_via_body(%{body_params: params} = conn, _) do
+ dismiss(conn, params)
+ end
+
# DELETE /api/v1/notifications/destroy_multiple
- def destroy_multiple(%{assigns: %{user: user}} = conn, %{"ids" => ids} = _params) do
+ def destroy_multiple(%{assigns: %{user: user}} = conn, %{ids: ids} = _params) do
Notification.destroy_multiple(user, ids)
json(conn, %{})
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/poll_controller.ex b/lib/pleroma/web/mastodon_api/controllers/poll_controller.ex
index d129f8672..db46ffcfc 100644
--- a/lib/pleroma/web/mastodon_api/controllers/poll_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/poll_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.PollController do
@@ -15,6 +15,8 @@ defmodule Pleroma.Web.MastodonAPI.PollController do
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+
plug(
OAuthScopesPlug,
%{scopes: ["read:statuses"], fallback: :proceed_unauthenticated} when action == :show
@@ -22,10 +24,10 @@ defmodule Pleroma.Web.MastodonAPI.PollController do
plug(OAuthScopesPlug, %{scopes: ["write:statuses"]} when action == :vote)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.PollOperation
@doc "GET /api/v1/polls/:id"
- def show(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def show(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Object{} = object <- Object.get_by_id_and_maybe_refetch(id, interval: 60),
%Activity{} = activity <- Activity.get_create_by_object_ap_id(object.data["id"]),
true <- Visibility.visible_for_user?(activity, user) do
@@ -37,7 +39,7 @@ defmodule Pleroma.Web.MastodonAPI.PollController do
end
@doc "POST /api/v1/polls/:id/votes"
- def vote(%{assigns: %{user: user}} = conn, %{"id" => id, "choices" => choices}) do
+ def vote(%{assigns: %{user: user}, body_params: %{choices: choices}} = conn, %{id: id}) do
with %Object{data: %{"type" => "Question"}} = object <- Object.get_by_id(id),
%Activity{} = activity <- Activity.get_create_by_object_ap_id(object.data["id"]),
true <- Visibility.visible_for_user?(activity, user),
diff --git a/lib/pleroma/web/mastodon_api/controllers/report_controller.ex b/lib/pleroma/web/mastodon_api/controllers/report_controller.ex
index 263c2180f..405167108 100644
--- a/lib/pleroma/web/mastodon_api/controllers/report_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/report_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.ReportController do
@@ -9,12 +9,13 @@ defmodule Pleroma.Web.MastodonAPI.ReportController do
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
plug(OAuthScopesPlug, %{scopes: ["write:reports"]} when action == :create)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.ReportOperation
@doc "POST /api/v1/reports"
- def create(%{assigns: %{user: user}} = conn, params) do
+ def create(%{assigns: %{user: user}, body_params: params} = conn, _) do
with {:ok, activity} <- Pleroma.Web.CommonAPI.report(user, params) do
render(conn, "show.json", activity: activity)
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex b/lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex
index ff9276541..1719c67ea 100644
--- a/lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/scheduled_activity_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.ScheduledActivityController do
@@ -11,19 +11,21 @@ defmodule Pleroma.Web.MastodonAPI.ScheduledActivityController do
alias Pleroma.ScheduledActivity
alias Pleroma.Web.MastodonAPI.MastodonAPI
- plug(:assign_scheduled_activity when action != :index)
-
@oauth_read_actions [:show, :index]
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
plug(OAuthScopesPlug, %{scopes: ["read:statuses"]} when action in @oauth_read_actions)
plug(OAuthScopesPlug, %{scopes: ["write:statuses"]} when action not in @oauth_read_actions)
-
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ plug(:assign_scheduled_activity when action != :index)
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.ScheduledActivityOperation
+
@doc "GET /api/v1/scheduled_statuses"
def index(%{assigns: %{user: user}} = conn, params) do
+ params = Map.new(params, fn {key, value} -> {to_string(key), value} end)
+
with scheduled_activities <- MastodonAPI.get_scheduled_activities(user, params) do
conn
|> add_link_headers(scheduled_activities)
@@ -37,7 +39,7 @@ defmodule Pleroma.Web.MastodonAPI.ScheduledActivityController do
end
@doc "PUT /api/v1/scheduled_statuses/:id"
- def update(%{assigns: %{scheduled_activity: scheduled_activity}} = conn, params) do
+ def update(%{assigns: %{scheduled_activity: scheduled_activity}, body_params: params} = conn, _) do
with {:ok, scheduled_activity} <- ScheduledActivity.update(scheduled_activity, params) do
render(conn, "show.json", scheduled_activity: scheduled_activity)
end
@@ -50,7 +52,7 @@ defmodule Pleroma.Web.MastodonAPI.ScheduledActivityController do
end
end
- defp assign_scheduled_activity(%{assigns: %{user: user}, params: %{"id" => id}} = conn, _) do
+ defp assign_scheduled_activity(%{assigns: %{user: user}, params: %{id: id}} = conn, _) do
case ScheduledActivity.get(user, id) do
%ScheduledActivity{} = activity -> assign(conn, :scheduled_activity, activity)
nil -> Pleroma.Web.MastodonAPI.FallbackController.call(conn, {:error, :not_found}) |> halt()
diff --git a/lib/pleroma/web/mastodon_api/controllers/search_controller.ex b/lib/pleroma/web/mastodon_api/controllers/search_controller.ex
index 6cfd68a84..77e2224e4 100644
--- a/lib/pleroma/web/mastodon_api/controllers/search_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/search_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.SearchController do
@@ -17,25 +17,33 @@ defmodule Pleroma.Web.MastodonAPI.SearchController do
require Logger
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+
# Note: Mastodon doesn't allow unauthenticated access (requires read:accounts / read:search)
plug(OAuthScopesPlug, %{scopes: ["read:search"], fallback: :proceed_unauthenticated})
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ # Note: on private instances auth is required (EnsurePublicOrAuthenticatedPlug is not skipped)
+
+ plug(RateLimiter, [name: :search] when action in [:search, :search2, :account_search])
- plug(RateLimiter, :search when action in [:search, :search2, :account_search])
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.SearchOperation
- def account_search(%{assigns: %{user: user}} = conn, %{"q" => query} = params) do
+ def account_search(%{assigns: %{user: user}} = conn, %{q: query} = params) do
accounts = User.search(query, search_options(params, user))
conn
|> put_view(AccountView)
- |> render("index.json", users: accounts, for: user, as: :user)
+ |> render("index.json",
+ users: accounts,
+ for: user,
+ as: :user
+ )
end
def search2(conn, params), do: do_search(:v2, conn, params)
def search(conn, params), do: do_search(:v1, conn, params)
- defp do_search(version, %{assigns: %{user: user}} = conn, %{"q" => query} = params) do
+ defp do_search(version, %{assigns: %{user: user}} = conn, %{q: query} = params) do
options = search_options(params, user)
timeout = Keyword.get(Repo.config(), :timeout, 15_000)
default_values = %{"statuses" => [], "accounts" => [], "hashtags" => []}
@@ -43,7 +51,7 @@ defmodule Pleroma.Web.MastodonAPI.SearchController do
result =
default_values
|> Enum.map(fn {resource, default_value} ->
- if params["type"] == nil or params["type"] == resource do
+ if params[:type] in [nil, resource] do
{resource, fn -> resource_search(version, resource, query, options) end}
else
{resource, fn -> default_value end}
@@ -66,12 +74,13 @@ defmodule Pleroma.Web.MastodonAPI.SearchController do
defp search_options(params, user) do
[
- resolve: params["resolve"] == "true",
- following: params["following"] == "true",
- limit: ControllerHelper.fetch_integer_param(params, "limit"),
- offset: ControllerHelper.fetch_integer_param(params, "offset"),
- type: params["type"],
+ resolve: params[:resolve],
+ following: params[:following],
+ limit: params[:limit],
+ offset: params[:offset],
+ type: params[:type],
author: get_author(params),
+ embed_relationships: ControllerHelper.embed_relationships?(params),
for_user: user
]
|> Enum.filter(&elem(&1, 1))
@@ -79,12 +88,23 @@ defmodule Pleroma.Web.MastodonAPI.SearchController do
defp resource_search(_, "accounts", query, options) do
accounts = with_fallback(fn -> User.search(query, options) end)
- AccountView.render("index.json", users: accounts, for: options[:for_user], as: :user)
+
+ AccountView.render("index.json",
+ users: accounts,
+ for: options[:for_user],
+ as: :user,
+ embed_relationships: options[:embed_relationships]
+ )
end
defp resource_search(_, "statuses", query, options) do
statuses = with_fallback(fn -> Activity.search(options[:for_user], query, options) end)
- StatusView.render("index.json", activities: statuses, for: options[:for_user], as: :activity)
+
+ StatusView.render("index.json",
+ activities: statuses,
+ for: options[:for_user],
+ as: :activity
+ )
end
defp resource_search(:v2, "hashtags", query, _options) do
@@ -121,7 +141,7 @@ defmodule Pleroma.Web.MastodonAPI.SearchController do
end
end
- defp get_author(%{"account_id" => account_id}) when is_binary(account_id),
+ defp get_author(%{account_id: account_id}) when is_binary(account_id),
do: User.get_cached_by_id(account_id)
defp get_author(_params), do: nil
diff --git a/lib/pleroma/web/mastodon_api/controllers/status_controller.ex b/lib/pleroma/web/mastodon_api/controllers/status_controller.ex
index e5d016f63..9dbf4f33c 100644
--- a/lib/pleroma/web/mastodon_api/controllers/status_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/status_controller.ex
@@ -1,11 +1,12 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.StatusController do
use Pleroma.Web, :controller
- import Pleroma.Web.ControllerHelper, only: [try_render: 3, add_link_headers: 2]
+ import Pleroma.Web.ControllerHelper,
+ only: [try_render: 3, add_link_headers: 2]
require Ecto.Query
@@ -23,6 +24,9 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
alias Pleroma.Web.MastodonAPI.AccountView
alias Pleroma.Web.MastodonAPI.ScheduledActivityView
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+ plug(:skip_plug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug when action in [:index, :show])
+
@unauthenticated_access %{fallback: :proceed_unauthenticated, scopes: []}
plug(
@@ -76,32 +80,32 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
%{scopes: ["write:bookmarks"]} when action in [:bookmark, :unbookmark]
)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
-
@rate_limited_status_actions ~w(reblog unreblog favourite unfavourite create delete)a
plug(
RateLimiter,
- {:status_id_action, bucket_name: "status_id_action:reblog_unreblog", params: ["id"]}
+ [name: :status_id_action, bucket_name: "status_id_action:reblog_unreblog", params: ["id"]]
when action in ~w(reblog unreblog)a
)
plug(
RateLimiter,
- {:status_id_action, bucket_name: "status_id_action:fav_unfav", params: ["id"]}
+ [name: :status_id_action, bucket_name: "status_id_action:fav_unfav", params: ["id"]]
when action in ~w(favourite unfavourite)a
)
- plug(RateLimiter, :statuses_actions when action in @rate_limited_status_actions)
+ plug(RateLimiter, [name: :statuses_actions] when action in @rate_limited_status_actions)
action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.StatusOperation
+
@doc """
GET `/api/v1/statuses?ids[]=1&ids[]=2`
`ids` query param is required
"""
- def index(%{assigns: %{user: user}} = conn, %{"ids" => ids}) do
+ def index(%{assigns: %{user: user}} = conn, %{ids: ids} = _params) do
limit = 100
activities =
@@ -110,7 +114,11 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
|> Activity.all_by_ids_with_object()
|> Enum.filter(&Visibility.visible_for_user?(&1, user))
- render(conn, "index.json", activities: activities, for: user, as: :activity)
+ render(conn, "index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
end
@doc """
@@ -119,20 +127,32 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
Creates a scheduled status when `scheduled_at` param is present and it's far enough
"""
def create(
- %{assigns: %{user: user}} = conn,
- %{"status" => _, "scheduled_at" => scheduled_at} = params
- ) do
- params = Map.put(params, "in_reply_to_status_id", params["in_reply_to_id"])
-
- if ScheduledActivity.far_enough?(scheduled_at) do
- with {:ok, scheduled_activity} <-
- ScheduledActivity.create(user, %{"params" => params, "scheduled_at" => scheduled_at}) do
- conn
- |> put_view(ScheduledActivityView)
- |> render("show.json", scheduled_activity: scheduled_activity)
- end
+ %{
+ assigns: %{user: user},
+ body_params: %{status: _, scheduled_at: scheduled_at} = params
+ } = conn,
+ _
+ )
+ when not is_nil(scheduled_at) do
+ params = Map.put(params, :in_reply_to_status_id, params[:in_reply_to_id])
+
+ attrs = %{
+ params: Map.new(params, fn {key, value} -> {to_string(key), value} end),
+ scheduled_at: scheduled_at
+ }
+
+ with {:far_enough, true} <- {:far_enough, ScheduledActivity.far_enough?(scheduled_at)},
+ {:ok, scheduled_activity} <- ScheduledActivity.create(user, attrs) do
+ conn
+ |> put_view(ScheduledActivityView)
+ |> render("show.json", scheduled_activity: scheduled_activity)
else
- create(conn, Map.drop(params, ["scheduled_at"]))
+ {:far_enough, _} ->
+ params = Map.drop(params, [:scheduled_at])
+ create(%Plug.Conn{conn | body_params: params}, %{})
+
+ error ->
+ error
end
end
@@ -141,8 +161,8 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
Creates a regular status
"""
- def create(%{assigns: %{user: user}} = conn, %{"status" => _} = params) do
- params = Map.put(params, "in_reply_to_status_id", params["in_reply_to_id"])
+ def create(%{assigns: %{user: user}, body_params: %{status: _} = params} = conn, _) do
+ params = Map.put(params, :in_reply_to_status_id, params[:in_reply_to_id])
with {:ok, activity} <- CommonAPI.post(user, params) do
try_render(conn, "show.json",
@@ -159,12 +179,13 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
end
- def create(%{assigns: %{user: _user}} = conn, %{"media_ids" => _} = params) do
- create(conn, Map.put(params, "status", ""))
+ def create(%{assigns: %{user: _user}, body_params: %{media_ids: _} = params} = conn, _) do
+ params = Map.put(params, :status, "")
+ create(%Plug.Conn{conn | body_params: params}, %{})
end
@doc "GET /api/v1/statuses/:id"
- def show(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def show(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Activity{} = activity <- Activity.get_by_id_with_object(id),
true <- Visibility.visible_for_user?(activity, user) do
try_render(conn, "show.json",
@@ -172,20 +193,23 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
for: user,
with_direct_conversation_id: true
)
+ else
+ _ -> {:error, :not_found}
end
end
@doc "DELETE /api/v1/statuses/:id"
- def delete(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def delete(%{assigns: %{user: user}} = conn, %{id: id}) do
with {:ok, %Activity{}} <- CommonAPI.delete(id, user) do
json(conn, %{})
else
+ {:error, :not_found} = e -> e
_e -> render_error(conn, :forbidden, "Can't delete this post")
end
end
@doc "POST /api/v1/statuses/:id/reblog"
- def reblog(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id} = params) do
+ def reblog(%{assigns: %{user: user}, body_params: params} = conn, %{id: ap_id_or_id}) do
with {:ok, announce, _activity} <- CommonAPI.repeat(ap_id_or_id, user, params),
%Activity{} = announce <- Activity.normalize(announce.data) do
try_render(conn, "show.json", %{activity: announce, for: user, as: :activity})
@@ -193,45 +217,45 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
@doc "POST /api/v1/statuses/:id/unreblog"
- def unreblog(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do
- with {:ok, _unannounce, %{data: %{"id" => id}}} <- CommonAPI.unrepeat(ap_id_or_id, user),
- %Activity{} = activity <- Activity.get_create_by_object_ap_id_with_object(id) do
+ def unreblog(%{assigns: %{user: user}} = conn, %{id: activity_id}) do
+ with {:ok, _unannounce} <- CommonAPI.unrepeat(activity_id, user),
+ %Activity{} = activity <- Activity.get_by_id(activity_id) do
try_render(conn, "show.json", %{activity: activity, for: user, as: :activity})
end
end
@doc "POST /api/v1/statuses/:id/favourite"
- def favourite(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do
- with {:ok, _fav, %{data: %{"id" => id}}} <- CommonAPI.favorite(ap_id_or_id, user),
- %Activity{} = activity <- Activity.get_create_by_object_ap_id(id) do
+ def favourite(%{assigns: %{user: user}} = conn, %{id: activity_id}) do
+ with {:ok, _fav} <- CommonAPI.favorite(user, activity_id),
+ %Activity{} = activity <- Activity.get_by_id(activity_id) do
try_render(conn, "show.json", activity: activity, for: user, as: :activity)
end
end
@doc "POST /api/v1/statuses/:id/unfavourite"
- def unfavourite(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do
- with {:ok, _, _, %{data: %{"id" => id}}} <- CommonAPI.unfavorite(ap_id_or_id, user),
- %Activity{} = activity <- Activity.get_create_by_object_ap_id(id) do
+ def unfavourite(%{assigns: %{user: user}} = conn, %{id: activity_id}) do
+ with {:ok, _unfav} <- CommonAPI.unfavorite(activity_id, user),
+ %Activity{} = activity <- Activity.get_by_id(activity_id) do
try_render(conn, "show.json", activity: activity, for: user, as: :activity)
end
end
@doc "POST /api/v1/statuses/:id/pin"
- def pin(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do
+ def pin(%{assigns: %{user: user}} = conn, %{id: ap_id_or_id}) do
with {:ok, activity} <- CommonAPI.pin(ap_id_or_id, user) do
try_render(conn, "show.json", activity: activity, for: user, as: :activity)
end
end
@doc "POST /api/v1/statuses/:id/unpin"
- def unpin(%{assigns: %{user: user}} = conn, %{"id" => ap_id_or_id}) do
+ def unpin(%{assigns: %{user: user}} = conn, %{id: ap_id_or_id}) do
with {:ok, activity} <- CommonAPI.unpin(ap_id_or_id, user) do
try_render(conn, "show.json", activity: activity, for: user, as: :activity)
end
end
@doc "POST /api/v1/statuses/:id/bookmark"
- def bookmark(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def bookmark(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Activity{} = activity <- Activity.get_by_id_with_object(id),
%User{} = user <- User.get_cached_by_nickname(user.nickname),
true <- Visibility.visible_for_user?(activity, user),
@@ -241,7 +265,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
@doc "POST /api/v1/statuses/:id/unbookmark"
- def unbookmark(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def unbookmark(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Activity{} = activity <- Activity.get_by_id_with_object(id),
%User{} = user <- User.get_cached_by_nickname(user.nickname),
true <- Visibility.visible_for_user?(activity, user),
@@ -251,7 +275,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
@doc "POST /api/v1/statuses/:id/mute"
- def mute_conversation(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def mute_conversation(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Activity{} = activity <- Activity.get_by_id(id),
{:ok, activity} <- CommonAPI.add_mute(user, activity) do
try_render(conn, "show.json", activity: activity, for: user, as: :activity)
@@ -259,7 +283,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
@doc "POST /api/v1/statuses/:id/unmute"
- def unmute_conversation(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def unmute_conversation(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Activity{} = activity <- Activity.get_by_id(id),
{:ok, activity} <- CommonAPI.remove_mute(user, activity) do
try_render(conn, "show.json", activity: activity, for: user, as: :activity)
@@ -268,7 +292,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
@doc "GET /api/v1/statuses/:id/card"
@deprecated "https://github.com/tootsuite/mastodon/pull/11213"
- def card(%{assigns: %{user: user}} = conn, %{"id" => status_id}) do
+ def card(%{assigns: %{user: user}} = conn, %{id: status_id}) do
with %Activity{} = activity <- Activity.get_by_id(status_id),
true <- Visibility.visible_for_user?(activity, user) do
data = Pleroma.Web.RichMedia.Helpers.fetch_data_for_activity(activity)
@@ -279,7 +303,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
@doc "GET /api/v1/statuses/:id/favourited_by"
- def favourited_by(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def favourited_by(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Activity{} = activity <- Activity.get_by_id_with_object(id),
{:visible, true} <- {:visible, Visibility.visible_for_user?(activity, user)},
%Object{data: %{"likes" => likes}} <- Object.normalize(activity) do
@@ -299,7 +323,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
@doc "GET /api/v1/statuses/:id/reblogged_by"
- def reblogged_by(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def reblogged_by(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Activity{} = activity <- Activity.get_by_id_with_object(id),
{:visible, true} <- {:visible, Visibility.visible_for_user?(activity, user)},
%Object{data: %{"announcements" => announces, "id" => ap_id}} <-
@@ -331,7 +355,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
@doc "GET /api/v1/statuses/:id/context"
- def context(%{assigns: %{user: user}} = conn, %{"id" => id}) do
+ def context(%{assigns: %{user: user}} = conn, %{id: id}) do
with %Activity{} = activity <- Activity.get_by_id(id) do
activities =
ActivityPub.fetch_activities_for_context(activity.data["context"], %{
@@ -345,20 +369,21 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
end
@doc "GET /api/v1/favourites"
- def favourites(%{assigns: %{user: user}} = conn, params) do
+ def favourites(%{assigns: %{user: %User{} = user}} = conn, params) do
params =
params
- |> Map.put("type", "Create")
- |> Map.put("favorited_by", user.ap_id)
- |> Map.put("blocking_user", user)
+ |> Map.new(fn {key, value} -> {to_string(key), value} end)
+ |> Map.take(Pleroma.Pagination.page_keys())
- activities =
- ActivityPub.fetch_activities([], params)
- |> Enum.reverse()
+ activities = ActivityPub.fetch_favourites(user, params)
conn
|> add_link_headers(activities)
- |> render("index.json", activities: activities, for: user, as: :activity)
+ |> render("index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
end
@doc "GET /api/v1/bookmarks"
@@ -376,6 +401,10 @@ defmodule Pleroma.Web.MastodonAPI.StatusController do
conn
|> add_link_headers(bookmarks)
- |> render("index.json", %{activities: activities, for: user, as: :activity})
+ |> render("index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
end
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex b/lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex
index fc7d52824..34eac97c5 100644
--- a/lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/subscription_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.SubscriptionController do
@@ -8,45 +8,40 @@ defmodule Pleroma.Web.MastodonAPI.SubscriptionController do
alias Pleroma.Web.Push
alias Pleroma.Web.Push.Subscription
- alias Pleroma.Web.MastodonAPI.PushSubscriptionView, as: View
action_fallback(:errors)
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+ plug(:restrict_push_enabled)
plug(Pleroma.Plugs.OAuthScopesPlug, %{scopes: ["push"]})
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.SubscriptionOperation
# Creates PushSubscription
# POST /api/v1/push/subscription
#
- def create(%{assigns: %{user: user, token: token}} = conn, params) do
- with true <- Push.enabled(),
- {:ok, _} <- Subscription.delete_if_exists(user, token),
+ def create(%{assigns: %{user: user, token: token}, body_params: params} = conn, _) do
+ with {:ok, _} <- Subscription.delete_if_exists(user, token),
{:ok, subscription} <- Subscription.create(user, token, params) do
- view = View.render("push_subscription.json", subscription: subscription)
- json(conn, view)
+ render(conn, "show.json", subscription: subscription)
end
end
# Gets PushSubscription
# GET /api/v1/push/subscription
#
- def get(%{assigns: %{user: user, token: token}} = conn, _params) do
- with true <- Push.enabled(),
- {:ok, subscription} <- Subscription.get(user, token) do
- view = View.render("push_subscription.json", subscription: subscription)
- json(conn, view)
+ def show(%{assigns: %{user: user, token: token}} = conn, _params) do
+ with {:ok, subscription} <- Subscription.get(user, token) do
+ render(conn, "show.json", subscription: subscription)
end
end
# Updates PushSubscription
# PUT /api/v1/push/subscription
#
- def update(%{assigns: %{user: user, token: token}} = conn, params) do
- with true <- Push.enabled(),
- {:ok, subscription} <- Subscription.update(user, token, params) do
- view = View.render("push_subscription.json", subscription: subscription)
- json(conn, view)
+ def update(%{assigns: %{user: user, token: token}, body_params: params} = conn, _) do
+ with {:ok, subscription} <- Subscription.update(user, token, params) do
+ render(conn, "show.json", subscription: subscription)
end
end
@@ -54,17 +49,26 @@ defmodule Pleroma.Web.MastodonAPI.SubscriptionController do
# DELETE /api/v1/push/subscription
#
def delete(%{assigns: %{user: user, token: token}} = conn, _params) do
- with true <- Push.enabled(),
- {:ok, _response} <- Subscription.delete(user, token),
+ with {:ok, _response} <- Subscription.delete(user, token),
do: json(conn, %{})
end
+ defp restrict_push_enabled(conn, _) do
+ if Push.enabled() do
+ conn
+ else
+ conn
+ |> render_error(:forbidden, "Web push subscription is disabled on this Pleroma instance")
+ |> halt()
+ end
+ end
+
# fallback action
#
def errors(conn, {:error, :not_found}) do
conn
|> put_status(:not_found)
- |> json(dgettext("errors", "Not found"))
+ |> json(%{error: dgettext("errors", "Record not found")})
end
def errors(conn, _) do
diff --git a/lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex b/lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex
index fe71c36af..f91df9ab7 100644
--- a/lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/suggestion_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.SuggestionController do
@@ -7,62 +7,26 @@ defmodule Pleroma.Web.MastodonAPI.SuggestionController do
require Logger
- alias Pleroma.Config
- alias Pleroma.Plugs.OAuthScopesPlug
- alias Pleroma.User
- alias Pleroma.Web.MediaProxy
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+ plug(Pleroma.Plugs.OAuthScopesPlug, %{scopes: ["read"]} when action == :index)
- action_fallback(Pleroma.Web.MastodonAPI.FallbackController)
-
- plug(OAuthScopesPlug, %{scopes: ["read"]} when action == :index)
-
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
-
- @doc "GET /api/v1/suggestions"
- def index(%{assigns: %{user: user}} = conn, _) do
- if Config.get([:suggestions, :enabled], false) do
- with {:ok, data} <- fetch_suggestions(user) do
- limit = Config.get([:suggestions, :limit], 23)
-
- data =
- data
- |> Enum.slice(0, limit)
- |> Enum.map(fn x ->
- x
- |> Map.put("id", fetch_suggestion_id(x))
- |> Map.put("avatar", MediaProxy.url(x["avatar"]))
- |> Map.put("avatar_static", MediaProxy.url(x["avatar_static"]))
- end)
-
- json(conn, data)
- end
- else
- json(conn, [])
- end
+ def open_api_operation(action) do
+ operation = String.to_existing_atom("#{action}_operation")
+ apply(__MODULE__, operation, [])
end
- defp fetch_suggestions(user) do
- api = Config.get([:suggestions, :third_party_engine], "")
- timeout = Config.get([:suggestions, :timeout], 5000)
- host = Config.get([Pleroma.Web.Endpoint, :url, :host])
-
- url =
- api
- |> String.replace("{{host}}", host)
- |> String.replace("{{user}}", user.nickname)
-
- with {:ok, %{status: 200, body: body}} <-
- Pleroma.HTTP.get(url, [], adapter: [recv_timeout: timeout, pool: :default]) do
- Jason.decode(body)
- else
- e -> Logger.error("Could not retrieve suggestions at fetch #{url}, #{inspect(e)}")
- end
+ def index_operation do
+ %OpenApiSpex.Operation{
+ tags: ["Suggestions"],
+ summary: "Follow suggestions (Not implemented)",
+ operationId: "SuggestionController.index",
+ responses: %{
+ 200 => Pleroma.Web.ApiSpec.Helpers.empty_array_response()
+ }
+ }
end
- defp fetch_suggestion_id(attrs) do
- case User.get_or_fetch(attrs["acct"]) do
- {:ok, %User{id: id}} -> id
- _ -> 0
- end
- end
+ @doc "GET /api/v1/suggestions"
+ def index(conn, params),
+ do: Pleroma.Web.MastodonAPI.MastodonAPIController.empty_array(conn, params)
end
diff --git a/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex b/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex
index 9f086a8c2..958567510 100644
--- a/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex
+++ b/lib/pleroma/web/mastodon_api/controllers/timeline_controller.ex
@@ -1,34 +1,57 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.TimelineController do
use Pleroma.Web, :controller
import Pleroma.Web.ControllerHelper,
- only: [add_link_headers: 2, add_link_headers: 3, truthy_param?: 1]
+ only: [add_link_headers: 2, add_link_headers: 3]
alias Pleroma.Pagination
+ alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
alias Pleroma.Plugs.OAuthScopesPlug
+ alias Pleroma.Plugs.RateLimiter
+ alias Pleroma.User
alias Pleroma.Web.ActivityPub.ActivityPub
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+ plug(:skip_plug, EnsurePublicOrAuthenticatedPlug when action in [:public, :hashtag])
+
+ # TODO: Replace with a macro when there is a Phoenix release with the following commit in it:
+ # https://github.com/phoenixframework/phoenix/commit/2e8c63c01fec4dde5467dbbbf9705ff9e780735e
+
+ plug(RateLimiter, [name: :timeline, bucket_name: :direct_timeline] when action == :direct)
+ plug(RateLimiter, [name: :timeline, bucket_name: :public_timeline] when action == :public)
+ plug(RateLimiter, [name: :timeline, bucket_name: :home_timeline] when action == :home)
+ plug(RateLimiter, [name: :timeline, bucket_name: :hashtag_timeline] when action == :hashtag)
+ plug(RateLimiter, [name: :timeline, bucket_name: :list_timeline] when action == :list)
+
plug(OAuthScopesPlug, %{scopes: ["read:statuses"]} when action in [:home, :direct])
plug(OAuthScopesPlug, %{scopes: ["read:lists"]} when action == :list)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["read:statuses"], fallback: :proceed_unauthenticated}
+ when action in [:public, :hashtag]
+ )
plug(:put_view, Pleroma.Web.MastodonAPI.StatusView)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.TimelineOperation
+
# GET /api/v1/timelines/home
def home(%{assigns: %{user: user}} = conn, params) do
params =
params
+ |> Map.new(fn {key, value} -> {to_string(key), value} end)
|> Map.put("type", ["Create", "Announce"])
|> Map.put("blocking_user", user)
|> Map.put("muting_user", user)
+ |> Map.put("reply_filtering_user", user)
|> Map.put("user", user)
- recipients = [user.ap_id | user.following]
+ recipients = [user.ap_id | User.following(user)]
activities =
recipients
@@ -37,13 +60,18 @@ defmodule Pleroma.Web.MastodonAPI.TimelineController do
conn
|> add_link_headers(activities)
- |> render("index.json", activities: activities, for: user, as: :activity)
+ |> render("index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
end
# GET /api/v1/timelines/direct
def direct(%{assigns: %{user: user}} = conn, params) do
params =
params
+ |> Map.new(fn {key, value} -> {to_string(key), value} end)
|> Map.put("type", "Create")
|> Map.put("blocking_user", user)
|> Map.put("user", user)
@@ -56,31 +84,51 @@ defmodule Pleroma.Web.MastodonAPI.TimelineController do
conn
|> add_link_headers(activities)
- |> render("index.json", activities: activities, for: user, as: :activity)
+ |> render("index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
end
# GET /api/v1/timelines/public
def public(%{assigns: %{user: user}} = conn, params) do
- local_only = truthy_param?(params["local"])
+ params = Map.new(params, fn {key, value} -> {to_string(key), value} end)
- activities =
- params
- |> Map.put("type", ["Create", "Announce"])
- |> Map.put("local_only", local_only)
- |> Map.put("blocking_user", user)
- |> Map.put("muting_user", user)
- |> ActivityPub.fetch_public_activities()
- |> Enum.reverse()
+ local_only = params["local"]
- conn
- |> add_link_headers(activities, %{"local" => local_only})
- |> render("index.json", activities: activities, for: user, as: :activity)
- end
+ cfg_key =
+ if local_only do
+ :local
+ else
+ :federated
+ end
- # GET /api/v1/timelines/tag/:tag
- def hashtag(%{assigns: %{user: user}} = conn, params) do
- local_only = truthy_param?(params["local"])
+ restrict? = Pleroma.Config.get([:restrict_unauthenticated, :timelines, cfg_key])
+ if restrict? and is_nil(user) do
+ render_error(conn, :unauthorized, "authorization required for timeline view")
+ else
+ activities =
+ params
+ |> Map.put("type", ["Create", "Announce"])
+ |> Map.put("local_only", local_only)
+ |> Map.put("blocking_user", user)
+ |> Map.put("muting_user", user)
+ |> Map.put("reply_filtering_user", user)
+ |> ActivityPub.fetch_public_activities()
+
+ conn
+ |> add_link_headers(activities, %{"local" => local_only})
+ |> render("index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
+ end
+ end
+
+ defp hashtag_fetching(params, user, local_only) do
tags =
[params["tag"], params["any"]]
|> List.flatten()
@@ -98,7 +146,7 @@ defmodule Pleroma.Web.MastodonAPI.TimelineController do
|> Map.get("none", [])
|> Enum.map(&String.downcase(&1))
- activities =
+ _activities =
params
|> Map.put("type", "Create")
|> Map.put("local_only", local_only)
@@ -109,18 +157,29 @@ defmodule Pleroma.Web.MastodonAPI.TimelineController do
|> Map.put("tag_all", tag_all)
|> Map.put("tag_reject", tag_reject)
|> ActivityPub.fetch_public_activities()
- |> Enum.reverse()
+ end
+
+ # GET /api/v1/timelines/tag/:tag
+ def hashtag(%{assigns: %{user: user}} = conn, params) do
+ params = Map.new(params, fn {key, value} -> {to_string(key), value} end)
+ local_only = params["local"]
+ activities = hashtag_fetching(params, user, local_only)
conn
|> add_link_headers(activities, %{"local" => local_only})
- |> render("index.json", activities: activities, for: user, as: :activity)
+ |> render("index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
end
# GET /api/v1/timelines/list/:list_id
- def list(%{assigns: %{user: user}} = conn, %{"list_id" => id} = params) do
+ def list(%{assigns: %{user: user}} = conn, %{list_id: id} = params) do
with %Pleroma.List{title: _title, following: following} <- Pleroma.List.get(id, user) do
params =
params
+ |> Map.new(fn {key, value} -> {to_string(key), value} end)
|> Map.put("type", "Create")
|> Map.put("blocking_user", user)
|> Map.put("user", user)
@@ -128,13 +187,20 @@ defmodule Pleroma.Web.MastodonAPI.TimelineController do
# we must filter the following list for the user to avoid leaking statuses the user
# does not actually have permission to see (for more info, peruse security issue #270).
+
+ user_following = User.following(user)
+
activities =
following
- |> Enum.filter(fn x -> x in user.following end)
+ |> Enum.filter(fn x -> x in user_following end)
|> ActivityPub.fetch_activities_bounded(following, params)
|> Enum.reverse()
- render(conn, "index.json", activities: activities, for: user, as: :activity)
+ render(conn, "index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
else
_e -> render_error(conn, :forbidden, "Error.")
end
diff --git a/lib/pleroma/web/mastodon_api/mastodon_api.ex b/lib/pleroma/web/mastodon_api/mastodon_api.ex
index d875a5788..70da64a7a 100644
--- a/lib/pleroma/web/mastodon_api/mastodon_api.ex
+++ b/lib/pleroma/web/mastodon_api/mastodon_api.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.MastodonAPI do
@@ -24,19 +24,16 @@ defmodule Pleroma.Web.MastodonAPI.MastodonAPI do
with {:ok, follower, _followed, _} <- result do
options = cast_params(params)
-
- case reblogs_visibility(options[:reblogs], result) do
- {:ok, follower} -> {:ok, follower}
- _ -> {:ok, follower}
- end
+ set_reblogs_visibility(options[:reblogs], result)
+ {:ok, follower}
end
end
- defp reblogs_visibility(false, {:ok, follower, followed, _}) do
+ defp set_reblogs_visibility(false, {:ok, follower, followed, _}) do
CommonAPI.hide_reblogs(follower, followed)
end
- defp reblogs_visibility(_, {:ok, follower, followed, _}) do
+ defp set_reblogs_visibility(_, {:ok, follower, followed, _}) do
CommonAPI.show_reblogs(follower, followed)
end
@@ -58,7 +55,9 @@ defmodule Pleroma.Web.MastodonAPI.MastodonAPI do
user
|> Notification.for_user_query(options)
+ |> restrict(:include_types, options)
|> restrict(:exclude_types, options)
+ |> restrict(:account_ap_id, options)
|> Pagination.fetch_paginated(params)
end
@@ -71,24 +70,38 @@ defmodule Pleroma.Web.MastodonAPI.MastodonAPI do
defp cast_params(params) do
param_types = %{
exclude_types: {:array, :string},
+ include_types: {:array, :string},
exclude_visibilities: {:array, :string},
reblogs: :boolean,
- with_muted: :boolean
+ with_muted: :boolean,
+ account_ap_id: :string
}
changeset = cast({%{}, param_types}, params, Map.keys(param_types))
changeset.changes
end
+ defp restrict(query, :include_types, %{include_types: mastodon_types = [_ | _]}) do
+ ap_types = convert_and_filter_mastodon_types(mastodon_types)
+
+ where(query, [q, a], fragment("? @> ARRAY[?->>'type']::varchar[]", ^ap_types, a.data))
+ end
+
defp restrict(query, :exclude_types, %{exclude_types: mastodon_types = [_ | _]}) do
- ap_types =
- mastodon_types
- |> Enum.map(&Activity.from_mastodon_notification_type/1)
- |> Enum.filter(& &1)
+ ap_types = convert_and_filter_mastodon_types(mastodon_types)
- query
- |> where([q, a], not fragment("? @> ARRAY[?->>'type']::varchar[]", ^ap_types, a.data))
+ where(query, [q, a], not fragment("? @> ARRAY[?->>'type']::varchar[]", ^ap_types, a.data))
+ end
+
+ defp restrict(query, :account_ap_id, %{account_ap_id: account_ap_id}) do
+ where(query, [n, a], a.actor == ^account_ap_id)
end
defp restrict(query, _, _), do: query
+
+ defp convert_and_filter_mastodon_types(types) do
+ types
+ |> Enum.map(&Activity.from_mastodon_notification_type/1)
+ |> Enum.filter(& &1)
+ end
end
diff --git a/lib/pleroma/web/mastodon_api/views/account_view.ex b/lib/pleroma/web/mastodon_api/views/account_view.ex
index 2d4976891..45fffaad2 100644
--- a/lib/pleroma/web/mastodon_api/views/account_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/account_view.ex
@@ -1,26 +1,45 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.AccountView do
use Pleroma.Web, :view
- alias Pleroma.HTML
+ alias Pleroma.FollowingRelationship
alias Pleroma.User
+ alias Pleroma.UserRelationship
alias Pleroma.Web.CommonAPI.Utils
alias Pleroma.Web.MastodonAPI.AccountView
alias Pleroma.Web.MediaProxy
def render("index.json", %{users: users} = opts) do
+ reading_user = opts[:for]
+
+ relationships_opt =
+ cond do
+ Map.has_key?(opts, :relationships) ->
+ opts[:relationships]
+
+ is_nil(reading_user) || !opts[:embed_relationships] ->
+ UserRelationship.view_relationships_option(nil, [])
+
+ true ->
+ UserRelationship.view_relationships_option(reading_user, users)
+ end
+
+ opts = Map.put(opts, :relationships, relationships_opt)
+
users
|> render_many(AccountView, "show.json", opts)
|> Enum.filter(&Enum.any?/1)
end
def render("show.json", %{user: user} = opts) do
- if User.visible_for?(user, opts[:for]),
- do: do_render("show.json", opts),
- else: %{}
+ if User.visible_for?(user, opts[:for]) do
+ do_render("show.json", opts)
+ else
+ %{}
+ end
end
def render("mention.json", %{user: user}) do
@@ -28,7 +47,7 @@ defmodule Pleroma.Web.MastodonAPI.AccountView do
id: to_string(user.id),
acct: user.nickname,
username: username_from_nickname(user.nickname),
- url: User.profile_url(user)
+ url: user.uri || user.ap_id
}
end
@@ -36,140 +55,219 @@ defmodule Pleroma.Web.MastodonAPI.AccountView do
%{}
end
- def render("relationship.json", %{user: %User{} = user, target: %User{} = target}) do
- follow_state = User.get_cached_follow_state(user, target)
+ def render(
+ "relationship.json",
+ %{user: %User{} = reading_user, target: %User{} = target} = opts
+ ) do
+ user_relationships = get_in(opts, [:relationships, :user_relationships])
+ following_relationships = get_in(opts, [:relationships, :following_relationships])
+
+ follow_state =
+ if following_relationships do
+ user_to_target_following_relation =
+ FollowingRelationship.find(following_relationships, reading_user, target)
- requested =
- if follow_state && !User.following?(user, target) do
- follow_state == "pending"
+ User.get_follow_state(reading_user, target, user_to_target_following_relation)
else
- false
+ User.get_follow_state(reading_user, target)
end
+ followed_by =
+ if following_relationships do
+ case FollowingRelationship.find(following_relationships, target, reading_user) do
+ %{state: :follow_accept} -> true
+ _ -> false
+ end
+ else
+ User.following?(target, reading_user)
+ end
+
+ # NOTE: adjust UserRelationship.view_relationships_option/2 on new relation-related flags
%{
id: to_string(target.id),
- following: User.following?(user, target),
- followed_by: User.following?(target, user),
- blocking: User.blocks_ap_id?(user, target),
- blocked_by: User.blocks_ap_id?(target, user),
- muting: User.mutes?(user, target),
- muting_notifications: User.muted_notifications?(user, target),
- subscribing: User.subscribed_to?(user, target),
- requested: requested,
- domain_blocking: User.blocks_domain?(user, target),
- showing_reblogs: User.showing_reblogs?(user, target),
+ following: follow_state == :follow_accept,
+ followed_by: followed_by,
+ blocking:
+ UserRelationship.exists?(
+ user_relationships,
+ :block,
+ reading_user,
+ target,
+ &User.blocks_user?(&1, &2)
+ ),
+ blocked_by:
+ UserRelationship.exists?(
+ user_relationships,
+ :block,
+ target,
+ reading_user,
+ &User.blocks_user?(&1, &2)
+ ),
+ muting:
+ UserRelationship.exists?(
+ user_relationships,
+ :mute,
+ reading_user,
+ target,
+ &User.mutes?(&1, &2)
+ ),
+ muting_notifications:
+ UserRelationship.exists?(
+ user_relationships,
+ :notification_mute,
+ reading_user,
+ target,
+ &User.muted_notifications?(&1, &2)
+ ),
+ subscribing:
+ UserRelationship.exists?(
+ user_relationships,
+ :inverse_subscription,
+ target,
+ reading_user,
+ &User.subscribed_to?(&2, &1)
+ ),
+ requested: follow_state == :follow_pending,
+ domain_blocking: User.blocks_domain?(reading_user, target),
+ showing_reblogs:
+ not UserRelationship.exists?(
+ user_relationships,
+ :reblog_mute,
+ reading_user,
+ target,
+ &User.muting_reblogs?(&1, &2)
+ ),
endorsed: false
}
end
- def render("relationships.json", %{user: user, targets: targets}) do
- render_many(targets, AccountView, "relationship.json", user: user, as: :target)
+ def render("relationships.json", %{user: user, targets: targets} = opts) do
+ relationships_opt =
+ cond do
+ Map.has_key?(opts, :relationships) ->
+ opts[:relationships]
+
+ is_nil(user) ->
+ UserRelationship.view_relationships_option(nil, [])
+
+ true ->
+ UserRelationship.view_relationships_option(user, targets)
+ end
+
+ render_opts = %{as: :target, user: user, relationships: relationships_opt}
+ render_many(targets, AccountView, "relationship.json", render_opts)
end
defp do_render("show.json", %{user: user} = opts) do
- display_name = HTML.strip_tags(user.name || user.nickname)
+ user = User.sanitize_html(user, User.html_filter_policy(opts[:for]))
+ display_name = user.name || user.nickname
image = User.avatar_url(user) |> MediaProxy.url()
header = User.banner_url(user) |> MediaProxy.url()
- user_info = User.get_cached_user_info(user)
following_count =
- if !user.info.hide_follows_count or !user.info.hide_follows or opts[:for] == user do
- user_info.following_count
+ if !user.hide_follows_count or !user.hide_follows or opts[:for] == user do
+ user.following_count || 0
else
0
end
followers_count =
- if !user.info.hide_followers_count or !user.info.hide_followers or opts[:for] == user do
- user_info.follower_count
+ if !user.hide_followers_count or !user.hide_followers or opts[:for] == user do
+ user.follower_count || 0
else
0
end
- bot = (user.info.source_data["type"] || "Person") in ["Application", "Service"]
+ bot = user.actor_type in ["Application", "Service"]
emojis =
- (user.info.source_data["tag"] || [])
- |> Enum.filter(fn %{"type" => t} -> t == "Emoji" end)
- |> Enum.map(fn %{"icon" => %{"url" => url}, "name" => name} ->
+ Enum.map(user.emoji, fn {shortcode, url} ->
%{
- "shortcode" => String.trim(name, ":"),
- "url" => MediaProxy.url(url),
- "static_url" => MediaProxy.url(url),
+ "shortcode" => shortcode,
+ "url" => url,
+ "static_url" => url,
"visible_in_picker" => false
}
end)
- fields =
- user.info
- |> User.Info.fields()
- |> Enum.map(fn %{"name" => name, "value" => value} ->
- %{
- "name" => Pleroma.HTML.strip_tags(name),
- "value" => Pleroma.HTML.filter_tags(value, Pleroma.HTML.Scrubber.LinksOnly)
- }
- end)
-
- raw_fields = Map.get(user.info, :raw_fields, [])
-
- bio = HTML.filter_tags(user.bio, User.html_filter_policy(opts[:for]))
- relationship = render("relationship.json", %{user: opts[:for], target: user})
-
- discoverable = user.info.discoverable
+ relationship =
+ if opts[:embed_relationships] do
+ render("relationship.json", %{
+ user: opts[:for],
+ target: user,
+ relationships: opts[:relationships]
+ })
+ else
+ %{}
+ end
%{
id: to_string(user.id),
username: username_from_nickname(user.nickname),
acct: user.nickname,
display_name: display_name,
- locked: user_info.locked,
+ locked: user.locked,
created_at: Utils.to_masto_date(user.inserted_at),
followers_count: followers_count,
following_count: following_count,
- statuses_count: user_info.note_count,
- note: bio || "",
- url: User.profile_url(user),
+ statuses_count: user.note_count,
+ note: user.bio || "",
+ url: user.uri || user.ap_id,
avatar: image,
avatar_static: image,
header: header,
header_static: header,
emojis: emojis,
- fields: fields,
+ fields: user.fields,
bot: bot,
source: %{
- note: HTML.strip_tags((user.bio || "") |> String.replace("<br>", "\n")),
+ note: prepare_user_bio(user),
sensitive: false,
- fields: raw_fields,
+ fields: user.raw_fields,
pleroma: %{
- discoverable: discoverable
+ discoverable: user.discoverable,
+ actor_type: user.actor_type
}
},
# Pleroma extension
pleroma: %{
- confirmation_pending: user_info.confirmation_pending,
+ confirmation_pending: user.confirmation_pending,
tags: user.tags,
- hide_followers_count: user.info.hide_followers_count,
- hide_follows_count: user.info.hide_follows_count,
- hide_followers: user.info.hide_followers,
- hide_follows: user.info.hide_follows,
- hide_favorites: user.info.hide_favorites,
+ hide_followers_count: user.hide_followers_count,
+ hide_follows_count: user.hide_follows_count,
+ hide_followers: user.hide_followers,
+ hide_follows: user.hide_follows,
+ hide_favorites: user.hide_favorites,
relationship: relationship,
- skip_thread_containment: user.info.skip_thread_containment,
- background_image: image_url(user.info.background) |> MediaProxy.url()
+ skip_thread_containment: user.skip_thread_containment,
+ background_image: image_url(user.background) |> MediaProxy.url()
}
}
|> maybe_put_role(user, opts[:for])
- |> maybe_put_settings(user, opts[:for], user_info)
+ |> maybe_put_settings(user, opts[:for], opts)
|> maybe_put_notification_settings(user, opts[:for])
|> maybe_put_settings_store(user, opts[:for], opts)
|> maybe_put_chat_token(user, opts[:for], opts)
|> maybe_put_activation_status(user, opts[:for])
|> maybe_put_follow_requests_count(user, opts[:for])
+ |> maybe_put_allow_following_move(user, opts[:for])
|> maybe_put_unread_conversation_count(user, opts[:for])
+ |> maybe_put_unread_notification_count(user, opts[:for])
end
+ defp prepare_user_bio(%User{bio: ""}), do: ""
+
+ defp prepare_user_bio(%User{bio: bio}) when is_binary(bio) do
+ bio
+ |> String.replace(~r(<br */?>), "\n")
+ |> Pleroma.HTML.strip_tags()
+ |> HtmlEntities.decode()
+ end
+
+ defp prepare_user_bio(_), do: ""
+
defp username_from_nickname(string) when is_binary(string) do
hd(String.split(string, "@"))
end
@@ -195,21 +293,21 @@ defmodule Pleroma.Web.MastodonAPI.AccountView do
data,
%User{id: user_id} = user,
%User{id: user_id},
- user_info
+ _opts
) do
data
- |> Kernel.put_in([:source, :privacy], user_info.default_scope)
- |> Kernel.put_in([:source, :pleroma, :show_role], user.info.show_role)
- |> Kernel.put_in([:source, :pleroma, :no_rich_text], user.info.no_rich_text)
+ |> Kernel.put_in([:source, :privacy], user.default_scope)
+ |> Kernel.put_in([:source, :pleroma, :show_role], user.show_role)
+ |> Kernel.put_in([:source, :pleroma, :no_rich_text], user.no_rich_text)
end
defp maybe_put_settings(data, _, _, _), do: data
- defp maybe_put_settings_store(data, %User{info: info, id: id}, %User{id: id}, %{
+ defp maybe_put_settings_store(data, %User{} = user, %User{}, %{
with_pleroma_settings: true
}) do
data
- |> Kernel.put_in([:pleroma, :settings_store], info.pleroma_settings_store)
+ |> Kernel.put_in([:pleroma, :settings_store], user.pleroma_settings_store)
end
defp maybe_put_settings_store(data, _, _, _), do: data
@@ -223,28 +321,38 @@ defmodule Pleroma.Web.MastodonAPI.AccountView do
defp maybe_put_chat_token(data, _, _, _), do: data
- defp maybe_put_role(data, %User{info: %{show_role: true}} = user, _) do
+ defp maybe_put_role(data, %User{show_role: true} = user, _) do
data
- |> Kernel.put_in([:pleroma, :is_admin], user.info.is_admin)
- |> Kernel.put_in([:pleroma, :is_moderator], user.info.is_moderator)
+ |> Kernel.put_in([:pleroma, :is_admin], user.is_admin)
+ |> Kernel.put_in([:pleroma, :is_moderator], user.is_moderator)
end
defp maybe_put_role(data, %User{id: user_id} = user, %User{id: user_id}) do
data
- |> Kernel.put_in([:pleroma, :is_admin], user.info.is_admin)
- |> Kernel.put_in([:pleroma, :is_moderator], user.info.is_moderator)
+ |> Kernel.put_in([:pleroma, :is_admin], user.is_admin)
+ |> Kernel.put_in([:pleroma, :is_moderator], user.is_moderator)
end
defp maybe_put_role(data, _, _), do: data
defp maybe_put_notification_settings(data, %User{id: user_id} = user, %User{id: user_id}) do
- Kernel.put_in(data, [:pleroma, :notification_settings], user.info.notification_settings)
+ Kernel.put_in(
+ data,
+ [:pleroma, :notification_settings],
+ Map.from_struct(user.notification_settings)
+ )
end
defp maybe_put_notification_settings(data, _, _), do: data
- defp maybe_put_activation_status(data, user, %User{info: %{is_admin: true}}) do
- Kernel.put_in(data, [:pleroma, :deactivated], user.info.deactivated)
+ defp maybe_put_allow_following_move(data, %User{id: user_id} = user, %User{id: user_id}) do
+ Kernel.put_in(data, [:pleroma, :allow_following_move], user.allow_following_move)
+ end
+
+ defp maybe_put_allow_following_move(data, _, _), do: data
+
+ defp maybe_put_activation_status(data, user, %User{is_admin: true}) do
+ Kernel.put_in(data, [:pleroma, :deactivated], user.deactivated)
end
defp maybe_put_activation_status(data, _, _), do: data
@@ -253,12 +361,22 @@ defmodule Pleroma.Web.MastodonAPI.AccountView do
data
|> Kernel.put_in(
[:pleroma, :unread_conversation_count],
- user.info.unread_conversation_count
+ user.unread_conversation_count
)
end
defp maybe_put_unread_conversation_count(data, _, _), do: data
+ defp maybe_put_unread_notification_count(data, %User{id: user_id}, %User{id: user_id} = user) do
+ Kernel.put_in(
+ data,
+ [:pleroma, :unread_notifications_count],
+ Pleroma.Notification.unread_notifications_count(user)
+ )
+ end
+
+ defp maybe_put_unread_notification_count(data, _, _), do: data
+
defp image_url(%{"url" => [%{"href" => href} | _]}), do: href
defp image_url(_), do: nil
end
diff --git a/lib/pleroma/web/mastodon_api/views/app_view.ex b/lib/pleroma/web/mastodon_api/views/app_view.ex
index f52b693a6..36071cd25 100644
--- a/lib/pleroma/web/mastodon_api/views/app_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/app_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.AppView do
@@ -7,9 +7,20 @@ defmodule Pleroma.Web.MastodonAPI.AppView do
alias Pleroma.Web.OAuth.App
- @vapid_key :web_push_encryption
- |> Application.get_env(:vapid_details, [])
- |> Keyword.get(:public_key)
+ def render("index.json", %{apps: apps, count: count, page_size: page_size, admin: true}) do
+ %{
+ apps: render_many(apps, Pleroma.Web.MastodonAPI.AppView, "show.json", %{admin: true}),
+ count: count,
+ page_size: page_size
+ }
+ end
+
+ def render("show.json", %{admin: true, app: %App{} = app} = assigns) do
+ "show.json"
+ |> render(Map.delete(assigns, :admin))
+ |> Map.put(:trusted, app.trusted)
+ |> Map.put(:id, app.id)
+ end
def render("show.json", %{app: %App{} = app}) do
%{
@@ -32,8 +43,10 @@ defmodule Pleroma.Web.MastodonAPI.AppView do
end
defp with_vapid_key(data) do
- if @vapid_key do
- Map.put(data, "vapid_key", @vapid_key)
+ vapid_key = Application.get_env(:web_push_encryption, :vapid_details, [])[:public_key]
+
+ if vapid_key do
+ Map.put(data, "vapid_key", vapid_key)
else
data
end
diff --git a/lib/pleroma/web/mastodon_api/views/conversation_view.ex b/lib/pleroma/web/mastodon_api/views/conversation_view.ex
index e9d2735b3..2b6f84c72 100644
--- a/lib/pleroma/web/mastodon_api/views/conversation_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/conversation_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.ConversationView do
@@ -12,7 +12,10 @@ defmodule Pleroma.Web.MastodonAPI.ConversationView do
alias Pleroma.Web.MastodonAPI.StatusView
def render("participations.json", %{participations: participations, for: user}) do
- render_many(participations, __MODULE__, "participation.json", as: :participation, for: user)
+ safe_render_many(participations, __MODULE__, "participation.json", %{
+ as: :participation,
+ for: user
+ })
end
def render("participation.json", %{participation: participation, for: user}) do
@@ -34,7 +37,11 @@ defmodule Pleroma.Web.MastodonAPI.ConversationView do
id: participation.id |> to_string(),
accounts: render(AccountView, "index.json", users: users, as: :user),
unread: !participation.read,
- last_status: render(StatusView, "show.json", activity: activity, for: user)
+ last_status:
+ render(StatusView, "show.json",
+ activity: activity,
+ direct_conversation_id: participation.id
+ )
}
end
end
diff --git a/lib/pleroma/web/mastodon_api/views/custom_emoji_view.ex b/lib/pleroma/web/mastodon_api/views/custom_emoji_view.ex
index cb8688941..47a242b8e 100644
--- a/lib/pleroma/web/mastodon_api/views/custom_emoji_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/custom_emoji_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.CustomEmojiView do
diff --git a/lib/pleroma/web/mastodon_api/views/filter_view.ex b/lib/pleroma/web/mastodon_api/views/filter_view.ex
index a685bc7b6..aeff646f5 100644
--- a/lib/pleroma/web/mastodon_api/views/filter_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/filter_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.FilterView do
@@ -7,11 +7,11 @@ defmodule Pleroma.Web.MastodonAPI.FilterView do
alias Pleroma.Web.CommonAPI.Utils
alias Pleroma.Web.MastodonAPI.FilterView
- def render("filters.json", %{filters: filters} = opts) do
- render_many(filters, FilterView, "filter.json", opts)
+ def render("index.json", %{filters: filters}) do
+ render_many(filters, FilterView, "show.json")
end
- def render("filter.json", %{filter: filter}) do
+ def render("show.json", %{filter: filter}) do
expires_at =
if filter.expires_at do
Utils.to_masto_date(filter.expires_at)
diff --git a/lib/pleroma/web/mastodon_api/views/instance_view.ex b/lib/pleroma/web/mastodon_api/views/instance_view.ex
index c4866e510..a329ffc28 100644
--- a/lib/pleroma/web/mastodon_api/views/instance_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/instance_view.ex
@@ -1,14 +1,17 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.InstanceView do
use Pleroma.Web, :view
+ alias Pleroma.Config
+ alias Pleroma.Web.ActivityPub.MRF
+
@mastodon_api_level "2.7.2"
def render("show.json", _) do
- instance = Pleroma.Config.get(:instance)
+ instance = Config.get(:instance)
%{
uri: Pleroma.Web.base_url(),
@@ -29,7 +32,58 @@ defmodule Pleroma.Web.MastodonAPI.InstanceView do
upload_limit: Keyword.get(instance, :upload_limit),
avatar_upload_limit: Keyword.get(instance, :avatar_upload_limit),
background_upload_limit: Keyword.get(instance, :background_upload_limit),
- banner_upload_limit: Keyword.get(instance, :banner_upload_limit)
+ banner_upload_limit: Keyword.get(instance, :banner_upload_limit),
+ pleroma: %{
+ metadata: %{
+ features: features(),
+ federation: federation()
+ },
+ vapid_public_key: Keyword.get(Pleroma.Web.Push.vapid_config(), :public_key)
+ }
}
end
+
+ def features do
+ [
+ "pleroma_api",
+ "mastodon_api",
+ "mastodon_api_streaming",
+ "polls",
+ "pleroma_explicit_addressing",
+ "shareable_emoji_packs",
+ "multifetch",
+ "pleroma:api/v1/notifications:include_types_filter",
+ if Config.get([:media_proxy, :enabled]) do
+ "media_proxy"
+ end,
+ if Config.get([:gopher, :enabled]) do
+ "gopher"
+ end,
+ if Config.get([:chat, :enabled]) do
+ "chat"
+ end,
+ if Config.get([:instance, :allow_relay]) do
+ "relay"
+ end,
+ if Config.get([:instance, :safe_dm_mentions]) do
+ "safe_dm_mentions"
+ end,
+ "pleroma_emoji_reactions"
+ ]
+ |> Enum.filter(& &1)
+ end
+
+ def federation do
+ quarantined = Config.get([:instance, :quarantined_instances], [])
+
+ if Config.get([:instance, :mrf_transparency]) do
+ {:ok, data} = MRF.describe()
+
+ data
+ |> Map.merge(%{quarantined_instances: quarantined})
+ else
+ %{}
+ end
+ |> Map.put(:enabled, Config.get([:instance, :federating]))
+ end
end
diff --git a/lib/pleroma/web/mastodon_api/views/list_view.ex b/lib/pleroma/web/mastodon_api/views/list_view.ex
index bfda6f5b3..580596b64 100644
--- a/lib/pleroma/web/mastodon_api/views/list_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/list_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.ListView do
diff --git a/lib/pleroma/web/mastodon_api/views/marker_view.ex b/lib/pleroma/web/mastodon_api/views/marker_view.ex
index 38fbeed5f..21d535d54 100644
--- a/lib/pleroma/web/mastodon_api/views/marker_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/marker_view.ex
@@ -1,17 +1,21 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.MarkerView do
use Pleroma.Web, :view
def render("markers.json", %{markers: markers}) do
- Enum.reduce(markers, %{}, fn m, acc ->
- Map.put_new(acc, m.timeline, %{
- last_read_id: m.last_read_id,
- version: m.lock_version,
- updated_at: NaiveDateTime.to_iso8601(m.updated_at)
- })
+ Map.new(markers, fn m ->
+ {m.timeline,
+ %{
+ last_read_id: m.last_read_id,
+ version: m.lock_version,
+ updated_at: NaiveDateTime.to_iso8601(m.updated_at),
+ pleroma: %{
+ unread_count: m.unread_count
+ }
+ }}
end)
end
end
diff --git a/lib/pleroma/web/mastodon_api/views/notification_view.ex b/lib/pleroma/web/mastodon_api/views/notification_view.ex
index 5e3dbe728..c46ddcf55 100644
--- a/lib/pleroma/web/mastodon_api/views/notification_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/notification_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.NotificationView do
@@ -8,24 +8,87 @@ defmodule Pleroma.Web.MastodonAPI.NotificationView do
alias Pleroma.Activity
alias Pleroma.Notification
alias Pleroma.User
+ alias Pleroma.UserRelationship
alias Pleroma.Web.CommonAPI
alias Pleroma.Web.MastodonAPI.AccountView
alias Pleroma.Web.MastodonAPI.NotificationView
alias Pleroma.Web.MastodonAPI.StatusView
- def render("index.json", %{notifications: notifications, for: user}) do
- safe_render_many(notifications, NotificationView, "show.json", %{for: user})
+ def render("index.json", %{notifications: notifications, for: reading_user} = opts) do
+ activities = Enum.map(notifications, & &1.activity)
+
+ parent_activities =
+ activities
+ |> Enum.filter(
+ &(Activity.mastodon_notification_type(&1) in [
+ "favourite",
+ "reblog",
+ "pleroma:emoji_reaction"
+ ])
+ )
+ |> Enum.map(& &1.data["object"])
+ |> Activity.create_by_object_ap_id()
+ |> Activity.with_preloaded_object(:left)
+ |> Pleroma.Repo.all()
+
+ relationships_opt =
+ cond do
+ Map.has_key?(opts, :relationships) ->
+ opts[:relationships]
+
+ is_nil(reading_user) ->
+ UserRelationship.view_relationships_option(nil, [])
+
+ true ->
+ move_activities_targets =
+ activities
+ |> Enum.filter(&(Activity.mastodon_notification_type(&1) == "move"))
+ |> Enum.map(&User.get_cached_by_ap_id(&1.data["target"]))
+
+ actors =
+ activities
+ |> Enum.map(fn a -> User.get_cached_by_ap_id(a.data["actor"]) end)
+ |> Enum.filter(& &1)
+ |> Kernel.++(move_activities_targets)
+
+ UserRelationship.view_relationships_option(reading_user, actors, subset: :source_mutes)
+ end
+
+ opts =
+ opts
+ |> Map.put(:parent_activities, parent_activities)
+ |> Map.put(:relationships, relationships_opt)
+
+ safe_render_many(notifications, NotificationView, "show.json", opts)
end
- def render("show.json", %{
- notification: %Notification{activity: activity} = notification,
- for: user
- }) do
+ def render(
+ "show.json",
+ %{
+ notification: %Notification{activity: activity} = notification,
+ for: reading_user
+ } = opts
+ ) do
actor = User.get_cached_by_ap_id(activity.data["actor"])
- parent_activity = Activity.get_create_by_object_ap_id(activity.data["object"])
+
+ parent_activity_fn = fn ->
+ if opts[:parent_activities] do
+ Activity.Queries.find_by_object_ap_id(opts[:parent_activities], activity.data["object"])
+ else
+ Activity.get_create_by_object_ap_id(activity.data["object"])
+ end
+ end
+
mastodon_type = Activity.mastodon_notification_type(activity)
- with %{id: _} = account <- AccountView.render("show.json", %{user: actor, for: user}) do
+ # Note: :relationships contain user mutes (needed for :muted flag in :status)
+ status_render_opts = %{relationships: opts[:relationships]}
+
+ with %{id: _} = account <-
+ AccountView.render(
+ "show.json",
+ %{user: actor, for: reading_user}
+ ) do
response = %{
id: to_string(notification.id),
type: mastodon_type,
@@ -38,24 +101,23 @@ defmodule Pleroma.Web.MastodonAPI.NotificationView do
case mastodon_type do
"mention" ->
- response
- |> Map.merge(%{
- status: StatusView.render("show.json", %{activity: activity, for: user})
- })
+ put_status(response, activity, reading_user, status_render_opts)
"favourite" ->
- response
- |> Map.merge(%{
- status: StatusView.render("show.json", %{activity: parent_activity, for: user})
- })
+ put_status(response, parent_activity_fn.(), reading_user, status_render_opts)
"reblog" ->
+ put_status(response, parent_activity_fn.(), reading_user, status_render_opts)
+
+ "move" ->
+ put_target(response, activity, reading_user, %{})
+
+ "pleroma:emoji_reaction" ->
response
- |> Map.merge(%{
- status: StatusView.render("show.json", %{activity: parent_activity, for: user})
- })
+ |> put_status(parent_activity_fn.(), reading_user, status_render_opts)
+ |> put_emoji(activity)
- "follow" ->
+ type when type in ["follow", "follow_request"] ->
response
_ ->
@@ -65,4 +127,23 @@ defmodule Pleroma.Web.MastodonAPI.NotificationView do
_ -> nil
end
end
+
+ defp put_emoji(response, activity) do
+ Map.put(response, :emoji, activity.data["content"])
+ end
+
+ defp put_status(response, activity, reading_user, opts) do
+ status_render_opts = Map.merge(opts, %{activity: activity, for: reading_user})
+ status_render = StatusView.render("show.json", status_render_opts)
+
+ Map.put(response, :status, status_render)
+ end
+
+ defp put_target(response, activity, reading_user, opts) do
+ target_user = User.get_cached_by_ap_id(activity.data["target"])
+ target_render_opts = Map.merge(opts, %{user: target_user, for: reading_user})
+ target_render = AccountView.render("show.json", target_render_opts)
+
+ Map.put(response, :target, target_render)
+ end
end
diff --git a/lib/pleroma/web/mastodon_api/views/poll_view.ex b/lib/pleroma/web/mastodon_api/views/poll_view.ex
index 753039da3..59a5deb28 100644
--- a/lib/pleroma/web/mastodon_api/views/poll_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/poll_view.ex
@@ -1,11 +1,10 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.PollView do
use Pleroma.Web, :view
- alias Pleroma.HTML
alias Pleroma.Web.CommonAPI.Utils
def render("show.json", %{object: object, multiple: multiple, options: options} = params) do
@@ -20,6 +19,7 @@ defmodule Pleroma.Web.MastodonAPI.PollView do
expired: expired,
multiple: multiple,
votes_count: votes_count,
+ voters_count: (multiple || nil) && voters_count(object),
options: options,
voted: voted?(params),
emojis: Pleroma.Web.MastodonAPI.StatusView.build_emojis(object.data["emoji"])
@@ -57,12 +57,18 @@ defmodule Pleroma.Web.MastodonAPI.PollView do
current_count = option["replies"]["totalItems"] || 0
{%{
- title: HTML.strip_tags(name),
+ title: name,
votes_count: current_count
}, current_count + count}
end)
end
+ defp voters_count(%{data: %{"voters" => [_ | _] = voters}}) do
+ length(voters)
+ end
+
+ defp voters_count(_), do: 0
+
defp voted?(%{object: object} = opts) do
if opts[:for] do
existing_votes = Pleroma.Web.ActivityPub.Utils.get_existing_votes(opts[:for].ap_id, object)
diff --git a/lib/pleroma/web/mastodon_api/views/report_view.ex b/lib/pleroma/web/mastodon_api/views/report_view.ex
index 9da2dd740..98cb581ef 100644
--- a/lib/pleroma/web/mastodon_api/views/report_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/report_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.ReportView do
diff --git a/lib/pleroma/web/mastodon_api/views/scheduled_activity_view.ex b/lib/pleroma/web/mastodon_api/views/scheduled_activity_view.ex
index fc042a276..458f6bc78 100644
--- a/lib/pleroma/web/mastodon_api/views/scheduled_activity_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/scheduled_activity_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.ScheduledActivityView do
diff --git a/lib/pleroma/web/mastodon_api/views/status_view.ex b/lib/pleroma/web/mastodon_api/views/status_view.ex
index 9b8dd3086..05a26017a 100644
--- a/lib/pleroma/web/mastodon_api/views/status_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/status_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.StatusView do
@@ -9,12 +9,11 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
alias Pleroma.Activity
alias Pleroma.ActivityExpiration
- alias Pleroma.Conversation
- alias Pleroma.Conversation.Participation
alias Pleroma.HTML
alias Pleroma.Object
alias Pleroma.Repo
alias Pleroma.User
+ alias Pleroma.UserRelationship
alias Pleroma.Web.CommonAPI
alias Pleroma.Web.CommonAPI.Utils
alias Pleroma.Web.MastodonAPI.AccountView
@@ -46,7 +45,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
end)
end
- defp get_user(ap_id) do
+ def get_user(ap_id, fake_record_fallback \\ true) do
cond do
user = User.get_cached_by_ap_id(ap_id) ->
user
@@ -54,8 +53,12 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
user = User.get_by_guessed_nickname(ap_id) ->
user
- true ->
+ fake_record_fallback ->
+ # TODO: refactor (fake records is never a good idea)
User.error_user(ap_id)
+
+ true ->
+ nil
end
end
@@ -73,10 +76,47 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
end
def render("index.json", opts) do
- replied_to_activities = get_replied_to_activities(opts.activities)
- opts = Map.put(opts, :replied_to_activities, replied_to_activities)
+ reading_user = opts[:for]
+
+ # To do: check AdminAPIControllerTest on the reasons behind nil activities in the list
+ activities = Enum.filter(opts.activities, & &1)
+ replied_to_activities = get_replied_to_activities(activities)
+
+ parent_activities =
+ activities
+ |> Enum.filter(&(&1.data["type"] == "Announce" && &1.data["object"]))
+ |> Enum.map(&Object.normalize(&1).data["id"])
+ |> Activity.create_by_object_ap_id()
+ |> Activity.with_preloaded_object(:left)
+ |> Activity.with_preloaded_bookmark(reading_user)
+ |> Activity.with_set_thread_muted_field(reading_user)
+ |> Repo.all()
+
+ relationships_opt =
+ cond do
+ Map.has_key?(opts, :relationships) ->
+ opts[:relationships]
+
+ is_nil(reading_user) ->
+ UserRelationship.view_relationships_option(nil, [])
+
+ true ->
+ # Note: unresolved users are filtered out
+ actors =
+ (activities ++ parent_activities)
+ |> Enum.map(&get_user(&1.data["actor"], false))
+ |> Enum.filter(& &1)
- safe_render_many(opts.activities, StatusView, "show.json", opts)
+ UserRelationship.view_relationships_option(reading_user, actors, subset: :source_mutes)
+ end
+
+ opts =
+ opts
+ |> Map.put(:replied_to_activities, replied_to_activities)
+ |> Map.put(:parent_activities, parent_activities)
+ |> Map.put(:relationships, relationships_opt)
+
+ safe_render_many(activities, StatusView, "show.json", opts)
end
def render(
@@ -87,17 +127,25 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
created_at = Utils.to_masto_date(activity.data["published"])
activity_object = Object.normalize(activity)
- reblogged_activity =
- Activity.create_by_object_ap_id(activity_object.data["id"])
- |> Activity.with_preloaded_bookmark(opts[:for])
- |> Activity.with_set_thread_muted_field(opts[:for])
- |> Repo.one()
+ reblogged_parent_activity =
+ if opts[:parent_activities] do
+ Activity.Queries.find_by_object_ap_id(
+ opts[:parent_activities],
+ activity_object.data["id"]
+ )
+ else
+ Activity.create_by_object_ap_id(activity_object.data["id"])
+ |> Activity.with_preloaded_bookmark(opts[:for])
+ |> Activity.with_set_thread_muted_field(opts[:for])
+ |> Repo.one()
+ end
- reblogged = render("show.json", Map.put(opts, :activity, reblogged_activity))
+ reblog_rendering_opts = Map.put(opts, :activity, reblogged_parent_activity)
+ reblogged = render("show.json", reblog_rendering_opts)
favorited = opts[:for] && opts[:for].ap_id in (activity_object.data["likes"] || [])
- bookmarked = Activity.get_bookmark(reblogged_activity, opts[:for]) != nil
+ bookmarked = Activity.get_bookmark(reblogged_parent_activity, opts[:for]) != nil
mentions =
activity.recipients
@@ -109,7 +157,11 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
id: to_string(activity.id),
uri: activity_object.data["id"],
url: activity_object.data["id"],
- account: AccountView.render("show.json", %{user: user, for: opts[:for]}),
+ account:
+ AccountView.render("show.json", %{
+ user: user,
+ for: opts[:for]
+ }),
in_reply_to_id: nil,
in_reply_to_account_id: nil,
reblog: reblogged,
@@ -118,7 +170,7 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
reblogs_count: 0,
replies_count: 0,
favourites_count: 0,
- reblogged: reblogged?(reblogged_activity, opts[:for]),
+ reblogged: reblogged?(reblogged_parent_activity, opts[:for]),
favourited: present?(favorited),
bookmarked: present?(bookmarked),
muted: false,
@@ -177,15 +229,18 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
expires_at =
with true <- client_posted_this_activity,
- expiration when not is_nil(expiration) <-
+ %ActivityExpiration{scheduled_at: scheduled_at} <-
ActivityExpiration.get_by_activity_id(activity.id) do
- expiration.scheduled_at
+ scheduled_at
+ else
+ _ -> nil
end
thread_muted? =
- case activity.thread_muted? do
- thread_muted? when is_boolean(thread_muted?) -> thread_muted?
- nil -> (opts[:for] && CommonAPI.thread_muted?(opts[:for], activity)) || false
+ cond do
+ is_nil(opts[:for]) -> false
+ is_boolean(activity.thread_muted?) -> activity.thread_muted?
+ true -> CommonAPI.thread_muted?(opts[:for], activity)
end
attachment_data = object.data["attachment"] || []
@@ -218,21 +273,6 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
summary = object.data["summary"] || ""
- summary_html =
- summary
- |> HTML.get_cached_scrubbed_html_for_activity(
- User.html_filter_policy(opts[:for]),
- activity,
- "mastoapi:summary"
- )
-
- summary_plaintext =
- summary
- |> HTML.get_cached_stripped_html_for_activity(
- activity,
- "mastoapi:summary"
- )
-
card = render("card.json", Pleroma.Web.RichMedia.Helpers.fetch_data_for_activity(activity))
url =
@@ -243,23 +283,51 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
end
direct_conversation_id =
- with {_, true} <- {:include_id, opts[:with_direct_conversation_id]},
- {_, %User{} = for_user} <- {:for_user, opts[:for]},
- %{data: %{"context" => context}} when is_binary(context) <- activity,
- %Conversation{} = conversation <- Conversation.get_for_ap_id(context),
- %Participation{id: participation_id} <-
- Participation.for_user_and_conversation(for_user, conversation) do
- participation_id
+ with {_, nil} <- {:direct_conversation_id, opts[:direct_conversation_id]},
+ {_, true} <- {:include_id, opts[:with_direct_conversation_id]},
+ {_, %User{} = for_user} <- {:for_user, opts[:for]} do
+ Activity.direct_conversation_id(activity, for_user)
else
+ {:direct_conversation_id, participation_id} when is_integer(participation_id) ->
+ participation_id
+
_e ->
nil
end
+ emoji_reactions =
+ with %{data: %{"reactions" => emoji_reactions}} <- object do
+ Enum.map(emoji_reactions, fn [emoji, users] ->
+ %{
+ name: emoji,
+ count: length(users),
+ me: !!(opts[:for] && opts[:for].ap_id in users)
+ }
+ end)
+ else
+ _ -> []
+ end
+
+ # Status muted state (would do 1 request per status unless user mutes are preloaded)
+ muted =
+ thread_muted? ||
+ UserRelationship.exists?(
+ get_in(opts, [:relationships, :user_relationships]),
+ :mute,
+ opts[:for],
+ user,
+ fn for_user, user -> User.mutes?(for_user, user) end
+ )
+
%{
id: to_string(activity.id),
uri: object.data["id"],
url: url,
- account: AccountView.render("show.json", %{user: user, for: opts[:for]}),
+ account:
+ AccountView.render("show.json", %{
+ user: user,
+ for: opts[:for]
+ }),
in_reply_to_id: reply_to && to_string(reply_to.id),
in_reply_to_account_id: reply_to_user && to_string(reply_to_user.id),
reblog: nil,
@@ -272,10 +340,10 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
reblogged: reblogged?(activity, opts[:for]),
favourited: present?(favorited),
bookmarked: present?(bookmarked),
- muted: thread_muted? || User.mutes?(opts[:for], user),
+ muted: muted,
pinned: pinned?(activity, user),
sensitive: sensitive,
- spoiler_text: summary_html,
+ spoiler_text: summary,
visibility: get_visibility(object),
media_attachments: attachments,
poll: render(PollView, "show.json", object: object, for: opts[:for]),
@@ -292,10 +360,11 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
conversation_id: get_context_id(activity),
in_reply_to_account_acct: reply_to_user && reply_to_user.nickname,
content: %{"text/plain" => content_plaintext},
- spoiler_text: %{"text/plain" => summary_plaintext},
+ spoiler_text: %{"text/plain" => summary},
expires_at: expires_at,
direct_conversation_id: direct_conversation_id,
- thread_muted: thread_muted?
+ thread_muted: thread_muted?,
+ emoji_reactions: emoji_reactions
}
}
end
@@ -324,11 +393,9 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
nil
end
- site_name = rich_media[:site_name] || page_url_data.host
-
%{
type: "link",
- provider_name: site_name,
+ provider_name: page_url_data.host,
provider_url: page_url_data.scheme <> "://" <> page_url_data.host,
url: page_url,
image: image_url |> MediaProxy.url(),
@@ -423,7 +490,8 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
end
end
- def render_content(%{data: %{"type" => "Video"}} = object) do
+ def render_content(%{data: %{"type" => object_type}} = object)
+ when object_type in ["Video", "Event", "Audio"] do
with name when not is_nil(name) and name != "" <- object.data["name"] do
"<p><a href=\"#{object.data["id"]}\">#{name}</a></p>#{object.data["content"]}"
else
@@ -455,11 +523,9 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
"""
@spec build_tags(list(any())) :: list(map())
def build_tags(object_tags) when is_list(object_tags) do
- object_tags = for tag when is_binary(tag) <- object_tags, do: tag
-
- Enum.reduce(object_tags, [], fn tag, tags ->
- tags ++ [%{name: tag, url: "/tag/#{URI.encode(tag)}"}]
- end)
+ object_tags
+ |> Enum.filter(&is_binary/1)
+ |> Enum.map(&%{name: &1, url: "/tag/#{URI.encode(&1)}"})
end
def build_tags(_), do: []
@@ -498,6 +564,6 @@ defmodule Pleroma.Web.MastodonAPI.StatusView do
defp present?(false), do: false
defp present?(_), do: true
- defp pinned?(%Activity{id: id}, %User{info: %{pinned_activities: pinned_activities}}),
+ defp pinned?(%Activity{id: id}, %User{pinned_activities: pinned_activities}),
do: id in pinned_activities
end
diff --git a/lib/pleroma/web/mastodon_api/views/push_subscription_view.ex b/lib/pleroma/web/mastodon_api/views/subscription_view.ex
index 021489711..7c67cc924 100644
--- a/lib/pleroma/web/mastodon_api/views/push_subscription_view.ex
+++ b/lib/pleroma/web/mastodon_api/views/subscription_view.ex
@@ -1,12 +1,12 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
-defmodule Pleroma.Web.MastodonAPI.PushSubscriptionView do
+defmodule Pleroma.Web.MastodonAPI.SubscriptionView do
use Pleroma.Web, :view
alias Pleroma.Web.Push
- def render("push_subscription.json", %{subscription: subscription}) do
+ def render("show.json", %{subscription: subscription}) do
%{
id: to_string(subscription.id),
endpoint: subscription.endpoint,
diff --git a/lib/pleroma/web/mastodon_api/websocket_handler.ex b/lib/pleroma/web/mastodon_api/websocket_handler.ex
index a400d1c8d..94e4595d8 100644
--- a/lib/pleroma/web/mastodon_api/websocket_handler.ex
+++ b/lib/pleroma/web/mastodon_api/websocket_handler.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastodonAPI.WebsocketHandler do
@@ -12,29 +12,19 @@ defmodule Pleroma.Web.MastodonAPI.WebsocketHandler do
@behaviour :cowboy_websocket
- @streams [
- "public",
- "public:local",
- "public:media",
- "public:local:media",
- "user",
- "user:notification",
- "direct",
- "list",
- "hashtag"
- ]
- @anonymous_streams ["public", "public:local", "hashtag"]
-
- # Handled by periodic keepalive in Pleroma.Web.Streamer.Ping.
- @timeout :infinity
+ # Client ping period.
+ @tick :timer.seconds(30)
+ # Cowboy timeout period.
+ @timeout :timer.seconds(60)
+ # Hibernate every X messages
+ @hibernate_every 100
def init(%{qs: qs} = req, state) do
- with params <- :cow_qs.parse_qs(qs),
+ with params <- Enum.into(:cow_qs.parse_qs(qs), %{}),
sec_websocket <- :cowboy_req.header("sec-websocket-protocol", req, nil),
- access_token <- List.keyfind(params, "access_token", 0),
- {_, stream} <- List.keyfind(params, "stream", 0),
- {:ok, user} <- allow_request(stream, [access_token, sec_websocket]),
- topic when is_binary(topic) <- expand_topic(stream, params) do
+ access_token <- Map.get(params, "access_token"),
+ {:ok, user} <- authenticate_request(access_token, sec_websocket),
+ {:ok, topic} <- Streamer.get_topic(Map.get(params, "stream"), user, params) do
req =
if sec_websocket do
:cowboy_req.set_resp_header("sec-websocket-protocol", sec_websocket, req)
@@ -42,43 +32,70 @@ defmodule Pleroma.Web.MastodonAPI.WebsocketHandler do
req
end
- {:cowboy_websocket, req, %{user: user, topic: topic}, %{idle_timeout: @timeout}}
+ {:cowboy_websocket, req, %{user: user, topic: topic, count: 0, timer: nil},
+ %{idle_timeout: @timeout}}
else
- {:error, code} ->
- Logger.debug("#{__MODULE__} denied connection: #{inspect(code)} - #{inspect(req)}")
- {:ok, req} = :cowboy_req.reply(code, req)
+ {:error, :bad_topic} ->
+ Logger.debug("#{__MODULE__} bad topic #{inspect(req)}")
+ {:ok, req} = :cowboy_req.reply(404, req)
{:ok, req, state}
- error ->
- Logger.debug("#{__MODULE__} denied connection: #{inspect(error)} - #{inspect(req)}")
- {:ok, req} = :cowboy_req.reply(400, req)
+ {:error, :unauthorized} ->
+ Logger.debug("#{__MODULE__} authentication error: #{inspect(req)}")
+ {:ok, req} = :cowboy_req.reply(401, req)
{:ok, req, state}
end
end
def websocket_init(state) do
- send(self(), :subscribe)
- {:ok, state}
- end
-
- # We never receive messages.
- def websocket_handle(_frame, state) do
- {:ok, state}
- end
-
- def websocket_info(:subscribe, state) do
Logger.debug(
"#{__MODULE__} accepted websocket connection for user #{
(state.user || %{id: "anonymous"}).id
}, topic #{state.topic}"
)
- Streamer.add_socket(state.topic, streamer_socket(state))
+ Streamer.add_socket(state.topic, state.user)
+ {:ok, %{state | timer: timer()}}
+ end
+
+ # Client's Pong frame.
+ def websocket_handle(:pong, state) do
+ if state.timer, do: Process.cancel_timer(state.timer)
+ {:ok, %{state | timer: timer()}}
+ end
+
+ # We never receive messages.
+ def websocket_handle(frame, state) do
+ Logger.error("#{__MODULE__} received frame: #{inspect(frame)}")
{:ok, state}
end
+ def websocket_info({:render_with_user, view, template, item}, state) do
+ user = %User{} = User.get_cached_by_ap_id(state.user.ap_id)
+
+ unless Streamer.filtered_by_user?(user, item) do
+ websocket_info({:text, view.render(template, item, user)}, %{state | user: user})
+ else
+ {:ok, state}
+ end
+ end
+
def websocket_info({:text, message}, state) do
- {:reply, {:text, message}, state}
+ # If the websocket processed X messages, force an hibernate/GC.
+ # We don't hibernate at every message to balance CPU usage/latency with RAM usage.
+ if state.count > @hibernate_every do
+ {:reply, {:text, message}, %{state | count: 0}, :hibernate}
+ else
+ {:reply, {:text, message}, %{state | count: state.count + 1}}
+ end
+ end
+
+ # Ping tick. We don't re-queue a timer there, it is instead queued when :pong is received.
+ # As we hibernate there, reset the count to 0.
+ # If the client misses :pong, Cowboy will automatically timeout the connection after
+ # `@idle_timeout`.
+ def websocket_info(:tick, state) do
+ {:reply, :ping, %{state | timer: nil, count: 0}, :hibernate}
end
def terminate(reason, _req, state) do
@@ -88,56 +105,29 @@ defmodule Pleroma.Web.MastodonAPI.WebsocketHandler do
}, topic #{state.topic || "?"}: #{inspect(reason)}"
)
- Streamer.remove_socket(state.topic, streamer_socket(state))
+ Streamer.remove_socket(state.topic)
:ok
end
# Public streams without authentication.
- defp allow_request(stream, [nil, nil]) when stream in @anonymous_streams do
+ defp authenticate_request(nil, nil) do
{:ok, nil}
end
# Authenticated streams.
- defp allow_request(stream, [access_token, sec_websocket]) when stream in @streams do
- token =
- with {"access_token", token} <- access_token do
- token
- else
- _ -> sec_websocket
- end
+ defp authenticate_request(access_token, sec_websocket) do
+ token = access_token || sec_websocket
with true <- is_bitstring(token),
%Token{user_id: user_id} <- Repo.get_by(Token, token: token),
user = %User{} <- User.get_cached_by_id(user_id) do
{:ok, user}
else
- _ -> {:error, 403}
+ _ -> {:error, :unauthorized}
end
end
- # Not authenticated.
- defp allow_request(stream, _) when stream in @streams, do: {:error, 403}
-
- # No matching stream.
- defp allow_request(_, _), do: {:error, 404}
-
- defp expand_topic("hashtag", params) do
- case List.keyfind(params, "tag", 0) do
- {_, tag} -> "hashtag:#{tag}"
- _ -> nil
- end
- end
-
- defp expand_topic("list", params) do
- case List.keyfind(params, "list", 0) do
- {_, list} -> "list:#{list}"
- _ -> nil
- end
- end
-
- defp expand_topic(topic, _), do: topic
-
- defp streamer_socket(state) do
- %{transport_pid: self(), assigns: state}
+ defp timer do
+ Process.send_after(self(), :tick, @tick)
end
end
diff --git a/lib/pleroma/web/media_proxy/media_proxy.ex b/lib/pleroma/web/media_proxy/media_proxy.ex
index 1725ab071..b2b524524 100644
--- a/lib/pleroma/web/media_proxy/media_proxy.ex
+++ b/lib/pleroma/web/media_proxy/media_proxy.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MediaProxy do
diff --git a/lib/pleroma/web/media_proxy/media_proxy_controller.ex b/lib/pleroma/web/media_proxy/media_proxy_controller.ex
index 8403850ff..4657a4383 100644
--- a/lib/pleroma/web/media_proxy/media_proxy_controller.ex
+++ b/lib/pleroma/web/media_proxy/media_proxy_controller.ex
@@ -1,9 +1,10 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MediaProxy.MediaProxyController do
use Pleroma.Web, :controller
+
alias Pleroma.ReverseProxy
alias Pleroma.Web.MediaProxy
diff --git a/lib/pleroma/web/metadata.ex b/lib/pleroma/web/metadata.ex
index 8761260f2..a9f70c43e 100644
--- a/lib/pleroma/web/metadata.ex
+++ b/lib/pleroma/web/metadata.ex
@@ -1,12 +1,17 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Metadata do
alias Phoenix.HTML
def build_tags(params) do
- Enum.reduce(Pleroma.Config.get([__MODULE__, :providers], []), "", fn parser, acc ->
+ providers = [
+ Pleroma.Web.Metadata.Providers.RestrictIndexing
+ | Pleroma.Config.get([__MODULE__, :providers], [])
+ ]
+
+ Enum.reduce(providers, "", fn parser, acc ->
rendered_html =
params
|> parser.build_tags()
diff --git a/lib/pleroma/web/metadata/feed.ex b/lib/pleroma/web/metadata/feed.ex
index 8043e6c54..bd1459a17 100644
--- a/lib/pleroma/web/metadata/feed.ex
+++ b/lib/pleroma/web/metadata/feed.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Metadata.Providers.Feed do
@@ -16,7 +16,7 @@ defmodule Pleroma.Web.Metadata.Providers.Feed do
[
rel: "alternate",
type: "application/atom+xml",
- href: Helpers.feed_path(Endpoint, :feed, user.nickname) <> ".atom"
+ href: Helpers.user_feed_path(Endpoint, :feed, user.nickname) <> ".atom"
], []}
]
end
diff --git a/lib/pleroma/web/metadata/opengraph.ex b/lib/pleroma/web/metadata/opengraph.ex
index e7fa7f408..68c871e71 100644
--- a/lib/pleroma/web/metadata/opengraph.ex
+++ b/lib/pleroma/web/metadata/opengraph.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Metadata.Providers.OpenGraph do
@@ -68,7 +68,7 @@ defmodule Pleroma.Web.Metadata.Providers.OpenGraph do
property: "og:title",
content: Utils.user_name_string(user)
], []},
- {:meta, [property: "og:url", content: User.profile_url(user)], []},
+ {:meta, [property: "og:url", content: user.uri || user.ap_id], []},
{:meta, [property: "og:description", content: truncated_bio], []},
{:meta, [property: "og:type", content: "website"], []},
{:meta, [property: "og:image", content: Utils.attachment_url(User.avatar_url(user))], []},
diff --git a/lib/pleroma/web/metadata/player_view.ex b/lib/pleroma/web/metadata/player_view.ex
index 4289ebdbd..5a918532a 100644
--- a/lib/pleroma/web/metadata/player_view.ex
+++ b/lib/pleroma/web/metadata/player_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Metadata.PlayerView do
diff --git a/lib/pleroma/web/metadata/provider.ex b/lib/pleroma/web/metadata/provider.ex
index 197fb2a77..767288f9c 100644
--- a/lib/pleroma/web/metadata/provider.ex
+++ b/lib/pleroma/web/metadata/provider.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Metadata.Providers.Provider do
diff --git a/lib/pleroma/web/metadata/rel_me.ex b/lib/pleroma/web/metadata/rel_me.ex
index f87fc1973..8905c9c72 100644
--- a/lib/pleroma/web/metadata/rel_me.ex
+++ b/lib/pleroma/web/metadata/rel_me.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Metadata.Providers.RelMe do
@@ -8,8 +8,10 @@ defmodule Pleroma.Web.Metadata.Providers.RelMe do
@impl Provider
def build_tags(%{user: user}) do
- (Floki.attribute(user.bio, "link[rel~=me]", "href") ++
- Floki.attribute(user.bio, "a[rel~=me]", "href"))
+ bio_tree = Floki.parse_fragment!(user.bio)
+
+ (Floki.attribute(bio_tree, "link[rel~=me]", "href") ++
+ Floki.attribute(bio_tree, "a[rel~=me]", "href"))
|> Enum.map(fn link ->
{:link, [rel: "me", href: link], []}
end)
diff --git a/lib/pleroma/web/metadata/restrict_indexing.ex b/lib/pleroma/web/metadata/restrict_indexing.ex
new file mode 100644
index 000000000..f15607896
--- /dev/null
+++ b/lib/pleroma/web/metadata/restrict_indexing.ex
@@ -0,0 +1,25 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.Metadata.Providers.RestrictIndexing do
+ @behaviour Pleroma.Web.Metadata.Providers.Provider
+
+ @moduledoc """
+ Restricts indexing of remote users.
+ """
+
+ @impl true
+ def build_tags(%{user: %{local: false}}) do
+ [
+ {:meta,
+ [
+ name: "robots",
+ content: "noindex, noarchive"
+ ], []}
+ ]
+ end
+
+ @impl true
+ def build_tags(%{user: %{local: true}}), do: []
+end
diff --git a/lib/pleroma/web/metadata/twitter_card.ex b/lib/pleroma/web/metadata/twitter_card.ex
index d6a6049b3..5d08ce422 100644
--- a/lib/pleroma/web/metadata/twitter_card.ex
+++ b/lib/pleroma/web/metadata/twitter_card.ex
@@ -1,6 +1,6 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Metadata.Providers.TwitterCard do
@@ -31,7 +31,7 @@ defmodule Pleroma.Web.Metadata.Providers.TwitterCard do
if attachments == [] or Metadata.activity_nsfw?(object) do
[
image_tag(user),
- {:meta, [property: "twitter:card", content: "summary_large_image"], []}
+ {:meta, [property: "twitter:card", content: "summary"], []}
]
else
attachments
diff --git a/lib/pleroma/web/metadata/utils.ex b/lib/pleroma/web/metadata/utils.ex
index 382ecf426..2f0dfb474 100644
--- a/lib/pleroma/web/metadata/utils.ex
+++ b/lib/pleroma/web/metadata/utils.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Metadata.Utils do
@@ -15,19 +15,28 @@ defmodule Pleroma.Web.Metadata.Utils do
|> String.replace(~r/<br\s?\/?>/, " ")
|> HTML.get_cached_stripped_html_for_activity(object, "metadata")
|> Emoji.Formatter.demojify()
+ |> HtmlEntities.decode()
|> Formatter.truncate()
end
def scrub_html_and_truncate(content, max_length \\ 200) when is_binary(content) do
content
+ |> scrub_html
+ |> Emoji.Formatter.demojify()
+ |> HtmlEntities.decode()
+ |> Formatter.truncate(max_length)
+ end
+
+ def scrub_html(content) when is_binary(content) do
+ content
# html content comes from DB already encoded, decode first and scrub after
|> HtmlEntities.decode()
|> String.replace(~r/<br\s?\/?>/, " ")
|> HTML.strip_tags()
- |> Emoji.Formatter.demojify()
- |> Formatter.truncate(max_length)
end
+ def scrub_html(content), do: content
+
def attachment_url(url) do
MediaProxy.url(url)
end
diff --git a/lib/pleroma/web/mongooseim/mongoose_im_controller.ex b/lib/pleroma/web/mongooseim/mongoose_im_controller.ex
index 6ed181cff..6cbbe8fd8 100644
--- a/lib/pleroma/web/mongooseim/mongoose_im_controller.ex
+++ b/lib/pleroma/web/mongooseim/mongoose_im_controller.ex
@@ -1,20 +1,20 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MongooseIM.MongooseIMController do
use Pleroma.Web, :controller
- alias Comeonin.Pbkdf2
+ alias Pleroma.Plugs.AuthenticationPlug
alias Pleroma.Plugs.RateLimiter
alias Pleroma.Repo
alias Pleroma.User
- plug(RateLimiter, :authentication when action in [:user_exists, :check_password])
- plug(RateLimiter, {:authentication, params: ["user"]} when action == :check_password)
+ plug(RateLimiter, [name: :authentication] when action in [:user_exists, :check_password])
+ plug(RateLimiter, [name: :authentication, params: ["user"]] when action == :check_password)
def user_exists(conn, %{"user" => username}) do
- with %User{} <- Repo.get_by(User, nickname: username, local: true) do
+ with %User{} <- Repo.get_by(User, nickname: username, local: true, deactivated: false) do
conn
|> json(true)
else
@@ -26,9 +26,9 @@ defmodule Pleroma.Web.MongooseIM.MongooseIMController do
end
def check_password(conn, %{"user" => username, "pass" => password}) do
- with %User{password_hash: password_hash} <-
+ with %User{password_hash: password_hash, deactivated: false} <-
Repo.get_by(User, nickname: username, local: true),
- true <- Pbkdf2.checkpw(password, password_hash) do
+ true <- AuthenticationPlug.checkpw(password, password_hash) do
conn
|> json(true)
else
diff --git a/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex b/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex
index 192984242..721b599d4 100644
--- a/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex
+++ b/lib/pleroma/web/nodeinfo/nodeinfo_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Nodeinfo.NodeinfoController do
@@ -9,8 +9,8 @@ defmodule Pleroma.Web.Nodeinfo.NodeinfoController do
alias Pleroma.Stats
alias Pleroma.User
alias Pleroma.Web
- alias Pleroma.Web.ActivityPub.MRF
alias Pleroma.Web.Federator.Publisher
+ alias Pleroma.Web.MastodonAPI.InstanceView
def schemas(conn, _params) do
response = %{
@@ -34,50 +34,12 @@ defmodule Pleroma.Web.Nodeinfo.NodeinfoController do
def raw_nodeinfo do
stats = Stats.get_stats()
- quarantined = Config.get([:instance, :quarantined_instances], [])
-
staff_accounts =
User.all_superusers()
|> Enum.map(fn u -> u.ap_id end)
- federation_response =
- if Config.get([:instance, :mrf_transparency]) do
- {:ok, data} = MRF.describe()
-
- data
- |> Map.merge(%{quarantined_instances: quarantined})
- else
- %{}
- end
-
- features =
- [
- "pleroma_api",
- "mastodon_api",
- "mastodon_api_streaming",
- "polls",
- "pleroma_explicit_addressing",
- "shareable_emoji_packs",
- if Config.get([:media_proxy, :enabled]) do
- "media_proxy"
- end,
- if Config.get([:gopher, :enabled]) do
- "gopher"
- end,
- if Config.get([:chat, :enabled]) do
- "chat"
- end,
- if Config.get([:suggestions, :enabled]) do
- "suggestions"
- end,
- if Config.get([:instance, :allow_relay]) do
- "relay"
- end,
- if Config.get([:instance, :safe_dm_mentions]) do
- "safe_dm_mentions"
- end
- ]
- |> Enum.filter(& &1)
+ features = InstanceView.features()
+ federation = InstanceView.federation()
%{
version: "2.0",
@@ -93,23 +55,19 @@ defmodule Pleroma.Web.Nodeinfo.NodeinfoController do
openRegistrations: Config.get([:instance, :registrations_open]),
usage: %{
users: %{
- total: stats.user_count || 0
+ total: Map.get(stats, :user_count, 0)
},
- localPosts: stats.status_count || 0
+ localPosts: Map.get(stats, :status_count, 0)
},
metadata: %{
nodeName: Config.get([:instance, :name]),
nodeDescription: Config.get([:instance, :description]),
private: !Config.get([:instance, :public], true),
suggestions: %{
- enabled: Config.get([:suggestions, :enabled], false),
- thirdPartyEngine: Config.get([:suggestions, :third_party_engine], ""),
- timeout: Config.get([:suggestions, :timeout], 5000),
- limit: Config.get([:suggestions, :limit], 23),
- web: Config.get([:suggestions, :web], "")
+ enabled: false
},
staffAccounts: staff_accounts,
- federation: federation_response,
+ federation: federation,
pollLimits: Config.get([:instance, :poll_limits]),
postFormats: Config.get([:instance, :allowed_post_formats]),
uploadLimits: %{
@@ -118,6 +76,12 @@ defmodule Pleroma.Web.Nodeinfo.NodeinfoController do
banner: Config.get([:instance, :banner_upload_limit]),
background: Config.get([:instance, :background_upload_limit])
},
+ fieldsLimits: %{
+ maxFields: Config.get([:instance, :max_account_fields]),
+ maxRemoteFields: Config.get([:instance, :max_remote_account_fields]),
+ nameLength: Config.get([:instance, :account_field_name_length]),
+ valueLength: Config.get([:instance, :account_field_value_length])
+ },
accountActivationRequired: Config.get([:instance, :account_activation_required], false),
invitesEnabled: Config.get([:instance, :invites_enabled], false),
mailerEnabled: Config.get([Pleroma.Emails.Mailer, :enabled], false),
diff --git a/lib/pleroma/web/oauth.ex b/lib/pleroma/web/oauth.ex
index 280cf28c0..2f1b8708d 100644
--- a/lib/pleroma/web/oauth.ex
+++ b/lib/pleroma/web/oauth.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth do
diff --git a/lib/pleroma/web/oauth/app.ex b/lib/pleroma/web/oauth/app.ex
index cc3fb1ce5..6a6d5f2e2 100644
--- a/lib/pleroma/web/oauth/app.ex
+++ b/lib/pleroma/web/oauth/app.ex
@@ -1,10 +1,11 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.App do
use Ecto.Schema
import Ecto.Changeset
+ import Ecto.Query
alias Pleroma.Repo
@type t :: %__MODULE__{}
@@ -16,14 +17,24 @@ defmodule Pleroma.Web.OAuth.App do
field(:website, :string)
field(:client_id, :string)
field(:client_secret, :string)
+ field(:trusted, :boolean, default: false)
+
+ has_many(:oauth_authorizations, Pleroma.Web.OAuth.Authorization, on_delete: :delete_all)
+ has_many(:oauth_tokens, Pleroma.Web.OAuth.Token, on_delete: :delete_all)
timestamps()
end
+ @spec changeset(App.t(), map()) :: Ecto.Changeset.t()
+ def changeset(struct, params) do
+ cast(struct, params, [:client_name, :redirect_uris, :scopes, :website, :trusted])
+ end
+
+ @spec register_changeset(App.t(), map()) :: Ecto.Changeset.t()
def register_changeset(struct, params \\ %{}) do
changeset =
struct
- |> cast(params, [:client_name, :redirect_uris, :scopes, :website])
+ |> changeset(params)
|> validate_required([:client_name, :redirect_uris, :scopes])
if changeset.valid? do
@@ -41,6 +52,21 @@ defmodule Pleroma.Web.OAuth.App do
end
end
+ @spec create(map()) :: {:ok, App.t()} | {:error, Ecto.Changeset.t()}
+ def create(params) do
+ with changeset <- __MODULE__.register_changeset(%__MODULE__{}, params) do
+ Repo.insert(changeset)
+ end
+ end
+
+ @spec update(map()) :: {:ok, App.t()} | {:error, Ecto.Changeset.t()}
+ def update(params) do
+ with %__MODULE__{} = app <- Repo.get(__MODULE__, params["id"]),
+ changeset <- changeset(app, params) do
+ Repo.update(changeset)
+ end
+ end
+
@doc """
Gets app by attrs or create new with attrs.
And updates the scopes if need.
@@ -65,4 +91,58 @@ defmodule Pleroma.Web.OAuth.App do
|> change(%{scopes: scopes})
|> Repo.update()
end
+
+ @spec search(map()) :: {:ok, [App.t()], non_neg_integer()}
+ def search(params) do
+ query = from(a in __MODULE__)
+
+ query =
+ if params[:client_name] do
+ from(a in query, where: a.client_name == ^params[:client_name])
+ else
+ query
+ end
+
+ query =
+ if params[:client_id] do
+ from(a in query, where: a.client_id == ^params[:client_id])
+ else
+ query
+ end
+
+ query =
+ if Map.has_key?(params, :trusted) do
+ from(a in query, where: a.trusted == ^params[:trusted])
+ else
+ query
+ end
+
+ query =
+ from(u in query,
+ limit: ^params[:page_size],
+ offset: ^((params[:page] - 1) * params[:page_size])
+ )
+
+ count = Repo.aggregate(__MODULE__, :count, :id)
+
+ {:ok, Repo.all(query), count}
+ end
+
+ @spec destroy(pos_integer()) :: {:ok, App.t()} | {:error, Ecto.Changeset.t()}
+ def destroy(id) do
+ with %__MODULE__{} = app <- Repo.get(__MODULE__, id) do
+ Repo.delete(app)
+ end
+ end
+
+ @spec errors(Ecto.Changeset.t()) :: map()
+ def errors(changeset) do
+ Enum.reduce(changeset.errors, %{}, fn
+ {:client_name, {error, _}}, acc ->
+ Map.put(acc, :name, error)
+
+ {key, {error, _}}, acc ->
+ Map.put(acc, key, error)
+ end)
+ end
end
diff --git a/lib/pleroma/web/oauth/authorization.ex b/lib/pleroma/web/oauth/authorization.ex
index ed42a34f3..268ee5b63 100644
--- a/lib/pleroma/web/oauth/authorization.ex
+++ b/lib/pleroma/web/oauth/authorization.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.Authorization do
diff --git a/lib/pleroma/web/oauth/fallback_controller.ex b/lib/pleroma/web/oauth/fallback_controller.ex
index dd7f08bf1..a89ced886 100644
--- a/lib/pleroma/web/oauth/fallback_controller.ex
+++ b/lib/pleroma/web/oauth/fallback_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.FallbackController do
diff --git a/lib/pleroma/web/oauth/mfa_controller.ex b/lib/pleroma/web/oauth/mfa_controller.ex
new file mode 100644
index 000000000..e52cccd85
--- /dev/null
+++ b/lib/pleroma/web/oauth/mfa_controller.ex
@@ -0,0 +1,97 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.OAuth.MFAController do
+ @moduledoc """
+ The model represents api to use Multi Factor authentications.
+ """
+
+ use Pleroma.Web, :controller
+
+ alias Pleroma.MFA
+ alias Pleroma.Web.Auth.TOTPAuthenticator
+ alias Pleroma.Web.OAuth.MFAView, as: View
+ alias Pleroma.Web.OAuth.OAuthController
+ alias Pleroma.Web.OAuth.Token
+
+ plug(:fetch_session when action in [:show, :verify])
+ plug(:fetch_flash when action in [:show, :verify])
+
+ @doc """
+ Display form to input mfa code or recovery code.
+ """
+ def show(conn, %{"mfa_token" => mfa_token} = params) do
+ template = Map.get(params, "challenge_type", "totp")
+
+ conn
+ |> put_view(View)
+ |> render("#{template}.html", %{
+ mfa_token: mfa_token,
+ redirect_uri: params["redirect_uri"],
+ state: params["state"]
+ })
+ end
+
+ @doc """
+ Verification code and continue authorization.
+ """
+ def verify(conn, %{"mfa" => %{"mfa_token" => mfa_token} = mfa_params} = _) do
+ with {:ok, %{user: user, authorization: auth}} <- MFA.Token.validate(mfa_token),
+ {:ok, _} <- validates_challenge(user, mfa_params) do
+ conn
+ |> OAuthController.after_create_authorization(auth, %{
+ "authorization" => %{
+ "redirect_uri" => mfa_params["redirect_uri"],
+ "state" => mfa_params["state"]
+ }
+ })
+ else
+ _ ->
+ conn
+ |> put_flash(:error, "Two-factor authentication failed.")
+ |> put_status(:unauthorized)
+ |> show(mfa_params)
+ end
+ end
+
+ @doc """
+ Verification second step of MFA (or recovery) and returns access token.
+
+ ## Endpoint
+ POST /oauth/mfa/challenge
+
+ params:
+ `client_id`
+ `client_secret`
+ `mfa_token` - access token to check second step of mfa
+ `challenge_type` - 'totp' or 'recovery'
+ `code`
+
+ """
+ def challenge(conn, %{"mfa_token" => mfa_token} = params) do
+ with {:ok, app} <- Token.Utils.fetch_app(conn),
+ {:ok, %{user: user, authorization: auth}} <- MFA.Token.validate(mfa_token),
+ {:ok, _} <- validates_challenge(user, params),
+ {:ok, token} <- Token.exchange_token(app, auth) do
+ json(conn, Token.Response.build(user, token))
+ else
+ _error ->
+ conn
+ |> put_status(400)
+ |> json(%{error: "Invalid code"})
+ end
+ end
+
+ # Verify TOTP Code
+ defp validates_challenge(user, %{"challenge_type" => "totp", "code" => code} = _) do
+ TOTPAuthenticator.verify(code, user)
+ end
+
+ # Verify Recovery Code
+ defp validates_challenge(user, %{"challenge_type" => "recovery", "code" => code} = _) do
+ TOTPAuthenticator.verify_recovery_code(user, code)
+ end
+
+ defp validates_challenge(_, _), do: {:error, :unsupported_challenge_type}
+end
diff --git a/lib/pleroma/scheduler.ex b/lib/pleroma/web/oauth/mfa_view.ex
index d84cd99ad..e88e7066b 100644
--- a/lib/pleroma/scheduler.ex
+++ b/lib/pleroma/web/oauth/mfa_view.ex
@@ -2,6 +2,7 @@
# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
-defmodule Pleroma.Scheduler do
- use Quantum.Scheduler, otp_app: :pleroma
+defmodule Pleroma.Web.OAuth.MFAView do
+ use Pleroma.Web, :view
+ import Phoenix.HTML.Form
end
diff --git a/lib/pleroma/web/oauth/oauth_controller.ex b/lib/pleroma/web/oauth/oauth_controller.ex
index 03c9a5027..7c804233c 100644
--- a/lib/pleroma/web/oauth/oauth_controller.ex
+++ b/lib/pleroma/web/oauth/oauth_controller.ex
@@ -1,11 +1,13 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.OAuthController do
use Pleroma.Web, :controller
alias Pleroma.Helpers.UriHelper
+ alias Pleroma.MFA
+ alias Pleroma.Plugs.RateLimiter
alias Pleroma.Registration
alias Pleroma.Repo
alias Pleroma.User
@@ -13,10 +15,11 @@ defmodule Pleroma.Web.OAuth.OAuthController do
alias Pleroma.Web.ControllerHelper
alias Pleroma.Web.OAuth.App
alias Pleroma.Web.OAuth.Authorization
+ alias Pleroma.Web.OAuth.MFAController
+ alias Pleroma.Web.OAuth.Scopes
alias Pleroma.Web.OAuth.Token
alias Pleroma.Web.OAuth.Token.Strategy.RefreshToken
alias Pleroma.Web.OAuth.Token.Strategy.Revoke, as: RevokeToken
- alias Pleroma.Web.OAuth.Scopes
require Logger
@@ -24,7 +27,10 @@ defmodule Pleroma.Web.OAuth.OAuthController do
plug(:fetch_session)
plug(:fetch_flash)
- plug(Pleroma.Plugs.RateLimiter, :authentication when action == :create_authorization)
+
+ plug(:skip_plug, [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug])
+
+ plug(RateLimiter, [name: :authentication] when action == :create_authorization)
action_fallback(Pleroma.Web.OAuth.FallbackController)
@@ -36,7 +42,7 @@ defmodule Pleroma.Web.OAuth.OAuthController do
authorize(conn, Map.merge(params, auth_attrs))
end
- def authorize(%Plug.Conn{assigns: %{token: %Token{}}} = conn, params) do
+ def authorize(%Plug.Conn{assigns: %{token: %Token{}}} = conn, %{"force_login" => _} = params) do
if ControllerHelper.truthy_param?(params["force_login"]) do
do_authorize(conn, params)
else
@@ -44,6 +50,22 @@ defmodule Pleroma.Web.OAuth.OAuthController do
end
end
+ # Note: the token is set in oauth_plug, but the token and client do not always go together.
+ # For example, MastodonFE's token is set if user requests with another client,
+ # after user already authorized to MastodonFE.
+ # So we have to check client and token.
+ def authorize(
+ %Plug.Conn{assigns: %{token: %Token{} = token}} = conn,
+ %{"client_id" => client_id} = params
+ ) do
+ with %Token{} = t <- Repo.get_by(Token, token: token.token) |> Repo.preload(:app),
+ ^client_id <- t.app.client_id do
+ handle_existing_authorization(conn, params)
+ else
+ _ -> do_authorize(conn, params)
+ end
+ end
+
def authorize(%Plug.Conn{} = conn, params), do: do_authorize(conn, params)
defp do_authorize(%Plug.Conn{} = conn, params) do
@@ -101,7 +123,8 @@ defmodule Pleroma.Web.OAuth.OAuthController do
%{"authorization" => _} = params,
opts \\ []
) do
- with {:ok, auth} <- do_create_authorization(conn, params, opts[:user]) do
+ with {:ok, auth, user} <- do_create_authorization(conn, params, opts[:user]),
+ {:mfa_required, _, _, false} <- {:mfa_required, user, auth, MFA.require?(user)} do
after_create_authorization(conn, auth, params)
else
error ->
@@ -150,17 +173,53 @@ defmodule Pleroma.Web.OAuth.OAuthController do
defp handle_create_authorization_error(
%Plug.Conn{} = conn,
- {:auth_active, false},
+ {:account_status, :confirmation_pending},
%{"authorization" => _} = params
) do
- # Per https://github.com/tootsuite/mastodon/blob/
- # 51e154f5e87968d6bb115e053689767ab33e80cd/app/controllers/api/base_controller.rb#L76
conn
|> put_flash(:error, dgettext("errors", "Your login is missing a confirmed e-mail address"))
|> put_status(:forbidden)
|> authorize(params)
end
+ defp handle_create_authorization_error(
+ %Plug.Conn{} = conn,
+ {:mfa_required, user, auth, _},
+ params
+ ) do
+ {:ok, token} = MFA.Token.create_token(user, auth)
+
+ data = %{
+ "mfa_token" => token.token,
+ "redirect_uri" => params["authorization"]["redirect_uri"],
+ "state" => params["authorization"]["state"]
+ }
+
+ MFAController.show(conn, data)
+ end
+
+ defp handle_create_authorization_error(
+ %Plug.Conn{} = conn,
+ {:account_status, :password_reset_pending},
+ %{"authorization" => _} = params
+ ) do
+ conn
+ |> put_flash(:error, dgettext("errors", "Password reset is required"))
+ |> put_status(:forbidden)
+ |> authorize(params)
+ end
+
+ defp handle_create_authorization_error(
+ %Plug.Conn{} = conn,
+ {:account_status, :deactivated},
+ %{"authorization" => _} = params
+ ) do
+ conn
+ |> put_flash(:error, dgettext("errors", "Your account is currently disabled"))
+ |> put_status(:forbidden)
+ |> authorize(params)
+ end
+
defp handle_create_authorization_error(%Plug.Conn{} = conn, error, %{"authorization" => _}) do
Authenticator.handle_error(conn, error)
end
@@ -191,7 +250,8 @@ defmodule Pleroma.Web.OAuth.OAuthController do
json(conn, Token.Response.build(user, token, response_attrs))
else
- _error -> render_invalid_credentials_error(conn)
+ error ->
+ handle_token_exchange_error(conn, error)
end
end
@@ -201,46 +261,15 @@ defmodule Pleroma.Web.OAuth.OAuthController do
) do
with {:ok, %User{} = user} <- Authenticator.get_user(conn),
{:ok, app} <- Token.Utils.fetch_app(conn),
- {:auth_active, true} <- {:auth_active, User.auth_active?(user)},
- {:user_active, true} <- {:user_active, !user.info.deactivated},
- {:password_reset_pending, false} <-
- {:password_reset_pending, user.info.password_reset_pending},
+ {:account_status, :active} <- {:account_status, User.account_status(user)},
{:ok, scopes} <- validate_scopes(app, params),
{:ok, auth} <- Authorization.create_authorization(app, user, scopes),
+ {:mfa_required, _, _, false} <- {:mfa_required, user, auth, MFA.require?(user)},
{:ok, token} <- Token.exchange_token(app, auth) do
json(conn, Token.Response.build(user, token))
else
- {:auth_active, false} ->
- # Per https://github.com/tootsuite/mastodon/blob/
- # 51e154f5e87968d6bb115e053689767ab33e80cd/app/controllers/api/base_controller.rb#L76
- render_error(
- conn,
- :forbidden,
- "Your login is missing a confirmed e-mail address",
- %{},
- "missing_confirmed_email"
- )
-
- {:user_active, false} ->
- render_error(
- conn,
- :forbidden,
- "Your account is currently disabled",
- %{},
- "account_is_disabled"
- )
-
- {:password_reset_pending, true} ->
- render_error(
- conn,
- :forbidden,
- "Password reset is required",
- %{},
- "password_reset_required"
- )
-
- _error ->
- render_invalid_credentials_error(conn)
+ error ->
+ handle_token_exchange_error(conn, error)
end
end
@@ -262,13 +291,57 @@ defmodule Pleroma.Web.OAuth.OAuthController do
{:ok, token} <- Token.exchange_token(app, auth) do
json(conn, Token.Response.build_for_client_credentials(token))
else
- _error -> render_invalid_credentials_error(conn)
+ _error ->
+ handle_token_exchange_error(conn, :invalid_credentails)
end
end
# Bad request
def token_exchange(%Plug.Conn{} = conn, params), do: bad_request(conn, params)
+ defp handle_token_exchange_error(%Plug.Conn{} = conn, {:mfa_required, user, auth, _}) do
+ conn
+ |> put_status(:forbidden)
+ |> json(build_and_response_mfa_token(user, auth))
+ end
+
+ defp handle_token_exchange_error(%Plug.Conn{} = conn, {:account_status, :deactivated}) do
+ render_error(
+ conn,
+ :forbidden,
+ "Your account is currently disabled",
+ %{},
+ "account_is_disabled"
+ )
+ end
+
+ defp handle_token_exchange_error(
+ %Plug.Conn{} = conn,
+ {:account_status, :password_reset_pending}
+ ) do
+ render_error(
+ conn,
+ :forbidden,
+ "Password reset is required",
+ %{},
+ "password_reset_required"
+ )
+ end
+
+ defp handle_token_exchange_error(%Plug.Conn{} = conn, {:account_status, :confirmation_pending}) do
+ render_error(
+ conn,
+ :forbidden,
+ "Your login is missing a confirmed e-mail address",
+ %{},
+ "missing_confirmed_email"
+ )
+ end
+
+ defp handle_token_exchange_error(%Plug.Conn{} = conn, _error) do
+ render_invalid_credentials_error(conn)
+ end
+
def token_revoke(%Plug.Conn{} = conn, %{"token" => _token} = params) do
with {:ok, app} <- Token.Utils.fetch_app(conn),
{:ok, _token} <- RevokeToken.revoke(app, params) do
@@ -389,7 +462,8 @@ defmodule Pleroma.Web.OAuth.OAuthController do
def register(%Plug.Conn{} = conn, %{"authorization" => _, "op" => "connect"} = params) do
with registration_id when not is_nil(registration_id) <- get_session_registration_id(conn),
%Registration{} = registration <- Repo.get(Registration, registration_id),
- {_, {:ok, auth}} <- {:create_authorization, do_create_authorization(conn, params)},
+ {_, {:ok, auth, _user}} <-
+ {:create_authorization, do_create_authorization(conn, params)},
%User{} = user <- Repo.preload(auth, :user).user,
{:ok, _updated_registration} <- Registration.bind_to_user(registration, user) do
conn
@@ -455,8 +529,9 @@ defmodule Pleroma.Web.OAuth.OAuthController do
%App{} = app <- Repo.get_by(App, client_id: client_id),
true <- redirect_uri in String.split(app.redirect_uris),
{:ok, scopes} <- validate_scopes(app, auth_attrs),
- {:auth_active, true} <- {:auth_active, User.auth_active?(user)} do
- Authorization.create_authorization(app, user, scopes)
+ {:account_status, :active} <- {:account_status, User.account_status(user)},
+ {:ok, auth} <- Authorization.create_authorization(app, user, scopes) do
+ {:ok, auth, user}
end
end
@@ -470,9 +545,15 @@ defmodule Pleroma.Web.OAuth.OAuthController do
defp put_session_registration_id(%Plug.Conn{} = conn, registration_id),
do: put_session(conn, :registration_id, registration_id)
+ defp build_and_response_mfa_token(user, auth) do
+ with {:ok, token} <- MFA.Token.create_token(user, auth) do
+ Token.Response.build_for_mfa_token(user, token)
+ end
+ end
+
@spec validate_scopes(App.t(), map()) ::
{:ok, list()} | {:error, :missing_scopes | :unsupported_scopes}
- defp validate_scopes(app, params) do
+ defp validate_scopes(%App{} = app, params) do
params
|> Scopes.fetch_scopes(app.scopes)
|> Scopes.validate(app.scopes)
diff --git a/lib/pleroma/web/oauth/oauth_view.ex b/lib/pleroma/web/oauth/oauth_view.ex
index 9b37a91c5..94ddaf913 100644
--- a/lib/pleroma/web/oauth/oauth_view.ex
+++ b/lib/pleroma/web/oauth/oauth_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.OAuthView do
diff --git a/lib/pleroma/web/oauth/scopes.ex b/lib/pleroma/web/oauth/scopes.ex
index 48bd14407..6f06f1431 100644
--- a/lib/pleroma/web/oauth/scopes.ex
+++ b/lib/pleroma/web/oauth/scopes.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.Scopes do
@@ -7,15 +7,18 @@ defmodule Pleroma.Web.OAuth.Scopes do
Functions for dealing with scopes.
"""
+ alias Pleroma.Plugs.OAuthScopesPlug
+
@doc """
Fetch scopes from request params.
Note: `scopes` is used by Mastodon — supporting it but sticking to
OAuth's standard `scope` wherever we control it
"""
- @spec fetch_scopes(map(), list()) :: list()
+ @spec fetch_scopes(map() | struct(), list()) :: list()
+
def fetch_scopes(params, default) do
- parse_scopes(params["scope"] || params["scopes"], default)
+ parse_scopes(params["scope"] || params["scopes"] || params[:scopes], default)
end
def parse_scopes(scopes, _default) when is_list(scopes) do
@@ -55,13 +58,19 @@ defmodule Pleroma.Web.OAuth.Scopes do
"""
@spec validate(list() | nil, list()) ::
{:ok, list()} | {:error, :missing_scopes | :unsupported_scopes}
- def validate([], _app_scopes), do: {:error, :missing_scopes}
- def validate(nil, _app_scopes), do: {:error, :missing_scopes}
+ def validate(blank_scopes, _app_scopes) when blank_scopes in [nil, []],
+ do: {:error, :missing_scopes}
def validate(scopes, app_scopes) do
- case Pleroma.Plugs.OAuthScopesPlug.filter_descendants(scopes, app_scopes) do
+ case OAuthScopesPlug.filter_descendants(scopes, app_scopes) do
^scopes -> {:ok, scopes}
_ -> {:error, :unsupported_scopes}
end
end
+
+ def contains_admin_scopes?(scopes) do
+ scopes
+ |> OAuthScopesPlug.filter_descendants(["admin"])
+ |> Enum.any?()
+ end
end
diff --git a/lib/pleroma/web/oauth/token.ex b/lib/pleroma/web/oauth/token.ex
index 8ea373805..08bb7326d 100644
--- a/lib/pleroma/web/oauth/token.ex
+++ b/lib/pleroma/web/oauth/token.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.Token do
diff --git a/lib/pleroma/web/oauth/token/clean_worker.ex b/lib/pleroma/web/oauth/token/clean_worker.ex
index f639f9c6f..2c3bb9ded 100644
--- a/lib/pleroma/web/oauth/token/clean_worker.ex
+++ b/lib/pleroma/web/oauth/token/clean_worker.ex
@@ -4,19 +4,15 @@
defmodule Pleroma.Web.OAuth.Token.CleanWorker do
@moduledoc """
- The module represents functions to clean an expired oauth tokens.
+ The module represents functions to clean an expired OAuth and MFA tokens.
"""
use GenServer
@ten_seconds 10_000
@one_day 86_400_000
- @interval Pleroma.Config.get(
- [:oauth2, :clean_expired_tokens_interval],
- @one_day
- )
-
- alias Pleroma.Web.OAuth.Token
+ alias Pleroma.MFA
+ alias Pleroma.Web.OAuth
alias Pleroma.Workers.BackgroundWorker
def start_link(_), do: GenServer.start_link(__MODULE__, %{})
@@ -29,10 +25,14 @@ defmodule Pleroma.Web.OAuth.Token.CleanWorker do
@doc false
def handle_info(:perform, state) do
BackgroundWorker.enqueue("clean_expired_tokens", %{})
+ interval = Pleroma.Config.get([:oauth2, :clean_expired_tokens_interval], @one_day)
- Process.send_after(self(), :perform, @interval)
+ Process.send_after(self(), :perform, interval)
{:noreply, state}
end
- def perform(:clean), do: Token.delete_expired_tokens()
+ def perform(:clean) do
+ OAuth.Token.delete_expired_tokens()
+ MFA.Token.delete_expired_tokens()
+ end
end
diff --git a/lib/pleroma/web/oauth/token/query.ex b/lib/pleroma/web/oauth/token/query.ex
index 9642103e6..93d6e26ed 100644
--- a/lib/pleroma/web/oauth/token/query.ex
+++ b/lib/pleroma/web/oauth/token/query.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.Token.Query do
diff --git a/lib/pleroma/web/oauth/token/response.ex b/lib/pleroma/web/oauth/token/response.ex
index 266110814..0e72c31e9 100644
--- a/lib/pleroma/web/oauth/token/response.ex
+++ b/lib/pleroma/web/oauth/token/response.ex
@@ -1,10 +1,11 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.Token.Response do
@moduledoc false
+ alias Pleroma.MFA
alias Pleroma.User
alias Pleroma.Web.OAuth.Token.Utils
@@ -32,5 +33,13 @@ defmodule Pleroma.Web.OAuth.Token.Response do
}
end
+ def build_for_mfa_token(user, mfa_token) do
+ %{
+ error: "mfa_required",
+ mfa_token: mfa_token.token,
+ supported_challenge_types: MFA.supported_methods(user)
+ }
+ end
+
defp expires_in, do: Pleroma.Config.get([:oauth2, :token_expires_in], 600)
end
diff --git a/lib/pleroma/web/oauth/token/strategy/refresh_token.ex b/lib/pleroma/web/oauth/token/strategy/refresh_token.ex
index c620050c8..debc29b0b 100644
--- a/lib/pleroma/web/oauth/token/strategy/refresh_token.ex
+++ b/lib/pleroma/web/oauth/token/strategy/refresh_token.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.Token.Strategy.RefreshToken do
diff --git a/lib/pleroma/web/oauth/token/strategy/revoke.ex b/lib/pleroma/web/oauth/token/strategy/revoke.ex
index 983f095b4..069c1ee21 100644
--- a/lib/pleroma/web/oauth/token/strategy/revoke.ex
+++ b/lib/pleroma/web/oauth/token/strategy/revoke.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.Token.Strategy.Revoke do
diff --git a/lib/pleroma/web/oauth/token/utils.ex b/lib/pleroma/web/oauth/token/utils.ex
index 1e8765e93..43aeab6b0 100644
--- a/lib/pleroma/web/oauth/token/utils.ex
+++ b/lib/pleroma/web/oauth/token/utils.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OAuth.Token.Utils do
diff --git a/lib/pleroma/web/ostatus/ostatus_controller.ex b/lib/pleroma/web/ostatus/ostatus_controller.ex
index 6958519de..6971cd9f8 100644
--- a/lib/pleroma/web/ostatus/ostatus_controller.ex
+++ b/lib/pleroma/web/ostatus/ostatus_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.OStatus.OStatusController do
@@ -8,17 +8,21 @@ defmodule Pleroma.Web.OStatus.OStatusController do
alias Fallback.RedirectController
alias Pleroma.Activity
alias Pleroma.Object
+ alias Pleroma.Plugs.RateLimiter
alias Pleroma.User
alias Pleroma.Web.ActivityPub.ActivityPubController
- alias Pleroma.Web.ActivityPub.ObjectView
alias Pleroma.Web.ActivityPub.Visibility
alias Pleroma.Web.Endpoint
alias Pleroma.Web.Metadata.PlayerView
alias Pleroma.Web.Router
+ plug(Pleroma.Plugs.EnsureAuthenticatedPlug,
+ unless_func: &Pleroma.Web.FederatingPlug.federating?/1
+ )
+
plug(
- Pleroma.Plugs.RateLimiter,
- {:ap_routes, params: ["uuid"]} when action in [:object, :activity]
+ RateLimiter,
+ [name: :ap_routes, params: ["uuid"]] when action in [:object, :activity]
)
plug(
@@ -37,11 +41,9 @@ defmodule Pleroma.Web.OStatus.OStatusController do
with id <- o_status_url(conn, :object, uuid),
{_, %Activity{} = activity} <-
{:activity, Activity.get_create_by_object_ap_id_with_object(id)},
- {_, true} <- {:public?, Visibility.is_public?(activity)},
- %User{} = user <- User.get_cached_by_ap_id(activity.data["actor"]) do
+ {_, true} <- {:public?, Visibility.is_public?(activity)} do
case format do
- "html" -> redirect(conn, to: "/notice/#{activity.id}")
- _ -> represent_activity(conn, nil, activity, user)
+ _ -> redirect(conn, to: "/notice/#{activity.id}")
end
else
reason when reason in [{:public?, false}, {:activity, nil}] ->
@@ -60,11 +62,9 @@ defmodule Pleroma.Web.OStatus.OStatusController do
def activity(%{assigns: %{format: format}} = conn, %{"uuid" => uuid}) do
with id <- o_status_url(conn, :activity, uuid),
{_, %Activity{} = activity} <- {:activity, Activity.normalize(id)},
- {_, true} <- {:public?, Visibility.is_public?(activity)},
- %User{} = user <- User.get_cached_by_ap_id(activity.data["actor"]) do
+ {_, true} <- {:public?, Visibility.is_public?(activity)} do
case format do
- "html" -> redirect(conn, to: "/notice/#{activity.id}")
- _ -> represent_activity(conn, format, activity, user)
+ _ -> redirect(conn, to: "/notice/#{activity.id}")
end
else
reason when reason in [{:public?, false}, {:activity, nil}] ->
@@ -80,7 +80,15 @@ defmodule Pleroma.Web.OStatus.OStatusController do
{_, true} <- {:public?, Visibility.is_public?(activity)},
%User{} = user <- User.get_cached_by_ap_id(activity.data["actor"]) do
cond do
- format == "html" && activity.data["type"] == "Create" ->
+ format in ["json", "activity+json"] ->
+ if activity.local do
+ %{data: %{"id" => redirect_url}} = Object.normalize(activity)
+ redirect(conn, external: redirect_url)
+ else
+ {:error, :not_found}
+ end
+
+ activity.data["type"] == "Create" ->
%Object{} = object = Object.normalize(activity)
RedirectController.redirector_with_meta(
@@ -93,11 +101,8 @@ defmodule Pleroma.Web.OStatus.OStatusController do
}
)
- format == "html" ->
- RedirectController.redirector(conn, nil)
-
true ->
- represent_activity(conn, format, activity, user)
+ RedirectController.redirector(conn, nil)
end
else
reason when reason in [{:public?, false}, {:activity, nil}] ->
@@ -134,31 +139,13 @@ defmodule Pleroma.Web.OStatus.OStatusController do
end
end
- defp represent_activity(
- conn,
- "activity+json",
- %Activity{data: %{"type" => "Create"}} = activity,
- _user
- ) do
- object = Object.normalize(activity)
-
- conn
- |> put_resp_header("content-type", "application/activity+json")
- |> put_view(ObjectView)
- |> render("object.json", %{object: object})
- end
-
- defp represent_activity(_conn, _, _, _) do
- {:error, :not_found}
- end
-
- def errors(conn, {:error, :not_found}) do
+ defp errors(conn, {:error, :not_found}) do
render_error(conn, :not_found, "Not found")
end
- def errors(conn, {:fetch_user, nil}), do: errors(conn, {:error, :not_found})
+ defp errors(conn, {:fetch_user, nil}), do: errors(conn, {:error, :not_found})
- def errors(conn, _) do
+ defp errors(conn, _) do
render_error(conn, :internal_server_error, "Something went wrong")
end
end
diff --git a/lib/pleroma/web/pleroma_api/controllers/account_controller.ex b/lib/pleroma/web/pleroma_api/controllers/account_controller.ex
index 9012e2175..0a3f45620 100644
--- a/lib/pleroma/web/pleroma_api/controllers/account_controller.ex
+++ b/lib/pleroma/web/pleroma_api/controllers/account_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.PleromaAPI.AccountController do
@@ -9,16 +9,28 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do
only: [json_response: 3, add_link_headers: 2, assign_account_by_id: 2]
alias Ecto.Changeset
+ alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.Plugs.RateLimiter
alias Pleroma.User
alias Pleroma.Web.ActivityPub.ActivityPub
- alias Pleroma.Web.CommonAPI
alias Pleroma.Web.MastodonAPI.StatusView
require Pleroma.Constants
plug(
+ OpenApiSpex.Plug.PutApiSpec,
+ [module: Pleroma.Web.ApiSpec] when action == :confirmation_resend
+ )
+
+ plug(Pleroma.Web.ApiSpec.CastAndValidate)
+
+ plug(
+ :skip_plug,
+ [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] when action == :confirmation_resend
+ )
+
+ plug(
OAuthScopesPlug,
%{scopes: ["follow", "write:follows"]} when action in [:subscribe, :unsubscribe]
)
@@ -34,21 +46,21 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do
]
)
- plug(OAuthScopesPlug, %{scopes: ["read:favourites"]} when action == :favourites)
-
- # An extra safety measure for possible actions not guarded by OAuth permissions specification
plug(
- Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
- when action != :confirmation_resend
+ OAuthScopesPlug,
+ %{scopes: ["read:favourites"], fallback: :proceed_unauthenticated} when action == :favourites
)
- plug(RateLimiter, :account_confirmation_resend when action == :confirmation_resend)
+ plug(RateLimiter, [name: :account_confirmation_resend] when action == :confirmation_resend)
+
plug(:assign_account_by_id when action in [:favourites, :subscribe, :unsubscribe])
plug(:put_view, Pleroma.Web.MastodonAPI.AccountView)
+ defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.PleromaAccountOperation
+
@doc "POST /api/v1/pleroma/accounts/confirmation_resend"
def confirmation_resend(conn, params) do
- nickname_or_email = params["email"] || params["nickname"]
+ nickname_or_email = params[:email] || params[:nickname]
with %User{} = user <- User.get_by_nickname_or_email(nickname_or_email),
{:ok, _} <- User.try_send_confirmation_email(user) do
@@ -57,42 +69,33 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do
end
@doc "PATCH /api/v1/pleroma/accounts/update_avatar"
- def update_avatar(%{assigns: %{user: user}} = conn, %{"img" => ""}) do
- {:ok, user} =
+ def update_avatar(%{assigns: %{user: user}, body_params: %{img: ""}} = conn, _) do
+ {:ok, _user} =
user
|> Changeset.change(%{avatar: nil})
|> User.update_and_set_cache()
- CommonAPI.update(user)
-
json(conn, %{url: nil})
end
- def update_avatar(%{assigns: %{user: user}} = conn, params) do
+ def update_avatar(%{assigns: %{user: user}, body_params: params} = conn, _params) do
{:ok, %{data: data}} = ActivityPub.upload(params, type: :avatar)
- {:ok, user} = user |> Changeset.change(%{avatar: data}) |> User.update_and_set_cache()
+ {:ok, _user} = user |> Changeset.change(%{avatar: data}) |> User.update_and_set_cache()
%{"url" => [%{"href" => href} | _]} = data
- CommonAPI.update(user)
-
json(conn, %{url: href})
end
@doc "PATCH /api/v1/pleroma/accounts/update_banner"
- def update_banner(%{assigns: %{user: user}} = conn, %{"banner" => ""}) do
- new_info = %{"banner" => %{}}
-
- with {:ok, user} <- User.update_info(user, &User.Info.profile_update(&1, new_info)) do
- CommonAPI.update(user)
+ def update_banner(%{assigns: %{user: user}, body_params: %{banner: ""}} = conn, _) do
+ with {:ok, _user} <- User.update_banner(user, %{}) do
json(conn, %{url: nil})
end
end
- def update_banner(%{assigns: %{user: user}} = conn, params) do
- with {:ok, object} <- ActivityPub.upload(%{"img" => params["banner"]}, type: :banner),
- new_info <- %{"banner" => object.data},
- {:ok, user} <- User.update_info(user, &User.Info.profile_update(&1, new_info)) do
- CommonAPI.update(user)
+ def update_banner(%{assigns: %{user: user}, body_params: params} = conn, _) do
+ with {:ok, object} <- ActivityPub.upload(%{img: params[:banner]}, type: :banner),
+ {:ok, _user} <- User.update_banner(user, object.data) do
%{"url" => [%{"href" => href} | _]} = object.data
json(conn, %{url: href})
@@ -100,18 +103,15 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do
end
@doc "PATCH /api/v1/pleroma/accounts/update_background"
- def update_background(%{assigns: %{user: user}} = conn, %{"img" => ""}) do
- new_info = %{"background" => %{}}
-
- with {:ok, _user} <- User.update_info(user, &User.Info.profile_update(&1, new_info)) do
+ def update_background(%{assigns: %{user: user}, body_params: %{img: ""}} = conn, _) do
+ with {:ok, _user} <- User.update_background(user, %{}) do
json(conn, %{url: nil})
end
end
- def update_background(%{assigns: %{user: user}} = conn, params) do
+ def update_background(%{assigns: %{user: user}, body_params: params} = conn, _) do
with {:ok, object} <- ActivityPub.upload(params, type: :background),
- new_info <- %{"background" => object.data},
- {:ok, _user} <- User.update_info(user, &User.Info.profile_update(&1, new_info)) do
+ {:ok, _user} <- User.update_background(user, object.data) do
%{"url" => [%{"href" => href} | _]} = object.data
json(conn, %{url: href})
@@ -119,20 +119,21 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do
end
@doc "GET /api/v1/pleroma/accounts/:id/favourites"
- def favourites(%{assigns: %{account: %{info: %{hide_favorites: true}}}} = conn, _params) do
+ def favourites(%{assigns: %{account: %{hide_favorites: true}}} = conn, _params) do
render_error(conn, :forbidden, "Can't get favorites")
end
def favourites(%{assigns: %{user: for_user, account: user}} = conn, params) do
params =
params
+ |> Map.new(fn {key, value} -> {to_string(key), value} end)
|> Map.put("type", "Create")
|> Map.put("favorited_by", user.ap_id)
|> Map.put("blocking_user", for_user)
recipients =
if for_user do
- [Pleroma.Constants.as_public()] ++ [for_user.ap_id | for_user.following]
+ [Pleroma.Constants.as_public()] ++ [for_user.ap_id | User.following(for_user)]
else
[Pleroma.Constants.as_public()]
end
@@ -145,12 +146,16 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do
conn
|> add_link_headers(activities)
|> put_view(StatusView)
- |> render("index.json", activities: activities, for: for_user, as: :activity)
+ |> render("index.json",
+ activities: activities,
+ for: for_user,
+ as: :activity
+ )
end
@doc "POST /api/v1/pleroma/accounts/:id/subscribe"
def subscribe(%{assigns: %{user: user, account: subscription_target}} = conn, _params) do
- with {:ok, subscription_target} <- User.subscribe(user, subscription_target) do
+ with {:ok, _subscription} <- User.subscribe(user, subscription_target) do
render(conn, "relationship.json", user: user, target: subscription_target)
else
{:error, message} -> json_response(conn, :forbidden, %{error: message})
@@ -159,7 +164,7 @@ defmodule Pleroma.Web.PleromaAPI.AccountController do
@doc "POST /api/v1/pleroma/accounts/:id/unsubscribe"
def unsubscribe(%{assigns: %{user: user, account: subscription_target}} = conn, _params) do
- with {:ok, subscription_target} <- User.unsubscribe(user, subscription_target) do
+ with {:ok, _subscription} <- User.unsubscribe(user, subscription_target) do
render(conn, "relationship.json", user: user, target: subscription_target)
else
{:error, message} -> json_response(conn, :forbidden, %{error: message})
diff --git a/lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex b/lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex
index a474d41d4..d276b96a4 100644
--- a/lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex
+++ b/lib/pleroma/web/pleroma_api/controllers/emoji_api_controller.ex
@@ -1,191 +1,93 @@
defmodule Pleroma.Web.PleromaAPI.EmojiAPIController do
use Pleroma.Web, :controller
- alias Pleroma.Plugs.OAuthScopesPlug
-
- require Logger
+ alias Pleroma.Emoji.Pack
plug(
- OAuthScopesPlug,
- %{scopes: ["write"]}
+ Pleroma.Plugs.OAuthScopesPlug,
+ %{scopes: ["write"], admin: true}
when action in [
+ :import_from_filesystem,
+ :remote,
+ :download,
:create,
+ :update,
:delete,
- :download_from,
- :list_from,
- :import_from_fs,
+ :add_file,
:update_file,
- :update_metadata
+ :delete_file
]
)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
-
- def emoji_dir_path do
- Path.join(
- Pleroma.Config.get!([:instance, :static_dir]),
- "emoji"
- )
- end
-
- @doc """
- Lists packs from the remote instance.
-
- Since JS cannot ask remote instances for their packs due to CPS, it has to
- be done by the server
- """
- def list_from(conn, %{"instance_address" => address}) do
- address = String.trim(address)
-
- if shareable_packs_available(address) do
- list_resp =
- "#{address}/api/pleroma/emoji/packs" |> Tesla.get!() |> Map.get(:body) |> Jason.decode!()
+ plug(
+ :skip_plug,
+ [Pleroma.Plugs.OAuthScopesPlug, Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug]
+ when action in [:archive, :show, :list]
+ )
- json(conn, list_resp)
+ def remote(conn, %{"url" => url}) do
+ with {:ok, packs} <- Pack.list_remote(url) do
+ json(conn, packs)
else
- conn
- |> put_status(:internal_server_error)
- |> json(%{error: "The requested instance does not support sharing emoji packs"})
+ {:shareable, _} ->
+ conn
+ |> put_status(:internal_server_error)
+ |> json(%{error: "The requested instance does not support sharing emoji packs"})
end
end
- @doc """
- Lists the packs available on the instance as JSON.
-
- The information is public and does not require authentification. The format is
- a map of "pack directory name" to pack.json contents.
- """
- def list_packs(conn, _params) do
- # Create the directory first if it does not exist. This is probably the first request made
- # with the API so it should be sufficient
- with {:create_dir, :ok} <- {:create_dir, File.mkdir_p(emoji_dir_path())},
- {:ls, {:ok, results}} <- {:ls, File.ls(emoji_dir_path())} do
- pack_infos =
- results
- |> Enum.filter(&has_pack_json?/1)
- |> Enum.map(&load_pack/1)
- # Check if all the files are in place and can be sent
- |> Enum.map(&validate_pack/1)
- # Transform into a map of pack-name => pack-data
- |> Enum.into(%{})
-
- json(conn, pack_infos)
+ def list(conn, _params) do
+ emoji_path =
+ Path.join(
+ Pleroma.Config.get!([:instance, :static_dir]),
+ "emoji"
+ )
+
+ with {:ok, packs} <- Pack.list_local() do
+ json(conn, packs)
else
{:create_dir, {:error, e}} ->
conn
|> put_status(:internal_server_error)
- |> json(%{error: "Failed to create the emoji pack directory at #{emoji_dir_path()}: #{e}"})
+ |> json(%{error: "Failed to create the emoji pack directory at #{emoji_path}: #{e}"})
{:ls, {:error, e}} ->
conn
|> put_status(:internal_server_error)
|> json(%{
- error:
- "Failed to get the contents of the emoji pack directory at #{emoji_dir_path()}: #{e}"
+ error: "Failed to get the contents of the emoji pack directory at #{emoji_path}: #{e}"
})
end
end
- defp has_pack_json?(file) do
- dir_path = Path.join(emoji_dir_path(), file)
- # Filter to only use the pack.json packs
- File.dir?(dir_path) and File.exists?(Path.join(dir_path, "pack.json"))
- end
-
- defp load_pack(pack_name) do
- pack_path = Path.join(emoji_dir_path(), pack_name)
- pack_file = Path.join(pack_path, "pack.json")
+ def show(conn, %{"name" => name}) do
+ name = String.trim(name)
- {pack_name, Jason.decode!(File.read!(pack_file))}
- end
-
- defp validate_pack({name, pack}) do
- pack_path = Path.join(emoji_dir_path(), name)
-
- if can_download?(pack, pack_path) do
- archive_for_sha = make_archive(name, pack, pack_path)
- archive_sha = :crypto.hash(:sha256, archive_for_sha) |> Base.encode16()
-
- pack =
- pack
- |> put_in(["pack", "can-download"], true)
- |> put_in(["pack", "download-sha256"], archive_sha)
-
- {name, pack}
+ with {:ok, pack} <- Pack.show(name) do
+ json(conn, pack)
else
- {name, put_in(pack, ["pack", "can-download"], false)}
- end
- end
-
- defp can_download?(pack, pack_path) do
- # If the pack is set as shared, check if it can be downloaded
- # That means that when asked, the pack can be packed and sent to the remote
- # Otherwise, they'd have to download it from external-src
- pack["pack"]["share-files"] &&
- Enum.all?(pack["files"], fn {_, path} ->
- File.exists?(Path.join(pack_path, path))
- end)
- end
-
- defp create_archive_and_cache(name, pack, pack_dir, md5) do
- files =
- ['pack.json'] ++
- (pack["files"] |> Enum.map(fn {_, path} -> to_charlist(path) end))
-
- {:ok, {_, zip_result}} = :zip.zip('#{name}.zip', files, [:memory, cwd: to_charlist(pack_dir)])
-
- cache_seconds_per_file = Pleroma.Config.get!([:emoji, :shared_pack_cache_seconds_per_file])
- cache_ms = :timer.seconds(cache_seconds_per_file * Enum.count(files))
-
- Cachex.put!(
- :emoji_packs_cache,
- name,
- # if pack.json MD5 changes, the cache is not valid anymore
- %{pack_json_md5: md5, pack_data: zip_result},
- # Add a minute to cache time for every file in the pack
- ttl: cache_ms
- )
-
- Logger.debug("Created an archive for the '#{name}' emoji pack, \
-keeping it in cache for #{div(cache_ms, 1000)}s")
-
- zip_result
- end
-
- defp make_archive(name, pack, pack_dir) do
- # Having a different pack.json md5 invalidates cache
- pack_file_md5 = :crypto.hash(:md5, File.read!(Path.join(pack_dir, "pack.json")))
-
- case Cachex.get!(:emoji_packs_cache, name) do
- %{pack_file_md5: ^pack_file_md5, pack_data: zip_result} ->
- Logger.debug("Using cache for the '#{name}' shared emoji pack")
- zip_result
+ {:loaded, _} ->
+ conn
+ |> put_status(:not_found)
+ |> json(%{error: "Pack #{name} does not exist"})
- _ ->
- create_archive_and_cache(name, pack, pack_dir, pack_file_md5)
+ {:error, :empty_values} ->
+ conn
+ |> put_status(:bad_request)
+ |> json(%{error: "pack name cannot be empty"})
end
end
- @doc """
- An endpoint for other instances (via admin UI) or users (via browser)
- to download packs that the instance shares.
- """
- def download_shared(conn, %{"name" => name}) do
- pack_dir = Path.join(emoji_dir_path(), name)
- pack_file = Path.join(pack_dir, "pack.json")
-
- with {_, true} <- {:exists?, File.exists?(pack_file)},
- pack = Jason.decode!(File.read!(pack_file)),
- {_, true} <- {:can_download?, can_download?(pack, pack_dir)} do
- zip_result = make_archive(name, pack, pack_dir)
- send_download(conn, {:binary, zip_result}, filename: "#{name}.zip")
+ def archive(conn, %{"name" => name}) do
+ with {:ok, archive} <- Pack.get_archive(name) do
+ send_download(conn, {:binary, archive}, filename: "#{name}.zip")
else
{:can_download?, _} ->
conn
|> put_status(:forbidden)
|> json(%{
- error: "Pack #{name} cannot be downloaded from this instance, either pack sharing\
- was disabled for this pack or some files are missing"
+ error:
+ "Pack #{name} cannot be downloaded from this instance, either pack sharing was disabled for this pack or some files are missing"
})
{:exists?, _} ->
@@ -195,396 +97,201 @@ keeping it in cache for #{div(cache_ms, 1000)}s")
end
end
- defp shareable_packs_available(address) do
- "#{address}/.well-known/nodeinfo"
- |> Tesla.get!()
- |> Map.get(:body)
- |> Jason.decode!()
- |> Map.get("links")
- |> List.last()
- |> Map.get("href")
- # Get the actual nodeinfo address and fetch it
- |> Tesla.get!()
- |> Map.get(:body)
- |> Jason.decode!()
- |> get_in(["metadata", "features"])
- |> Enum.member?("shareable_emoji_packs")
- end
-
- @doc """
- An admin endpoint to request downloading a pack named `pack_name` from the instance
- `instance_address`.
-
- If the requested instance's admin chose to share the pack, it will be downloaded
- from that instance, otherwise it will be downloaded from the fallback source, if there is one.
- """
- def download_from(conn, %{"instance_address" => address, "pack_name" => name} = data) do
- address = String.trim(address)
-
- if shareable_packs_available(address) do
- full_pack =
- "#{address}/api/pleroma/emoji/packs/list"
- |> Tesla.get!()
- |> Map.get(:body)
- |> Jason.decode!()
- |> Map.get(name)
-
- pack_info_res =
- case full_pack["pack"] do
- %{"share-files" => true, "can-download" => true, "download-sha256" => sha} ->
- {:ok,
- %{
- sha: sha,
- uri: "#{address}/api/pleroma/emoji/packs/download_shared/#{name}"
- }}
-
- %{"fallback-src" => src, "fallback-src-sha256" => sha} when is_binary(src) ->
- {:ok,
- %{
- sha: sha,
- uri: src,
- fallback: true
- }}
-
- _ ->
- {:error,
- "The pack was not set as shared and there is no fallback src to download from"}
- end
-
- with {:ok, %{sha: sha, uri: uri} = pinfo} <- pack_info_res,
- %{body: emoji_archive} <- Tesla.get!(uri),
- {_, true} <- {:checksum, Base.decode16!(sha) == :crypto.hash(:sha256, emoji_archive)} do
- local_name = data["as"] || name
- pack_dir = Path.join(emoji_dir_path(), local_name)
- File.mkdir_p!(pack_dir)
-
- files = Enum.map(full_pack["files"], fn {_, path} -> to_charlist(path) end)
- # Fallback cannot contain a pack.json file
- files = if pinfo[:fallback], do: files, else: ['pack.json'] ++ files
-
- {:ok, _} = :zip.unzip(emoji_archive, cwd: to_charlist(pack_dir), file_list: files)
-
- # Fallback can't contain a pack.json file, since that would cause the fallback-src-sha256
- # in it to depend on itself
- if pinfo[:fallback] do
- pack_file_path = Path.join(pack_dir, "pack.json")
-
- File.write!(pack_file_path, Jason.encode!(full_pack, pretty: true))
- end
-
- json(conn, "ok")
- else
- {:error, e} ->
- conn |> put_status(:internal_server_error) |> json(%{error: e})
-
- {:checksum, _} ->
- conn
- |> put_status(:internal_server_error)
- |> json(%{error: "SHA256 for the pack doesn't match the one sent by the server"})
- end
+ def download(conn, %{"url" => url, "name" => name} = params) do
+ with :ok <- Pack.download(name, url, params["as"]) do
+ json(conn, "ok")
else
- conn
- |> put_status(:internal_server_error)
- |> json(%{error: "The requested instance does not support sharing emoji packs"})
+ {:shareable, _} ->
+ conn
+ |> put_status(:internal_server_error)
+ |> json(%{error: "The requested instance does not support sharing emoji packs"})
+
+ {:checksum, _} ->
+ conn
+ |> put_status(:internal_server_error)
+ |> json(%{error: "SHA256 for the pack doesn't match the one sent by the server"})
+
+ {:error, e} ->
+ conn
+ |> put_status(:internal_server_error)
+ |> json(%{error: e})
end
end
- @doc """
- Creates an empty pack named `name` which then can be updated via the admin UI.
- """
def create(conn, %{"name" => name}) do
- pack_dir = Path.join(emoji_dir_path(), name)
+ name = String.trim(name)
- if not File.exists?(pack_dir) do
- File.mkdir_p!(pack_dir)
-
- pack_file_p = Path.join(pack_dir, "pack.json")
+ with :ok <- Pack.create(name) do
+ json(conn, "ok")
+ else
+ {:error, :eexist} ->
+ conn
+ |> put_status(:conflict)
+ |> json(%{error: "A pack named \"#{name}\" already exists"})
- File.write!(
- pack_file_p,
- Jason.encode!(%{pack: %{}, files: %{}}, pretty: true)
- )
+ {:error, :empty_values} ->
+ conn
+ |> put_status(:bad_request)
+ |> json(%{error: "pack name cannot be empty"})
- conn |> json("ok")
- else
- conn
- |> put_status(:conflict)
- |> json(%{error: "A pack named \"#{name}\" already exists"})
+ {:error, _} ->
+ render_error(
+ conn,
+ :internal_server_error,
+ "Unexpected error occurred while creating pack."
+ )
end
end
- @doc """
- Deletes the pack `name` and all it's files.
- """
def delete(conn, %{"name" => name}) do
- pack_dir = Path.join(emoji_dir_path(), name)
+ name = String.trim(name)
- case File.rm_rf(pack_dir) do
- {:ok, _} ->
- conn |> json("ok")
+ with {:ok, deleted} when deleted != [] <- Pack.delete(name) do
+ json(conn, "ok")
+ else
+ {:ok, []} ->
+ conn
+ |> put_status(:not_found)
+ |> json(%{error: "Pack #{name} does not exist"})
- {:error, _} ->
+ {:error, :empty_values} ->
+ conn
+ |> put_status(:bad_request)
+ |> json(%{error: "pack name cannot be empty"})
+
+ {:error, _, _} ->
conn
|> put_status(:internal_server_error)
|> json(%{error: "Couldn't delete the pack #{name}"})
end
end
- @doc """
- An endpoint to update `pack_names`'s metadata.
-
- `new_data` is the new metadata for the pack, that will replace the old metadata.
- """
- def update_metadata(conn, %{"pack_name" => name, "new_data" => new_data}) do
- pack_file_p = Path.join([emoji_dir_path(), name, "pack.json"])
-
- full_pack = Jason.decode!(File.read!(pack_file_p))
-
- # The new fallback-src is in the new data and it's not the same as it was in the old data
- should_update_fb_sha =
- not is_nil(new_data["fallback-src"]) and
- new_data["fallback-src"] != full_pack["pack"]["fallback-src"]
-
- with {_, true} <- {:should_update?, should_update_fb_sha},
- %{body: pack_arch} <- Tesla.get!(new_data["fallback-src"]),
- {:ok, flist} <- :zip.unzip(pack_arch, [:memory]),
- {_, true} <- {:has_all_files?, has_all_files?(full_pack, flist)} do
- fallback_sha = :crypto.hash(:sha256, pack_arch) |> Base.encode16()
-
- new_data = Map.put(new_data, "fallback-src-sha256", fallback_sha)
- update_metadata_and_send(conn, full_pack, new_data, pack_file_p)
+ def update(conn, %{"name" => name, "metadata" => metadata}) do
+ with {:ok, pack} <- Pack.update_metadata(name, metadata) do
+ json(conn, pack.pack)
else
- {:should_update?, _} ->
- update_metadata_and_send(conn, full_pack, new_data, pack_file_p)
-
{:has_all_files?, _} ->
conn
|> put_status(:bad_request)
|> json(%{error: "The fallback archive does not have all files specified in pack.json"})
- end
- end
- # Check if all files from the pack.json are in the archive
- defp has_all_files?(%{"files" => files}, flist) do
- Enum.all?(files, fn {_, from_manifest} ->
- Enum.find(flist, fn {from_archive, _} ->
- to_string(from_archive) == from_manifest
- end)
- end)
- end
-
- defp update_metadata_and_send(conn, full_pack, new_data, pack_file_p) do
- full_pack = Map.put(full_pack, "pack", new_data)
- File.write!(pack_file_p, Jason.encode!(full_pack, pretty: true))
-
- # Send new data back with fallback sha filled
- json(conn, new_data)
- end
-
- defp get_filename(%{"filename" => filename}), do: filename
-
- defp get_filename(%{"file" => file}) do
- case file do
- %Plug.Upload{filename: filename} -> filename
- url when is_binary(url) -> Path.basename(url)
+ {:error, _} ->
+ render_error(
+ conn,
+ :internal_server_error,
+ "Unexpected error occurred while updating pack metadata."
+ )
end
end
- defp empty?(str), do: String.trim(str) == ""
-
- defp update_file_and_send(conn, updated_full_pack, pack_file_p) do
- # Write the emoji pack file
- File.write!(pack_file_p, Jason.encode!(updated_full_pack, pretty: true))
+ def add_file(conn, %{"name" => name} = params) do
+ filename = params["filename"] || get_filename(params["file"])
+ shortcode = params["shortcode"] || Path.basename(filename, Path.extname(filename))
- # Return the modified file list
- json(conn, updated_full_pack["files"])
- end
-
- @doc """
- Updates a file in a pack.
-
- Updating can mean three things:
-
- - `add` adds an emoji named `shortcode` to the pack `pack_name`,
- that means that the emoji file needs to be uploaded with the request
- (thus requiring it to be a multipart request) and be named `file`.
- There can also be an optional `filename` that will be the new emoji file name
- (if it's not there, the name will be taken from the uploaded file).
- - `update` changes emoji shortcode (from `shortcode` to `new_shortcode` or moves the file
- (from the current filename to `new_filename`)
- - `remove` removes the emoji named `shortcode` and it's associated file
- """
-
- # Add
- def update_file(
- conn,
- %{"pack_name" => pack_name, "action" => "add", "shortcode" => shortcode} = params
- ) do
- pack_dir = Path.join(emoji_dir_path(), pack_name)
- pack_file_p = Path.join(pack_dir, "pack.json")
-
- full_pack = Jason.decode!(File.read!(pack_file_p))
-
- with {_, false} <- {:has_shortcode, Map.has_key?(full_pack["files"], shortcode)},
- filename <- get_filename(params),
- false <- empty?(shortcode),
- false <- empty?(filename) do
- file_path = Path.join(pack_dir, filename)
-
- # If the name contains directories, create them
- if String.contains?(file_path, "/") do
- File.mkdir_p!(Path.dirname(file_path))
- end
-
- case params["file"] do
- %Plug.Upload{path: upload_path} ->
- # Copy the uploaded file from the temporary directory
- File.copy!(upload_path, file_path)
-
- url when is_binary(url) ->
- # Download and write the file
- file_contents = Tesla.get!(url).body
- File.write!(file_path, file_contents)
- end
-
- updated_full_pack = put_in(full_pack, ["files", shortcode], filename)
- update_file_and_send(conn, updated_full_pack, pack_file_p)
+ with {:ok, pack} <- Pack.add_file(name, shortcode, filename, params["file"]) do
+ json(conn, pack.files)
else
- {:has_shortcode, _} ->
+ {:exists, _} ->
conn
|> put_status(:conflict)
|> json(%{error: "An emoji with the \"#{shortcode}\" shortcode already exists"})
- true ->
+ {:loaded, _} ->
conn
|> put_status(:bad_request)
- |> json(%{error: "shortcode or filename cannot be empty"})
- end
- end
+ |> json(%{error: "pack \"#{name}\" is not found"})
- # Remove
- def update_file(conn, %{
- "pack_name" => pack_name,
- "action" => "remove",
- "shortcode" => shortcode
- }) do
- pack_dir = Path.join(emoji_dir_path(), pack_name)
- pack_file_p = Path.join(pack_dir, "pack.json")
+ {:error, :empty_values} ->
+ conn
+ |> put_status(:bad_request)
+ |> json(%{error: "pack name, shortcode or filename cannot be empty"})
- full_pack = Jason.decode!(File.read!(pack_file_p))
+ {:error, _} ->
+ render_error(
+ conn,
+ :internal_server_error,
+ "Unexpected error occurred while adding file to pack."
+ )
+ end
+ end
- if Map.has_key?(full_pack["files"], shortcode) do
- {emoji_file_path, updated_full_pack} = pop_in(full_pack, ["files", shortcode])
+ def update_file(conn, %{"name" => name, "shortcode" => shortcode} = params) do
+ new_shortcode = params["new_shortcode"]
+ new_filename = params["new_filename"]
+ force = params["force"] == true
- emoji_file_path = Path.join(pack_dir, emoji_file_path)
+ with {:ok, pack} <- Pack.update_file(name, shortcode, new_shortcode, new_filename, force) do
+ json(conn, pack.files)
+ else
+ {:exists, _} ->
+ conn
+ |> put_status(:bad_request)
+ |> json(%{error: "Emoji \"#{shortcode}\" does not exist"})
- # Delete the emoji file
- File.rm!(emoji_file_path)
+ {:not_used, _} ->
+ conn
+ |> put_status(:conflict)
+ |> json(%{
+ error:
+ "New shortcode \"#{new_shortcode}\" is already used. If you want to override emoji use 'force' option"
+ })
- # If the old directory has no more files, remove it
- if String.contains?(emoji_file_path, "/") do
- dir = Path.dirname(emoji_file_path)
+ {:loaded, _} ->
+ conn
+ |> put_status(:bad_request)
+ |> json(%{error: "pack \"#{name}\" is not found"})
- if Enum.empty?(File.ls!(dir)) do
- File.rmdir!(dir)
- end
- end
+ {:error, :empty_values} ->
+ conn
+ |> put_status(:bad_request)
+ |> json(%{error: "new_shortcode or new_filename cannot be empty"})
- update_file_and_send(conn, updated_full_pack, pack_file_p)
- else
- conn
- |> put_status(:bad_request)
- |> json(%{error: "Emoji \"#{shortcode}\" does not exist"})
+ {:error, _} ->
+ render_error(
+ conn,
+ :internal_server_error,
+ "Unexpected error occurred while updating file in pack."
+ )
end
end
- # Update
- def update_file(
- conn,
- %{"pack_name" => pack_name, "action" => "update", "shortcode" => shortcode} = params
- ) do
- pack_dir = Path.join(emoji_dir_path(), pack_name)
- pack_file_p = Path.join(pack_dir, "pack.json")
-
- full_pack = Jason.decode!(File.read!(pack_file_p))
-
- with {_, true} <- {:has_shortcode, Map.has_key?(full_pack["files"], shortcode)},
- %{"new_shortcode" => new_shortcode, "new_filename" => new_filename} <- params,
- false <- empty?(new_shortcode),
- false <- empty?(new_filename) do
- # First, remove the old shortcode, saving the old path
- {old_emoji_file_path, updated_full_pack} = pop_in(full_pack, ["files", shortcode])
- old_emoji_file_path = Path.join(pack_dir, old_emoji_file_path)
- new_emoji_file_path = Path.join(pack_dir, new_filename)
-
- # If the name contains directories, create them
- if String.contains?(new_emoji_file_path, "/") do
- File.mkdir_p!(Path.dirname(new_emoji_file_path))
- end
-
- # Move/Rename the old filename to a new filename
- # These are probably on the same filesystem, so just rename should work
- :ok = File.rename(old_emoji_file_path, new_emoji_file_path)
-
- # If the old directory has no more files, remove it
- if String.contains?(old_emoji_file_path, "/") do
- dir = Path.dirname(old_emoji_file_path)
-
- if Enum.empty?(File.ls!(dir)) do
- File.rmdir!(dir)
- end
- end
-
- # Then, put in the new shortcode with the new path
- updated_full_pack = put_in(updated_full_pack, ["files", new_shortcode], new_filename)
- update_file_and_send(conn, updated_full_pack, pack_file_p)
+ def delete_file(conn, %{"name" => name, "shortcode" => shortcode}) do
+ with {:ok, pack} <- Pack.delete_file(name, shortcode) do
+ json(conn, pack.files)
else
- {:has_shortcode, _} ->
+ {:exists, _} ->
conn
|> put_status(:bad_request)
|> json(%{error: "Emoji \"#{shortcode}\" does not exist"})
- true ->
+ {:loaded, _} ->
conn
|> put_status(:bad_request)
- |> json(%{error: "new_shortcode or new_filename cannot be empty"})
+ |> json(%{error: "pack \"#{name}\" is not found"})
- _ ->
+ {:error, :empty_values} ->
conn
|> put_status(:bad_request)
- |> json(%{error: "new_shortcode or new_file were not specified"})
- end
- end
+ |> json(%{error: "pack name or shortcode cannot be empty"})
- def update_file(conn, %{"action" => action}) do
- conn
- |> put_status(:bad_request)
- |> json(%{error: "Unknown action: #{action}"})
+ {:error, _} ->
+ render_error(
+ conn,
+ :internal_server_error,
+ "Unexpected error occurred while removing file from pack."
+ )
+ end
end
- @doc """
- Imports emoji from the filesystem.
-
- Importing means checking all the directories in the
- `$instance_static/emoji/` for directories which do not have
- `pack.json`. If one has an emoji.txt file, that file will be used
- to create a `pack.json` file with it's contents. If the directory has
- neither, all the files with specific configured extenstions will be
- assumed to be emojis and stored in the new `pack.json` file.
- """
- def import_from_fs(conn, _params) do
- with {:ok, results} <- File.ls(emoji_dir_path()) do
- imported_pack_names =
- results
- |> Enum.filter(fn file ->
- dir_path = Path.join(emoji_dir_path(), file)
- # Find the directories that do NOT have pack.json
- File.dir?(dir_path) and not File.exists?(Path.join(dir_path, "pack.json"))
- end)
- |> Enum.map(&write_pack_json_contents/1)
-
- json(conn, imported_pack_names)
+ def import_from_filesystem(conn, _params) do
+ with {:ok, names} <- Pack.import_from_filesystem() do
+ json(conn, names)
else
+ {:error, :no_read_write} ->
+ conn
+ |> put_status(:internal_server_error)
+ |> json(%{error: "Error: emoji pack directory must be writable"})
+
{:error, _} ->
conn
|> put_status(:internal_server_error)
@@ -592,44 +299,6 @@ keeping it in cache for #{div(cache_ms, 1000)}s")
end
end
- defp write_pack_json_contents(dir) do
- dir_path = Path.join(emoji_dir_path(), dir)
- emoji_txt_path = Path.join(dir_path, "emoji.txt")
-
- files_for_pack = files_for_pack(emoji_txt_path, dir_path)
- pack_json_contents = Jason.encode!(%{pack: %{}, files: files_for_pack})
-
- File.write!(Path.join(dir_path, "pack.json"), pack_json_contents)
-
- dir
- end
-
- defp files_for_pack(emoji_txt_path, dir_path) do
- if File.exists?(emoji_txt_path) do
- # There's an emoji.txt file, it's likely from a pack installed by the pack manager.
- # Make a pack.json file from the contents of that emoji.txt fileh
-
- # FIXME: Copy-pasted from Pleroma.Emoji/load_from_file_stream/2
-
- # Create a map of shortcodes to filenames from emoji.txt
- File.read!(emoji_txt_path)
- |> String.split("\n")
- |> Enum.map(&String.trim/1)
- |> Enum.map(fn line ->
- case String.split(line, ~r/,\s*/) do
- # This matches both strings with and without tags
- # and we don't care about tags here
- [name, file | _] -> {name, file}
- _ -> nil
- end
- end)
- |> Enum.filter(fn x -> not is_nil(x) end)
- |> Enum.into(%{})
- else
- # If there's no emoji.txt, assume all files
- # that are of certain extensions from the config are emojis and import them all
- pack_extensions = Pleroma.Config.get!([:emoji, :pack_extensions])
- Pleroma.Emoji.Loader.make_shortcode_to_file_map(dir_path, pack_extensions)
- end
- end
+ defp get_filename(%Plug.Upload{filename: filename}), do: filename
+ defp get_filename(url) when is_binary(url), do: Path.basename(url)
end
diff --git a/lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex b/lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex
index d71d72dd5..d4e0d8b7c 100644
--- a/lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex
+++ b/lib/pleroma/web/pleroma_api/controllers/mascot_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.PleromaAPI.MascotController do
@@ -12,8 +12,6 @@ defmodule Pleroma.Web.PleromaAPI.MascotController do
plug(OAuthScopesPlug, %{scopes: ["read:accounts"]} when action == :show)
plug(OAuthScopesPlug, %{scopes: ["write:accounts"]} when action != :show)
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
-
@doc "GET /api/v1/pleroma/mascot"
def show(%{assigns: %{user: user}} = conn, _params) do
json(conn, User.get_mascot(user))
@@ -24,9 +22,7 @@ defmodule Pleroma.Web.PleromaAPI.MascotController do
with {:ok, object} <- ActivityPub.upload(file, actor: User.ap_id(user)),
# Reject if not an image
%{type: "image"} = attachment <- render_attachment(object) do
- # Sure!
- # Save to the user's info
- {:ok, _user} = User.update_info(user, &User.Info.mascot_update(&1, attachment))
+ {:ok, _user} = User.mascot_update(user, attachment)
json(conn, attachment)
else
diff --git a/lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex b/lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex
index fc39abf05..e834133b2 100644
--- a/lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex
+++ b/lib/pleroma/web/pleroma_api/controllers/pleroma_api_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do
@@ -7,27 +7,110 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do
import Pleroma.Web.ControllerHelper, only: [add_link_headers: 2]
+ alias Pleroma.Activity
alias Pleroma.Conversation.Participation
alias Pleroma.Notification
+ alias Pleroma.Object
alias Pleroma.Plugs.OAuthScopesPlug
+ alias Pleroma.User
alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.CommonAPI
+ alias Pleroma.Web.MastodonAPI.AccountView
alias Pleroma.Web.MastodonAPI.ConversationView
alias Pleroma.Web.MastodonAPI.NotificationView
alias Pleroma.Web.MastodonAPI.StatusView
plug(
OAuthScopesPlug,
- %{scopes: ["read:statuses"]} when action in [:conversation, :conversation_statuses]
+ %{scopes: ["read:statuses"]}
+ when action in [:conversation, :conversation_statuses]
)
plug(
OAuthScopesPlug,
- %{scopes: ["write:conversations"]} when action == :update_conversation
+ %{scopes: ["read:statuses"], fallback: :proceed_unauthenticated}
+ when action == :emoji_reactions_by
)
- plug(OAuthScopesPlug, %{scopes: ["write:notifications"]} when action == :read_notification)
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["write:statuses"]}
+ when action in [:react_with_emoji, :unreact_with_emoji]
+ )
+
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["write:conversations"]}
+ when action in [:update_conversation, :mark_conversations_as_read]
+ )
+
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["write:notifications"]} when action == :mark_notifications_as_read
+ )
+
+ def emoji_reactions_by(%{assigns: %{user: user}} = conn, %{"id" => activity_id} = params) do
+ with %Activity{} = activity <- Activity.get_by_id_with_object(activity_id),
+ %Object{data: %{"reactions" => emoji_reactions}} when is_list(emoji_reactions) <-
+ Object.normalize(activity) do
+ reactions =
+ emoji_reactions
+ |> Enum.map(fn [emoji, user_ap_ids] ->
+ if params["emoji"] && params["emoji"] != emoji do
+ nil
+ else
+ users =
+ Enum.map(user_ap_ids, &User.get_cached_by_ap_id/1)
+ |> Enum.filter(fn
+ %{deactivated: false} -> true
+ _ -> false
+ end)
+
+ %{
+ name: emoji,
+ count: length(users),
+ accounts:
+ AccountView.render("index.json", %{
+ users: users,
+ for: user,
+ as: :user
+ }),
+ me: !!(user && user.ap_id in user_ap_ids)
+ }
+ end
+ end)
+ |> Enum.filter(& &1)
+
+ conn
+ |> json(reactions)
+ else
+ _e ->
+ conn
+ |> json([])
+ end
+ end
+
+ def react_with_emoji(%{assigns: %{user: user}} = conn, %{"id" => activity_id, "emoji" => emoji}) do
+ with {:ok, _activity} <- CommonAPI.react_with_emoji(activity_id, user, emoji),
+ activity <- Activity.get_by_id(activity_id) do
+ conn
+ |> put_view(StatusView)
+ |> render("show.json", %{activity: activity, for: user, as: :activity})
+ end
+ end
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ def unreact_with_emoji(%{assigns: %{user: user}} = conn, %{
+ "id" => activity_id,
+ "emoji" => emoji
+ }) do
+ with {:ok, _activity} <-
+ CommonAPI.unreact_with_emoji(activity_id, user, emoji),
+ activity <- Activity.get_by_id(activity_id) do
+ conn
+ |> put_view(StatusView)
+ |> render("show.json", %{activity: activity, for: user, as: :activity})
+ end
+ end
def conversation(%{assigns: %{user: user}} = conn, %{"id" => participation_id}) do
with %Participation{} = participation <- Participation.get(participation_id),
@@ -35,16 +118,20 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do
conn
|> put_view(ConversationView)
|> render("participation.json", %{participation: participation, for: user})
+ else
+ _error ->
+ conn
+ |> put_status(404)
+ |> json(%{"error" => "Unknown conversation id"})
end
end
def conversation_statuses(
- %{assigns: %{user: user}} = conn,
+ %{assigns: %{user: %{id: user_id} = user}} = conn,
%{"id" => participation_id} = params
) do
- participation = Participation.get(participation_id, preload: [:conversation])
-
- if user.id == participation.user_id do
+ with %Participation{user_id: ^user_id} = participation <-
+ Participation.get(participation_id, preload: [:conversation]) do
params =
params
|> Map.put("blocking_user", user)
@@ -53,13 +140,23 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do
activities =
participation.conversation.ap_id
- |> ActivityPub.fetch_activities_for_context(params)
+ |> ActivityPub.fetch_activities_for_context_query(params)
+ |> Pleroma.Pagination.fetch_paginated(Map.put(params, "total", false))
|> Enum.reverse()
conn
|> add_link_headers(activities)
|> put_view(StatusView)
- |> render("index.json", %{activities: activities, for: user, as: :activity})
+ |> render("index.json",
+ activities: activities,
+ for: user,
+ as: :activity
+ )
+ else
+ _error ->
+ conn
+ |> put_status(404)
+ |> json(%{"error" => "Unknown conversation id"})
end
end
@@ -67,20 +164,27 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do
%{assigns: %{user: user}} = conn,
%{"id" => participation_id, "recipients" => recipients}
) do
- participation =
- participation_id
- |> Participation.get()
-
- with true <- user.id == participation.user_id,
+ with %Participation{} = participation <- Participation.get(participation_id),
+ true <- user.id == participation.user_id,
{:ok, participation} <- Participation.set_recipients(participation, recipients) do
conn
|> put_view(ConversationView)
|> render("participation.json", %{participation: participation, for: user})
+ else
+ {:error, message} ->
+ conn
+ |> put_status(:bad_request)
+ |> json(%{"error" => message})
+
+ _error ->
+ conn
+ |> put_status(404)
+ |> json(%{"error" => "Unknown conversation id"})
end
end
- def read_conversations(%{assigns: %{user: user}} = conn, _params) do
- with {:ok, participations} <- Participation.mark_all_as_read(user) do
+ def mark_conversations_as_read(%{assigns: %{user: user}} = conn, _params) do
+ with {:ok, _, participations} <- Participation.mark_all_as_read(user) do
conn
|> add_link_headers(participations)
|> put_view(ConversationView)
@@ -88,7 +192,7 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do
end
end
- def read_notification(%{assigns: %{user: user}} = conn, %{"id" => notification_id}) do
+ def mark_notifications_as_read(%{assigns: %{user: user}} = conn, %{"id" => notification_id}) do
with {:ok, notification} <- Notification.read_one(user, notification_id) do
conn
|> put_view(NotificationView)
@@ -101,13 +205,16 @@ defmodule Pleroma.Web.PleromaAPI.PleromaAPIController do
end
end
- def read_notification(%{assigns: %{user: user}} = conn, %{"max_id" => max_id}) do
+ def mark_notifications_as_read(%{assigns: %{user: user}} = conn, %{"max_id" => max_id}) do
with notifications <- Notification.set_read_up_to(user, max_id) do
notifications = Enum.take(notifications, 80)
conn
|> put_view(NotificationView)
- |> render("index.json", %{notifications: notifications, for: user})
+ |> render("index.json",
+ notifications: notifications,
+ for: user
+ )
end
end
end
diff --git a/lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex b/lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex
index b74b3debc..22da6c0ad 100644
--- a/lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex
+++ b/lib/pleroma/web/pleroma_api/controllers/scrobble_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.PleromaAPI.ScrobbleController do
@@ -13,10 +13,12 @@ defmodule Pleroma.Web.PleromaAPI.ScrobbleController do
alias Pleroma.Web.CommonAPI
alias Pleroma.Web.MastodonAPI.StatusView
- plug(OAuthScopesPlug, %{scopes: ["read"]} when action == :user_scrobbles)
- plug(OAuthScopesPlug, %{scopes: ["write"]} when action != :user_scrobbles)
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["read"], fallback: :proceed_unauthenticated} when action == :user_scrobbles
+ )
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ plug(OAuthScopesPlug, %{scopes: ["write"]} when action != :user_scrobbles)
def new_scrobble(%{assigns: %{user: user}} = conn, %{"title" => _} = params) do
params =
diff --git a/lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex b/lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex
new file mode 100644
index 000000000..eb9989cdf
--- /dev/null
+++ b/lib/pleroma/web/pleroma_api/controllers/two_factor_authentication_controller.ex
@@ -0,0 +1,133 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.PleromaAPI.TwoFactorAuthenticationController do
+ @moduledoc "The module represents actions to manage MFA"
+ use Pleroma.Web, :controller
+
+ import Pleroma.Web.ControllerHelper, only: [json_response: 3]
+
+ alias Pleroma.MFA
+ alias Pleroma.MFA.TOTP
+ alias Pleroma.Plugs.OAuthScopesPlug
+ alias Pleroma.Web.CommonAPI.Utils
+
+ plug(OAuthScopesPlug, %{scopes: ["read:security"]} when action in [:settings])
+
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["write:security"]} when action in [:setup, :confirm, :disable, :backup_codes]
+ )
+
+ @doc """
+ Gets user multi factor authentication settings
+
+ ## Endpoint
+ GET /api/pleroma/accounts/mfa
+
+ """
+ def settings(%{assigns: %{user: user}} = conn, _params) do
+ json(conn, %{settings: MFA.mfa_settings(user)})
+ end
+
+ @doc """
+ Prepare setup mfa method
+
+ ## Endpoint
+ GET /api/pleroma/accounts/mfa/setup/[:method]
+
+ """
+ def setup(%{assigns: %{user: user}} = conn, %{"method" => "totp"} = _params) do
+ with {:ok, user} <- MFA.setup_totp(user),
+ %{secret: secret} = _ <- user.multi_factor_authentication_settings.totp do
+ provisioning_uri = TOTP.provisioning_uri(secret, "#{user.email}")
+
+ json(conn, %{provisioning_uri: provisioning_uri, key: secret})
+ else
+ {:error, message} ->
+ json_response(conn, :unprocessable_entity, %{error: message})
+ end
+ end
+
+ def setup(conn, _params) do
+ json_response(conn, :bad_request, %{error: "undefined method"})
+ end
+
+ @doc """
+ Confirms setup and enable mfa method
+
+ ## Endpoint
+ POST /api/pleroma/accounts/mfa/confirm/:method
+
+ - params:
+ `code` - confirmation code
+ `password` - current password
+ """
+ def confirm(
+ %{assigns: %{user: user}} = conn,
+ %{"method" => "totp", "password" => _, "code" => _} = params
+ ) do
+ with {:ok, _user} <- Utils.confirm_current_password(user, params["password"]),
+ {:ok, _user} <- MFA.confirm_totp(user, params) do
+ json(conn, %{})
+ else
+ {:error, message} ->
+ json_response(conn, :unprocessable_entity, %{error: message})
+ end
+ end
+
+ def confirm(conn, _) do
+ json_response(conn, :bad_request, %{error: "undefined mfa method"})
+ end
+
+ @doc """
+ Disable mfa method and disable mfa if need.
+ """
+ def disable(%{assigns: %{user: user}} = conn, %{"method" => "totp"} = params) do
+ with {:ok, user} <- Utils.confirm_current_password(user, params["password"]),
+ {:ok, _user} <- MFA.disable_totp(user) do
+ json(conn, %{})
+ else
+ {:error, message} ->
+ json_response(conn, :unprocessable_entity, %{error: message})
+ end
+ end
+
+ def disable(%{assigns: %{user: user}} = conn, %{"method" => "mfa"} = params) do
+ with {:ok, user} <- Utils.confirm_current_password(user, params["password"]),
+ {:ok, _user} <- MFA.disable(user) do
+ json(conn, %{})
+ else
+ {:error, message} ->
+ json_response(conn, :unprocessable_entity, %{error: message})
+ end
+ end
+
+ def disable(conn, _) do
+ json_response(conn, :bad_request, %{error: "undefined mfa method"})
+ end
+
+ @doc """
+ Generates backup codes.
+
+ ## Endpoint
+ GET /api/pleroma/accounts/mfa/backup_codes
+
+ ## Response
+ ### Success
+ `{codes: [codes]}`
+
+ ### Error
+ `{error: [error_message]}`
+
+ """
+ def backup_codes(%{assigns: %{user: user}} = conn, _params) do
+ with {:ok, codes} <- MFA.generate_backup_codes(user) do
+ json(conn, %{codes: codes})
+ else
+ {:error, message} ->
+ json_response(conn, :unprocessable_entity, %{error: message})
+ end
+ end
+end
diff --git a/lib/pleroma/web/push/impl.ex b/lib/pleroma/web/push/impl.ex
index dd445e8bf..691725702 100644
--- a/lib/pleroma/web/push/impl.ex
+++ b/lib/pleroma/web/push/impl.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Push.Impl do
@@ -16,46 +16,51 @@ defmodule Pleroma.Web.Push.Impl do
require Logger
import Ecto.Query
- @types ["Create", "Follow", "Announce", "Like"]
+ defdelegate mastodon_notification_type(activity), to: Activity
+
+ @types ["Create", "Follow", "Announce", "Like", "Move"]
@doc "Performs sending notifications for user subscriptions"
@spec perform(Notification.t()) :: list(any) | :error
def perform(
%{
- activity: %{data: %{"type" => activity_type}, id: activity_id} = activity,
- user_id: user_id
- } = notif
+ activity: %{data: %{"type" => activity_type}} = activity,
+ user: %User{id: user_id}
+ } = notification
)
when activity_type in @types do
- actor = User.get_cached_by_ap_id(notif.activity.data["actor"])
+ actor = User.get_cached_by_ap_id(notification.activity.data["actor"])
- type = Activity.mastodon_notification_type(notif.activity)
+ mastodon_type = mastodon_notification_type(notification.activity)
gcm_api_key = Application.get_env(:web_push_encryption, :gcm_api_key)
avatar_url = User.avatar_url(actor)
object = Object.normalize(activity)
+ user = User.get_cached_by_id(user_id)
+ direct_conversation_id = Activity.direct_conversation_id(activity, user)
- for subscription <- fetch_subsriptions(user_id),
- get_in(subscription.data, ["alerts", type]) do
+ for subscription <- fetch_subscriptions(user_id),
+ Subscription.enabled?(subscription, mastodon_type) do
%{
- title: format_title(notif),
access_token: subscription.token.token,
- body: format_body(notif, actor, object),
- notification_id: notif.id,
- notification_type: type,
+ notification_id: notification.id,
+ notification_type: mastodon_type,
icon: avatar_url,
preferred_locale: "en",
pleroma: %{
- activity_id: activity_id
+ activity_id: notification.activity.id,
+ direct_conversation_id: direct_conversation_id
}
}
+ |> Map.merge(build_content(notification, actor, object, mastodon_type))
|> Jason.encode!()
|> push_message(build_sub(subscription), gcm_api_key, subscription)
end
+ |> (&{:ok, &1}).()
end
def perform(_) do
Logger.warn("Unknown notification type")
- :error
+ {:error, :unknown_type}
end
@doc "Push message to web"
@@ -80,7 +85,7 @@ defmodule Pleroma.Web.Push.Impl do
end
@doc "Gets user subscriptions"
- def fetch_subsriptions(user_id) do
+ def fetch_subscriptions(user_id) do
Subscription
|> where(user_id: ^user_id)
|> preload(:token)
@@ -97,10 +102,35 @@ defmodule Pleroma.Web.Push.Impl do
}
end
+ def build_content(notification, actor, object, mastodon_type \\ nil)
+
+ def build_content(
+ %{
+ user: %{notification_settings: %{privacy_option: true}}
+ } = notification,
+ _actor,
+ _object,
+ mastodon_type
+ ) do
+ %{body: format_title(notification, mastodon_type)}
+ end
+
+ def build_content(notification, actor, object, mastodon_type) do
+ mastodon_type = mastodon_type || mastodon_notification_type(notification.activity)
+
+ %{
+ title: format_title(notification, mastodon_type),
+ body: format_body(notification, actor, object, mastodon_type)
+ }
+ end
+
+ def format_body(activity, actor, object, mastodon_type \\ nil)
+
def format_body(
%{activity: %{data: %{"type" => "Create"}}},
actor,
- %{data: %{"content" => content}}
+ %{data: %{"content" => content}},
+ _mastodon_type
) do
"@#{actor.nickname}: #{Utils.scrub_html_and_truncate(content, 80)}"
end
@@ -108,33 +138,44 @@ defmodule Pleroma.Web.Push.Impl do
def format_body(
%{activity: %{data: %{"type" => "Announce"}}},
actor,
- %{data: %{"content" => content}}
+ %{data: %{"content" => content}},
+ _mastodon_type
) do
"@#{actor.nickname} repeated: #{Utils.scrub_html_and_truncate(content, 80)}"
end
def format_body(
- %{activity: %{data: %{"type" => type}}},
+ %{activity: %{data: %{"type" => type}}} = notification,
actor,
- _object
+ _object,
+ mastodon_type
)
when type in ["Follow", "Like"] do
- case type do
- "Follow" -> "@#{actor.nickname} has followed you"
- "Like" -> "@#{actor.nickname} has favorited your post"
+ mastodon_type = mastodon_type || mastodon_notification_type(notification.activity)
+
+ case mastodon_type do
+ "follow" -> "@#{actor.nickname} has followed you"
+ "follow_request" -> "@#{actor.nickname} has requested to follow you"
+ "favourite" -> "@#{actor.nickname} has favorited your post"
end
end
- def format_title(%{activity: %{data: %{"directMessage" => true}}}) do
+ def format_title(activity, mastodon_type \\ nil)
+
+ def format_title(%{activity: %{data: %{"directMessage" => true}}}, _mastodon_type) do
"New Direct Message"
end
- def format_title(%{activity: %{data: %{"type" => type}}}) do
- case type do
- "Create" -> "New Mention"
- "Follow" -> "New Follower"
- "Announce" -> "New Repeat"
- "Like" -> "New Favorite"
+ def format_title(%{activity: activity}, mastodon_type) do
+ mastodon_type = mastodon_type || mastodon_notification_type(activity)
+
+ case mastodon_type do
+ "mention" -> "New Mention"
+ "follow" -> "New Follower"
+ "follow_request" -> "New Follow Request"
+ "reblog" -> "New Repeat"
+ "favourite" -> "New Favorite"
+ type -> "New #{String.capitalize(type || "event")}"
end
end
end
diff --git a/lib/pleroma/web/push/push.ex b/lib/pleroma/web/push/push.ex
index 7ef1532ac..b80a6438d 100644
--- a/lib/pleroma/web/push/push.ex
+++ b/lib/pleroma/web/push/push.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Push do
diff --git a/lib/pleroma/web/push/subscription.ex b/lib/pleroma/web/push/subscription.ex
index 988fabaeb..3e401a490 100644
--- a/lib/pleroma/web/push/subscription.ex
+++ b/lib/pleroma/web/push/subscription.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Push.Subscription do
@@ -25,20 +25,28 @@ defmodule Pleroma.Web.Push.Subscription do
timestamps()
end
- @supported_alert_types ~w[follow favourite mention reblog]
+ @supported_alert_types ~w[follow favourite mention reblog]a
- defp alerts(%{"data" => %{"alerts" => alerts}}) do
+ defp alerts(%{data: %{alerts: alerts}}) do
alerts = Map.take(alerts, @supported_alert_types)
%{"alerts" => alerts}
end
+ def enabled?(subscription, "follow_request") do
+ enabled?(subscription, "follow")
+ end
+
+ def enabled?(subscription, alert_type) do
+ get_in(subscription.data, ["alerts", alert_type])
+ end
+
def create(
%User{} = user,
%Token{} = token,
%{
- "subscription" => %{
- "endpoint" => endpoint,
- "keys" => %{"auth" => key_auth, "p256dh" => key_p256dh}
+ subscription: %{
+ endpoint: endpoint,
+ keys: %{auth: key_auth, p256dh: key_p256dh}
}
} = params
) do
diff --git a/lib/pleroma/web/rel_me.ex b/lib/pleroma/web/rel_me.ex
index d376e2069..8e2b51508 100644
--- a/lib/pleroma/web/rel_me.ex
+++ b/lib/pleroma/web/rel_me.ex
@@ -1,13 +1,11 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.RelMe do
- @hackney_options [
+ @options [
pool: :media,
- recv_timeout: 2_000,
- max_body: 2_000_000,
- with_body: true
+ max_body: 2_000_000
]
if Pleroma.Config.get(:env) == :test do
@@ -25,13 +23,24 @@ defmodule Pleroma.Web.RelMe do
def parse(_), do: {:error, "No URL provided"}
defp parse_url(url) do
- {:ok, %Tesla.Env{body: html}} = Pleroma.HTTP.get(url, [], adapter: @hackney_options)
-
- data =
- Floki.attribute(html, "link[rel~=me]", "href") ++
- Floki.attribute(html, "a[rel~=me]", "href")
-
- {:ok, data}
+ opts =
+ if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do
+ Keyword.merge(@options,
+ recv_timeout: 2_000,
+ with_body: true
+ )
+ else
+ @options
+ end
+
+ with {:ok, %Tesla.Env{body: html, status: status}} when status in 200..299 <-
+ Pleroma.HTTP.get(url, [], adapter: opts),
+ {:ok, html_tree} <- Floki.parse_document(html),
+ data <-
+ Floki.attribute(html_tree, "link[rel~=me]", "href") ++
+ Floki.attribute(html_tree, "a[rel~=me]", "href") do
+ {:ok, data}
+ end
rescue
e -> {:error, "Parsing error: #{inspect(e)}"}
end
diff --git a/lib/pleroma/web/rich_media/helpers.ex b/lib/pleroma/web/rich_media/helpers.ex
index 6506de46c..9d3d7f978 100644
--- a/lib/pleroma/web/rich_media/helpers.ex
+++ b/lib/pleroma/web/rich_media/helpers.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright _ 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright _ 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.RichMedia.Helpers do
@@ -64,5 +64,8 @@ defmodule Pleroma.Web.RichMedia.Helpers do
def fetch_data_for_activity(_), do: %{}
- def perform(:fetch, %Activity{} = activity), do: fetch_data_for_activity(activity)
+ def perform(:fetch, %Activity{} = activity) do
+ fetch_data_for_activity(activity)
+ :ok
+ end
end
diff --git a/lib/pleroma/web/rich_media/parser.ex b/lib/pleroma/web/rich_media/parser.ex
index c06b0a0f2..40980def8 100644
--- a/lib/pleroma/web/rich_media/parser.ex
+++ b/lib/pleroma/web/rich_media/parser.ex
@@ -1,13 +1,11 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.RichMedia.Parser do
- @hackney_options [
+ @options [
pool: :media,
- recv_timeout: 2_000,
- max_body: 2_000_000,
- with_body: true
+ max_body: 2_000_000
]
defp parsers do
@@ -77,22 +75,32 @@ defmodule Pleroma.Web.RichMedia.Parser do
end
defp parse_url(url) do
+ opts =
+ if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Hackney do
+ Keyword.merge(@options,
+ recv_timeout: 2_000,
+ with_body: true
+ )
+ else
+ @options
+ end
+
try do
- {:ok, %Tesla.Env{body: html}} = Pleroma.HTTP.get(url, [], adapter: @hackney_options)
+ {:ok, %Tesla.Env{body: html}} = Pleroma.HTTP.get(url, [], adapter: opts)
html
- |> parse_html
+ |> parse_html()
|> maybe_parse()
|> Map.put(:url, url)
|> clean_parsed_data()
|> check_parsed_data()
rescue
e ->
- {:error, "Parsing error: #{inspect(e)}"}
+ {:error, "Parsing error: #{inspect(e)} #{inspect(__STACKTRACE__)}"}
end
end
- defp parse_html(html), do: Floki.parse(html)
+ defp parse_html(html), do: Floki.parse_document!(html)
defp maybe_parse(html) do
Enum.reduce_while(parsers(), %{}, fn parser, acc ->
diff --git a/lib/pleroma/web/rich_media/parsers/meta_tags_parser.ex b/lib/pleroma/web/rich_media/parsers/meta_tags_parser.ex
index 913975616..ae0f36702 100644
--- a/lib/pleroma/web/rich_media/parsers/meta_tags_parser.ex
+++ b/lib/pleroma/web/rich_media/parsers/meta_tags_parser.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.RichMedia.Parsers.MetaTagsParser do
@@ -48,6 +48,6 @@ defmodule Pleroma.Web.RichMedia.Parsers.MetaTagsParser do
defp maybe_put_title(meta, _), do: meta
defp get_page_title(html) do
- Floki.find(html, "title") |> Floki.text()
+ Floki.find(html, "html head title") |> List.first() |> Floki.text()
end
end
diff --git a/lib/pleroma/web/rich_media/parsers/oembed_parser.ex b/lib/pleroma/web/rich_media/parsers/oembed_parser.ex
index 875637c4d..8f32bf91b 100644
--- a/lib/pleroma/web/rich_media/parsers/oembed_parser.ex
+++ b/lib/pleroma/web/rich_media/parsers/oembed_parser.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.RichMedia.Parsers.OEmbed do
diff --git a/lib/pleroma/web/rich_media/parsers/ogp.ex b/lib/pleroma/web/rich_media/parsers/ogp.ex
index d40fa009f..3e9012588 100644
--- a/lib/pleroma/web/rich_media/parsers/ogp.ex
+++ b/lib/pleroma/web/rich_media/parsers/ogp.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.RichMedia.Parsers.OGP do
diff --git a/lib/pleroma/web/rich_media/parsers/twitter_card.ex b/lib/pleroma/web/rich_media/parsers/twitter_card.ex
index afaa98f3d..09d4b526e 100644
--- a/lib/pleroma/web/rich_media/parsers/twitter_card.ex
+++ b/lib/pleroma/web/rich_media/parsers/twitter_card.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.RichMedia.Parsers.TwitterCard do
diff --git a/lib/pleroma/web/router.ex b/lib/pleroma/web/router.ex
index f69c5c2bc..d77a61361 100644
--- a/lib/pleroma/web/router.ex
+++ b/lib/pleroma/web/router.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Router do
@@ -13,77 +13,73 @@ defmodule Pleroma.Web.Router do
pipeline :oauth do
plug(:fetch_session)
plug(Pleroma.Plugs.OAuthPlug)
+ plug(Pleroma.Plugs.UserEnabledPlug)
end
- pipeline :api do
- plug(:accepts, ["json"])
- plug(:fetch_session)
+ pipeline :expect_authentication do
+ plug(Pleroma.Plugs.ExpectAuthenticatedCheckPlug)
+ end
+
+ pipeline :expect_public_instance_or_authentication do
+ plug(Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug)
+ end
+
+ pipeline :authenticate do
plug(Pleroma.Plugs.OAuthPlug)
plug(Pleroma.Plugs.BasicAuthDecoderPlug)
plug(Pleroma.Plugs.UserFetcherPlug)
plug(Pleroma.Plugs.SessionAuthenticationPlug)
plug(Pleroma.Plugs.LegacyAuthenticationPlug)
plug(Pleroma.Plugs.AuthenticationPlug)
+ end
+
+ pipeline :after_auth do
plug(Pleroma.Plugs.UserEnabledPlug)
plug(Pleroma.Plugs.SetUserSessionIdPlug)
plug(Pleroma.Plugs.EnsureUserKeyPlug)
- plug(Pleroma.Plugs.IdempotencyPlug)
end
- pipeline :authenticated_api do
+ pipeline :base_api do
plug(:accepts, ["json"])
plug(:fetch_session)
- plug(Pleroma.Plugs.OAuthPlug)
- plug(Pleroma.Plugs.BasicAuthDecoderPlug)
- plug(Pleroma.Plugs.UserFetcherPlug)
- plug(Pleroma.Plugs.SessionAuthenticationPlug)
- plug(Pleroma.Plugs.LegacyAuthenticationPlug)
- plug(Pleroma.Plugs.AuthenticationPlug)
- plug(Pleroma.Plugs.UserEnabledPlug)
- plug(Pleroma.Plugs.SetUserSessionIdPlug)
+ plug(:authenticate)
+ plug(OpenApiSpex.Plug.PutApiSpec, module: Pleroma.Web.ApiSpec)
+ end
+
+ pipeline :api do
+ plug(:expect_public_instance_or_authentication)
+ plug(:base_api)
+ plug(:after_auth)
+ plug(Pleroma.Plugs.IdempotencyPlug)
+ end
+
+ pipeline :authenticated_api do
+ plug(:expect_authentication)
+ plug(:base_api)
+ plug(:after_auth)
plug(Pleroma.Plugs.EnsureAuthenticatedPlug)
plug(Pleroma.Plugs.IdempotencyPlug)
end
pipeline :admin_api do
- plug(:accepts, ["json"])
- plug(:fetch_session)
- plug(Pleroma.Plugs.OAuthPlug)
- plug(Pleroma.Plugs.BasicAuthDecoderPlug)
- plug(Pleroma.Plugs.UserFetcherPlug)
- plug(Pleroma.Plugs.SessionAuthenticationPlug)
- plug(Pleroma.Plugs.LegacyAuthenticationPlug)
- plug(Pleroma.Plugs.AuthenticationPlug)
+ plug(:expect_authentication)
+ plug(:base_api)
plug(Pleroma.Plugs.AdminSecretAuthenticationPlug)
- plug(Pleroma.Plugs.UserEnabledPlug)
- plug(Pleroma.Plugs.SetUserSessionIdPlug)
+ plug(:after_auth)
plug(Pleroma.Plugs.EnsureAuthenticatedPlug)
plug(Pleroma.Plugs.UserIsAdminPlug)
plug(Pleroma.Plugs.IdempotencyPlug)
end
pipeline :mastodon_html do
- plug(:accepts, ["html"])
- plug(:fetch_session)
- plug(Pleroma.Plugs.OAuthPlug)
- plug(Pleroma.Plugs.BasicAuthDecoderPlug)
- plug(Pleroma.Plugs.UserFetcherPlug)
- plug(Pleroma.Plugs.SessionAuthenticationPlug)
- plug(Pleroma.Plugs.LegacyAuthenticationPlug)
- plug(Pleroma.Plugs.AuthenticationPlug)
- plug(Pleroma.Plugs.UserEnabledPlug)
- plug(Pleroma.Plugs.SetUserSessionIdPlug)
- plug(Pleroma.Plugs.EnsureUserKeyPlug)
+ plug(:browser)
+ plug(:authenticate)
+ plug(:after_auth)
end
pipeline :pleroma_html do
- plug(:accepts, ["html"])
- plug(:fetch_session)
- plug(Pleroma.Plugs.OAuthPlug)
- plug(Pleroma.Plugs.BasicAuthDecoderPlug)
- plug(Pleroma.Plugs.UserFetcherPlug)
- plug(Pleroma.Plugs.SessionAuthenticationPlug)
- plug(Pleroma.Plugs.AuthenticationPlug)
+ plug(:browser)
+ plug(:authenticate)
plug(Pleroma.Plugs.EnsureUserKeyPlug)
end
@@ -93,10 +89,12 @@ defmodule Pleroma.Web.Router do
pipeline :config do
plug(:accepts, ["json", "xml"])
+ plug(OpenApiSpex.Plug.PutApiSpec, module: Pleroma.Web.ApiSpec)
end
pipeline :pleroma_api do
plug(:accepts, ["html", "json"])
+ plug(OpenApiSpex.Plug.PutApiSpec, module: Pleroma.Web.ApiSpec)
end
pipeline :mailbox_preview do
@@ -134,6 +132,7 @@ defmodule Pleroma.Web.Router do
post("/users/follow", AdminAPIController, :user_follow)
post("/users/unfollow", AdminAPIController, :user_unfollow)
+ put("/users/disable_mfa", AdminAPIController, :disable_mfa)
delete("/users", AdminAPIController, :user_delete)
post("/users", AdminAPIController, :users_create)
patch("/users/:nickname/toggle_activation", AdminAPIController, :user_toggle_activation)
@@ -171,49 +170,70 @@ defmodule Pleroma.Web.Router do
post("/users/email_invite", AdminAPIController, :email_invite)
get("/users/:nickname/password_reset", AdminAPIController, :get_password_reset)
- patch("/users/:nickname/force_password_reset", AdminAPIController, :force_password_reset)
+ patch("/users/force_password_reset", AdminAPIController, :force_password_reset)
+ get("/users/:nickname/credentials", AdminAPIController, :show_user_credentials)
+ patch("/users/:nickname/credentials", AdminAPIController, :update_user_credentials)
get("/users", AdminAPIController, :list_users)
get("/users/:nickname", AdminAPIController, :user_show)
get("/users/:nickname/statuses", AdminAPIController, :list_user_statuses)
+ get("/instances/:instance/statuses", AdminAPIController, :list_instance_statuses)
+
+ patch("/users/confirm_email", AdminAPIController, :confirm_email)
+ patch("/users/resend_confirmation_email", AdminAPIController, :resend_confirmation_email)
+
get("/reports", AdminAPIController, :list_reports)
get("/reports/:id", AdminAPIController, :report_show)
- put("/reports/:id", AdminAPIController, :report_update_state)
- post("/reports/:id/respond", AdminAPIController, :report_respond)
+ patch("/reports", AdminAPIController, :reports_update)
+ post("/reports/:id/notes", AdminAPIController, :report_notes_create)
+ delete("/reports/:report_id/notes/:id", AdminAPIController, :report_notes_delete)
+ get("/statuses/:id", AdminAPIController, :status_show)
put("/statuses/:id", AdminAPIController, :status_update)
delete("/statuses/:id", AdminAPIController, :status_delete)
+ get("/statuses", AdminAPIController, :list_statuses)
get("/config", AdminAPIController, :config_show)
post("/config", AdminAPIController, :config_update)
- get("/config/migrate_to_db", AdminAPIController, :migrate_to_db)
- get("/config/migrate_from_db", AdminAPIController, :migrate_from_db)
+ get("/config/descriptions", AdminAPIController, :config_descriptions)
+ get("/need_reboot", AdminAPIController, :need_reboot)
+ get("/restart", AdminAPIController, :restart)
get("/moderation_log", AdminAPIController, :list_log)
post("/reload_emoji", AdminAPIController, :reload_emoji)
+ get("/stats", AdminAPIController, :stats)
+
+ get("/oauth_app", AdminAPIController, :oauth_app_list)
+ post("/oauth_app", AdminAPIController, :oauth_app_create)
+ patch("/oauth_app/:id", AdminAPIController, :oauth_app_update)
+ delete("/oauth_app/:id", AdminAPIController, :oauth_app_delete)
end
scope "/api/pleroma/emoji", Pleroma.Web.PleromaAPI do
+ # Modifying packs
scope "/packs" do
- # Modifying packs
pipe_through(:admin_api)
- post("/import_from_fs", EmojiAPIController, :import_from_fs)
+ get("/import", EmojiAPIController, :import_from_filesystem)
+ get("/remote", EmojiAPIController, :remote)
+ post("/download", EmojiAPIController, :download)
- post("/:pack_name/update_file", EmojiAPIController, :update_file)
- post("/:pack_name/update_metadata", EmojiAPIController, :update_metadata)
- put("/:name", EmojiAPIController, :create)
+ post("/:name", EmojiAPIController, :create)
+ patch("/:name", EmojiAPIController, :update)
delete("/:name", EmojiAPIController, :delete)
- post("/download_from", EmojiAPIController, :download_from)
- post("/list_from", EmojiAPIController, :list_from)
+
+ post("/:name/files", EmojiAPIController, :add_file)
+ patch("/:name/files", EmojiAPIController, :update_file)
+ delete("/:name/files", EmojiAPIController, :delete_file)
end
+ # Pack info / downloading
scope "/packs" do
- # Pack info / downloading
- get("/", EmojiAPIController, :list_packs)
- get("/:name/download_shared/", EmojiAPIController, :download_shared)
+ get("/", EmojiAPIController, :list)
+ get("/:name", EmojiAPIController, :show)
+ get("/:name/archive", EmojiAPIController, :archive)
end
end
@@ -221,9 +241,9 @@ defmodule Pleroma.Web.Router do
pipe_through(:pleroma_html)
post("/main/ostatus", UtilController, :remote_subscribe)
- get("/ostatus_subscribe", UtilController, :remote_follow)
+ get("/ostatus_subscribe", RemoteFollowController, :follow)
- post("/ostatus_subscribe", UtilController, :do_remote_follow)
+ post("/ostatus_subscribe", RemoteFollowController, :do_follow)
end
scope "/api/pleroma", Pleroma.Web.TwitterAPI do
@@ -239,6 +259,16 @@ defmodule Pleroma.Web.Router do
post("/follow_import", UtilController, :follow_import)
end
+ scope "/api/pleroma", Pleroma.Web.PleromaAPI do
+ pipe_through(:authenticated_api)
+
+ get("/accounts/mfa", TwoFactorAuthenticationController, :settings)
+ get("/accounts/mfa/backup_codes", TwoFactorAuthenticationController, :backup_codes)
+ get("/accounts/mfa/setup/:method", TwoFactorAuthenticationController, :setup)
+ post("/accounts/mfa/confirm/:method", TwoFactorAuthenticationController, :confirm)
+ delete("/accounts/mfa/:method", TwoFactorAuthenticationController, :disable)
+ end
+
scope "/oauth", Pleroma.Web.OAuth do
scope [] do
pipe_through(:oauth)
@@ -250,6 +280,10 @@ defmodule Pleroma.Web.Router do
post("/revoke", OAuthController, :token_revoke)
get("/registration_details", OAuthController, :registration_details)
+ post("/mfa/challenge", MFAController, :challenge)
+ post("/mfa/verify", MFAController, :verify, as: :mfa_verify)
+ get("/mfa", MFAController, :show)
+
scope [] do
pipe_through(:browser)
@@ -261,19 +295,28 @@ defmodule Pleroma.Web.Router do
end
scope "/api/v1/pleroma", Pleroma.Web.PleromaAPI do
+ pipe_through(:api)
+
+ get("/statuses/:id/reactions/:emoji", PleromaAPIController, :emoji_reactions_by)
+ get("/statuses/:id/reactions", PleromaAPIController, :emoji_reactions_by)
+ end
+
+ scope "/api/v1/pleroma", Pleroma.Web.PleromaAPI do
scope [] do
pipe_through(:authenticated_api)
get("/conversations/:id/statuses", PleromaAPIController, :conversation_statuses)
get("/conversations/:id", PleromaAPIController, :conversation)
- post("/conversations/read", PleromaAPIController, :read_conversations)
+ post("/conversations/read", PleromaAPIController, :mark_conversations_as_read)
end
scope [] do
pipe_through(:authenticated_api)
patch("/conversations/:id", PleromaAPIController, :update_conversation)
- post("/notifications/read", PleromaAPIController, :read_notification)
+ put("/statuses/:id/reactions/:emoji", PleromaAPIController, :react_with_emoji)
+ delete("/statuses/:id/reactions/:emoji", PleromaAPIController, :unreact_with_emoji)
+ post("/notifications/read", PleromaAPIController, :mark_notifications_as_read)
patch("/accounts/update_avatar", AccountController, :update_avatar)
patch("/accounts/update_banner", AccountController, :update_banner)
@@ -309,51 +352,85 @@ defmodule Pleroma.Web.Router do
pipe_through(:authenticated_api)
get("/accounts/verify_credentials", AccountController, :verify_credentials)
+ patch("/accounts/update_credentials", AccountController, :update_credentials)
get("/accounts/relationships", AccountController, :relationships)
-
get("/accounts/:id/lists", AccountController, :lists)
- get("/accounts/:id/identity_proofs", MastodonAPIController, :empty_array)
-
- get("/follow_requests", FollowRequestController, :index)
+ get("/accounts/:id/identity_proofs", AccountController, :identity_proofs)
+ get("/endorsements", AccountController, :endorsements)
get("/blocks", AccountController, :blocks)
get("/mutes", AccountController, :mutes)
- get("/timelines/home", TimelineController, :home)
- get("/timelines/direct", TimelineController, :direct)
+ post("/follows", AccountController, :follow_by_uri)
+ post("/accounts/:id/follow", AccountController, :follow)
+ post("/accounts/:id/unfollow", AccountController, :unfollow)
+ post("/accounts/:id/block", AccountController, :block)
+ post("/accounts/:id/unblock", AccountController, :unblock)
+ post("/accounts/:id/mute", AccountController, :mute)
+ post("/accounts/:id/unmute", AccountController, :unmute)
- get("/favourites", StatusController, :favourites)
- get("/bookmarks", StatusController, :bookmarks)
+ get("/apps/verify_credentials", AppController, :verify_credentials)
- get("/notifications", NotificationController, :index)
- get("/notifications/:id", NotificationController, :show)
- post("/notifications/clear", NotificationController, :clear)
- post("/notifications/dismiss", NotificationController, :dismiss)
- delete("/notifications/destroy_multiple", NotificationController, :destroy_multiple)
+ get("/conversations", ConversationController, :index)
+ post("/conversations/:id/read", ConversationController, :mark_as_read)
- get("/scheduled_statuses", ScheduledActivityController, :index)
- get("/scheduled_statuses/:id", ScheduledActivityController, :show)
+ get("/domain_blocks", DomainBlockController, :index)
+ post("/domain_blocks", DomainBlockController, :create)
+ delete("/domain_blocks", DomainBlockController, :delete)
+
+ get("/filters", FilterController, :index)
+
+ post("/filters", FilterController, :create)
+ get("/filters/:id", FilterController, :show)
+ put("/filters/:id", FilterController, :update)
+ delete("/filters/:id", FilterController, :delete)
+
+ get("/follow_requests", FollowRequestController, :index)
+ post("/follow_requests/:id/authorize", FollowRequestController, :authorize)
+ post("/follow_requests/:id/reject", FollowRequestController, :reject)
get("/lists", ListController, :index)
get("/lists/:id", ListController, :show)
get("/lists/:id/accounts", ListController, :list_accounts)
- get("/domain_blocks", DomainBlockController, :index)
+ delete("/lists/:id", ListController, :delete)
+ post("/lists", ListController, :create)
+ put("/lists/:id", ListController, :update)
+ post("/lists/:id/accounts", ListController, :add_to_list)
+ delete("/lists/:id/accounts", ListController, :remove_from_list)
- get("/filters", FilterController, :index)
+ get("/markers", MarkerController, :index)
+ post("/markers", MarkerController, :upsert)
- get("/suggestions", SuggestionController, :index)
+ post("/media", MediaController, :create)
+ get("/media/:id", MediaController, :show)
+ put("/media/:id", MediaController, :update)
- get("/conversations", ConversationController, :index)
- post("/conversations/:id/read", ConversationController, :read)
+ get("/notifications", NotificationController, :index)
+ get("/notifications/:id", NotificationController, :show)
- get("/endorsements", AccountController, :endorsements)
+ post("/notifications/:id/dismiss", NotificationController, :dismiss)
+ post("/notifications/clear", NotificationController, :clear)
+ delete("/notifications/destroy_multiple", NotificationController, :destroy_multiple)
+ # Deprecated: was removed in Mastodon v3, use `/notifications/:id/dismiss` instead
+ post("/notifications/dismiss", NotificationController, :dismiss_via_body)
- patch("/accounts/update_credentials", AccountController, :update_credentials)
+ post("/polls/:id/votes", PollController, :vote)
+
+ post("/reports", ReportController, :create)
+
+ get("/scheduled_statuses", ScheduledActivityController, :index)
+ get("/scheduled_statuses/:id", ScheduledActivityController, :show)
+
+ put("/scheduled_statuses/:id", ScheduledActivityController, :update)
+ delete("/scheduled_statuses/:id", ScheduledActivityController, :delete)
+
+ # Unlike `GET /api/v1/accounts/:id/favourites`, demands authentication
+ get("/favourites", StatusController, :favourites)
+ get("/bookmarks", StatusController, :bookmarks)
post("/statuses", StatusController, :create)
delete("/statuses/:id", StatusController, :delete)
-
post("/statuses/:id/reblog", StatusController, :reblog)
post("/statuses/:id/unreblog", StatusController, :unreblog)
post("/statuses/:id/favourite", StatusController, :favourite)
@@ -365,49 +442,16 @@ defmodule Pleroma.Web.Router do
post("/statuses/:id/mute", StatusController, :mute_conversation)
post("/statuses/:id/unmute", StatusController, :unmute_conversation)
- put("/scheduled_statuses/:id", ScheduledActivityController, :update)
- delete("/scheduled_statuses/:id", ScheduledActivityController, :delete)
-
- post("/polls/:id/votes", PollController, :vote)
-
- post("/media", MediaController, :create)
- put("/media/:id", MediaController, :update)
-
- delete("/lists/:id", ListController, :delete)
- post("/lists", ListController, :create)
- put("/lists/:id", ListController, :update)
-
- post("/lists/:id/accounts", ListController, :add_to_list)
- delete("/lists/:id/accounts", ListController, :remove_from_list)
-
- post("/filters", FilterController, :create)
- get("/filters/:id", FilterController, :show)
- put("/filters/:id", FilterController, :update)
- delete("/filters/:id", FilterController, :delete)
-
- post("/reports", ReportController, :create)
-
- post("/follows", AccountController, :follows)
- post("/accounts/:id/follow", AccountController, :follow)
- post("/accounts/:id/unfollow", AccountController, :unfollow)
- post("/accounts/:id/block", AccountController, :block)
- post("/accounts/:id/unblock", AccountController, :unblock)
- post("/accounts/:id/mute", AccountController, :mute)
- post("/accounts/:id/unmute", AccountController, :unmute)
-
- post("/follow_requests/:id/authorize", FollowRequestController, :authorize)
- post("/follow_requests/:id/reject", FollowRequestController, :reject)
-
- post("/domain_blocks", DomainBlockController, :create)
- delete("/domain_blocks", DomainBlockController, :delete)
-
post("/push/subscription", SubscriptionController, :create)
- get("/push/subscription", SubscriptionController, :get)
+ get("/push/subscription", SubscriptionController, :show)
put("/push/subscription", SubscriptionController, :update)
delete("/push/subscription", SubscriptionController, :delete)
- get("/markers", MarkerController, :index)
- post("/markers", MarkerController, :upsert)
+ get("/suggestions", SuggestionController, :index)
+
+ get("/timelines/home", TimelineController, :home)
+ get("/timelines/direct", TimelineController, :direct)
+ get("/timelines/list/:list_id", TimelineController, :list)
end
scope "/api/web", Pleroma.Web do
@@ -419,15 +463,24 @@ defmodule Pleroma.Web.Router do
scope "/api/v1", Pleroma.Web.MastodonAPI do
pipe_through(:api)
- post("/accounts", AccountController, :create)
get("/accounts/search", SearchController, :account_search)
+ get("/search", SearchController, :search)
+
+ get("/accounts/:id/statuses", AccountController, :statuses)
+ get("/accounts/:id/followers", AccountController, :followers)
+ get("/accounts/:id/following", AccountController, :following)
+ get("/accounts/:id", AccountController, :show)
+
+ post("/accounts", AccountController, :create)
get("/instance", InstanceController, :show)
get("/instance/peers", InstanceController, :peers)
post("/apps", AppController, :create)
- get("/apps/verify_credentials", AppController, :verify_credentials)
+ get("/statuses", StatusController, :index)
+ get("/statuses/:id", StatusController, :show)
+ get("/statuses/:id/context", StatusController, :context)
get("/statuses/:id/card", StatusController, :card)
get("/statuses/:id/favourited_by", StatusController, :favourited_by)
get("/statuses/:id/reblogged_by", StatusController, :reblogged_by)
@@ -438,25 +491,15 @@ defmodule Pleroma.Web.Router do
get("/timelines/public", TimelineController, :public)
get("/timelines/tag/:tag", TimelineController, :hashtag)
- get("/timelines/list/:list_id", TimelineController, :list)
-
- get("/statuses", StatusController, :index)
- get("/statuses/:id", StatusController, :show)
- get("/statuses/:id/context", StatusController, :context)
get("/polls/:id", PollController, :show)
-
- get("/accounts/:id/statuses", AccountController, :statuses)
- get("/accounts/:id/followers", AccountController, :followers)
- get("/accounts/:id/following", AccountController, :following)
- get("/accounts/:id", AccountController, :show)
-
- get("/search", SearchController, :search)
end
scope "/api/v2", Pleroma.Web.MastodonAPI do
pipe_through(:api)
get("/search", SearchController, :search2)
+
+ post("/media", MediaController, :create2)
end
scope "/api", Pleroma.Web do
@@ -480,21 +523,28 @@ defmodule Pleroma.Web.Router do
)
end
+ scope "/api" do
+ pipe_through(:base_api)
+
+ get("/openapi", OpenApiSpex.Plug.RenderSpec, [])
+ end
+
scope "/api", Pleroma.Web, as: :authenticated_twitter_api do
pipe_through(:authenticated_api)
get("/oauth_tokens", TwitterAPI.Controller, :oauth_tokens)
delete("/oauth_tokens/:id", TwitterAPI.Controller, :revoke_token)
- post("/qvitter/statuses/notifications/read", TwitterAPI.Controller, :notifications_read)
- end
-
- pipeline :ap_service_actor do
- plug(:accepts, ["activity+json", "json"])
+ post(
+ "/qvitter/statuses/notifications/read",
+ TwitterAPI.Controller,
+ :mark_notifications_as_read
+ )
end
pipeline :ostatus do
- plug(:accepts, ["html", "xml", "atom", "activity+json", "json"])
+ plug(:accepts, ["html", "xml", "rss", "atom", "activity+json", "json"])
+ plug(Pleroma.Plugs.StaticFEPlug)
end
pipeline :oembed do
@@ -502,24 +552,22 @@ defmodule Pleroma.Web.Router do
end
scope "/", Pleroma.Web do
- pipe_through(:ostatus)
- pipe_through(:http_signature)
+ pipe_through([:ostatus, :http_signature])
get("/objects/:uuid", OStatus.OStatusController, :object)
get("/activities/:uuid", OStatus.OStatusController, :activity)
get("/notice/:id", OStatus.OStatusController, :notice)
get("/notice/:id/embed_player", OStatus.OStatusController, :notice_player)
- get("/users/:nickname/feed", Feed.FeedController, :feed)
- get("/users/:nickname", Feed.FeedController, :feed_redirect)
+ get("/users/:nickname/feed", Feed.UserController, :feed, as: :user_feed)
+ get("/users/:nickname", Feed.UserController, :feed_redirect, as: :user_feed)
- get("/mailer/unsubscribe/:token", Mailer.SubscriptionController, :unsubscribe)
+ get("/tags/:tag", Feed.TagController, :feed, as: :tag_feed)
end
- pipeline :activitypub do
- plug(:accepts, ["activity+json", "json"])
- plug(Pleroma.Web.Plugs.HTTPSignaturePlug)
- plug(Pleroma.Web.Plugs.MappedSignatureToIdentityPlug)
+ scope "/", Pleroma.Web do
+ pipe_through(:browser)
+ get("/mailer/unsubscribe/:token", Mailer.SubscriptionController, :unsubscribe)
end
scope "/", Pleroma.Web.ActivityPub do
@@ -529,18 +577,22 @@ defmodule Pleroma.Web.Router do
get("/users/:nickname/outbox", ActivityPubController, :outbox)
end
- pipeline :activitypub_client do
+ pipeline :ap_service_actor do
plug(:accepts, ["activity+json", "json"])
+ end
+
+ # Server to Server (S2S) AP interactions
+ pipeline :activitypub do
+ plug(:ap_service_actor)
+ plug(:http_signature)
+ end
+
+ # Client to Server (C2S) AP interactions
+ pipeline :activitypub_client do
+ plug(:ap_service_actor)
plug(:fetch_session)
- plug(Pleroma.Plugs.OAuthPlug)
- plug(Pleroma.Plugs.BasicAuthDecoderPlug)
- plug(Pleroma.Plugs.UserFetcherPlug)
- plug(Pleroma.Plugs.SessionAuthenticationPlug)
- plug(Pleroma.Plugs.LegacyAuthenticationPlug)
- plug(Pleroma.Plugs.AuthenticationPlug)
- plug(Pleroma.Plugs.UserEnabledPlug)
- plug(Pleroma.Plugs.SetUserSessionIdPlug)
- plug(Pleroma.Plugs.EnsureUserKeyPlug)
+ plug(:authenticate)
+ plug(:after_auth)
end
scope "/", Pleroma.Web.ActivityPub do
@@ -552,6 +604,7 @@ defmodule Pleroma.Web.Router do
post("/users/:nickname/outbox", ActivityPubController, :update_outbox)
post("/api/ap/upload_media", ActivityPubController, :upload_media)
+ # The following two are S2S as well, see `ActivityPub.fetch_follow_information_for_user/1`:
get("/users/:nickname/followers", ActivityPubController, :followers)
get("/users/:nickname/following", ActivityPubController, :following)
end
@@ -572,8 +625,8 @@ defmodule Pleroma.Web.Router do
post("/inbox", ActivityPubController, :inbox)
end
- get("/following", ActivityPubController, :following, assigns: %{relay: true})
- get("/followers", ActivityPubController, :followers, assigns: %{relay: true})
+ get("/following", ActivityPubController, :relay_following)
+ get("/followers", ActivityPubController, :relay_followers)
end
scope "/internal/fetch", Pleroma.Web.ActivityPub do
@@ -612,12 +665,7 @@ defmodule Pleroma.Web.Router do
get("/web/*path", MastoFEController, :index)
end
- pipeline :remote_media do
- end
-
scope "/proxy/", Pleroma.Web.MediaProxy do
- pipe_through(:remote_media)
-
get("/:sig/:url", MediaProxyController, :remote)
get("/:sig/:url/:filename", MediaProxyController, :remote)
end
@@ -630,6 +678,34 @@ defmodule Pleroma.Web.Router do
end
end
+ # Test-only routes needed to test action dispatching and plug chain execution
+ if Pleroma.Config.get(:env) == :test do
+ @test_actions [
+ :do_oauth_check,
+ :fallback_oauth_check,
+ :skip_oauth_check,
+ :fallback_oauth_skip_publicity_check,
+ :skip_oauth_skip_publicity_check,
+ :missing_oauth_check_definition
+ ]
+
+ scope "/test/api", Pleroma.Tests do
+ pipe_through(:api)
+
+ for action <- @test_actions do
+ get("/#{action}", AuthTestController, action)
+ end
+ end
+
+ scope "/test/authenticated_api", Pleroma.Tests do
+ pipe_through(:authenticated_api)
+
+ for action <- @test_actions do
+ get("/#{action}", AuthTestController, action)
+ end
+ end
+ end
+
scope "/", Pleroma.Web.MongooseIM do
get("/user_exists", MongooseIMController, :user_exists)
get("/check_password", MongooseIMController, :check_password)
diff --git a/lib/pleroma/web/static_fe/static_fe_controller.ex b/lib/pleroma/web/static_fe/static_fe_controller.ex
new file mode 100644
index 000000000..c3efb6651
--- /dev/null
+++ b/lib/pleroma/web/static_fe/static_fe_controller.ex
@@ -0,0 +1,176 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.StaticFE.StaticFEController do
+ use Pleroma.Web, :controller
+
+ alias Pleroma.Activity
+ alias Pleroma.Object
+ alias Pleroma.User
+ alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.Visibility
+ alias Pleroma.Web.Metadata
+ alias Pleroma.Web.Router.Helpers
+
+ plug(:put_layout, :static_fe)
+ plug(:put_view, Pleroma.Web.StaticFE.StaticFEView)
+ plug(:assign_id)
+
+ plug(Pleroma.Plugs.EnsureAuthenticatedPlug,
+ unless_func: &Pleroma.Web.FederatingPlug.federating?/1
+ )
+
+ @page_keys ["max_id", "min_id", "limit", "since_id", "order"]
+
+ defp get_title(%Object{data: %{"name" => name}}) when is_binary(name),
+ do: name
+
+ defp get_title(%Object{data: %{"summary" => summary}}) when is_binary(summary),
+ do: summary
+
+ defp get_title(_), do: nil
+
+ defp not_found(conn, message) do
+ conn
+ |> put_status(404)
+ |> render("error.html", %{message: message, meta: ""})
+ end
+
+ defp get_counts(%Activity{} = activity) do
+ %Object{data: data} = Object.normalize(activity)
+
+ %{
+ likes: data["like_count"] || 0,
+ replies: data["repliesCount"] || 0,
+ announces: data["announcement_count"] || 0
+ }
+ end
+
+ defp represent(%Activity{} = activity), do: represent(activity, false)
+
+ defp represent(%Activity{object: %Object{data: data}} = activity, selected) do
+ {:ok, user} = User.get_or_fetch(activity.object.data["actor"])
+
+ link =
+ case user.local do
+ true -> Helpers.o_status_url(Pleroma.Web.Endpoint, :notice, activity)
+ _ -> data["url"] || data["external_url"] || data["id"]
+ end
+
+ content =
+ if data["content"] do
+ data["content"]
+ |> Pleroma.HTML.filter_tags()
+ |> Pleroma.Emoji.Formatter.emojify(Map.get(data, "emoji", %{}))
+ else
+ nil
+ end
+
+ %{
+ user: User.sanitize_html(user),
+ title: get_title(activity.object),
+ content: content,
+ attachment: data["attachment"],
+ link: link,
+ published: data["published"],
+ sensitive: data["sensitive"],
+ selected: selected,
+ counts: get_counts(activity),
+ id: activity.id
+ }
+ end
+
+ def show(%{assigns: %{notice_id: notice_id}} = conn, _params) do
+ with %Activity{local: true} = activity <-
+ Activity.get_by_id_with_object(notice_id),
+ true <- Visibility.is_public?(activity.object),
+ %User{} = user <- User.get_by_ap_id(activity.object.data["actor"]) do
+ meta = Metadata.build_tags(%{activity_id: notice_id, object: activity.object, user: user})
+
+ timeline =
+ activity.object.data["context"]
+ |> ActivityPub.fetch_activities_for_context(%{})
+ |> Enum.reverse()
+ |> Enum.map(&represent(&1, &1.object.id == activity.object.id))
+
+ render(conn, "conversation.html", %{activities: timeline, meta: meta})
+ else
+ %Activity{object: %Object{data: data}} ->
+ conn
+ |> put_status(:found)
+ |> redirect(external: data["url"] || data["external_url"] || data["id"])
+
+ _ ->
+ not_found(conn, "Post not found.")
+ end
+ end
+
+ def show(%{assigns: %{username_or_id: username_or_id}} = conn, params) do
+ case User.get_cached_by_nickname_or_id(username_or_id) do
+ %User{} = user ->
+ meta = Metadata.build_tags(%{user: user})
+
+ timeline =
+ ActivityPub.fetch_user_activities(user, nil, Map.take(params, @page_keys))
+ |> Enum.map(&represent/1)
+
+ prev_page_id =
+ (params["min_id"] || params["max_id"]) &&
+ List.first(timeline) && List.first(timeline).id
+
+ next_page_id = List.last(timeline) && List.last(timeline).id
+
+ render(conn, "profile.html", %{
+ user: User.sanitize_html(user),
+ timeline: timeline,
+ prev_page_id: prev_page_id,
+ next_page_id: next_page_id,
+ meta: meta
+ })
+
+ _ ->
+ not_found(conn, "User not found.")
+ end
+ end
+
+ def show(%{assigns: %{object_id: _}} = conn, _params) do
+ url = Helpers.url(conn) <> conn.request_path
+
+ case Activity.get_create_by_object_ap_id_with_object(url) do
+ %Activity{} = activity ->
+ to = Helpers.o_status_path(Pleroma.Web.Endpoint, :notice, activity)
+ redirect(conn, to: to)
+
+ _ ->
+ not_found(conn, "Post not found.")
+ end
+ end
+
+ def show(%{assigns: %{activity_id: _}} = conn, _params) do
+ url = Helpers.url(conn) <> conn.request_path
+
+ case Activity.get_by_ap_id(url) do
+ %Activity{} = activity ->
+ to = Helpers.o_status_path(Pleroma.Web.Endpoint, :notice, activity)
+ redirect(conn, to: to)
+
+ _ ->
+ not_found(conn, "Post not found.")
+ end
+ end
+
+ defp assign_id(%{path_info: ["notice", notice_id]} = conn, _opts),
+ do: assign(conn, :notice_id, notice_id)
+
+ defp assign_id(%{path_info: ["users", user_id]} = conn, _opts),
+ do: assign(conn, :username_or_id, user_id)
+
+ defp assign_id(%{path_info: ["objects", object_id]} = conn, _opts),
+ do: assign(conn, :object_id, object_id)
+
+ defp assign_id(%{path_info: ["activities", activity_id]} = conn, _opts),
+ do: assign(conn, :activity_id, activity_id)
+
+ defp assign_id(conn, _opts), do: conn
+end
diff --git a/lib/pleroma/web/static_fe/static_fe_view.ex b/lib/pleroma/web/static_fe/static_fe_view.ex
new file mode 100644
index 000000000..b3d1d1ec8
--- /dev/null
+++ b/lib/pleroma/web/static_fe/static_fe_view.ex
@@ -0,0 +1,38 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.StaticFE.StaticFEView do
+ use Pleroma.Web, :view
+
+ alias Calendar.Strftime
+ alias Pleroma.Emoji.Formatter
+ alias Pleroma.User
+ alias Pleroma.Web.Endpoint
+ alias Pleroma.Web.Gettext
+ alias Pleroma.Web.MediaProxy
+ alias Pleroma.Web.Metadata.Utils
+ alias Pleroma.Web.Router.Helpers
+
+ use Phoenix.HTML
+
+ @media_types ["image", "audio", "video"]
+
+ def fetch_media_type(%{"mediaType" => mediaType}) do
+ Utils.fetch_media_type(@media_types, mediaType)
+ end
+
+ def format_date(date) do
+ {:ok, date, _} = DateTime.from_iso8601(date)
+ Strftime.strftime!(date, "%Y/%m/%d %l:%M:%S %p UTC")
+ end
+
+ def instance_name, do: Pleroma.Config.get([:instance, :name], "Pleroma")
+
+ def open_content? do
+ Pleroma.Config.get(
+ [:frontend_configurations, :collapse_message_with_subjects],
+ true
+ )
+ end
+end
diff --git a/lib/pleroma/web/streamer/ping.ex b/lib/pleroma/web/streamer/ping.ex
deleted file mode 100644
index db3e68abe..000000000
--- a/lib/pleroma/web/streamer/ping.ex
+++ /dev/null
@@ -1,37 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Web.Streamer.Ping do
- use GenServer
- require Logger
-
- alias Pleroma.Web.Streamer.State
- alias Pleroma.Web.Streamer.StreamerSocket
-
- @keepalive_interval :timer.seconds(30)
-
- def start_link(opts) do
- ping_interval = Keyword.get(opts, :ping_interval, @keepalive_interval)
- GenServer.start_link(__MODULE__, %{ping_interval: ping_interval}, name: __MODULE__)
- end
-
- def init(%{ping_interval: ping_interval} = args) do
- Process.send_after(self(), :ping, ping_interval)
- {:ok, args}
- end
-
- def handle_info(:ping, %{ping_interval: ping_interval} = state) do
- State.get_sockets()
- |> Map.values()
- |> List.flatten()
- |> Enum.each(fn %StreamerSocket{transport_pid: transport_pid} ->
- Logger.debug("Sending keepalive ping")
- send(transport_pid, {:text, ""})
- end)
-
- Process.send_after(self(), :ping, ping_interval)
-
- {:noreply, state}
- end
-end
diff --git a/lib/pleroma/web/streamer/state.ex b/lib/pleroma/web/streamer/state.ex
deleted file mode 100644
index 5ce3ebb8a..000000000
--- a/lib/pleroma/web/streamer/state.ex
+++ /dev/null
@@ -1,82 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Web.Streamer.State do
- use GenServer
- require Logger
-
- alias Pleroma.Web.Streamer.StreamerSocket
-
- @env Mix.env()
-
- def start_link(_) do
- GenServer.start_link(__MODULE__, %{sockets: %{}}, name: __MODULE__)
- end
-
- def add_socket(topic, socket) do
- GenServer.call(__MODULE__, {:add, topic, socket})
- end
-
- def remove_socket(topic, socket) do
- do_remove_socket(@env, topic, socket)
- end
-
- def get_sockets do
- %{sockets: stream_sockets} = GenServer.call(__MODULE__, :get_state)
- stream_sockets
- end
-
- def init(init_arg) do
- {:ok, init_arg}
- end
-
- def handle_call(:get_state, _from, state) do
- {:reply, state, state}
- end
-
- def handle_call({:add, topic, socket}, _from, %{sockets: sockets} = state) do
- internal_topic = internal_topic(topic, socket)
- stream_socket = StreamerSocket.from_socket(socket)
-
- sockets_for_topic =
- sockets
- |> Map.get(internal_topic, [])
- |> List.insert_at(0, stream_socket)
- |> Enum.uniq()
-
- state = put_in(state, [:sockets, internal_topic], sockets_for_topic)
- Logger.debug("Got new conn for #{topic}")
- {:reply, state, state}
- end
-
- def handle_call({:remove, topic, socket}, _from, %{sockets: sockets} = state) do
- internal_topic = internal_topic(topic, socket)
- stream_socket = StreamerSocket.from_socket(socket)
-
- sockets_for_topic =
- sockets
- |> Map.get(internal_topic, [])
- |> List.delete(stream_socket)
-
- state = Kernel.put_in(state, [:sockets, internal_topic], sockets_for_topic)
- {:reply, state, state}
- end
-
- defp do_remove_socket(:test, _, _) do
- :ok
- end
-
- defp do_remove_socket(_env, topic, socket) do
- GenServer.call(__MODULE__, {:remove, topic, socket})
- end
-
- defp internal_topic(topic, socket)
- when topic in ~w[user user:notification direct] do
- "#{topic}:#{socket.assigns[:user].id}"
- end
-
- defp internal_topic(topic, _) do
- topic
- end
-end
diff --git a/lib/pleroma/web/streamer/streamer.ex b/lib/pleroma/web/streamer/streamer.ex
index 2fc7ac8cf..49a400df7 100644
--- a/lib/pleroma/web/streamer/streamer.ex
+++ b/lib/pleroma/web/streamer/streamer.ex
@@ -1,55 +1,290 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.Streamer do
- alias Pleroma.Web.Streamer.State
- alias Pleroma.Web.Streamer.Worker
+ require Logger
+
+ alias Pleroma.Activity
+ alias Pleroma.Config
+ alias Pleroma.Conversation.Participation
+ alias Pleroma.Notification
+ alias Pleroma.Object
+ alias Pleroma.User
+ alias Pleroma.Web.ActivityPub.ActivityPub
+ alias Pleroma.Web.ActivityPub.Visibility
+ alias Pleroma.Web.CommonAPI
+ alias Pleroma.Web.StreamerView
- @timeout 60_000
@mix_env Mix.env()
+ @registry Pleroma.Web.StreamerRegistry
+
+ def registry, do: @registry
+
+ @public_streams ["public", "public:local", "public:media", "public:local:media"]
+ @user_streams ["user", "user:notification", "direct"]
+
+ @doc "Expands and authorizes a stream, and registers the process for streaming."
+ @spec get_topic_and_add_socket(stream :: String.t(), User.t() | nil, Map.t() | nil) ::
+ {:ok, topic :: String.t()} | {:error, :bad_topic} | {:error, :unauthorized}
+ def get_topic_and_add_socket(stream, user, params \\ %{}) do
+ case get_topic(stream, user, params) do
+ {:ok, topic} -> add_socket(topic, user)
+ error -> error
+ end
+ end
+
+ @doc "Expand and authorizes a stream"
+ @spec get_topic(stream :: String.t(), User.t() | nil, Map.t()) ::
+ {:ok, topic :: String.t()} | {:error, :bad_topic}
+ def get_topic(stream, user, params \\ %{})
- def add_socket(topic, socket) do
- State.add_socket(topic, socket)
+ # Allow all public steams.
+ def get_topic(stream, _, _) when stream in @public_streams do
+ {:ok, stream}
end
- def remove_socket(topic, socket) do
- State.remove_socket(topic, socket)
+ # Allow all hashtags streams.
+ def get_topic("hashtag", _, %{"tag" => tag}) do
+ {:ok, "hashtag:" <> tag}
end
- def get_sockets do
- State.get_sockets()
+ # Expand user streams.
+ def get_topic(stream, %User{} = user, _) when stream in @user_streams do
+ {:ok, stream <> ":" <> to_string(user.id)}
end
- def stream(topics, items) do
- if should_send?() do
- Task.async(fn ->
- :poolboy.transaction(
- :streamer_worker,
- &Worker.stream(&1, topics, items),
- @timeout
- )
+ def get_topic(stream, _, _) when stream in @user_streams do
+ {:error, :unauthorized}
+ end
+
+ # List streams.
+ def get_topic("list", %User{} = user, %{"list" => id}) do
+ if Pleroma.List.get(id, user) do
+ {:ok, "list:" <> to_string(id)}
+ else
+ {:error, :bad_topic}
+ end
+ end
+
+ def get_topic("list", _, _) do
+ {:error, :unauthorized}
+ end
+
+ def get_topic(_, _, _) do
+ {:error, :bad_topic}
+ end
+
+ @doc "Registers the process for streaming. Use `get_topic/3` to get the full authorized topic."
+ def add_socket(topic, user) do
+ if should_env_send?() do
+ auth? = if user, do: true
+ Registry.register(@registry, topic, auth?)
+ end
+
+ {:ok, topic}
+ end
+
+ def remove_socket(topic) do
+ if should_env_send?(), do: Registry.unregister(@registry, topic)
+ end
+
+ def stream(topics, item) when is_list(topics) do
+ if should_env_send?() do
+ Enum.each(topics, fn t ->
+ spawn(fn -> do_stream(t, item) end)
end)
end
+
+ :ok
+ end
+
+ def stream(topic, items) when is_list(items) do
+ if should_env_send?() do
+ Enum.each(items, fn i ->
+ spawn(fn -> do_stream(topic, i) end)
+ end)
+
+ :ok
+ end
end
- def supervisor, do: Pleroma.Web.Streamer.Supervisor
+ def stream(topic, item) do
+ if should_env_send?() do
+ spawn(fn -> do_stream(topic, item) end)
+ end
- defp should_send? do
- handle_should_send(@mix_env)
+ :ok
end
- defp handle_should_send(:test) do
- case Process.whereis(:streamer_worker) do
- nil ->
- false
+ def filtered_by_user?(%User{} = user, %Activity{} = item) do
+ %{block: blocked_ap_ids, mute: muted_ap_ids, reblog_mute: reblog_muted_ap_ids} =
+ User.outgoing_relationships_ap_ids(user, [:block, :mute, :reblog_mute])
+
+ recipient_blocks = MapSet.new(blocked_ap_ids ++ muted_ap_ids)
+ recipients = MapSet.new(item.recipients)
+ domain_blocks = Pleroma.Web.ActivityPub.MRF.subdomains_regex(user.domain_blocks)
- pid ->
- Process.alive?(pid)
+ with parent <- Object.normalize(item) || item,
+ true <-
+ Enum.all?([blocked_ap_ids, muted_ap_ids], &(item.actor not in &1)),
+ true <- item.data["type"] != "Announce" || item.actor not in reblog_muted_ap_ids,
+ true <- Enum.all?([blocked_ap_ids, muted_ap_ids], &(parent.data["actor"] not in &1)),
+ true <- MapSet.disjoint?(recipients, recipient_blocks),
+ %{host: item_host} <- URI.parse(item.actor),
+ %{host: parent_host} <- URI.parse(parent.data["actor"]),
+ false <- Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, item_host),
+ false <- Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, parent_host),
+ true <- thread_containment(item, user),
+ false <- CommonAPI.thread_muted?(user, item) do
+ false
+ else
+ _ -> true
end
end
- defp handle_should_send(:benchmark), do: false
+ def filtered_by_user?(%User{} = user, %Notification{activity: activity}) do
+ filtered_by_user?(user, activity)
+ end
+
+ defp do_stream("direct", item) do
+ recipient_topics =
+ User.get_recipients_from_activity(item)
+ |> Enum.map(fn %{id: id} -> "direct:#{id}" end)
+
+ Enum.each(recipient_topics, fn user_topic ->
+ Logger.debug("Trying to push direct message to #{user_topic}\n\n")
+ push_to_socket(user_topic, item)
+ end)
+ end
+
+ defp do_stream("participation", participation) do
+ user_topic = "direct:#{participation.user_id}"
+ Logger.debug("Trying to push a conversation participation to #{user_topic}\n\n")
+
+ push_to_socket(user_topic, participation)
+ end
- defp handle_should_send(_), do: true
+ defp do_stream("list", item) do
+ # filter the recipient list if the activity is not public, see #270.
+ recipient_lists =
+ case Visibility.is_public?(item) do
+ true ->
+ Pleroma.List.get_lists_from_activity(item)
+
+ _ ->
+ Pleroma.List.get_lists_from_activity(item)
+ |> Enum.filter(fn list ->
+ owner = User.get_cached_by_id(list.user_id)
+
+ Visibility.visible_for_user?(item, owner)
+ end)
+ end
+
+ recipient_topics =
+ recipient_lists
+ |> Enum.map(fn %{id: id} -> "list:#{id}" end)
+
+ Enum.each(recipient_topics, fn list_topic ->
+ Logger.debug("Trying to push message to #{list_topic}\n\n")
+ push_to_socket(list_topic, item)
+ end)
+ end
+
+ defp do_stream(topic, %Notification{} = item)
+ when topic in ["user", "user:notification"] do
+ Registry.dispatch(@registry, "#{topic}:#{item.user_id}", fn list ->
+ Enum.each(list, fn {pid, _auth} ->
+ send(pid, {:render_with_user, StreamerView, "notification.json", item})
+ end)
+ end)
+ end
+
+ defp do_stream("user", item) do
+ Logger.debug("Trying to push to users")
+
+ recipient_topics =
+ User.get_recipients_from_activity(item)
+ |> Enum.map(fn %{id: id} -> "user:#{id}" end)
+
+ Enum.each(recipient_topics, fn topic ->
+ push_to_socket(topic, item)
+ end)
+ end
+
+ defp do_stream(topic, item) do
+ Logger.debug("Trying to push to #{topic}")
+ Logger.debug("Pushing item to #{topic}")
+ push_to_socket(topic, item)
+ end
+
+ defp push_to_socket(topic, %Participation{} = participation) do
+ rendered = StreamerView.render("conversation.json", participation)
+
+ Registry.dispatch(@registry, topic, fn list ->
+ Enum.each(list, fn {pid, _} ->
+ send(pid, {:text, rendered})
+ end)
+ end)
+ end
+
+ defp push_to_socket(topic, %Activity{
+ data: %{"type" => "Delete", "deleted_activity_id" => deleted_activity_id}
+ }) do
+ rendered = Jason.encode!(%{event: "delete", payload: to_string(deleted_activity_id)})
+
+ Registry.dispatch(@registry, topic, fn list ->
+ Enum.each(list, fn {pid, _} ->
+ send(pid, {:text, rendered})
+ end)
+ end)
+ end
+
+ defp push_to_socket(_topic, %Activity{data: %{"type" => "Delete"}}), do: :noop
+
+ defp push_to_socket(topic, item) do
+ anon_render = StreamerView.render("update.json", item)
+
+ Registry.dispatch(@registry, topic, fn list ->
+ Enum.each(list, fn {pid, auth?} ->
+ if auth? do
+ send(pid, {:render_with_user, StreamerView, "update.json", item})
+ else
+ send(pid, {:text, anon_render})
+ end
+ end)
+ end)
+ end
+
+ defp thread_containment(_activity, %User{skip_thread_containment: true}), do: true
+
+ defp thread_containment(activity, user) do
+ if Config.get([:instance, :skip_thread_containment]) do
+ true
+ else
+ ActivityPub.contain_activity(activity, user)
+ end
+ end
+
+ # In test environement, only return true if the registry is started.
+ # In benchmark environment, returns false.
+ # In any other environment, always returns true.
+ cond do
+ @mix_env == :test ->
+ def should_env_send? do
+ case Process.whereis(@registry) do
+ nil ->
+ false
+
+ pid ->
+ Process.alive?(pid)
+ end
+ end
+
+ @mix_env == :benchmark ->
+ def should_env_send?, do: false
+
+ true ->
+ def should_env_send?, do: true
+ end
end
diff --git a/lib/pleroma/web/streamer/streamer_socket.ex b/lib/pleroma/web/streamer/streamer_socket.ex
deleted file mode 100644
index cf0fa3077..000000000
--- a/lib/pleroma/web/streamer/streamer_socket.ex
+++ /dev/null
@@ -1,35 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Web.Streamer.StreamerSocket do
- defstruct transport_pid: nil, user: nil
-
- alias Pleroma.User
- alias Pleroma.Web.Streamer.StreamerSocket
-
- def from_socket(%{
- transport_pid: transport_pid,
- assigns: %{user: nil}
- }) do
- %StreamerSocket{
- transport_pid: transport_pid
- }
- end
-
- def from_socket(%{
- transport_pid: transport_pid,
- assigns: %{user: %User{} = user}
- }) do
- %StreamerSocket{
- transport_pid: transport_pid,
- user: user
- }
- end
-
- def from_socket(%{transport_pid: transport_pid}) do
- %StreamerSocket{
- transport_pid: transport_pid
- }
- end
-end
diff --git a/lib/pleroma/web/streamer/supervisor.ex b/lib/pleroma/web/streamer/supervisor.ex
deleted file mode 100644
index ec5985085..000000000
--- a/lib/pleroma/web/streamer/supervisor.ex
+++ /dev/null
@@ -1,37 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Web.Streamer.Supervisor do
- use Supervisor
-
- def start_link(opts) do
- Supervisor.start_link(__MODULE__, opts, name: __MODULE__)
- end
-
- def init(args) do
- children = [
- {Pleroma.Web.Streamer.State, args},
- {Pleroma.Web.Streamer.Ping, args},
- :poolboy.child_spec(:streamer_worker, poolboy_config())
- ]
-
- opts = [strategy: :one_for_one, name: Pleroma.Web.Streamer.Supervisor]
- Supervisor.init(children, opts)
- end
-
- defp poolboy_config do
- opts =
- Pleroma.Config.get(:streamer,
- workers: 3,
- overflow_workers: 2
- )
-
- [
- {:name, {:local, :streamer_worker}},
- {:worker_module, Pleroma.Web.Streamer.Worker},
- {:size, opts[:workers]},
- {:max_overflow, opts[:overflow_workers]}
- ]
- end
-end
diff --git a/lib/pleroma/web/streamer/worker.ex b/lib/pleroma/web/streamer/worker.ex
deleted file mode 100644
index 0ea224874..000000000
--- a/lib/pleroma/web/streamer/worker.ex
+++ /dev/null
@@ -1,224 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Web.Streamer.Worker do
- use GenServer
-
- require Logger
-
- alias Pleroma.Activity
- alias Pleroma.Config
- alias Pleroma.Conversation.Participation
- alias Pleroma.Notification
- alias Pleroma.Object
- alias Pleroma.User
- alias Pleroma.Web.ActivityPub.ActivityPub
- alias Pleroma.Web.ActivityPub.Visibility
- alias Pleroma.Web.CommonAPI
- alias Pleroma.Web.Streamer.State
- alias Pleroma.Web.Streamer.StreamerSocket
- alias Pleroma.Web.StreamerView
-
- def start_link(_) do
- GenServer.start_link(__MODULE__, %{}, [])
- end
-
- def init(init_arg) do
- {:ok, init_arg}
- end
-
- def stream(pid, topics, items) do
- GenServer.call(pid, {:stream, topics, items})
- end
-
- def handle_call({:stream, topics, item}, _from, state) when is_list(topics) do
- Enum.each(topics, fn t ->
- do_stream(%{topic: t, item: item})
- end)
-
- {:reply, state, state}
- end
-
- def handle_call({:stream, topic, items}, _from, state) when is_list(items) do
- Enum.each(items, fn i ->
- do_stream(%{topic: topic, item: i})
- end)
-
- {:reply, state, state}
- end
-
- def handle_call({:stream, topic, item}, _from, state) do
- do_stream(%{topic: topic, item: item})
-
- {:reply, state, state}
- end
-
- defp do_stream(%{topic: "direct", item: item}) do
- recipient_topics =
- User.get_recipients_from_activity(item)
- |> Enum.map(fn %{id: id} -> "direct:#{id}" end)
-
- Enum.each(recipient_topics, fn user_topic ->
- Logger.debug("Trying to push direct message to #{user_topic}\n\n")
- push_to_socket(State.get_sockets(), user_topic, item)
- end)
- end
-
- defp do_stream(%{topic: "participation", item: participation}) do
- user_topic = "direct:#{participation.user_id}"
- Logger.debug("Trying to push a conversation participation to #{user_topic}\n\n")
-
- push_to_socket(State.get_sockets(), user_topic, participation)
- end
-
- defp do_stream(%{topic: "list", item: item}) do
- # filter the recipient list if the activity is not public, see #270.
- recipient_lists =
- case Visibility.is_public?(item) do
- true ->
- Pleroma.List.get_lists_from_activity(item)
-
- _ ->
- Pleroma.List.get_lists_from_activity(item)
- |> Enum.filter(fn list ->
- owner = User.get_cached_by_id(list.user_id)
-
- Visibility.visible_for_user?(item, owner)
- end)
- end
-
- recipient_topics =
- recipient_lists
- |> Enum.map(fn %{id: id} -> "list:#{id}" end)
-
- Enum.each(recipient_topics, fn list_topic ->
- Logger.debug("Trying to push message to #{list_topic}\n\n")
- push_to_socket(State.get_sockets(), list_topic, item)
- end)
- end
-
- defp do_stream(%{topic: topic, item: %Notification{} = item})
- when topic in ["user", "user:notification"] do
- State.get_sockets()
- |> Map.get("#{topic}:#{item.user_id}", [])
- |> Enum.each(fn %StreamerSocket{transport_pid: transport_pid, user: socket_user} ->
- with %User{} = user <- User.get_cached_by_ap_id(socket_user.ap_id),
- true <- should_send?(user, item) do
- send(transport_pid, {:text, StreamerView.render("notification.json", socket_user, item)})
- end
- end)
- end
-
- defp do_stream(%{topic: "user", item: item}) do
- Logger.debug("Trying to push to users")
-
- recipient_topics =
- User.get_recipients_from_activity(item)
- |> Enum.map(fn %{id: id} -> "user:#{id}" end)
-
- Enum.each(recipient_topics, fn topic ->
- push_to_socket(State.get_sockets(), topic, item)
- end)
- end
-
- defp do_stream(%{topic: topic, item: item}) do
- Logger.debug("Trying to push to #{topic}")
- Logger.debug("Pushing item to #{topic}")
- push_to_socket(State.get_sockets(), topic, item)
- end
-
- defp should_send?(%User{} = user, %Activity{} = item) do
- blocks = user.info.blocks || []
- mutes = user.info.mutes || []
- reblog_mutes = user.info.muted_reblogs || []
- recipient_blocks = MapSet.new(blocks ++ mutes)
- recipients = MapSet.new(item.recipients)
- domain_blocks = Pleroma.Web.ActivityPub.MRF.subdomains_regex(user.info.domain_blocks)
-
- with parent when not is_nil(parent) <- Object.normalize(item),
- true <- Enum.all?([blocks, mutes, reblog_mutes], &(item.actor not in &1)),
- true <- Enum.all?([blocks, mutes], &(parent.data["actor"] not in &1)),
- true <- MapSet.disjoint?(recipients, recipient_blocks),
- %{host: item_host} <- URI.parse(item.actor),
- %{host: parent_host} <- URI.parse(parent.data["actor"]),
- false <- Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, item_host),
- false <- Pleroma.Web.ActivityPub.MRF.subdomain_match?(domain_blocks, parent_host),
- true <- thread_containment(item, user),
- false <- CommonAPI.thread_muted?(user, item) do
- true
- else
- _ -> false
- end
- end
-
- defp should_send?(%User{} = user, %Notification{activity: activity}) do
- should_send?(user, activity)
- end
-
- def push_to_socket(topics, topic, %Activity{data: %{"type" => "Announce"}} = item) do
- Enum.each(topics[topic] || [], fn %StreamerSocket{
- transport_pid: transport_pid,
- user: socket_user
- } ->
- # Get the current user so we have up-to-date blocks etc.
- if socket_user do
- user = User.get_cached_by_ap_id(socket_user.ap_id)
-
- if should_send?(user, item) do
- send(transport_pid, {:text, StreamerView.render("update.json", item, user)})
- end
- else
- send(transport_pid, {:text, StreamerView.render("update.json", item)})
- end
- end)
- end
-
- def push_to_socket(topics, topic, %Participation{} = participation) do
- Enum.each(topics[topic] || [], fn %StreamerSocket{transport_pid: transport_pid} ->
- send(transport_pid, {:text, StreamerView.render("conversation.json", participation)})
- end)
- end
-
- def push_to_socket(topics, topic, %Activity{
- data: %{"type" => "Delete", "deleted_activity_id" => deleted_activity_id}
- }) do
- Enum.each(topics[topic] || [], fn %StreamerSocket{transport_pid: transport_pid} ->
- send(
- transport_pid,
- {:text, %{event: "delete", payload: to_string(deleted_activity_id)} |> Jason.encode!()}
- )
- end)
- end
-
- def push_to_socket(_topics, _topic, %Activity{data: %{"type" => "Delete"}}), do: :noop
-
- def push_to_socket(topics, topic, item) do
- Enum.each(topics[topic] || [], fn %StreamerSocket{
- transport_pid: transport_pid,
- user: socket_user
- } ->
- # Get the current user so we have up-to-date blocks etc.
- if socket_user do
- user = User.get_cached_by_ap_id(socket_user.ap_id)
-
- if should_send?(user, item) do
- send(transport_pid, {:text, StreamerView.render("update.json", item, user)})
- end
- else
- send(transport_pid, {:text, StreamerView.render("update.json", item)})
- end
- end)
- end
-
- @spec thread_containment(Activity.t(), User.t()) :: boolean()
- defp thread_containment(_activity, %User{info: %{skip_thread_containment: true}}), do: true
-
- defp thread_containment(activity, user) do
- if Config.get([:instance, :skip_thread_containment]) do
- true
- else
- ActivityPub.contain_activity(activity, user)
- end
- end
-end
diff --git a/lib/pleroma/web/templates/email/new_users_digest.html.eex b/lib/pleroma/web/templates/email/new_users_digest.html.eex
new file mode 100644
index 000000000..40d9b8381
--- /dev/null
+++ b/lib/pleroma/web/templates/email/new_users_digest.html.eex
@@ -0,0 +1,158 @@
+<%= for {user, total_statuses, latest_status} <- @users_and_statuses do %>
+ <%# user card START %>
+ <div style="background-color:transparent;">
+ <div class="block-grid mixed-two-up no-stack"
+ style="Margin: 0 auto; min-width: 320px; max-width: 590px; overflow-wrap: break-word; word-wrap: break-word; word-break: break-word; background-color: <%= @styling.content_background_color%>;">
+ <div style="border-collapse: collapse;display: table;width: 100%;background-color:<%= @styling.content_background_color%>;">
+ <!--[if (mso)|(IE)]><table width="100%" cellpadding="0" cellspacing="0" border="0" style="background-color:transparent;"><tr><td align="center"><table cellpadding="0" cellspacing="0" border="0" style="width:590px"><tr class="layout-full-width" style="background-color:<%= @styling.content_background_color%>"><![endif]-->
+ <!--[if (mso)|(IE)]><td align="center" width="147" style="background-color:<%= @styling.content_background_color%>;width:76px; border-top: 0px solid transparent; border-left: 0px solid transparent; border-bottom: 0px solid transparent; border-right: 0px solid transparent;" valign="top"><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 0px; padding-left: 20px; padding-top:5px; padding-bottom:5px;"><![endif]-->
+ <div class="col num3"
+ style="display: table-cell; vertical-align: top; max-width: 320px; min-width: 76px; width: 76px;">
+ <div style="width:100% !important;">
+ <!--[if (!mso)&(!IE)]><!-->
+ <div
+ style="border-top:0px solid transparent; border-left:0px solid transparent; border-bottom:0px solid transparent; border-right:0px solid transparent; padding-top:5px; padding-bottom:5px; padding-right: 0px; padding-left: 20px;">
+ <!--<![endif]-->
+ <div align="left" class="img-container left "
+ style="padding-right: 0px;padding-left: 0px;">
+ <!--[if mso]><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr style="line-height:0px"><td style="padding-right: 0px;padding-left: 0px;" align="left"><![endif]--><img
+ alt="<%= user.name %>" border="0" class="left " src="<%= avatar_url(user) %>"
+ style="text-decoration: none; -ms-interpolation-mode: bicubic; border: 0; height: auto; width: 100%; max-width: 76px; display: block;"
+ title="<%= user.name %>" width="76" />
+ <!--[if mso]></td></tr></table><![endif]-->
+ </div>
+ <!--[if (!mso)&(!IE)]><!-->
+ </div>
+ <!--<![endif]-->
+ </div>
+ </div>
+
+ <!--[if (mso)|(IE)]></td></tr></table><![endif]-->
+ <!--[if (mso)|(IE)]></td><td align="center" width="442" style="background-color:<%= @styling.content_background_color%>;width:442px; border-top: 0px solid transparent; border-left: 0px solid transparent; border-bottom: 0px solid transparent; border-right: 0px solid transparent;" valign="top"><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 0px; padding-left: 0px; padding-top:5px; padding-bottom:5px;"><![endif]-->
+ <div class="col num9"
+ style="display: table-cell; vertical-align: top; min-width: 320px; max-width: 441px; width: 442px;">
+ <div style="width:100% !important;">
+ <!--[if (!mso)&(!IE)]><!-->
+ <div
+ style="border-top:0px solid transparent; border-left:0px solid transparent; border-bottom:0px solid transparent; border-right:0px solid transparent; padding-top:5px; padding-bottom:5px; padding-right: 0px; padding-left: 0px;">
+ <!--<![endif]-->
+ <!--[if mso]><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 10px; padding-left: 10px; padding-top: 10px; padding-bottom: 10px; font-family: Arial, sans-serif"><![endif]-->
+ <div
+ style="color:<%= @styling.text_color %>;font-family:Arial, 'Helvetica Neue', Helvetica, sans-serif;line-height:120%;padding-top:10px;padding-right:10px;padding-bottom:10px;padding-left:10px;">
+ <div
+ style="font-family: Arial, 'Helvetica Neue', Helvetica, sans-serif; font-size: 12px; line-height: 14px; color: <%= @styling.text_color %>;">
+ <p style="font-size: 14px; line-height: 19px; margin: 0;"><span
+ style="font-size: 16px; color: <%= @styling.text_color %>;"><%= user.name %></span></p>
+ <p style="font-size: 14px; line-height: 19px; margin: 0;"><span
+ style="font-size: 16px;"><%= link "@" <> user.nickname, style: "color: #{@styling.link_color};text-decoration: none;", to: admin_user_url(user) %></span></p>
+ <p style="font-size: 14px; line-height: 19px; margin: 0;"><span
+ style="font-size: 16px;">Total: <%= total_statuses %></span></p>
+ </div>
+ </div>
+ <!--[if mso]></td></tr></table><![endif]-->
+ <!--[if (!mso)&(!IE)]><!-->
+ </div>
+ <!--<![endif]-->
+ </div>
+ </div>
+ <!--[if (mso)|(IE)]></td></tr></table><![endif]-->
+ <!--[if (mso)|(IE)]></td></tr></table></td></tr></table><![endif]-->
+ </div>
+ </div>
+ </div>
+ <%# user card END %>
+
+ <%= if latest_status do %>
+ <div style="background-color:transparent;">
+ <div class="block-grid"
+ style="Margin: 0 auto; min-width: 320px; max-width: 590px; overflow-wrap: break-word; word-wrap: break-word; word-break: break-word; background-color: <%= @styling.content_background_color%>;">
+ <div style="border-collapse: collapse;display: table;width: 100%;background-color:<%= @styling.content_background_color%>;">
+ <!--[if (mso)|(IE)]><table width="100%" cellpadding="0" cellspacing="0" border="0" style="background-color:transparent;"><tr><td align="center"><table cellpadding="0" cellspacing="0" border="0" style="width:590px"><tr class="layout-full-width" style="background-color:<%= @styling.content_background_color%>"><![endif]-->
+ <!--[if (mso)|(IE)]><td align="center" width="590" style="background-color:<%= @styling.content_background_color%>;width:590px; border-top: 0px solid transparent; border-left: 0px solid transparent; border-bottom: 0px solid transparent; border-right: 0px solid transparent;" valign="top"><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 15px; padding-left: 15px; padding-top:5px; padding-bottom:5px;"><![endif]-->
+ <div class="col num12"
+ style="min-width: 320px; max-width: 590px; display: table-cell; vertical-align: top; width: 590px;">
+ <div style="width:100% !important;">
+ <!--[if (!mso)&(!IE)]><!-->
+ <div
+ style="border-top:0px solid transparent; border-left:0px solid transparent; border-bottom:0px solid transparent; border-right:0px solid transparent; padding-top:5px; padding-bottom:5px; padding-right: 15px; padding-left: 15px;">
+ <!--<![endif]-->
+ <!--[if mso]><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 10px; padding-left: 10px; padding-top: 10px; padding-bottom: 10px; font-family: Arial, sans-serif"><![endif]-->
+ <div
+ style="color:<%= @styling.text_color %>;font-family:Arial, 'Helvetica Neue', Helvetica, sans-serif;line-height:120%;padding-top:10px;padding-right:10px;padding-bottom:10px;padding-left:10px;">
+ <div
+ style="font-family: Arial, 'Helvetica Neue', Helvetica, sans-serif; font-size: 12px; line-height: 14px; color: <%= @styling.text_color %>;">
+ <span style="font-size: 16px; line-height: 19px;"><%= raw latest_status.object.data["content"] %></span></div>
+ </div>
+ <!--[if mso]></td></tr></table><![endif]-->
+ <!--[if mso]><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 10px; padding-left: 15px; padding-top: 10px; padding-bottom: 10px; font-family: Arial, sans-serif"><![endif]-->
+ <div
+ style="color:<%= @styling.text_muted_color %>;font-family:Arial, 'Helvetica Neue', Helvetica, sans-serif;line-height:120%;padding-top:10px;padding-right:10px;padding-bottom:10px;padding-left:15px;">
+ <div
+ style="font-family: Arial, 'Helvetica Neue', Helvetica, sans-serif; font-size: 12px; line-height: 14px; color: <%= @styling.text_muted_color %>;">
+ <p style="font-size: 14px; line-height: 16px; margin: 0;"><%= format_date latest_status.object.data["published"] %></p>
+ </div>
+ </div>
+ <!--[if mso]></td></tr></table><![endif]-->
+ <!--[if (!mso)&(!IE)]><!-->
+ </div>
+ <!--<![endif]-->
+ </div>
+ </div>
+ <!--[if (mso)|(IE)]></td></tr></table><![endif]-->
+ <!--[if (mso)|(IE)]></td></tr></table></td></tr></table><![endif]-->
+ </div>
+ </div>
+ </div>
+ <% end %>
+ <%# divider start %>
+ <div style="background-color:transparent;">
+ <div class="block-grid"
+ style="Margin: 0 auto; min-width: 320px; max-width: 590px; overflow-wrap: break-word; word-wrap: break-word; word-break: break-word; background-color: <%= @styling.content_background_color%>;">
+ <div style="border-collapse: collapse;display: table;width: 100%;background-color:<%= @styling.content_background_color%>;">
+ <!--[if (mso)|(IE)]><table width="100%" cellpadding="0" cellspacing="0" border="0" style="background-color:transparent;"><tr><td align="center"><table cellpadding="0" cellspacing="0" border="0" style="width:590px"><tr class="layout-full-width" style="background-color:<%= @styling.content_background_color%>"><![endif]-->
+ <!--[if (mso)|(IE)]><td align="center" width="590" style="background-color:<%= @styling.content_background_color%>;width:590px; border-top: 0px solid transparent; border-left: 0px solid transparent; border-bottom: 0px solid transparent; border-right: 0px solid transparent;" valign="top"><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 0px; padding-left: 0px; padding-top:5px; padding-bottom:5px;"><![endif]-->
+ <div class="col num12"
+ style="min-width: 320px; max-width: 590px; display: table-cell; vertical-align: top; width: 590px;">
+ <div style="width:100% !important;">
+ <!--[if (!mso)&(!IE)]><!-->
+ <div
+ style="border-top:0px solid transparent; border-left:0px solid transparent; border-bottom:0px solid transparent; border-right:0px solid transparent; padding-top:5px; padding-bottom:5px; padding-right: 0px; padding-left: 0px;">
+ <!--<![endif]-->
+ <table border="0" cellpadding="0" cellspacing="0" class="divider" role="presentation"
+ style="table-layout: fixed; vertical-align: top; border-spacing: 0; border-collapse: collapse; mso-table-lspace: 0pt; mso-table-rspace: 0pt; min-width: 100%; -ms-text-size-adjust: 100%; -webkit-text-size-adjust: 100%;"
+ valign="top" width="100%">
+ <tbody>
+ <tr style="vertical-align: top;" valign="top">
+ <td class="divider_inner"
+ style="word-break: break-word; vertical-align: top; min-width: 100%; -ms-text-size-adjust: 100%; -webkit-text-size-adjust: 100%; padding-top: 10px; padding-right: 10px; padding-bottom: 10px; padding-left: 10px;"
+ valign="top">
+ <table align="center" border="0" cellpadding="0" cellspacing="0" class="divider_content"
+ height="0" role="presentation"
+ style="table-layout: fixed; vertical-align: top; border-spacing: 0; border-collapse: collapse; mso-table-lspace: 0pt; mso-table-rspace: 0pt; width: 100%; border-top: 1px solid <%= @styling.text_color %>; height: 0px;"
+ valign="top" width="100%">
+ <tbody>
+ <tr style="vertical-align: top;" valign="top">
+ <td height="0"
+ style="word-break: break-word; vertical-align: top; -ms-text-size-adjust: 100%; -webkit-text-size-adjust: 100%;"
+ valign="top"><span></span></td>
+ </tr>
+ </tbody>
+ </table>
+ </td>
+ </tr>
+ </tbody>
+ </table>
+ <!--[if (!mso)&(!IE)]><!-->
+ </div>
+ <!--<![endif]-->
+ </div>
+ </div>
+ <!--[if (mso)|(IE)]></td></tr></table><![endif]-->
+ <!--[if (mso)|(IE)]></td></tr></table></td></tr></table><![endif]-->
+ </div>
+ </div>
+ </div>
+
+ <%# divider end %>
+ <%# user card END %>
+<% end %>
diff --git a/lib/pleroma/web/templates/feed/feed/_activity.xml.eex b/lib/pleroma/web/templates/feed/feed/_activity.atom.eex
index d1f5e903c..78350f2aa 100644
--- a/lib/pleroma/web/templates/feed/feed/_activity.xml.eex
+++ b/lib/pleroma/web/templates/feed/feed/_activity.atom.eex
@@ -2,12 +2,14 @@
<activity:object-type>http://activitystrea.ms/schema/1.0/note</activity:object-type>
<activity:verb>http://activitystrea.ms/schema/1.0/post</activity:verb>
<id><%= @data["id"] %></id>
- <title><%= "New note by #{@user.nickname}" %></title>
- <content type="html"><%= activity_content(@activity) %></content>
- <published><%= @data["published"] %></published>
- <updated><%= @data["published"] %></updated>
- <ostatus:conversation ref="<%= activity_context(@activity) %>"><%= activity_context(@activity) %></ostatus:conversation>
- <link ref="<%= activity_context(@activity) %>" rel="ostatus:conversation"/>
+ <title><%= activity_title(@data, Keyword.get(@feed_config, :post_title, %{})) %></title>
+ <content type="html"><%= activity_content(@data) %></content>
+ <published><%= @activity.data["published"] %></published>
+ <updated><%= @activity.data["published"] %></updated>
+ <ostatus:conversation ref="<%= activity_context(@activity) %>">
+ <%= activity_context(@activity) %>
+ </ostatus:conversation>
+ <link href="<%= activity_context(@activity) %>" rel="ostatus:conversation"/>
<%= if @data["summary"] do %>
<summary><%= @data["summary"] %></summary>
diff --git a/lib/pleroma/web/templates/feed/feed/_activity.rss.eex b/lib/pleroma/web/templates/feed/feed/_activity.rss.eex
new file mode 100644
index 000000000..a304a16af
--- /dev/null
+++ b/lib/pleroma/web/templates/feed/feed/_activity.rss.eex
@@ -0,0 +1,49 @@
+<item>
+ <activity:object-type>http://activitystrea.ms/schema/1.0/note</activity:object-type>
+ <activity:verb>http://activitystrea.ms/schema/1.0/post</activity:verb>
+ <guid><%= @data["id"] %></guid>
+ <title><%= activity_title(@data, Keyword.get(@feed_config, :post_title, %{})) %></title>
+ <description><%= activity_content(@data) %></description>
+ <pubDate><%= @activity.data["published"] %></pubDate>
+ <updated><%= @activity.data["published"] %></updated>
+ <ostatus:conversation ref="<%= activity_context(@activity) %>">
+ <%= activity_context(@activity) %>
+ </ostatus:conversation>
+ <link rel="ostatus:conversation"><%= activity_context(@activity) %></link>
+
+ <%= if @data["summary"] do %>
+ <description><%= @data["summary"] %></description>
+ <% end %>
+
+ <%= if @activity.local do %>
+ <link><%= @data["id"] %></link>
+ <% else %>
+ <link><%= @data["external_url"] %></link>
+ <% end %>
+
+ <%= for tag <- @data["tag"] || [] do %>
+ <category term="<%= tag %>"></category>
+ <% end %>
+
+ <%= for attachment <- @data["attachment"] || [] do %>
+ <link type="<%= attachment_type(attachment) %>"><%= attachment_href(attachment) %></link>
+ <% end %>
+
+ <%= if @data["inReplyTo"] do %>
+ <thr:in-reply-to ref='<%= @data["inReplyTo"] %>' href='<%= get_href(@data["inReplyTo"]) %>'/>
+ <% end %>
+
+ <%= for id <- @activity.recipients do %>
+ <%= if id == Pleroma.Constants.as_public() do %>
+ <link rel="mentioned" ostatus:object-type="http://activitystrea.ms/schema/1.0/collection">http://activityschema.org/collection/public</link>
+ <% else %>
+ <%= unless Regex.match?(~r/^#{Pleroma.Web.base_url()}.+followers$/, id) do %>
+ <link rel="mentioned" ostatus:object-type="http://activitystrea.ms/schema/1.0/person"><%= id %></link>
+ <% end %>
+ <% end %>
+ <% end %>
+
+ <%= for {emoji, file} <- @data["emoji"] || %{} do %>
+ <link name="<%= emoji %>" rel="emoji"><%= file %></link>
+ <% end %>
+</item>
diff --git a/lib/pleroma/web/templates/feed/feed/_author.xml.eex b/lib/pleroma/web/templates/feed/feed/_author.atom.eex
index 25cbffada..25cbffada 100644
--- a/lib/pleroma/web/templates/feed/feed/_author.xml.eex
+++ b/lib/pleroma/web/templates/feed/feed/_author.atom.eex
diff --git a/lib/pleroma/web/templates/feed/feed/_author.rss.eex b/lib/pleroma/web/templates/feed/feed/_author.rss.eex
new file mode 100644
index 000000000..526aeddcf
--- /dev/null
+++ b/lib/pleroma/web/templates/feed/feed/_author.rss.eex
@@ -0,0 +1,17 @@
+<managingEditor>
+ <guid><%= @user.ap_id %></guid>
+ <activity:object>http://activitystrea.ms/schema/1.0/person</activity:object>
+ <uri><%= @user.ap_id %></uri>
+ <poco:preferredUsername><%= @user.nickname %></poco:preferredUsername>
+ <poco:displayName><%= @user.name %></poco:displayName>
+ <poco:note><%= escape(@user.bio) %></poco:note>
+ <description><%= escape(@user.bio) %></description>
+ <name><%= @user.nickname %></name>
+ <link rel="avatar"><%= User.avatar_url(@user) %></link>
+ <%= if User.banner_url(@user) do %>
+ <link rel="header"><%= User.banner_url(@user) %></link>
+ <% end %>
+ <%= if @user.local do %>
+ <ap_enabled>true</ap_enabled>
+ <% end %>
+</managingEditor>
diff --git a/lib/pleroma/web/templates/feed/feed/_tag_activity.atom.eex b/lib/pleroma/web/templates/feed/feed/_tag_activity.atom.eex
new file mode 100644
index 000000000..cf5874a91
--- /dev/null
+++ b/lib/pleroma/web/templates/feed/feed/_tag_activity.atom.eex
@@ -0,0 +1,51 @@
+<entry>
+ <activity:object-type>http://activitystrea.ms/schema/1.0/note</activity:object-type>
+ <activity:verb>http://activitystrea.ms/schema/1.0/post</activity:verb>
+
+ <%= render @view_module, "_tag_author.atom", assigns %>
+
+ <id><%= @data["id"] %></id>
+ <title><%= activity_title(@data, Keyword.get(@feed_config, :post_title, %{})) %></title>
+ <content type="html"><%= activity_content(@data) %></content>
+
+ <%= if @activity.local do %>
+ <link type="application/atom+xml" href='<%= @data["id"] %>' rel="self"/>
+ <link type="text/html" href='<%= @data["id"] %>' rel="alternate"/>
+ <% else %>
+ <link type="text/html" href='<%= @data["external_url"] %>' rel="alternate"/>
+ <% end %>
+
+ <published><%= @activity.data["published"] %></published>
+ <updated><%= @activity.data["published"] %></updated>
+
+ <ostatus:conversation ref="<%= activity_context(@activity) %>">
+ <%= activity_context(@activity) %>
+ </ostatus:conversation>
+ <link href="<%= activity_context(@activity) %>" rel="ostatus:conversation"/>
+
+ <%= if @data["summary"] do %>
+ <summary><%= @data["summary"] %></summary>
+ <% end %>
+
+ <%= for id <- @activity.recipients do %>
+ <%= if id == Pleroma.Constants.as_public() do %>
+ <link rel="mentioned"
+ ostatus:object-type="http://activitystrea.ms/schema/1.0/collection"
+ href="http://activityschema.org/collection/public"/>
+ <% else %>
+ <%= unless Regex.match?(~r/^#{Pleroma.Web.base_url()}.+followers$/, id) do %>
+ <link rel="mentioned"
+ ostatus:object-type="http://activitystrea.ms/schema/1.0/person"
+ href="<%= id %>" />
+ <% end %>
+ <% end %>
+ <% end %>
+
+ <%= for tag <- @data["tag"] || [] do %>
+ <category term="<%= tag %>"></category>
+ <% end %>
+
+ <%= for {emoji, file} <- @data["emoji"] || %{} do %>
+ <link name="<%= emoji %>" rel="emoji" href="<%= file %>"/>
+ <% end %>
+</entry>
diff --git a/lib/pleroma/web/templates/feed/feed/_tag_activity.xml.eex b/lib/pleroma/web/templates/feed/feed/_tag_activity.xml.eex
new file mode 100644
index 000000000..2334e24a2
--- /dev/null
+++ b/lib/pleroma/web/templates/feed/feed/_tag_activity.xml.eex
@@ -0,0 +1,14 @@
+<item>
+ <title><%= activity_title(@data, Keyword.get(@feed_config, :post_title, %{})) %></title>
+
+
+ <guid isPermalink="true"><%= activity_context(@activity) %></guid>
+ <link><%= activity_context(@activity) %></link>
+ <pubDate><%= pub_date(@activity.data["published"]) %></pubDate>
+
+ <description><%= activity_content(@data) %></description>
+ <%= for attachment <- @data["attachment"] || [] do %>
+ <enclosure url="<%= attachment_href(attachment) %>" type="<%= attachment_type(attachment) %>"/>
+ <% end %>
+
+</item>
diff --git a/lib/pleroma/web/templates/feed/feed/_tag_author.atom.eex b/lib/pleroma/web/templates/feed/feed/_tag_author.atom.eex
new file mode 100644
index 000000000..997c4936e
--- /dev/null
+++ b/lib/pleroma/web/templates/feed/feed/_tag_author.atom.eex
@@ -0,0 +1,18 @@
+<author>
+ <activity:object-type>http://activitystrea.ms/schema/1.0/person</activity:object-type>
+ <id><%= @actor.ap_id %></id>
+ <uri><%= @actor.ap_id %></uri>
+ <name><%= @actor.nickname %></name>
+ <summary><%= escape(@actor.bio) %></summary>
+ <link rel="avatar" href="<%= User.avatar_url(@actor) %>"/>
+ <%= if User.banner_url(@actor) do %>
+ <link rel="header" href="<%= User.banner_url(@actor) %>"/>
+ <% end %>
+ <%= if @actor.local do %>
+ <ap_enabled>true</ap_enabled>
+ <% end %>
+
+ <poco:preferredUsername><%= @actor.nickname %></poco:preferredUsername>
+ <poco:displayName><%= @actor.name %></poco:displayName>
+ <poco:note><%= escape(@actor.bio) %></poco:note>
+</author>
diff --git a/lib/pleroma/web/templates/feed/feed/tag.atom.eex b/lib/pleroma/web/templates/feed/feed/tag.atom.eex
new file mode 100644
index 000000000..a288539ed
--- /dev/null
+++ b/lib/pleroma/web/templates/feed/feed/tag.atom.eex
@@ -0,0 +1,22 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<feed xml:lang="en-US" xmlns="http://www.w3.org/2005/Atom"
+ xmlns:thr="http://purl.org/syndication/thread/1.0"
+ xmlns:georss="http://www.georss.org/georss"
+ xmlns:activity="http://activitystrea.ms/spec/1.0/"
+ xmlns:media="http://purl.org/syndication/atommedia"
+ xmlns:poco="http://portablecontacts.net/spec/1.0"
+ xmlns:ostatus="http://ostatus.org/schema/1.0"
+ xmlns:statusnet="http://status.net/schema/api/1/">
+
+ <id><%= '#{tag_feed_url(@conn, :feed, @tag)}.rss' %></id>
+ <title>#<%= @tag %></title>
+
+ <subtitle>These are public toots tagged with #<%= @tag %>. You can interact with them if you have an account anywhere in the fediverse.</subtitle>
+ <logo><%= feed_logo() %></logo>
+ <updated><%= most_recent_update(@activities) %></updated>
+ <link rel="self" href="<%= '#{tag_feed_url(@conn, :feed, @tag)}.atom' %>" type="application/atom+xml"/>
+ <%= for activity <- @activities do %>
+ <%= render @view_module, "_tag_activity.atom", Map.merge(assigns, prepare_activity(activity, actor: true)) %>
+ <% end %>
+</feed>
diff --git a/lib/pleroma/web/templates/feed/feed/tag.rss.eex b/lib/pleroma/web/templates/feed/feed/tag.rss.eex
new file mode 100644
index 000000000..eeda01a04
--- /dev/null
+++ b/lib/pleroma/web/templates/feed/feed/tag.rss.eex
@@ -0,0 +1,15 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<rss version="2.0" xmlns:webfeeds="http://webfeeds.org/rss/1.0">
+ <channel>
+
+
+ <title>#<%= @tag %></title>
+ <description>These are public toots tagged with #<%= @tag %>. You can interact with them if you have an account anywhere in the fediverse.</description>
+ <link><%= '#{tag_feed_url(@conn, :feed, @tag)}.rss' %></link>
+ <webfeeds:logo><%= feed_logo() %></webfeeds:logo>
+ <webfeeds:accentColor>2b90d9</webfeeds:accentColor>
+ <%= for activity <- @activities do %>
+ <%= render @view_module, "_tag_activity.xml", Map.merge(assigns, prepare_activity(activity)) %>
+ <% end %>
+ </channel>
+</rss>
diff --git a/lib/pleroma/web/templates/feed/feed/feed.xml.eex b/lib/pleroma/web/templates/feed/feed/user.atom.eex
index 45df9dc09..c6acd848f 100644
--- a/lib/pleroma/web/templates/feed/feed/feed.xml.eex
+++ b/lib/pleroma/web/templates/feed/feed/user.atom.eex
@@ -6,19 +6,19 @@
xmlns:poco="http://portablecontacts.net/spec/1.0"
xmlns:ostatus="http://ostatus.org/schema/1.0">
- <id><%= feed_url(@conn, :feed, @user.nickname) <> ".atom" %></id>
+ <id><%= user_feed_url(@conn, :feed, @user.nickname) <> ".atom" %></id>
<title><%= @user.nickname <> "'s timeline" %></title>
<updated><%= most_recent_update(@activities, @user) %></updated>
<logo><%= logo(@user) %></logo>
- <link rel="self" href="<%= '#{feed_url(@conn, :feed, @user.nickname)}.atom' %>" type="application/atom+xml"/>
+ <link rel="self" href="<%= '#{user_feed_url(@conn, :feed, @user.nickname)}.atom' %>" type="application/atom+xml"/>
- <%= render @view_module, "_author.xml", assigns %>
+ <%= render @view_module, "_author.atom", assigns %>
<%= if last_activity(@activities) do %>
- <link rel="next" href="<%= '#{feed_url(@conn, :feed, @user.nickname)}.atom?max_id=#{last_activity(@activities).id}' %>" type="application/atom+xml"/>
+ <link rel="next" href="<%= '#{user_feed_url(@conn, :feed, @user.nickname)}.atom?max_id=#{last_activity(@activities).id}' %>" type="application/atom+xml"/>
<% end %>
<%= for activity <- @activities do %>
- <%= render @view_module, "_activity.xml", Map.merge(assigns, %{activity: activity, data: activity_object_data(activity)}) %>
+ <%= render @view_module, "_activity.atom", Map.merge(assigns, prepare_activity(activity)) %>
<% end %>
</feed>
diff --git a/lib/pleroma/web/templates/feed/feed/user.rss.eex b/lib/pleroma/web/templates/feed/feed/user.rss.eex
new file mode 100644
index 000000000..d69120480
--- /dev/null
+++ b/lib/pleroma/web/templates/feed/feed/user.rss.eex
@@ -0,0 +1,20 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<rss version="2.0">
+ <channel>
+ <guid><%= user_feed_url(@conn, :feed, @user.nickname) <> ".rss" %></guid>
+ <title><%= @user.nickname <> "'s timeline" %></title>
+ <updated><%= most_recent_update(@activities, @user) %></updated>
+ <image><%= logo(@user) %></image>
+ <link><%= '#{user_feed_url(@conn, :feed, @user.nickname)}.rss' %></link>
+
+ <%= render @view_module, "_author.rss", assigns %>
+
+ <%= if last_activity(@activities) do %>
+ <link rel="next"><%= '#{user_feed_url(@conn, :feed, @user.nickname)}.rss?max_id=#{last_activity(@activities).id}' %></link>
+ <% end %>
+
+ <%= for activity <- @activities do %>
+ <%= render @view_module, "_activity.rss", Map.merge(assigns, prepare_activity(activity)) %>
+ <% end %>
+ </channel>
+</rss>
diff --git a/lib/pleroma/web/templates/layout/email_styled.html.eex b/lib/pleroma/web/templates/layout/email_styled.html.eex
new file mode 100644
index 000000000..ca2caaf4d
--- /dev/null
+++ b/lib/pleroma/web/templates/layout/email_styled.html.eex
@@ -0,0 +1,193 @@
+<!DOCTYPE html
+ PUBLIC "-//W3C//DTD XHTML 1.0 Transitional //EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+
+<html xmlns="http://www.w3.org/1999/xhtml" xmlns:o="urn:schemas-microsoft-com:office:office"
+ xmlns:v="urn:schemas-microsoft-com:vml">
+
+<head>
+ <!--[if gte mso 9]><xml><o:OfficeDocumentSettings><o:AllowPNG/><o:PixelsPerInch>96</o:PixelsPerInch></o:OfficeDocumentSettings></xml><![endif]-->
+ <meta content="text/html; charset=utf-8" http-equiv="Content-Type" />
+ <meta content="width=device-width" name="viewport" />
+ <!--[if !mso]><!-->
+ <meta content="IE=edge" http-equiv="X-UA-Compatible" />
+ <!--<![endif]-->
+ <title><%= @email.subject %></title>
+ <!--[if !mso]><!-->
+ <!--<![endif]-->
+ <style type="text/css">
+ body {
+ margin: 0;
+ padding: 0;
+ }
+
+ a {
+
+ color: <%= @styling.link_color %>;
+ text-decoration: none;
+ }
+
+ table,
+ td,
+ tr {
+ vertical-align: top;
+ border-collapse: collapse;
+ }
+
+ * {
+ line-height: inherit;
+ }
+
+ a[x-apple-data-detectors=true] {
+ color: inherit !important;
+ text-decoration: none !important;
+ }
+ </style>
+ <style id="media-query" type="text/css">
+ @media (max-width: 610px) {
+
+ .block-grid,
+ .col {
+ min-width: 320px !important;
+ max-width: 100% !important;
+ display: block !important;
+ }
+
+ .block-grid {
+ width: 100% !important;
+ }
+
+ .col {
+ width: 100% !important;
+ }
+
+ .col>div {
+ margin: 0 auto;
+ }
+
+ .no-stack .col {
+ min-width: 0 !important;
+ display: table-cell !important;
+ }
+
+ .no-stack.two-up .col {
+ width: 50% !important;
+ }
+
+ .no-stack .col.num4 {
+ width: 33% !important;
+ }
+
+ .no-stack .col.num8 {
+ width: 66% !important;
+ }
+
+ .no-stack .col.num4 {
+ width: 33% !important;
+ }
+
+ .no-stack .col.num3 {
+ width: 25% !important;
+ }
+
+ .no-stack .col.num6 {
+ width: 50% !important;
+ }
+
+ .no-stack .col.num9 {
+ width: 75% !important;
+ }
+
+ }
+ </style>
+</head>
+
+<body class="clean-body" style="margin: 0; padding: 0; -webkit-text-size-adjust: 100%; background-color: <%= @styling.background_color %>;">
+ <!--[if IE]><div class="ie-browser"><![endif]-->
+ <table bgcolor="<%= @styling.background_color %>" cellpadding="0" cellspacing="0" class="nl-container" role="presentation"
+ style="table-layout: fixed; vertical-align: top; min-width: 320px; Margin: 0 auto; border-spacing: 0; border-collapse: collapse; mso-table-lspace: 0pt; mso-table-rspace: 0pt; background-color: <%= @styling.background_color %>; width: 100%;"
+ valign="top" width="100%">
+ <tbody>
+ <tr style="vertical-align: top;" valign="top">
+ <td style="word-break: break-word; vertical-align: top;" valign="top">
+ <!--[if (mso)|(IE)]><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td align="center" style="background-color:<%= @styling.background_color %>"><![endif]-->
+
+ <%# header %>
+ <div style="background-color:transparent;">
+ <div class="block-grid"
+ style="Margin: 0 auto; min-width: 320px; max-width: 590px; overflow-wrap: break-word; word-wrap: break-word; word-break: break-word; background-color: <%= @styling.content_background_color%>;">
+ <div style="border-collapse: collapse;display: table;width: 100%;background-color:<%= @styling.content_background_color%>;">
+ <!--[if (mso)|(IE)]><table width="100%" cellpadding="0" cellspacing="0" border="0" style="background-color:transparent;"><tr><td align="center"><table cellpadding="0" cellspacing="0" border="0" style="width:590px"><tr class="layout-full-width" style="background-color:<%= @styling.content_background_color%>"><![endif]-->
+ <!--[if (mso)|(IE)]><td align="center" width="590" style="background-color:<%= @styling.content_background_color%>;width:590px; border-top: 0px solid transparent; border-left: 0px solid transparent; border-bottom: 0px solid transparent; border-right: 0px solid transparent;" valign="top"><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 0px; padding-left: 0px; padding-top:5px; padding-bottom:5px;"><![endif]-->
+ <div class="col num12"
+ style="min-width: 320px; max-width: 590px; display: table-cell; vertical-align: top; width: 590px;">
+ <div style="width:100% !important;">
+ <!--[if (!mso)&(!IE)]><!-->
+ <div
+ style="border-top:0px solid transparent; border-left:0px solid transparent; border-bottom:0px solid transparent; border-right:0px solid transparent; padding-top:5px; padding-bottom:5px; padding-right: 0px; padding-left: 0px;">
+ <!--<![endif]-->
+ <div align="center" class="img-container center"
+ style="padding-right: 0px;padding-left: 0px;">
+ <!--[if mso]><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr style="line-height:0px"><td style="padding-right: 0px;padding-left: 0px;" align="center"><![endif]--><img
+ align="center" alt="Image" border="0" class="center" src="<%= @logo_url %>"
+ style="text-decoration: none; -ms-interpolation-mode: bicubic; border: 0; height: 80px; width: auto; max-height: 80px; display: block;"
+ title="Image" height="80" />
+ <!--[if mso]></td></tr></table><![endif]-->
+ </div>
+ <!--[if (!mso)&(!IE)]><!-->
+ </div>
+ <!--<![endif]-->
+ </div>
+ </div>
+ <!--[if (mso)|(IE)]></td></tr></table><![endif]-->
+ <!--[if (mso)|(IE)]></td></tr></table></td></tr></table><![endif]-->
+ </div>
+ </div>
+ </div>
+
+
+ <%# title %>
+ <%= if @title do %>
+ <div style="background-color:transparent;">
+ <div class="block-grid"
+ style="Margin: 0 auto; min-width: 320px; max-width: 590px; overflow-wrap: break-word; word-wrap: break-word; word-break: break-word; background-color: <%= @styling.content_background_color%>;">
+ <div style="border-collapse: collapse;display: table;width: 100%;background-color:<%= @styling.content_background_color%>;">
+ <!--[if (mso)|(IE)]><table width="100%" cellpadding="0" cellspacing="0" border="0" style="background-color:transparent;"><tr><td align="center"><table cellpadding="0" cellspacing="0" border="0" style="width:590px"><tr class="layout-full-width" style="background-color:<%= @styling.content_background_color%>"><![endif]-->
+ <!--[if (mso)|(IE)]><td align="center" width="590" style="background-color:<%= @styling.content_background_color%>;width:590px; border-top: 0px solid transparent; border-left: 0px solid transparent; border-bottom: 0px solid transparent; border-right: 0px solid transparent;" valign="top"><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 0px; padding-left: 0px; padding-top:5px; padding-bottom:5px;"><![endif]-->
+ <div class="col num12"
+ style="min-width: 320px; max-width: 590px; display: table-cell; vertical-align: top; width: 590px;">
+ <div style="width:100% !important;">
+ <!--[if (!mso)&(!IE)]><!-->
+ <div
+ style="border-top:0px solid transparent; border-left:0px solid transparent; border-bottom:0px solid transparent; border-right:0px solid transparent; padding-top:5px; padding-bottom:5px; padding-right: 0px; padding-left: 0px;">
+ <!--<![endif]-->
+ <!--[if mso]><table width="100%" cellpadding="0" cellspacing="0" border="0"><tr><td style="padding-right: 10px; padding-left: 10px; padding-top: 10px; padding-bottom: 10px; font-family: Arial, sans-serif"><![endif]-->
+ <div
+ style="line-height:120%;padding-top:10px;padding-right:10px;padding-bottom:10px;padding-left:10px;">
+ <div
+ style="font-family: Arial, 'Helvetica Neue', Helvetica, sans-serif;line-height: 14px; color: <%= @styling.header_color %>;">
+ <p style="line-height: 36px; text-align: center; margin: 0;"><span
+ style="font-size: 30px; color: <%= @styling.header_color %>;"><%= @title %></span></p>
+ </div>
+ </div>
+ <!--[if mso]></td></tr></table><![endif]-->
+ <!--[if (!mso)&(!IE)]><!-->
+ </div>
+ <!--<![endif]-->
+ </div>
+ </div>
+ <!--[if (mso)|(IE)]></td></tr></table><![endif]-->
+ <!--[if (mso)|(IE)]></td></tr></table></td></tr></table><![endif]-->
+ </div>
+ </div>
+ </div>
+ <% end %>
+ <%= render @view_module, @view_template, assigns %>
+
+ </td>
+ </tr>
+ </tbody>
+ </table>
+ <!--[if (IE)]></div><![endif]-->
+</body>
+
+</html>
diff --git a/lib/pleroma/web/templates/layout/static_fe.html.eex b/lib/pleroma/web/templates/layout/static_fe.html.eex
new file mode 100644
index 000000000..dc0ee2a5c
--- /dev/null
+++ b/lib/pleroma/web/templates/layout/static_fe.html.eex
@@ -0,0 +1,15 @@
+<!DOCTYPE html>
+<html>
+ <head>
+ <meta charset="utf-8" />
+ <meta name="viewport" content="width=device-width,initial-scale=1,minimal-ui" />
+ <title><%= Pleroma.Config.get([:instance, :name]) %></title>
+ <%= Phoenix.HTML.raw(assigns[:meta] || "") %>
+ <link rel="stylesheet" href="/static-fe/static-fe.css">
+ </head>
+ <body>
+ <div class="container">
+ <%= render @view_module, @view_template, assigns %>
+ </div>
+ </body>
+</html>
diff --git a/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex b/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex
new file mode 100644
index 000000000..750f65386
--- /dev/null
+++ b/lib/pleroma/web/templates/o_auth/mfa/recovery.html.eex
@@ -0,0 +1,24 @@
+<%= if get_flash(@conn, :info) do %>
+<p class="alert alert-info" role="alert"><%= get_flash(@conn, :info) %></p>
+<% end %>
+<%= if get_flash(@conn, :error) do %>
+<p class="alert alert-danger" role="alert"><%= get_flash(@conn, :error) %></p>
+<% end %>
+
+<h2>Two-factor recovery</h2>
+
+<%= form_for @conn, mfa_verify_path(@conn, :verify), [as: "mfa"], fn f -> %>
+<div class="input">
+ <%= label f, :code, "Recovery code" %>
+ <%= text_input f, :code %>
+ <%= hidden_input f, :mfa_token, value: @mfa_token %>
+ <%= hidden_input f, :state, value: @state %>
+ <%= hidden_input f, :redirect_uri, value: @redirect_uri %>
+ <%= hidden_input f, :challenge_type, value: "recovery" %>
+</div>
+
+<%= submit "Verify" %>
+<% end %>
+<a href="<%= mfa_path(@conn, :show, %{challenge_type: "totp", mfa_token: @mfa_token, state: @state, redirect_uri: @redirect_uri}) %>">
+ Enter a two-factor code
+</a>
diff --git a/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex b/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex
new file mode 100644
index 000000000..af6e546b0
--- /dev/null
+++ b/lib/pleroma/web/templates/o_auth/mfa/totp.html.eex
@@ -0,0 +1,24 @@
+<%= if get_flash(@conn, :info) do %>
+<p class="alert alert-info" role="alert"><%= get_flash(@conn, :info) %></p>
+<% end %>
+<%= if get_flash(@conn, :error) do %>
+<p class="alert alert-danger" role="alert"><%= get_flash(@conn, :error) %></p>
+<% end %>
+
+<h2>Two-factor authentication</h2>
+
+<%= form_for @conn, mfa_verify_path(@conn, :verify), [as: "mfa"], fn f -> %>
+<div class="input">
+ <%= label f, :code, "Authentication code" %>
+ <%= text_input f, :code %>
+ <%= hidden_input f, :mfa_token, value: @mfa_token %>
+ <%= hidden_input f, :state, value: @state %>
+ <%= hidden_input f, :redirect_uri, value: @redirect_uri %>
+ <%= hidden_input f, :challenge_type, value: "totp" %>
+</div>
+
+<%= submit "Verify" %>
+<% end %>
+<a href="<%= mfa_path(@conn, :show, %{challenge_type: "recovery", mfa_token: @mfa_token, state: @state, redirect_uri: @redirect_uri}) %>">
+ Enter a two-factor recovery code
+</a>
diff --git a/lib/pleroma/web/templates/static_fe/static_fe/_attachment.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/_attachment.html.eex
new file mode 100644
index 000000000..4853e7f4b
--- /dev/null
+++ b/lib/pleroma/web/templates/static_fe/static_fe/_attachment.html.eex
@@ -0,0 +1,8 @@
+<%= case @mediaType do %>
+<% "audio" -> %>
+<audio class="u-audio" src="<%= @url %>" controls="controls"></audio>
+<% "video" -> %>
+<video class="u-video" src="<%= @url %>" controls="controls"></video>
+<% _ -> %>
+<img class="u-photo" src="<%= @url %>" alt="<%= @name %>" title="<%= @name %>">
+<% end %>
diff --git a/lib/pleroma/web/templates/static_fe/static_fe/_notice.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/_notice.html.eex
new file mode 100644
index 000000000..df0244795
--- /dev/null
+++ b/lib/pleroma/web/templates/static_fe/static_fe/_notice.html.eex
@@ -0,0 +1,41 @@
+<div class="activity h-entry" <%= if @selected do %> id="selected" <% end %>>
+ <p class="pull-right">
+ <a class="activity-link u-url u-uid" href="<%= @link %>">
+ <time class="dt-published" datetime="<%= @published %>">
+ <%= format_date(@published) %>
+ </time>
+ </a>
+ </p>
+ <%= render("_user_card.html", %{user: @user}) %>
+ <div class="activity-content">
+ <%= if @title != "" do %>
+ <details <%= if open_content?() do %>open<% end %>>
+ <summary class="p-name"><%= raw @title %></summary>
+ <div class="e-content"><%= raw @content %></div>
+ </details>
+ <% else %>
+ <div class="e-content"><%= raw @content %></div>
+ <% end %>
+ <%= for %{"name" => name, "url" => [url | _]} <- @attachment do %>
+ <%= if @sensitive do %>
+ <details class="nsfw">
+ <summary><%= Gettext.gettext("sensitive media") %></summary>
+ <div>
+ <%= render("_attachment.html", %{name: name, url: url["href"],
+ mediaType: fetch_media_type(url)}) %>
+ </div>
+ </details>
+ <% else %>
+ <%= render("_attachment.html", %{name: name, url: url["href"],
+ mediaType: fetch_media_type(url)}) %>
+ <% end %>
+ <% end %>
+ </div>
+ <%= if @selected do %>
+ <dl class="counts">
+ <dt><%= Gettext.gettext("replies") %></dt><dd><%= @counts.replies %></dd>
+ <dt><%= Gettext.gettext("announces") %></dt><dd><%= @counts.announces %></dd>
+ <dt><%= Gettext.gettext("likes") %></dt><dd><%= @counts.likes %></dd>
+ </dl>
+ <% end %>
+</div>
diff --git a/lib/pleroma/web/templates/static_fe/static_fe/_user_card.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/_user_card.html.eex
new file mode 100644
index 000000000..977b894d3
--- /dev/null
+++ b/lib/pleroma/web/templates/static_fe/static_fe/_user_card.html.eex
@@ -0,0 +1,11 @@
+<div class="p-author h-card">
+ <a class="u-url" rel="author noopener" href="<%= (@user.uri || @user.ap_id) %>">
+ <div class="avatar">
+ <img class="u-photo" src="<%= User.avatar_url(@user) |> MediaProxy.url %>" width="48" height="48" alt="">
+ </div>
+ <span class="display-name">
+ <bdi class="p-name"><%= raw Formatter.emojify(@user.name, @user.emoji) %></bdi>
+ <span class="nickname"><%= @user.nickname %></span>
+ </span>
+ </a>
+</div>
diff --git a/lib/pleroma/web/templates/static_fe/static_fe/conversation.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/conversation.html.eex
new file mode 100644
index 000000000..2acd84828
--- /dev/null
+++ b/lib/pleroma/web/templates/static_fe/static_fe/conversation.html.eex
@@ -0,0 +1,11 @@
+<header>
+ <h1><%= link instance_name(), to: "/" %></h1>
+</header>
+
+<main>
+ <div class="conversation">
+ <%= for activity <- @activities do %>
+ <%= render("_notice.html", activity) %>
+ <% end %>
+ </div>
+</main>
diff --git a/lib/pleroma/web/templates/static_fe/static_fe/error.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/error.html.eex
new file mode 100644
index 000000000..d98a1eba7
--- /dev/null
+++ b/lib/pleroma/web/templates/static_fe/static_fe/error.html.eex
@@ -0,0 +1,7 @@
+<header>
+ <h1><%= gettext("Oops") %></h1>
+</header>
+
+<main>
+ <p><%= @message %></p>
+</main>
diff --git a/lib/pleroma/web/templates/static_fe/static_fe/profile.html.eex b/lib/pleroma/web/templates/static_fe/static_fe/profile.html.eex
new file mode 100644
index 000000000..3191bf450
--- /dev/null
+++ b/lib/pleroma/web/templates/static_fe/static_fe/profile.html.eex
@@ -0,0 +1,31 @@
+<header>
+ <h1><%= link instance_name(), to: "/" %></h1>
+
+ <h3>
+ <form class="pull-right collapse" method="POST" action="<%= Helpers.util_path(@conn, :remote_subscribe) %>">
+ <input type="hidden" name="nickname" value="<%= @user.nickname %>">
+ <input type="hidden" name="profile" value="">
+ <button type="submit" class="collapse">Remote follow</button>
+ </form>
+ <%= raw Formatter.emojify(@user.name, @user.emoji) %> |
+ <%= link "@#{@user.nickname}@#{Endpoint.host()}", to: (@user.uri || @user.ap_id) %>
+ </h3>
+ <p><%= raw @user.bio %></p>
+</header>
+
+<main>
+ <div class="activity-stream">
+ <%= for activity <- @timeline do %>
+ <%= render("_notice.html", Map.put(activity, :selected, false)) %>
+ <% end %>
+ <p id="pagination">
+ <%= if @prev_page_id do %>
+ <%= link "«", to: "?min_id=" <> @prev_page_id %>
+ <% end %>
+ <%= if @prev_page_id && @next_page_id, do: " | " %>
+ <%= if @next_page_id do %>
+ <%= link "»", to: "?max_id=" <> @next_page_id %>
+ <% end %>
+ </p>
+ </div>
+</main>
diff --git a/lib/pleroma/web/templates/twitter_api/remote_follow/follow.html.eex b/lib/pleroma/web/templates/twitter_api/remote_follow/follow.html.eex
new file mode 100644
index 000000000..5ba192cd7
--- /dev/null
+++ b/lib/pleroma/web/templates/twitter_api/remote_follow/follow.html.eex
@@ -0,0 +1,11 @@
+<%= if @error == :error do %>
+ <h2>Error fetching user</h2>
+<% else %>
+ <h2>Remote follow</h2>
+ <img height="128" width="128" src="<%= avatar_url(@followee) %>">
+ <p><%= @followee.nickname %></p>
+ <%= form_for @conn, remote_follow_path(@conn, :do_follow), [as: "user"], fn f -> %>
+ <%= hidden_input f, :id, value: @followee.id %>
+ <%= submit "Authorize" %>
+ <% end %>
+<% end %>
diff --git a/lib/pleroma/web/templates/twitter_api/remote_follow/follow_login.html.eex b/lib/pleroma/web/templates/twitter_api/remote_follow/follow_login.html.eex
new file mode 100644
index 000000000..df44988ee
--- /dev/null
+++ b/lib/pleroma/web/templates/twitter_api/remote_follow/follow_login.html.eex
@@ -0,0 +1,14 @@
+<%= if @error do %>
+<h2><%= @error %></h2>
+<% end %>
+<h2>Log in to follow</h2>
+<p><%= @followee.nickname %></p>
+<img height="128" width="128" src="<%= avatar_url(@followee) %>">
+<%= form_for @conn, remote_follow_path(@conn, :do_follow), [as: "authorization"], fn f -> %>
+<%= text_input f, :name, placeholder: "Username", required: true %>
+<br>
+<%= password_input f, :password, placeholder: "Password", required: true %>
+<br>
+<%= hidden_input f, :id, value: @followee.id %>
+<%= submit "Authorize" %>
+<% end %>
diff --git a/lib/pleroma/web/templates/twitter_api/remote_follow/follow_mfa.html.eex b/lib/pleroma/web/templates/twitter_api/remote_follow/follow_mfa.html.eex
new file mode 100644
index 000000000..adc3a3e3d
--- /dev/null
+++ b/lib/pleroma/web/templates/twitter_api/remote_follow/follow_mfa.html.eex
@@ -0,0 +1,13 @@
+<%= if @error do %>
+<h2><%= @error %></h2>
+<% end %>
+<h2>Two-factor authentication</h2>
+<p><%= @followee.nickname %></p>
+<img height="128" width="128" src="<%= avatar_url(@followee) %>">
+<%= form_for @conn, remote_follow_path(@conn, :do_follow), [as: "mfa"], fn f -> %>
+<%= text_input f, :code, placeholder: "Authentication code", required: true %>
+<br>
+<%= hidden_input f, :id, value: @followee.id %>
+<%= hidden_input f, :token, value: @mfa_token %>
+<%= submit "Authorize" %>
+<% end %>
diff --git a/lib/pleroma/web/templates/twitter_api/util/followed.html.eex b/lib/pleroma/web/templates/twitter_api/remote_follow/followed.html.eex
index da473d502..da473d502 100644
--- a/lib/pleroma/web/templates/twitter_api/util/followed.html.eex
+++ b/lib/pleroma/web/templates/twitter_api/remote_follow/followed.html.eex
diff --git a/lib/pleroma/web/templates/twitter_api/util/follow.html.eex b/lib/pleroma/web/templates/twitter_api/util/follow.html.eex
deleted file mode 100644
index 06359fa6c..000000000
--- a/lib/pleroma/web/templates/twitter_api/util/follow.html.eex
+++ /dev/null
@@ -1,11 +0,0 @@
-<%= if @error == :error do %>
- <h2>Error fetching user</h2>
-<% else %>
- <h2>Remote follow</h2>
- <img width="128" height="128" src="<%= @avatar %>">
- <p><%= @name %></p>
- <%= form_for @conn, util_path(@conn, :do_remote_follow), [as: "user"], fn f -> %>
- <%= hidden_input f, :id, value: @id %>
- <%= submit "Authorize" %>
- <% end %>
-<% end %>
diff --git a/lib/pleroma/web/templates/twitter_api/util/follow_login.html.eex b/lib/pleroma/web/templates/twitter_api/util/follow_login.html.eex
deleted file mode 100644
index 4e3a2be67..000000000
--- a/lib/pleroma/web/templates/twitter_api/util/follow_login.html.eex
+++ /dev/null
@@ -1,14 +0,0 @@
-<%= if @error do %>
- <h2><%= @error %></h2>
-<% end %>
-<h2>Log in to follow</h2>
-<p><%= @name %></p>
-<img height="128" width="128" src="<%= @avatar %>">
-<%= form_for @conn, util_path(@conn, :do_remote_follow), [as: "authorization"], fn f -> %>
-<%= text_input f, :name, placeholder: "Username" %>
-<br>
-<%= password_input f, :password, placeholder: "Password" %>
-<br>
-<%= hidden_input f, :id, value: @id %>
-<%= submit "Authorize" %>
-<% end %>
diff --git a/lib/pleroma/web/translation_helpers.ex b/lib/pleroma/web/translation_helpers.ex
index a104ea6b8..7f78ce1b9 100644
--- a/lib/pleroma/web/translation_helpers.ex
+++ b/lib/pleroma/web/translation_helpers.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.TranslationHelpers do
diff --git a/lib/pleroma/web/twitter_api/controllers/password_controller.ex b/lib/pleroma/web/twitter_api/controllers/password_controller.ex
index 1941e6143..800ab8954 100644
--- a/lib/pleroma/web/twitter_api/controllers/password_controller.ex
+++ b/lib/pleroma/web/twitter_api/controllers/password_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.TwitterAPI.PasswordController do
diff --git a/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex b/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex
new file mode 100644
index 000000000..521dc9322
--- /dev/null
+++ b/lib/pleroma/web/twitter_api/controllers/remote_follow_controller.ex
@@ -0,0 +1,159 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.TwitterAPI.RemoteFollowController do
+ use Pleroma.Web, :controller
+
+ require Logger
+
+ alias Pleroma.Activity
+ alias Pleroma.MFA
+ alias Pleroma.Object.Fetcher
+ alias Pleroma.Plugs.OAuthScopesPlug
+ alias Pleroma.User
+ alias Pleroma.Web.Auth.Authenticator
+ alias Pleroma.Web.Auth.TOTPAuthenticator
+ alias Pleroma.Web.CommonAPI
+
+ @status_types ["Article", "Event", "Note", "Video", "Page", "Question"]
+
+ plug(Pleroma.Web.FederatingPlug)
+
+ # Note: follower can submit the form (with password auth) not being signed in (having no token)
+ plug(
+ OAuthScopesPlug,
+ %{fallback: :proceed_unauthenticated, scopes: ["follow", "write:follows"]}
+ when action in [:do_follow]
+ )
+
+ # GET /ostatus_subscribe
+ #
+ def follow(%{assigns: %{user: user}} = conn, %{"acct" => acct}) do
+ case is_status?(acct) do
+ true -> follow_status(conn, user, acct)
+ _ -> follow_account(conn, user, acct)
+ end
+ end
+
+ defp follow_status(conn, _user, acct) do
+ with {:ok, object} <- Fetcher.fetch_object_from_id(acct),
+ %Activity{id: activity_id} <- Activity.get_create_by_object_ap_id(object.data["id"]) do
+ redirect(conn, to: o_status_path(conn, :notice, activity_id))
+ else
+ error ->
+ handle_follow_error(conn, error)
+ end
+ end
+
+ defp follow_account(conn, user, acct) do
+ with {:ok, followee} <- User.get_or_fetch(acct) do
+ render(conn, follow_template(user), %{error: false, followee: followee, acct: acct})
+ else
+ {:error, _reason} ->
+ render(conn, follow_template(user), %{error: :error})
+ end
+ end
+
+ defp follow_template(%User{} = _user), do: "follow.html"
+ defp follow_template(_), do: "follow_login.html"
+
+ defp is_status?(acct) do
+ case Fetcher.fetch_and_contain_remote_object_from_id(acct) do
+ {:ok, %{"type" => type}} when type in @status_types ->
+ true
+
+ _ ->
+ false
+ end
+ end
+
+ # POST /ostatus_subscribe
+ #
+ # adds a remote account in followers if user already is signed in.
+ #
+ def do_follow(%{assigns: %{user: %User{} = user}} = conn, %{"user" => %{"id" => id}}) do
+ with {:fetch_user, %User{} = followee} <- {:fetch_user, User.get_cached_by_id(id)},
+ {:ok, _, _, _} <- CommonAPI.follow(user, followee) do
+ redirect(conn, to: "/users/#{followee.id}")
+ else
+ error ->
+ handle_follow_error(conn, error)
+ end
+ end
+
+ # POST /ostatus_subscribe
+ #
+ # step 1.
+ # checks login\password and displays step 2 form of MFA if need.
+ #
+ def do_follow(conn, %{"authorization" => %{"name" => _, "password" => _, "id" => id}}) do
+ with {_, %User{} = followee} <- {:fetch_user, User.get_cached_by_id(id)},
+ {_, {:ok, user}, _} <- {:auth, Authenticator.get_user(conn), followee},
+ {_, _, _, false} <- {:mfa_required, followee, user, MFA.require?(user)},
+ {:ok, _, _, _} <- CommonAPI.follow(user, followee) do
+ redirect(conn, to: "/users/#{followee.id}")
+ else
+ error ->
+ handle_follow_error(conn, error)
+ end
+ end
+
+ # POST /ostatus_subscribe
+ #
+ # step 2
+ # checks TOTP code. otherwise displays form with errors
+ #
+ def do_follow(conn, %{"mfa" => %{"code" => code, "token" => token, "id" => id}}) do
+ with {_, %User{} = followee} <- {:fetch_user, User.get_cached_by_id(id)},
+ {_, _, {:ok, %{user: user}}} <- {:mfa_token, followee, MFA.Token.validate(token)},
+ {_, _, _, {:ok, _}} <-
+ {:verify_mfa_code, followee, token, TOTPAuthenticator.verify(code, user)},
+ {:ok, _, _, _} <- CommonAPI.follow(user, followee) do
+ redirect(conn, to: "/users/#{followee.id}")
+ else
+ error ->
+ handle_follow_error(conn, error)
+ end
+ end
+
+ def do_follow(%{assigns: %{user: nil}} = conn, _) do
+ Logger.debug("Insufficient permissions: follow | write:follows.")
+ render(conn, "followed.html", %{error: "Insufficient permissions: follow | write:follows."})
+ end
+
+ defp handle_follow_error(conn, {:mfa_token, followee, _} = _) do
+ render(conn, "follow_login.html", %{error: "Wrong username or password", followee: followee})
+ end
+
+ defp handle_follow_error(conn, {:verify_mfa_code, followee, token, _} = _) do
+ render(conn, "follow_mfa.html", %{
+ error: "Wrong authentication code",
+ followee: followee,
+ mfa_token: token
+ })
+ end
+
+ defp handle_follow_error(conn, {:mfa_required, followee, user, _} = _) do
+ {:ok, %{token: token}} = MFA.Token.create_token(user)
+ render(conn, "follow_mfa.html", %{followee: followee, mfa_token: token, error: false})
+ end
+
+ defp handle_follow_error(conn, {:auth, _, followee} = _) do
+ render(conn, "follow_login.html", %{error: "Wrong username or password", followee: followee})
+ end
+
+ defp handle_follow_error(conn, {:fetch_user, error} = _) do
+ Logger.debug("Remote follow failed with error #{inspect(error)}")
+ render(conn, "followed.html", %{error: "Could not find user"})
+ end
+
+ defp handle_follow_error(conn, {:error, "Could not follow user:" <> _} = _) do
+ render(conn, "followed.html", %{error: "Error following account"})
+ end
+
+ defp handle_follow_error(conn, error) do
+ Logger.debug("Remote follow failed with error #{inspect(error)}")
+ render(conn, "followed.html", %{error: "Something went wrong."})
+ end
+end
diff --git a/lib/pleroma/web/twitter_api/controllers/util_controller.ex b/lib/pleroma/web/twitter_api/controllers/util_controller.ex
index 2305bb413..fd2aee175 100644
--- a/lib/pleroma/web/twitter_api/controllers/util_controller.ex
+++ b/lib/pleroma/web/twitter_api/controllers/util_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.TwitterAPI.UtilController do
@@ -7,22 +7,22 @@ defmodule Pleroma.Web.TwitterAPI.UtilController do
require Logger
- alias Pleroma.Activity
alias Pleroma.Config
alias Pleroma.Emoji
alias Pleroma.Healthcheck
alias Pleroma.Notification
- alias Pleroma.Plugs.AuthenticationPlug
alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.User
alias Pleroma.Web
alias Pleroma.Web.CommonAPI
alias Pleroma.Web.WebFinger
+ plug(Pleroma.Web.FederatingPlug when action == :remote_subscribe)
+
plug(
OAuthScopesPlug,
%{scopes: ["follow", "write:follows"]}
- when action in [:do_remote_follow, :follow_import]
+ when action == :follow_import
)
plug(OAuthScopesPlug, %{scopes: ["follow", "write:blocks"]} when action == :blocks_import)
@@ -77,94 +77,6 @@ defmodule Pleroma.Web.TwitterAPI.UtilController do
end
end
- def remote_follow(%{assigns: %{user: user}} = conn, %{"acct" => acct}) do
- if is_status?(acct) do
- {:ok, object} = Pleroma.Object.Fetcher.fetch_object_from_id(acct)
- %Activity{id: activity_id} = Activity.get_create_by_object_ap_id(object.data["id"])
- redirect(conn, to: "/notice/#{activity_id}")
- else
- with {:ok, followee} <- User.get_or_fetch(acct) do
- conn
- |> render(follow_template(user), %{
- error: false,
- acct: acct,
- avatar: User.avatar_url(followee),
- name: followee.nickname,
- id: followee.id
- })
- else
- {:error, _reason} ->
- render(conn, follow_template(user), %{error: :error})
- end
- end
- end
-
- defp follow_template(%User{} = _user), do: "follow.html"
- defp follow_template(_), do: "follow_login.html"
-
- defp is_status?(acct) do
- case Pleroma.Object.Fetcher.fetch_and_contain_remote_object_from_id(acct) do
- {:ok, %{"type" => type}} when type in ["Article", "Note", "Video", "Page", "Question"] ->
- true
-
- _ ->
- false
- end
- end
-
- def do_remote_follow(conn, %{
- "authorization" => %{"name" => username, "password" => password, "id" => id}
- }) do
- with %User{} = followee <- User.get_cached_by_id(id),
- {_, %User{} = user, _} <- {:auth, User.get_cached_by_nickname(username), followee},
- {_, true, _} <- {
- :auth,
- AuthenticationPlug.checkpw(password, user.password_hash),
- followee
- },
- {:ok, _follower, _followee, _activity} <- CommonAPI.follow(user, followee) do
- conn
- |> render("followed.html", %{error: false})
- else
- # Was already following user
- {:error, "Could not follow user:" <> _rest} ->
- render(conn, "followed.html", %{error: "Error following account"})
-
- {:auth, _, followee} ->
- conn
- |> render("follow_login.html", %{
- error: "Wrong username or password",
- id: id,
- name: followee.nickname,
- avatar: User.avatar_url(followee)
- })
-
- e ->
- Logger.debug("Remote follow failed with error #{inspect(e)}")
- render(conn, "followed.html", %{error: "Something went wrong."})
- end
- end
-
- def do_remote_follow(%{assigns: %{user: user}} = conn, %{"user" => %{"id" => id}}) do
- with {:fetch_user, %User{} = followee} <- {:fetch_user, User.get_cached_by_id(id)},
- {:ok, _follower, _followee, _activity} <- CommonAPI.follow(user, followee) do
- conn
- |> render("followed.html", %{error: false})
- else
- # Was already following user
- {:error, "Could not follow user:" <> _rest} ->
- render(conn, "followed.html", %{error: "Error following account"})
-
- {:fetch_user, error} ->
- Logger.debug("Remote follow failed with error #{inspect(error)}")
- render(conn, "followed.html", %{error: "Could not find user"})
-
- e ->
- Logger.debug("Remote follow failed with error #{inspect(e)}")
- render(conn, "followed.html", %{error: "Something went wrong."})
- end
- end
-
def notifications_read(%{assigns: %{user: user}} = conn, %{"id" => notification_id}) do
with {:ok, _} <- Notification.read_one(user, notification_id) do
json(conn, %{status: "success"})
@@ -280,15 +192,16 @@ defmodule Pleroma.Web.TwitterAPI.UtilController do
end
def follow_import(%{assigns: %{user: follower}} = conn, %{"list" => list}) do
- with lines <- String.split(list, "\n"),
- followed_identifiers <-
- Enum.map(lines, fn line ->
- String.split(line, ",") |> List.first()
- end)
- |> List.delete("Account address") do
- User.follow_import(follower, followed_identifiers)
- json(conn, "job started")
- end
+ followed_identifiers =
+ list
+ |> String.split("\n")
+ |> Enum.map(&(&1 |> String.split(",") |> List.first()))
+ |> List.delete("Account address")
+ |> Enum.map(&(&1 |> String.trim() |> String.trim_leading("@")))
+ |> Enum.reject(&(&1 == ""))
+
+ User.follow_import(follower, followed_identifiers)
+ json(conn, "job started")
end
def blocks_import(conn, %{"list" => %Plug.Upload{} = listfile}) do
@@ -296,10 +209,9 @@ defmodule Pleroma.Web.TwitterAPI.UtilController do
end
def blocks_import(%{assigns: %{user: blocker}} = conn, %{"list" => list}) do
- with blocked_identifiers <- String.split(list) do
- User.blocks_import(blocker, blocked_identifiers)
- json(conn, "job started")
- end
+ blocked_identifiers = list |> String.split() |> Enum.map(&String.trim_leading(&1, "@"))
+ User.blocks_import(blocker, blocked_identifiers)
+ json(conn, "job started")
end
def change_password(%{assigns: %{user: user}} = conn, params) do
@@ -345,7 +257,9 @@ defmodule Pleroma.Web.TwitterAPI.UtilController do
end
def delete_account(%{assigns: %{user: user}} = conn, params) do
- case CommonAPI.Utils.confirm_current_password(user, params["password"]) do
+ password = params["password"] || ""
+
+ case CommonAPI.Utils.confirm_current_password(user, password) do
{:ok, user} ->
User.delete(user)
json(conn, %{status: "success"})
diff --git a/lib/pleroma/web/twitter_api/twitter_api.ex b/lib/pleroma/web/twitter_api/twitter_api.ex
index bfd838902..5cfb385ac 100644
--- a/lib/pleroma/web/twitter_api/twitter_api.ex
+++ b/lib/pleroma/web/twitter_api/twitter_api.ex
@@ -1,83 +1,41 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.TwitterAPI.TwitterAPI do
+ import Pleroma.Web.Gettext
+
alias Pleroma.Emails.Mailer
alias Pleroma.Emails.UserEmail
alias Pleroma.Repo
alias Pleroma.User
alias Pleroma.UserInviteToken
- require Pleroma.Constants
-
def register_user(params, opts \\ []) do
- token = params["token"]
-
- params = %{
- nickname: params["nickname"],
- name: params["fullname"],
- bio: User.parse_bio(params["bio"]),
- email: params["email"],
- password: params["password"],
- password_confirmation: params["confirm"],
- captcha_solution: params["captcha_solution"],
- captcha_token: params["captcha_token"],
- captcha_answer_data: params["captcha_answer_data"]
- }
-
- captcha_enabled = Pleroma.Config.get([Pleroma.Captcha, :enabled])
- # true if captcha is disabled or enabled and valid, false otherwise
- captcha_ok =
- if not captcha_enabled do
- :ok
- else
- Pleroma.Captcha.validate(
- params[:captcha_token],
- params[:captcha_solution],
- params[:captcha_answer_data]
- )
- end
-
- # Captcha invalid
- if captcha_ok != :ok do
- {:error, error} = captcha_ok
- # I have no idea how this error handling works
- {:error, %{error: Jason.encode!(%{captcha: [error]})}}
+ params =
+ params
+ |> Map.take([:email, :token, :password])
+ |> Map.put(:bio, params |> Map.get(:bio, "") |> User.parse_bio())
+ |> Map.put(:nickname, params[:username])
+ |> Map.put(:name, Map.get(params, :fullname, params[:username]))
+ |> Map.put(:password_confirmation, params[:password])
+
+ if Pleroma.Config.get([:instance, :registrations_open]) do
+ create_user(params, opts)
else
- registration_process(
- params,
- %{
- registrations_open: Pleroma.Config.get([:instance, :registrations_open]),
- token: token
- },
- opts
- )
+ create_user_with_invite(params, opts)
end
end
- defp registration_process(params, %{registrations_open: true}, opts) do
- create_user(params, opts)
- end
-
- defp registration_process(params, %{token: token}, opts) do
- invite =
- unless is_nil(token) do
- Repo.get_by(UserInviteToken, %{token: token})
- end
-
- valid_invite? = invite && UserInviteToken.valid_invite?(invite)
-
- case invite do
- nil ->
- {:error, "Invalid token"}
-
- invite when valid_invite? ->
- UserInviteToken.update_usage!(invite)
- create_user(params, opts)
-
- _ ->
- {:error, "Expired token"}
+ defp create_user_with_invite(params, opts) do
+ with %{token: token} when is_binary(token) <- params,
+ %UserInviteToken{} = invite <- Repo.get_by(UserInviteToken, %{token: token}),
+ true <- UserInviteToken.valid_invite?(invite) do
+ UserInviteToken.update_usage!(invite)
+ create_user(params, opts)
+ else
+ nil -> {:error, "Invalid token"}
+ _ -> {:error, "Expired token"}
end
end
@@ -90,16 +48,18 @@ defmodule Pleroma.Web.TwitterAPI.TwitterAPI do
{:error, changeset} ->
errors =
- Ecto.Changeset.traverse_errors(changeset, fn {msg, _opts} -> msg end)
+ changeset
+ |> Ecto.Changeset.traverse_errors(fn {msg, _opts} -> msg end)
|> Jason.encode!()
- {:error, %{error: errors}}
+ {:error, errors}
end
end
def password_reset(nickname_or_email) do
with true <- is_binary(nickname_or_email),
- %User{local: true} = user <- User.get_by_nickname_or_email(nickname_or_email),
+ %User{local: true, email: email} = user when is_binary(email) <-
+ User.get_by_nickname_or_email(nickname_or_email),
{:ok, token_record} <- Pleroma.PasswordResetToken.create_token(user) do
user
|> UserEmail.password_reset_email(token_record.token)
@@ -110,6 +70,9 @@ defmodule Pleroma.Web.TwitterAPI.TwitterAPI do
false ->
{:error, "bad user identifier"}
+ %User{local: true, email: nil} ->
+ {:ok, :noop}
+
%User{local: false} ->
{:error, "remote user"}
@@ -117,4 +80,58 @@ defmodule Pleroma.Web.TwitterAPI.TwitterAPI do
{:error, "unknown user"}
end
end
+
+ def validate_captcha(app, params) do
+ if app.trusted || not Pleroma.Captcha.enabled?() do
+ :ok
+ else
+ do_validate_captcha(params)
+ end
+ end
+
+ defp do_validate_captcha(params) do
+ with :ok <- validate_captcha_presence(params),
+ :ok <-
+ Pleroma.Captcha.validate(
+ params[:captcha_token],
+ params[:captcha_solution],
+ params[:captcha_answer_data]
+ ) do
+ :ok
+ else
+ {:error, :captcha_error} ->
+ captcha_error(dgettext("errors", "CAPTCHA Error"))
+
+ {:error, :invalid} ->
+ captcha_error(dgettext("errors", "Invalid CAPTCHA"))
+
+ {:error, :kocaptcha_service_unavailable} ->
+ captcha_error(dgettext("errors", "Kocaptcha service unavailable"))
+
+ {:error, :expired} ->
+ captcha_error(dgettext("errors", "CAPTCHA expired"))
+
+ {:error, :already_used} ->
+ captcha_error(dgettext("errors", "CAPTCHA already used"))
+
+ {:error, :invalid_answer_data} ->
+ captcha_error(dgettext("errors", "Invalid answer data"))
+
+ {:error, error} ->
+ captcha_error(error)
+ end
+ end
+
+ defp validate_captcha_presence(params) do
+ [:captcha_solution, :captcha_token, :captcha_answer_data]
+ |> Enum.find_value(:ok, fn key ->
+ unless is_binary(params[key]) do
+ error = dgettext("errors", "Invalid CAPTCHA (Missing parameter: %{name})", name: key)
+ {:error, error}
+ end
+ end)
+ end
+
+ # For some reason FE expects error message to be a serialized JSON
+ defp captcha_error(error), do: {:error, Jason.encode!(%{captcha: [error]})}
end
diff --git a/lib/pleroma/web/twitter_api/twitter_api_controller.ex b/lib/pleroma/web/twitter_api/twitter_api_controller.ex
index bf5a6ae42..c2de26b0b 100644
--- a/lib/pleroma/web/twitter_api/twitter_api_controller.ex
+++ b/lib/pleroma/web/twitter_api/twitter_api_controller.ex
@@ -1,11 +1,12 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.TwitterAPI.Controller do
use Pleroma.Web, :controller
alias Pleroma.Notification
+ alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
alias Pleroma.Plugs.OAuthScopesPlug
alias Pleroma.User
alias Pleroma.Web.OAuth.Token
@@ -13,18 +14,27 @@ defmodule Pleroma.Web.TwitterAPI.Controller do
require Logger
- plug(OAuthScopesPlug, %{scopes: ["write:notifications"]} when action == :notifications_read)
+ plug(
+ OAuthScopesPlug,
+ %{scopes: ["write:notifications"]} when action == :mark_notifications_as_read
+ )
- plug(Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug)
+ plug(
+ :skip_plug,
+ [OAuthScopesPlug, EnsurePublicOrAuthenticatedPlug] when action == :confirm_email
+ )
+
+ plug(:skip_plug, OAuthScopesPlug when action in [:oauth_tokens, :revoke_token])
action_fallback(:errors)
def confirm_email(conn, %{"user_id" => uid, "token" => token}) do
- new_info = [need_confirmation: false]
-
- with %User{info: info} = user <- User.get_cached_by_id(uid),
- true <- user.local and info.confirmation_pending and info.confirmation_token == token,
- {:ok, _} <- User.update_info(user, &User.Info.confirmation_changeset(&1, new_info)) do
+ with %User{} = user <- User.get_cached_by_id(uid),
+ true <- user.local and user.confirmation_pending and user.confirmation_token == token,
+ {:ok, _} <-
+ user
+ |> User.confirmation_changeset(need_confirmation: false)
+ |> User.update_and_set_cache() do
redirect(conn, to: "/")
end
end
@@ -43,13 +53,13 @@ defmodule Pleroma.Web.TwitterAPI.Controller do
json_reply(conn, 201, "")
end
- def errors(conn, {:param_cast, _}) do
+ defp errors(conn, {:param_cast, _}) do
conn
|> put_status(400)
|> json("Invalid parameters")
end
- def errors(conn, _) do
+ defp errors(conn, _) do
conn
|> put_status(500)
|> json("Something went wrong")
@@ -61,7 +71,10 @@ defmodule Pleroma.Web.TwitterAPI.Controller do
|> send_resp(status, json)
end
- def notifications_read(%{assigns: %{user: user}} = conn, %{"latest_id" => latest_id} = params) do
+ def mark_notifications_as_read(
+ %{assigns: %{user: user}} = conn,
+ %{"latest_id" => latest_id} = params
+ ) do
Notification.set_read_up_to(user, latest_id)
notifications = Notification.for_user(user, params)
@@ -72,7 +85,7 @@ defmodule Pleroma.Web.TwitterAPI.Controller do
|> render("index.json", %{notifications: notifications, for: user})
end
- def notifications_read(%{assigns: %{user: _user}} = conn, _) do
+ def mark_notifications_as_read(%{assigns: %{user: _user}} = conn, _) do
bad_request_reply(conn, "You need to specify latest_id")
end
diff --git a/lib/pleroma/web/twitter_api/views/password_view.ex b/lib/pleroma/web/twitter_api/views/password_view.ex
index b166b925d..41462e4af 100644
--- a/lib/pleroma/web/twitter_api/views/password_view.ex
+++ b/lib/pleroma/web/twitter_api/views/password_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.TwitterAPI.PasswordView do
diff --git a/lib/pleroma/web/twitter_api/views/remote_follow_view.ex b/lib/pleroma/web/twitter_api/views/remote_follow_view.ex
new file mode 100644
index 000000000..c05c7821c
--- /dev/null
+++ b/lib/pleroma/web/twitter_api/views/remote_follow_view.ex
@@ -0,0 +1,10 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.TwitterAPI.RemoteFollowView do
+ use Pleroma.Web, :view
+ import Phoenix.HTML.Form
+
+ defdelegate avatar_url(user), to: Pleroma.User
+end
diff --git a/lib/pleroma/web/twitter_api/views/token_view.ex b/lib/pleroma/web/twitter_api/views/token_view.ex
index 3ff314913..c36303625 100644
--- a/lib/pleroma/web/twitter_api/views/token_view.ex
+++ b/lib/pleroma/web/twitter_api/views/token_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.TwitterAPI.TokenView do
diff --git a/lib/pleroma/web/twitter_api/views/util_view.ex b/lib/pleroma/web/twitter_api/views/util_view.ex
index f4050650e..52054e020 100644
--- a/lib/pleroma/web/twitter_api/views/util_view.ex
+++ b/lib/pleroma/web/twitter_api/views/util_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.TwitterAPI.UtilView do
diff --git a/lib/pleroma/web/uploader_controller.ex b/lib/pleroma/web/uploader_controller.ex
index 0cc172698..6533f1c0e 100644
--- a/lib/pleroma/web/uploader_controller.ex
+++ b/lib/pleroma/web/uploader_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.UploaderController do
diff --git a/lib/pleroma/web/views/email_view.ex b/lib/pleroma/web/views/email_view.ex
index b506a234b..6b0fbe61e 100644
--- a/lib/pleroma/web/views/email_view.ex
+++ b/lib/pleroma/web/views/email_view.ex
@@ -12,4 +12,8 @@ defmodule Pleroma.Web.EmailView do
|> Timex.parse!("{ISO:Extended:Z}")
|> Timex.format!("{Mshort} {D}, {YYYY} {h24}:{m}")
end
+
+ def admin_user_url(%{id: id}) do
+ Pleroma.Web.Endpoint.url() <> "/pleroma/admin/#/users/" <> id
+ end
end
diff --git a/lib/pleroma/web/views/error_helpers.ex b/lib/pleroma/web/views/error_helpers.ex
index bc08e60e4..df657a343 100644
--- a/lib/pleroma/web/views/error_helpers.ex
+++ b/lib/pleroma/web/views/error_helpers.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ErrorHelpers do
diff --git a/lib/pleroma/web/views/error_view.ex b/lib/pleroma/web/views/error_view.ex
index 5cb8669fe..e68d55e08 100644
--- a/lib/pleroma/web/views/error_view.ex
+++ b/lib/pleroma/web/views/error_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.ErrorView do
diff --git a/lib/pleroma/web/views/layout_view.ex b/lib/pleroma/web/views/layout_view.ex
index e5183701d..3e49c6549 100644
--- a/lib/pleroma/web/views/layout_view.ex
+++ b/lib/pleroma/web/views/layout_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.LayoutView do
diff --git a/lib/pleroma/web/views/masto_fe_view.ex b/lib/pleroma/web/views/masto_fe_view.ex
index 85b164b59..c3096006e 100644
--- a/lib/pleroma/web/views/masto_fe_view.ex
+++ b/lib/pleroma/web/views/masto_fe_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.MastoFEView do
@@ -61,12 +61,12 @@ defmodule Pleroma.Web.MastoFEView do
},
poll_limits: Config.get([:instance, :poll_limits]),
rights: %{
- delete_others_notice: present?(user.info.is_moderator),
- admin: present?(user.info.is_admin)
+ delete_others_notice: present?(user.is_moderator),
+ admin: present?(user.is_admin)
},
compose: %{
me: "#{user.id}",
- default_privacy: user.info.default_scope,
+ default_privacy: user.default_scope,
default_sensitive: false,
allow_content_types: Config.get([:instance, :allowed_post_formats])
},
@@ -86,7 +86,7 @@ defmodule Pleroma.Web.MastoFEView do
"video\/mp4"
]
},
- settings: user.info.settings || @default_settings,
+ settings: user.settings || @default_settings,
push_subscription: nil,
accounts: %{user.id => render(AccountView, "show.json", user: user, for: user)},
custom_emojis: render(CustomEmojiView, "index.json", custom_emojis: custom_emojis),
diff --git a/lib/pleroma/web/views/streamer_view.ex b/lib/pleroma/web/views/streamer_view.ex
index a9f14d09a..237b29ded 100644
--- a/lib/pleroma/web/views/streamer_view.ex
+++ b/lib/pleroma/web/views/streamer_view.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.StreamerView do
@@ -25,7 +25,7 @@ defmodule Pleroma.Web.StreamerView do
|> Jason.encode!()
end
- def render("notification.json", %User{} = user, %Notification{} = notify) do
+ def render("notification.json", %Notification{} = notify, %User{} = user) do
%{
event: "notification",
payload:
diff --git a/lib/pleroma/web/web.ex b/lib/pleroma/web/web.ex
index 687346554..4f9281851 100644
--- a/lib/pleroma/web/web.ex
+++ b/lib/pleroma/web/web.ex
@@ -1,7 +1,12 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
+defmodule Pleroma.Web.Plug do
+ # Substitute for `call/2` which is defined with `use Pleroma.Web, :plug`
+ @callback perform(Plug.Conn.t(), Plug.opts()) :: Plug.Conn.t()
+end
+
defmodule Pleroma.Web do
@moduledoc """
A module that keeps using definitions for controllers,
@@ -20,11 +25,19 @@ defmodule Pleroma.Web do
below.
"""
+ alias Pleroma.Plugs.EnsureAuthenticatedPlug
+ alias Pleroma.Plugs.EnsurePublicOrAuthenticatedPlug
+ alias Pleroma.Plugs.ExpectAuthenticatedCheckPlug
+ alias Pleroma.Plugs.ExpectPublicOrAuthenticatedCheckPlug
+ alias Pleroma.Plugs.OAuthScopesPlug
+ alias Pleroma.Plugs.PlugHelper
+
def controller do
quote do
use Phoenix.Controller, namespace: Pleroma.Web
import Plug.Conn
+
import Pleroma.Web.Gettext
import Pleroma.Web.Router.Helpers
import Pleroma.Web.TranslationHelpers
@@ -34,6 +47,79 @@ defmodule Pleroma.Web do
defp set_put_layout(conn, _) do
put_layout(conn, Pleroma.Config.get(:app_layout, "app.html"))
end
+
+ # Marks plugs intentionally skipped and blocks their execution if present in plugs chain
+ defp skip_plug(conn, plug_modules) do
+ plug_modules
+ |> List.wrap()
+ |> Enum.reduce(
+ conn,
+ fn plug_module, conn ->
+ try do
+ plug_module.skip_plug(conn)
+ rescue
+ UndefinedFunctionError ->
+ raise "`#{plug_module}` is not skippable. Append `use Pleroma.Web, :plug` to its code."
+ end
+ end
+ )
+ end
+
+ # Executed just before actual controller action, invokes before-action hooks (callbacks)
+ defp action(conn, params) do
+ with %{halted: false} = conn <- maybe_drop_authentication_if_oauth_check_ignored(conn),
+ %{halted: false} = conn <- maybe_perform_public_or_authenticated_check(conn),
+ %{halted: false} = conn <- maybe_perform_authenticated_check(conn),
+ %{halted: false} = conn <- maybe_halt_on_missing_oauth_scopes_check(conn) do
+ super(conn, params)
+ end
+ end
+
+ # For non-authenticated API actions, drops auth info if OAuth scopes check was ignored
+ # (neither performed nor explicitly skipped)
+ defp maybe_drop_authentication_if_oauth_check_ignored(conn) do
+ if PlugHelper.plug_called?(conn, ExpectPublicOrAuthenticatedCheckPlug) and
+ not PlugHelper.plug_called_or_skipped?(conn, OAuthScopesPlug) do
+ OAuthScopesPlug.drop_auth_info(conn)
+ else
+ conn
+ end
+ end
+
+ # Ensures instance is public -or- user is authenticated if such check was scheduled
+ defp maybe_perform_public_or_authenticated_check(conn) do
+ if PlugHelper.plug_called?(conn, ExpectPublicOrAuthenticatedCheckPlug) do
+ EnsurePublicOrAuthenticatedPlug.call(conn, %{})
+ else
+ conn
+ end
+ end
+
+ # Ensures user is authenticated if such check was scheduled
+ # Note: runs prior to action even if it was already executed earlier in plug chain
+ # (since OAuthScopesPlug has option of proceeding unauthenticated)
+ defp maybe_perform_authenticated_check(conn) do
+ if PlugHelper.plug_called?(conn, ExpectAuthenticatedCheckPlug) do
+ EnsureAuthenticatedPlug.call(conn, %{})
+ else
+ conn
+ end
+ end
+
+ # Halts if authenticated API action neither performs nor explicitly skips OAuth scopes check
+ defp maybe_halt_on_missing_oauth_scopes_check(conn) do
+ if PlugHelper.plug_called?(conn, ExpectAuthenticatedCheckPlug) and
+ not PlugHelper.plug_called_or_skipped?(conn, OAuthScopesPlug) do
+ conn
+ |> render_error(
+ :forbidden,
+ "Security violation: OAuth scopes check was neither handled nor explicitly skipped."
+ )
+ |> halt()
+ else
+ conn
+ end
+ end
end
end
@@ -96,6 +182,50 @@ defmodule Pleroma.Web do
end
end
+ def plug do
+ quote do
+ @behaviour Pleroma.Web.Plug
+ @behaviour Plug
+
+ @doc """
+ Marks a plug intentionally skipped and blocks its execution if it's present in plugs chain.
+ """
+ def skip_plug(conn) do
+ PlugHelper.append_to_private_list(
+ conn,
+ PlugHelper.skipped_plugs_list_id(),
+ __MODULE__
+ )
+ end
+
+ @impl Plug
+ @doc """
+ Before-plug hook that
+ * ensures the plug is not skipped
+ * processes `:if_func` / `:unless_func` functional pre-run conditions
+ * adds plug to the list of called plugs and calls `perform/2` if checks are passed
+
+ Note: multiple invocations of the same plug (with different or same options) are allowed.
+ """
+ def call(%Plug.Conn{} = conn, options) do
+ if PlugHelper.plug_skipped?(conn, __MODULE__) ||
+ (options[:if_func] && !options[:if_func].(conn)) ||
+ (options[:unless_func] && options[:unless_func].(conn)) do
+ conn
+ else
+ conn =
+ PlugHelper.append_to_private_list(
+ conn,
+ PlugHelper.called_plugs_list_id(),
+ __MODULE__
+ )
+
+ apply(__MODULE__, :perform, [conn, options])
+ end
+ end
+ end
+ end
+
@doc """
When used, dispatch to the appropriate controller/view/etc.
"""
diff --git a/lib/pleroma/web/web_finger/web_finger.ex b/lib/pleroma/web/web_finger/web_finger.ex
index b4cc80179..71ccf251a 100644
--- a/lib/pleroma/web/web_finger/web_finger.ex
+++ b/lib/pleroma/web/web_finger/web_finger.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.WebFinger do
@@ -86,54 +86,24 @@ defmodule Pleroma.Web.WebFinger do
|> XmlBuilder.to_doc()
end
- defp get_magic_key("data:application/magic-public-key," <> magic_key) do
- {:ok, magic_key}
- end
-
- defp get_magic_key(nil) do
- Logger.debug("Undefined magic key.")
- {:ok, nil}
- end
+ defp webfinger_from_xml(doc) do
+ subject = XML.string_from_xpath("//Subject", doc)
- defp get_magic_key(_) do
- {:error, "Missing magic key data."}
- end
+ subscribe_address =
+ ~s{//Link[@rel="http://ostatus.org/schema/1.0/subscribe"]/@template}
+ |> XML.string_from_xpath(doc)
- defp webfinger_from_xml(doc) do
- with magic_key <- XML.string_from_xpath(~s{//Link[@rel="magic-public-key"]/@href}, doc),
- {:ok, magic_key} <- get_magic_key(magic_key),
- topic <-
- XML.string_from_xpath(
- ~s{//Link[@rel="http://schemas.google.com/g/2010#updates-from"]/@href},
- doc
- ),
- subject <- XML.string_from_xpath("//Subject", doc),
- subscribe_address <-
- XML.string_from_xpath(
- ~s{//Link[@rel="http://ostatus.org/schema/1.0/subscribe"]/@template},
- doc
- ),
- ap_id <-
- XML.string_from_xpath(
- ~s{//Link[@rel="self" and @type="application/activity+json"]/@href},
- doc
- ) do
- data = %{
- "magic_key" => magic_key,
- "topic" => topic,
- "subject" => subject,
- "subscribe_address" => subscribe_address,
- "ap_id" => ap_id
- }
+ ap_id =
+ ~s{//Link[@rel="self" and @type="application/activity+json"]/@href}
+ |> XML.string_from_xpath(doc)
- {:ok, data}
- else
- {:error, e} ->
- {:error, e}
+ data = %{
+ "subject" => subject,
+ "subscribe_address" => subscribe_address,
+ "ap_id" => ap_id
+ }
- e ->
- {:error, e}
- end
+ {:ok, data}
end
defp webfinger_from_json(doc) do
@@ -146,9 +116,6 @@ defmodule Pleroma.Web.WebFinger do
{"application/ld+json; profile=\"https://www.w3.org/ns/activitystreams\"", "self"} ->
Map.put(data, "ap_id", link["href"])
- {_, "http://ostatus.org/schema/1.0/subscribe"} ->
- Map.put(data, "subscribe_address", link["template"])
-
_ ->
Logger.debug("Unhandled type: #{inspect(link["type"])}")
data
@@ -173,7 +140,8 @@ defmodule Pleroma.Web.WebFinger do
get_template_from_xml(body)
else
_ ->
- with {:ok, %{body: body}} <- HTTP.get("https://#{domain}/.well-known/host-meta", []) do
+ with {:ok, %{body: body, status: status}} when status in 200..299 <-
+ HTTP.get("https://#{domain}/.well-known/host-meta", []) do
get_template_from_xml(body)
else
e -> {:error, "Can't find LRDD template: #{inspect(e)}"}
@@ -193,19 +161,21 @@ defmodule Pleroma.Web.WebFinger do
URI.parse(account).host
end
+ encoded_account = URI.encode("acct:#{account}")
+
address =
case find_lrdd_template(domain) do
{:ok, template} ->
- String.replace(template, "{uri}", URI.encode(account))
+ String.replace(template, "{uri}", encoded_account)
_ ->
- "https://#{domain}/.well-known/webfinger?resource=acct:#{account}"
+ "https://#{domain}/.well-known/webfinger?resource=#{encoded_account}"
end
with response <-
HTTP.get(
address,
- Accept: "application/xrd+xml,application/jrd+json"
+ [{"accept", "application/xrd+xml,application/jrd+json"}]
),
{:ok, %{status: status, body: body}} when status in 200..299 <- response do
doc = XML.parse_document(body)
diff --git a/lib/pleroma/web/web_finger/web_finger_controller.ex b/lib/pleroma/web/web_finger/web_finger_controller.ex
index 896eb15f9..7077b20d2 100644
--- a/lib/pleroma/web/web_finger/web_finger_controller.ex
+++ b/lib/pleroma/web/web_finger/web_finger_controller.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.WebFinger.WebFingerController do
diff --git a/lib/pleroma/web/xml/xml.ex b/lib/pleroma/web/xml/xml.ex
index df50aac9c..c69a86a1e 100644
--- a/lib/pleroma/web/xml/xml.ex
+++ b/lib/pleroma/web/xml/xml.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Web.XML do
diff --git a/lib/pleroma/workers/activity_expiration_worker.ex b/lib/pleroma/workers/activity_expiration_worker.ex
deleted file mode 100644
index 4e3e4195f..000000000
--- a/lib/pleroma/workers/activity_expiration_worker.ex
+++ /dev/null
@@ -1,18 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Workers.ActivityExpirationWorker do
- use Pleroma.Workers.WorkerHelper, queue: "activity_expiration"
-
- @impl Oban.Worker
- def perform(
- %{
- "op" => "activity_expiration",
- "activity_expiration_id" => activity_expiration_id
- },
- _job
- ) do
- Pleroma.Daemons.ActivityExpirationDaemon.perform(:execute, activity_expiration_id)
- end
-end
diff --git a/lib/pleroma/workers/attachments_cleanup_worker.ex b/lib/pleroma/workers/attachments_cleanup_worker.ex
new file mode 100644
index 000000000..3c5820a86
--- /dev/null
+++ b/lib/pleroma/workers/attachments_cleanup_worker.ex
@@ -0,0 +1,95 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Workers.AttachmentsCleanupWorker do
+ import Ecto.Query
+
+ alias Pleroma.Object
+ alias Pleroma.Repo
+
+ use Pleroma.Workers.WorkerHelper, queue: "attachments_cleanup"
+
+ @impl Oban.Worker
+ def perform(
+ %{
+ "op" => "cleanup_attachments",
+ "object" => %{"data" => %{"attachment" => [_ | _] = attachments, "actor" => actor}}
+ },
+ _job
+ ) do
+ hrefs =
+ Enum.flat_map(attachments, fn attachment ->
+ Enum.map(attachment["url"], & &1["href"])
+ end)
+
+ names = Enum.map(attachments, & &1["name"])
+
+ uploader = Pleroma.Config.get([Pleroma.Upload, :uploader])
+
+ # find all objects for copies of the attachments, name and actor doesn't matter here
+ delete_ids =
+ from(o in Object,
+ where:
+ fragment(
+ "to_jsonb(array(select jsonb_array_elements((?)#>'{url}') ->> 'href' where jsonb_typeof((?)#>'{url}') = 'array'))::jsonb \\?| (?)",
+ o.data,
+ o.data,
+ ^hrefs
+ )
+ )
+ # The query above can be time consumptive on large instances until we
+ # refactor how uploads are stored
+ |> Repo.all(timeout: :infinity)
+ # we should delete 1 object for any given attachment, but don't delete
+ # files if there are more than 1 object for it
+ |> Enum.reduce(%{}, fn %{
+ id: id,
+ data: %{
+ "url" => [%{"href" => href}],
+ "actor" => obj_actor,
+ "name" => name
+ }
+ },
+ acc ->
+ Map.update(acc, href, %{id: id, count: 1}, fn val ->
+ case obj_actor == actor and name in names do
+ true ->
+ # set id of the actor's object that will be deleted
+ %{val | id: id, count: val.count + 1}
+
+ false ->
+ # another actor's object, just increase count to not delete file
+ %{val | count: val.count + 1}
+ end
+ end)
+ end)
+ |> Enum.map(fn {href, %{id: id, count: count}} ->
+ # only delete files that have single instance
+ with 1 <- count do
+ prefix =
+ case Pleroma.Config.get([Pleroma.Upload, :base_url]) do
+ nil -> "media"
+ _ -> ""
+ end
+
+ base_url =
+ String.trim_trailing(
+ Pleroma.Config.get([Pleroma.Upload, :base_url], Pleroma.Web.base_url()),
+ "/"
+ )
+
+ file_path = String.trim_leading(href, "#{base_url}/#{prefix}")
+
+ uploader.delete_file(file_path)
+ end
+
+ id
+ end)
+
+ from(o in Object, where: o.id in ^delete_ids)
+ |> Repo.delete_all()
+ end
+
+ def perform(%{"op" => "cleanup_attachments", "object" => _object}, _job), do: :ok
+end
diff --git a/lib/pleroma/workers/background_worker.ex b/lib/pleroma/workers/background_worker.ex
index 7ffc8eabe..57c3a9c3a 100644
--- a/lib/pleroma/workers/background_worker.ex
+++ b/lib/pleroma/workers/background_worker.ex
@@ -1,20 +1,15 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Workers.BackgroundWorker do
alias Pleroma.Activity
alias Pleroma.User
alias Pleroma.Web.ActivityPub.MRF.MediaProxyWarmingPolicy
- alias Pleroma.Web.OAuth.Token.CleanWorker
use Pleroma.Workers.WorkerHelper, queue: "background"
@impl Oban.Worker
- def perform(%{"op" => "fetch_initial_posts", "user_id" => user_id}, _job) do
- user = User.get_cached_by_id(user_id)
- User.perform(:fetch_initial_posts, user)
- end
def perform(%{"op" => "deactivate_user", "user_id" => user_id, "status" => status}, _job) do
user = User.get_cached_by_id(user_id)
@@ -40,7 +35,7 @@ defmodule Pleroma.Workers.BackgroundWorker do
_job
) do
blocker = User.get_cached_by_id(blocker_id)
- User.perform(:blocks_import, blocker, blocked_identifiers)
+ {:ok, User.perform(:blocks_import, blocker, blocked_identifiers)}
end
def perform(
@@ -52,11 +47,7 @@ defmodule Pleroma.Workers.BackgroundWorker do
_job
) do
follower = User.get_cached_by_id(follower_id)
- User.perform(:follow_import, follower, followed_identifiers)
- end
-
- def perform(%{"op" => "clean_expired_tokens"}, _job) do
- CleanWorker.perform(:clean)
+ {:ok, User.perform(:follow_import, follower, followed_identifiers)}
end
def perform(%{"op" => "media_proxy_preload", "message" => message}, _job) do
@@ -71,4 +62,11 @@ defmodule Pleroma.Workers.BackgroundWorker do
activity = Activity.get_by_id(activity_id)
Pleroma.Web.RichMedia.Helpers.perform(:fetch, activity)
end
+
+ def perform(%{"op" => "move_following", "origin_id" => origin_id, "target_id" => target_id}, _) do
+ origin = User.get_cached_by_id(origin_id)
+ target = User.get_cached_by_id(target_id)
+
+ Pleroma.FollowingRelationship.move_following(origin, target)
+ end
end
diff --git a/lib/pleroma/workers/cron/clear_oauth_token_worker.ex b/lib/pleroma/workers/cron/clear_oauth_token_worker.ex
new file mode 100644
index 000000000..341eff054
--- /dev/null
+++ b/lib/pleroma/workers/cron/clear_oauth_token_worker.ex
@@ -0,0 +1,21 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Workers.Cron.ClearOauthTokenWorker do
+ @moduledoc """
+ The worker to cleanup expired oAuth tokens.
+ """
+
+ use Oban.Worker, queue: "background"
+
+ alias Pleroma.Config
+ alias Pleroma.Web.OAuth.Token
+
+ @impl Oban.Worker
+ def perform(_opts, _job) do
+ if Config.get([:oauth2, :clean_expired_tokens], false) do
+ Token.delete_expired_tokens()
+ end
+ end
+end
diff --git a/lib/pleroma/workers/cron/digest_emails_worker.ex b/lib/pleroma/workers/cron/digest_emails_worker.ex
new file mode 100644
index 000000000..dd13c3b17
--- /dev/null
+++ b/lib/pleroma/workers/cron/digest_emails_worker.ex
@@ -0,0 +1,59 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Workers.Cron.DigestEmailsWorker do
+ @moduledoc """
+ The worker to send digest emails.
+ """
+
+ use Oban.Worker, queue: "digest_emails"
+
+ alias Pleroma.Config
+ alias Pleroma.Emails
+ alias Pleroma.Repo
+ alias Pleroma.User
+
+ import Ecto.Query
+
+ require Logger
+
+ @impl Oban.Worker
+ def perform(_opts, _job) do
+ config = Config.get([:email_notifications, :digest])
+
+ if config[:active] do
+ negative_interval = -Map.fetch!(config, :interval)
+ inactivity_threshold = Map.fetch!(config, :inactivity_threshold)
+ inactive_users_query = User.list_inactive_users_query(inactivity_threshold)
+
+ now = NaiveDateTime.truncate(NaiveDateTime.utc_now(), :second)
+
+ from(u in inactive_users_query,
+ where: fragment(~s(? ->'digest' @> 'true'), u.email_notifications),
+ where: not is_nil(u.email),
+ where: u.last_digest_emailed_at < datetime_add(^now, ^negative_interval, "day"),
+ select: u
+ )
+ |> Repo.all()
+ |> send_emails
+ end
+ end
+
+ def send_emails(users) do
+ Enum.each(users, &send_email/1)
+ end
+
+ @doc """
+ Send digest email to the given user.
+ Updates `last_digest_emailed_at` field for the user and returns the updated user.
+ """
+ @spec send_email(User.t()) :: User.t()
+ def send_email(user) do
+ with %Swoosh.Email{} = email <- Emails.UserEmail.digest_email(user) do
+ Emails.Mailer.deliver_async(email)
+ end
+
+ User.touch_last_digest_emailed_at(user)
+ end
+end
diff --git a/lib/pleroma/workers/cron/new_users_digest_worker.ex b/lib/pleroma/workers/cron/new_users_digest_worker.ex
new file mode 100644
index 000000000..9bd0a5621
--- /dev/null
+++ b/lib/pleroma/workers/cron/new_users_digest_worker.ex
@@ -0,0 +1,61 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Workers.Cron.NewUsersDigestWorker do
+ alias Pleroma.Activity
+ alias Pleroma.Repo
+ alias Pleroma.User
+
+ import Ecto.Query
+
+ use Pleroma.Workers.WorkerHelper, queue: "new_users_digest"
+
+ @impl Oban.Worker
+ def perform(_args, _job) do
+ if Pleroma.Config.get([Pleroma.Emails.NewUsersDigestEmail, :enabled]) do
+ today = NaiveDateTime.utc_now() |> Timex.beginning_of_day()
+
+ a_day_ago =
+ today
+ |> Timex.shift(days: -1)
+ |> Timex.beginning_of_day()
+
+ users_and_statuses =
+ %{
+ local: true,
+ order_by: :inserted_at
+ }
+ |> User.Query.build()
+ |> where([u], u.inserted_at >= ^a_day_ago and u.inserted_at < ^today)
+ |> Repo.all()
+ |> Enum.map(fn user ->
+ latest_status =
+ Activity
+ |> Activity.Queries.by_actor(user.ap_id)
+ |> Activity.Queries.by_type("Create")
+ |> Activity.with_preloaded_object()
+ |> order_by(desc: :inserted_at)
+ |> limit(1)
+ |> Repo.one()
+
+ total_statuses =
+ Activity
+ |> Activity.Queries.by_actor(user.ap_id)
+ |> Activity.Queries.by_type("Create")
+ |> Repo.aggregate(:count, :id)
+
+ {user, total_statuses, latest_status}
+ end)
+
+ if users_and_statuses != [] do
+ %{is_admin: true}
+ |> User.Query.build()
+ |> where([u], not is_nil(u.email))
+ |> Repo.all()
+ |> Enum.map(&Pleroma.Emails.NewUsersDigestEmail.new_users(&1, users_and_statuses))
+ |> Enum.each(&Pleroma.Emails.Mailer.deliver/1)
+ end
+ end
+ end
+end
diff --git a/lib/pleroma/workers/cron/purge_expired_activities_worker.ex b/lib/pleroma/workers/cron/purge_expired_activities_worker.ex
new file mode 100644
index 000000000..b8953dd7f
--- /dev/null
+++ b/lib/pleroma/workers/cron/purge_expired_activities_worker.ex
@@ -0,0 +1,46 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Workers.Cron.PurgeExpiredActivitiesWorker do
+ @moduledoc """
+ The worker to purge expired activities.
+ """
+
+ use Oban.Worker, queue: "activity_expiration"
+
+ alias Pleroma.Activity
+ alias Pleroma.ActivityExpiration
+ alias Pleroma.Config
+ alias Pleroma.User
+ alias Pleroma.Web.CommonAPI
+
+ require Logger
+
+ @interval :timer.minutes(1)
+
+ @impl Oban.Worker
+ def perform(_opts, _job) do
+ if Config.get([ActivityExpiration, :enabled]) do
+ Enum.each(ActivityExpiration.due_expirations(@interval), &delete_activity/1)
+ end
+ end
+
+ def delete_activity(%ActivityExpiration{activity_id: activity_id}) do
+ with {:activity, %Activity{} = activity} <-
+ {:activity, Activity.get_by_id_with_object(activity_id)},
+ {:user, %User{} = user} <- {:user, User.get_by_ap_id(activity.object.data["actor"])} do
+ CommonAPI.delete(activity.id, user)
+ else
+ {:activity, _} ->
+ Logger.error(
+ "#{__MODULE__} Couldn't delete expired activity: not found activity ##{activity_id}"
+ )
+
+ {:user, _} ->
+ Logger.error(
+ "#{__MODULE__} Couldn't delete expired activity: not found actorof ##{activity_id}"
+ )
+ end
+ end
+end
diff --git a/lib/pleroma/workers/cron/stats_worker.ex b/lib/pleroma/workers/cron/stats_worker.ex
new file mode 100644
index 000000000..e9b8d59c4
--- /dev/null
+++ b/lib/pleroma/workers/cron/stats_worker.ex
@@ -0,0 +1,16 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Workers.Cron.StatsWorker do
+ @moduledoc """
+ The worker to update peers statistics.
+ """
+
+ use Oban.Worker, queue: "background"
+
+ @impl Oban.Worker
+ def perform(_opts, _job) do
+ Pleroma.Stats.do_collect()
+ end
+end
diff --git a/lib/pleroma/workers/digest_emails_worker.ex b/lib/pleroma/workers/digest_emails_worker.ex
deleted file mode 100644
index 3e5a836d0..000000000
--- a/lib/pleroma/workers/digest_emails_worker.ex
+++ /dev/null
@@ -1,16 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Workers.DigestEmailsWorker do
- alias Pleroma.User
-
- use Pleroma.Workers.WorkerHelper, queue: "digest_emails"
-
- @impl Oban.Worker
- def perform(%{"op" => "digest_email", "user_id" => user_id}, _job) do
- user_id
- |> User.get_cached_by_id()
- |> Pleroma.Daemons.DigestEmailDaemon.perform()
- end
-end
diff --git a/lib/pleroma/workers/mailer_worker.ex b/lib/pleroma/workers/mailer_worker.ex
index 1b7a0eb3e..6955338a5 100644
--- a/lib/pleroma/workers/mailer_worker.ex
+++ b/lib/pleroma/workers/mailer_worker.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Workers.MailerWorker do
diff --git a/lib/pleroma/workers/publisher_worker.ex b/lib/pleroma/workers/publisher_worker.ex
index 455f7fc7e..daf79efc0 100644
--- a/lib/pleroma/workers/publisher_worker.ex
+++ b/lib/pleroma/workers/publisher_worker.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Workers.PublisherWorker do
diff --git a/lib/pleroma/workers/receiver_worker.ex b/lib/pleroma/workers/receiver_worker.ex
index 8ad756b62..f7a7124f3 100644
--- a/lib/pleroma/workers/receiver_worker.ex
+++ b/lib/pleroma/workers/receiver_worker.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Workers.ReceiverWorker do
diff --git a/lib/pleroma/workers/remote_fetcher_worker.ex b/lib/pleroma/workers/remote_fetcher_worker.ex
new file mode 100644
index 000000000..ec6534f21
--- /dev/null
+++ b/lib/pleroma/workers/remote_fetcher_worker.ex
@@ -0,0 +1,20 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Workers.RemoteFetcherWorker do
+ alias Pleroma.Object.Fetcher
+
+ use Pleroma.Workers.WorkerHelper, queue: "remote_fetcher"
+
+ @impl Oban.Worker
+ def perform(
+ %{
+ "op" => "fetch_remote",
+ "id" => id
+ } = args,
+ _job
+ ) do
+ {:ok, _object} = Fetcher.fetch_object_from_id(id, depth: args["depth"])
+ end
+end
diff --git a/lib/pleroma/workers/scheduled_activity_worker.ex b/lib/pleroma/workers/scheduled_activity_worker.ex
index ca7d53af1..97d1efbfb 100644
--- a/lib/pleroma/workers/scheduled_activity_worker.ex
+++ b/lib/pleroma/workers/scheduled_activity_worker.ex
@@ -1,12 +1,46 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Workers.ScheduledActivityWorker do
+ @moduledoc """
+ The worker to post scheduled activity.
+ """
+
use Pleroma.Workers.WorkerHelper, queue: "scheduled_activities"
+ alias Pleroma.Config
+ alias Pleroma.ScheduledActivity
+ alias Pleroma.User
+ alias Pleroma.Web.CommonAPI
+
+ require Logger
+
@impl Oban.Worker
- def perform(%{"op" => "execute", "activity_id" => activity_id}, _job) do
- Pleroma.Daemons.ScheduledActivityDaemon.perform(:execute, activity_id)
+ def perform(%{"activity_id" => activity_id}, _job) do
+ if Config.get([ScheduledActivity, :enabled]) do
+ case Pleroma.Repo.get(ScheduledActivity, activity_id) do
+ %ScheduledActivity{} = scheduled_activity ->
+ post_activity(scheduled_activity)
+
+ _ ->
+ Logger.error("#{__MODULE__} Couldn't find scheduled activity: #{activity_id}")
+ end
+ end
+ end
+
+ defp post_activity(%ScheduledActivity{user_id: user_id, params: params} = scheduled_activity) do
+ params = Map.new(params, fn {key, value} -> {String.to_existing_atom(key), value} end)
+
+ with {:delete, {:ok, _}} <- {:delete, ScheduledActivity.delete(scheduled_activity)},
+ {:user, %User{} = user} <- {:user, User.get_cached_by_id(user_id)},
+ {:post, {:ok, _}} <- {:post, CommonAPI.post(user, params)} do
+ :ok
+ else
+ error ->
+ Logger.error(
+ "#{__MODULE__} Couldn't create a status from the scheduled activity: #{inspect(error)}"
+ )
+ end
end
end
diff --git a/lib/pleroma/workers/transmogrifier_worker.ex b/lib/pleroma/workers/transmogrifier_worker.ex
index b581a2f86..11239ca5e 100644
--- a/lib/pleroma/workers/transmogrifier_worker.ex
+++ b/lib/pleroma/workers/transmogrifier_worker.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Workers.TransmogrifierWorker do
diff --git a/lib/pleroma/workers/web_pusher_worker.ex b/lib/pleroma/workers/web_pusher_worker.ex
index 61b451e3e..58ad25e39 100644
--- a/lib/pleroma/workers/web_pusher_worker.ex
+++ b/lib/pleroma/workers/web_pusher_worker.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Workers.WebPusherWorker do
@@ -13,7 +13,7 @@ defmodule Pleroma.Workers.WebPusherWorker do
notification =
Notification
|> Repo.get(notification_id)
- |> Repo.preload([:activity])
+ |> Repo.preload([:activity, :user])
Pleroma.Web.Push.Impl.perform(notification)
end
diff --git a/lib/pleroma/workers/worker_helper.ex b/lib/pleroma/workers/worker_helper.ex
index 358efa14a..d1f90c35b 100644
--- a/lib/pleroma/workers/worker_helper.ex
+++ b/lib/pleroma/workers/worker_helper.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.Workers.WorkerHelper do
diff --git a/lib/transports.ex b/lib/transports.ex
index 9f3fc535d..aab7fad99 100644
--- a/lib/transports.ex
+++ b/lib/transports.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Phoenix.Transports.WebSocket.Raw do
diff --git a/lib/xml_builder.ex b/lib/xml_builder.ex
index ceeef2755..33b63a71f 100644
--- a/lib/xml_builder.ex
+++ b/lib/xml_builder.ex
@@ -1,5 +1,5 @@
# Pleroma: A lightweight social networking server
-# Copyright © 2017-2019 Pleroma Authors <https://pleroma.social/>
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
# SPDX-License-Identifier: AGPL-3.0-only
defmodule Pleroma.XmlBuilder do